DE3931982A1 - Elektromotorisch angetriebenes geraet - Google Patents
Elektromotorisch angetriebenes geraetInfo
- Publication number
- DE3931982A1 DE3931982A1 DE19893931982 DE3931982A DE3931982A1 DE 3931982 A1 DE3931982 A1 DE 3931982A1 DE 19893931982 DE19893931982 DE 19893931982 DE 3931982 A DE3931982 A DE 3931982A DE 3931982 A1 DE3931982 A1 DE 3931982A1
- Authority
- DE
- Germany
- Prior art keywords
- brush
- switching
- rotation
- housing
- brush head
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 230000033001 locomotion Effects 0.000 claims abstract description 34
- 230000007246 mechanism Effects 0.000 claims abstract description 34
- 230000001680 brushing effect Effects 0.000 claims description 12
- 239000012528 membrane Substances 0.000 claims 2
- 238000004140 cleaning Methods 0.000 abstract description 4
- 230000008901 benefit Effects 0.000 abstract description 3
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- 235000021190 leftovers Nutrition 0.000 description 3
- 125000006850 spacer group Chemical group 0.000 description 3
- 230000009471 action Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- 235000013372 meat Nutrition 0.000 description 2
- 208000010201 Exanthema Diseases 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000003670 easy-to-clean Effects 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- RSMUVYRMZCOLBH-UHFFFAOYSA-N metsulfuron methyl Chemical compound COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(C)=NC(OC)=N1 RSMUVYRMZCOLBH-UHFFFAOYSA-N 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61C—DENTISTRY; APPARATUS OR METHODS FOR ORAL OR DENTAL HYGIENE
- A61C17/00—Devices for cleaning, polishing, rinsing or drying teeth, teeth cavities or prostheses; Saliva removers; Dental appliances for receiving spittle
- A61C17/16—Power-driven cleaning or polishing devices
- A61C17/22—Power-driven cleaning or polishing devices with brushes, cushions, cups, or the like
- A61C17/40—Power-driven cleaning or polishing devices with brushes, cushions, cups, or the like orbiting, e.g. nutating
Landscapes
- Health & Medical Sciences (AREA)
- Dentistry (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Brushes (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19893931982 DE3931982A1 (de) | 1989-09-26 | 1989-09-26 | Elektromotorisch angetriebenes geraet |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19893931982 DE3931982A1 (de) | 1989-09-26 | 1989-09-26 | Elektromotorisch angetriebenes geraet |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3931982A1 true DE3931982A1 (de) | 1991-04-11 |
| DE3931982C2 DE3931982C2 (https=) | 1992-01-16 |
Family
ID=6390153
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19893931982 Granted DE3931982A1 (de) | 1989-09-26 | 1989-09-26 | Elektromotorisch angetriebenes geraet |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE3931982A1 (https=) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4138021A1 (de) * | 1991-11-19 | 1993-05-27 | Gimelli Produktions Ag | Elektrische zahnbuerste |
| WO1993020777A1 (de) * | 1992-04-15 | 1993-10-28 | Wilhelm Maurer | Zahnreinigungsvorrichtung |
| DE4343103A1 (de) * | 1993-12-17 | 1995-06-22 | Braun Ag | Elektrische Zahnbürste |
| US5442827A (en) * | 1993-10-19 | 1995-08-22 | Bausch & Lomb Incorporated | Electric toothbrush |
| WO1996009018A1 (de) * | 1994-09-23 | 1996-03-28 | Braun Aktiengesellschaft | Bürstenteil für eine elektrische zahnbürste |
| WO1996013224A1 (de) * | 1994-10-29 | 1996-05-09 | Braun Aktiengesellschaft | Bürstenteil für eine elektrische zahnbürste |
| EP0850602A3 (de) * | 1996-12-24 | 1999-01-20 | ROWENTA-WERKE GmbH | Elektrische Zahnbürste |
| EP1247499A1 (de) * | 2001-04-03 | 2002-10-09 | WIK Far East Ltd. | Elektrische Zahnbürste |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3160902A (en) * | 1963-02-08 | 1964-12-15 | Aymar Julian Robert | Mechanical toothbrush |
| DE2715414A1 (de) * | 1977-04-06 | 1978-10-19 | Wilhelm Sander | Elektrische zahnbuerste |
| DE3430694A1 (de) * | 1984-08-21 | 1985-09-05 | Reinhard 4220 Dinslaken Fondermann | Elektrische rundumzahnfleischmassage- und zahnputzbuerste |
| DE3505897A1 (de) * | 1985-02-21 | 1986-08-21 | Steffen 7261 Gechingen Kramer | Elektrisches zahnreinigungsgeraet zum zahnfleischschonenden zaehneputzen |
| DE3516201A1 (de) * | 1985-05-06 | 1986-11-06 | Axel Dr.med.dent. 2903 Bad Zwischenahn Helmich | Massage-zahnbuerste |
