DE4442138A1 - Verfahren zur Herstellung von Benzophenonimin - Google Patents
Verfahren zur Herstellung von BenzophenoniminInfo
- Publication number
- DE4442138A1 DE4442138A1 DE4442138A DE4442138A DE4442138A1 DE 4442138 A1 DE4442138 A1 DE 4442138A1 DE 4442138 A DE4442138 A DE 4442138A DE 4442138 A DE4442138 A DE 4442138A DE 4442138 A1 DE4442138 A1 DE 4442138A1
- Authority
- DE
- Germany
- Prior art keywords
- preparation
- benzophenone
- oxides
- titanium
- bar
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000002360 preparation method Methods 0.000 title claims description 9
- SXZIXHOMFPUIRK-UHFFFAOYSA-N diphenylmethanimine Chemical compound C=1C=CC=CC=1C(=N)C1=CC=CC=C1 SXZIXHOMFPUIRK-UHFFFAOYSA-N 0.000 title claims description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 32
- 239000012965 benzophenone Substances 0.000 claims description 18
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 7
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 7
- 229910052782 aluminium Inorganic materials 0.000 claims description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 7
- -1 benzophenone imines Chemical class 0.000 claims description 7
- 229910052710 silicon Inorganic materials 0.000 claims description 7
- 239000010703 silicon Substances 0.000 claims description 7
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 7
- 229910052720 vanadium Inorganic materials 0.000 claims description 7
- 229910052719 titanium Inorganic materials 0.000 claims description 6
- 239000010936 titanium Substances 0.000 claims description 6
- 229910052845 zircon Inorganic materials 0.000 claims description 6
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims description 6
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 5
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims description 5
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 5
- 229910052787 antimony Inorganic materials 0.000 claims description 5
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 5
- 229910052797 bismuth Inorganic materials 0.000 claims description 5
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 5
- 229910052796 boron Inorganic materials 0.000 claims description 5
- 229910052733 gallium Inorganic materials 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052758 niobium Inorganic materials 0.000 claims description 5
- 239000010955 niobium Substances 0.000 claims description 5
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 5
- 229910052718 tin Inorganic materials 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 229910052785 arsenic Inorganic materials 0.000 claims description 3
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 3
- 229910052732 germanium Inorganic materials 0.000 claims description 3
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 3
- 229910052738 indium Inorganic materials 0.000 claims description 3
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- 229910052706 scandium Inorganic materials 0.000 claims description 3
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 3
- 229910052727 yttrium Inorganic materials 0.000 claims description 3
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- SOQBVABWOPYFQZ-UHFFFAOYSA-N oxygen(2-);titanium(4+) Chemical class [O-2].[O-2].[Ti+4] SOQBVABWOPYFQZ-UHFFFAOYSA-N 0.000 claims description 2
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims 1
- 229910052726 zirconium Inorganic materials 0.000 claims 1
- 229910021529 ammonia Inorganic materials 0.000 description 14
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 6
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 5
- 230000007306 turnover Effects 0.000 description 5
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 3
- GMVPRGQOIOIIMI-DODZYUBVSA-N 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid Chemical compound CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(O)=O GMVPRGQOIOIIMI-DODZYUBVSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000008366 benzophenones Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 2
- 229910003452 thorium oxide Inorganic materials 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000947853 Vibrionales Species 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- IAJNXBNRYMEYAZ-UHFFFAOYSA-N ethyl 2-cyano-3,3-diphenylprop-2-enoate Chemical compound C=1C=CC=CC=1C(=C(C#N)C(=O)OCC)C1=CC=CC=C1 IAJNXBNRYMEYAZ-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/02—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton containing imino groups
- C07C251/04—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton containing imino groups having carbon atoms of imino groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C251/10—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton containing imino groups having carbon atoms of imino groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of an unsaturated carbon skeleton
- C07C251/16—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton containing imino groups having carbon atoms of imino groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of an unsaturated carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/02—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton containing imino groups
- C07C251/24—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton containing imino groups having carbon atoms of imino groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C249/00—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C249/02—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton of compounds containing imino groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4442138A DE4442138A1 (de) | 1994-11-26 | 1994-11-26 | Verfahren zur Herstellung von Benzophenonimin |
| DE59505029T DE59505029D1 (de) | 1994-11-26 | 1995-11-17 | Verfahren zur Herstellung von Benzophenonimin |
| EP95118129A EP0713861B1 (de) | 1994-11-26 | 1995-11-17 | Verfahren zur Herstellung von Benzophenonimin |
| US08/561,300 US5679855A (en) | 1994-11-26 | 1995-11-21 | Preparation of benzophenone imines |
| KR1019950043478A KR100390079B1 (ko) | 1994-11-26 | 1995-11-24 | 벤조페논이민의제조방법 |
| TW084112545A TW299309B (enExample) | 1994-11-26 | 1995-11-24 | |
| CN95121847A CN1056831C (zh) | 1994-11-26 | 1995-11-26 | 二苯酮亚胺的制备方法 |
| JP30745095A JP4131575B2 (ja) | 1994-11-26 | 1995-11-27 | ベンゾフェノンイミンの製造法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4442138A DE4442138A1 (de) | 1994-11-26 | 1994-11-26 | Verfahren zur Herstellung von Benzophenonimin |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4442138A1 true DE4442138A1 (de) | 1996-05-30 |
Family
ID=6534236
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4442138A Withdrawn DE4442138A1 (de) | 1994-11-26 | 1994-11-26 | Verfahren zur Herstellung von Benzophenonimin |
| DE59505029T Expired - Lifetime DE59505029D1 (de) | 1994-11-26 | 1995-11-17 | Verfahren zur Herstellung von Benzophenonimin |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE59505029T Expired - Lifetime DE59505029D1 (de) | 1994-11-26 | 1995-11-17 | Verfahren zur Herstellung von Benzophenonimin |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US5679855A (enExample) |
| EP (1) | EP0713861B1 (enExample) |
| JP (1) | JP4131575B2 (enExample) |
| KR (1) | KR100390079B1 (enExample) |
| CN (1) | CN1056831C (enExample) |
| DE (2) | DE4442138A1 (enExample) |
| TW (1) | TW299309B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5917080A (en) * | 1995-03-31 | 1999-06-29 | Basf Aktiengesellschaft | Preparation of 2-cyano-3,3-diarylacrylic esters |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19642541A1 (de) * | 1996-10-15 | 1998-04-16 | Basf Ag | Verfahren zur Entfernung von Wasser und Ammoniak aus Benzophenonimin-Reaktionsausträgen |
| CN100384893C (zh) * | 2005-07-22 | 2008-04-30 | 中国科学院上海有机化学研究所 | 含卤素取代基的酮亚胺类前过渡金属钛配合物、合成方法和用途 |
| EP1996543B1 (de) * | 2006-03-10 | 2011-07-20 | Basf Se | Verfahren zur herstellung von benzophenoniminen |
| RU2477272C2 (ru) * | 2011-05-04 | 2013-03-10 | Государственное образовательное учреждение высшего профессионального образования Кабардино-Балкарский государственный университет им. Х.М. Бербекова | Кетимины на основе 4,4'-дихлорбензофенона, гуанидина или аминогуанидина и способ их получения |
| CN112321458B (zh) * | 2020-10-26 | 2023-04-07 | 宿迁科思化学有限公司 | 一种防晒剂中间体依托立林的制备方法 |
| EP4549616A1 (en) | 2023-10-31 | 2025-05-07 | Basf Se | Process for making amines from carbonyl compounds using hydrogen having low deuterium content produced with non-fossil energy |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4083869A (en) * | 1976-12-02 | 1978-04-11 | Mitsubishi Gas Chemical Company, Inc. | Process for producing imine compounds |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2533723A (en) * | 1947-07-28 | 1950-12-12 | Nopco Chem Co | Catalytic amine-ketone condensation |
| GB1280551A (en) * | 1968-07-01 | 1972-07-05 | Sandoz Ltd | Quinazoline derivatives |