| DE3445142A1 (de) * | 1982-01-07 | 1987-03-05 | Alfred Preiss | Elektrische zahnbuerste |
-
1989
- 1989-09-26 DE DE19893931982 patent/DE3931982A1/de active Granted
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3160902A (en) * | 1963-02-08 | 1964-12-15 | Aymar Julian Robert | Mechanical toothbrush |
| DE2715414A1 (de) * | 1977-04-06 | 1978-10-19 | Wilhelm Sander | Elektrische zahnbuerste |
| DE3445142A1 (de) * | 1982-01-07 | 1987-03-05 | Alfred Preiss | Elektrische zahnbuerste |
| DE3430694A1 (de) * | 1984-08-21 | 1985-09-05 | Reinhard 4220 Dinslaken Fondermann | Elektrische rundumzahnfleischmassage- und zahnputzbuerste |
| DE3505897A1 (de) * | 1985-02-21 | 1986-08-21 | Steffen 7261 Gechingen Kramer | Elektrisches zahnreinigungsgeraet zum zahnfleischschonenden zaehneputzen |
| DE3516201A1 (de) * | 1985-05-06 | 1986-11-06 | Axel Dr.med.dent. 2903 Bad Zwischenahn Helmich | Massage-zahnbuerste |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4138021A1 (de) * | 1991-11-19 | 1993-05-27 | Gimelli Produktions Ag | Elektrische zahnbuerste |
| WO1993020777A1 (de) * | 1992-04-15 | 1993-10-28 | Wilhelm Maurer | Zahnreinigungsvorrichtung |
| US5442827A (en) * | 1993-10-19 | 1995-08-22 | Bausch & Lomb Incorporated | Electric toothbrush |
| US5504960A (en) * | 1993-10-19 | 1996-04-09 | Bausch & Lomb Incorporated | Electric toothbrush |
| DE4343103A1 (de) * | 1993-12-17 | 1995-06-22 | Braun Ag | Elektrische Zahnbürste |
| US5504958A (en) * | 1993-12-17 | 1996-04-09 | Braun Aktiengesellschaft | Electric toothbrush |
| WO1996009018A1 (de) * | 1994-09-23 | 1996-03-28 | Braun Aktiengesellschaft | Bürstenteil für eine elektrische zahnbürste |
| US5867856A (en) * | 1994-09-23 | 1999-02-09 | Braun Aktiengesellschaft | Brush section for an electric toothbrush |
| WO1996013224A1 (de) * | 1994-10-29 | 1996-05-09 | Braun Aktiengesellschaft | Bürstenteil für eine elektrische zahnbürste |
| US5862558A (en) * | 1994-10-29 | 1999-01-26 | Braun Aktiengesellschaft | Brush section for an electric toothbrush |
| EP0850602A3 (de) * | 1996-12-24 | 1999-01-20 | ROWENTA-WERKE GmbH | Elektrische Zahnbürste |
| EP1247499A1 (de) * | 2001-04-03 | 2002-10-09 | WIK Far East Ltd. | Elektrische Zahnbürste |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3931982C2 (https=) | 1992-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19849531C2 (de) | Zahnbürste mit Kratzborsten, die in die Zahnzwischenräume eingreifen | |
| DE2901136C2 (de) | Handgerät für Zahnpflege oder Zahnbehandlung | |
| DE3855221T2 (de) | Rotierende zahnbürtse mit doppelbürste | |
| DE69104413T2 (de) | Motorisch angetriebene Zahnbürste. | |
| DE3346758A1 (de) | Zahnreinigungsgeraet | |
| WO1998047443A1 (de) | Elektrisch betriebenes zahnreinigungsgerät | |
| DE3938829A1 (de) | Elektrische zahnbuerste | |
| DE2838015A1 (de) | Elektrisch angetriebene zahnbuerste | |
| CH621472A5 (en) | Tooth-cleaning device | |
| WO1998036703A1 (de) | Apparat zur automatischen reinigung von zahnzwischenräumen | |
| DE3931982A1 (de) | Elektromotorisch angetriebenes geraet | |
| DE3152090C2 (https=) | ||
| DE3027137C2 (de) | Elektrisch betriebene, rotierende Zahnbürste | |
| DE2857650C2 (de) | Zahnbürste | |
| DE4243219A1 (de) | Elektromechanische Zahnbürste | |
| DE102008060829A1 (de) | 3-Profil Elektro-Zahnbürste mit Längshub-Putzbewegung, einem fixierten Griff-Mulden-Ring mit 3 Funktions-Griff-Stellungen, einem Wechsel-Steckaufsatz mit schalem + kurzem Zahnbürstenkopf | |
| DE2916215A1 (de) | Zahnbuerste | |
| DE3301865C2 (de) | Elektrische Zahnbürste | |
| DE8911427U1 (de) | Elektromotorisch angetriebenes Gerät, insbesondere zur medizinisch richtigen Pflege des Zahnfleisches und der Zähne | |
| DE4019830A1 (de) | Buerste vom leistungsverbindungstyp zum reinigen eines zwischenzahnbereichs oder aehnlichem | |
| DE1198783B (de) | Rotierende Zahnbuerste | |
| DE8535358U1 (de) | Motorisch angetriebene Vorrichtung zum Reinigen der Zähne | |
| DE2237568A1 (de) | Mechanisch betaetigte zahnbuerste | |
| DE2846739A1 (de) | Buerste zum reinigen der haende | |
| DE3735436A1 (de) | Elektrische zahnbuerste |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8125 | Change of the main classification |
Ipc: F16H 25/10 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee | ||
| 8370 | Indication of lapse of patent is to be deleted | ||
| 8339 | Ceased/non-payment of the annual fee |