| JPS5337647A (en) * | 1976-09-14 | 1978-04-06 | Mitsubishi Gas Chem Co Inc | Preparation of imine compounds |
| GB1549937A (en) * | 1976-09-14 | 1979-08-08 | Mitsubishi Gas Chemical Co | Process for producing imine compounds |
| JPS5930563A (ja) * | 1982-08-13 | 1984-02-18 | Comput Basic Mach Technol Res Assoc | 現像装置 |
-
1994
- 1994-11-26 DE DE4442138A patent/DE4442138A1/de not_active Withdrawn
-
1995
- 1995-11-17 DE DE59505029T patent/DE59505029D1/de not_active Expired - Lifetime
- 1995-11-17 EP EP95118129A patent/EP0713861B1/de not_active Expired - Lifetime
- 1995-11-21 US US08/561,300 patent/US5679855A/en not_active Expired - Lifetime
- 1995-11-24 TW TW084112545A patent/TW299309B/zh not_active IP Right Cessation
- 1995-11-24 KR KR1019950043478A patent/KR100390079B1/ko not_active Expired - Lifetime
- 1995-11-26 CN CN95121847A patent/CN1056831C/zh not_active Expired - Lifetime
- 1995-11-27 JP JP30745095A patent/JP4131575B2/ja not_active Expired - Lifetime
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4083869A (en) * | 1976-12-02 | 1978-04-11 | Mitsubishi Gas Chemical Company, Inc. | Process for producing imine compounds |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5917080A (en) * | 1995-03-31 | 1999-06-29 | Basf Aktiengesellschaft | Preparation of 2-cyano-3,3-diarylacrylic esters |
Also Published As
| Publication number | Publication date |
|---|---|
| US5679855A (en) | 1997-10-21 |
| TW299309B (enExample) | 1997-03-01 |
| EP0713861A1 (de) | 1996-05-29 |
| DE59505029D1 (de) | 1999-03-18 |
| EP0713861B1 (de) | 1999-02-03 |
| KR960017623A (ko) | 1996-06-17 |
| JP4131575B2 (ja) | 2008-08-13 |
| JPH08208582A (ja) | 1996-08-13 |
| CN1056831C (zh) | 2000-09-27 |
| CN1133835A (zh) | 1996-10-23 |
| KR100390079B1 (ko) | 2004-03-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0088328B1 (de) | Oxidationskatalysator, inbesondere für die Herstellung von Methacrylsäure durch Gasphasenoxidation von Methacrolein | |
| DE69020172T2 (de) | Verfahren zur Herstellung von epsilon-Caprolactam. | |
| EP0713861B1 (de) | Verfahren zur Herstellung von Benzophenonimin | |
| DE69513673T2 (de) | Verfahren zur herstellung von cyclopropancarbonsäure und ihre derivaten | |
| EP0742205B1 (de) | Verfahren zur Herstellung von beta-Carotin-Präparaten mit hohem 9(Z)-Gehalt | |
| DE2553102C2 (de) | Verfahren zur Herstellung von 3-Methyl-2-(4'-chlorphenyl)-butyronitril | |
| EP0144885B1 (de) | Verfahren zur gleichzeitigen Herstellung von Nitrilen und Acrylamid bzw. Methacrylamid | |
| DE2919974A1 (de) | Verfahren zur herstellung von cyanhydrinacylaten von aldehyden | |
| EP0008013B1 (de) | Verfahren zur Herstellung von Carbonylverbindungen | |
| EP0832871B1 (de) | Verfahren zur Herstellung von Beta-Isophoron durch Isomerisierung von Alpha-Isophoron (I) | |
| EP0034257B1 (de) | Verfahren zur Herstellung von 1.4-Diamino-2.3-dicyano-anthrachinon | |
| DE19639570A1 (de) | Verfahren zur Herstellung von 3,5,5-Trimethylcyclohexa-3-en-1-on(ß-Isophoron) durch Isomerisierung von 3,5,5-Trimethylcyclohexa-2-en-l-on(alpha-Isophoron) | |
| EP0413264B1 (de) | Verfahren zur Herstellung von Chlorcarbonsäurechloriden | |
| EP0897910B1 (de) | Verfahren zur Herstellung von 2-Carboxyy-5-nitro-benzolsulfonsäure und deren Salzen durch Oxidation | |
| EP0024588B1 (de) | Verfahren zur Herstellung von substituierten Cyclopropyl-carbonsäure-(alpha-cyano-3-phenoxy-benzyl)-estern | |
| DD202427A5 (de) | Verfahren zur herstellung von alpha-halogenalkylamiden | |
| EP0579113B1 (de) | Verbessertes Verfahren zur Herstellung von cyclischen Acetalen von 3-formyl-2-butenyl-triphenylphosphoniumchlorid | |
| DE2738643C2 (de) | Verfahren zur Herstellung von α-Cyano-3-phenoxy-benzylalkohol | |
| EP0157225B1 (de) | Verfahren zur Herstellung von Benzimidazolyl,-Benzoxazolyl- und Benzthiazolyloxyphenoxypropionsäurederivaten | |
| DE2727613A1 (de) | Cyanosubstituierte cyclopropanderivate und verfahren zu ihrer herstellung | |
| DE3633885A1 (de) | Verfahren zur kontinuierlichen herstellung von aliphatischen aldehyden und ketonen | |
| DE19754322B4 (de) | Verfahren zur Herstellung von Salzen cyclischer Amidine | |
| EP0340703B1 (de) | Verfahren zur Herstellung von Formylcyclopropan | |
| DE2201456C3 (de) | Verfahren zur Herstellung von Aldehyden und Diolen | |
| DE3877648T2 (de) | Verfahren zur herstellung von naproxen. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8130 | Withdrawal |