DE3731134C2 - Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe - Google Patents
Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter FarbwiedergabeInfo
- Publication number
- DE3731134C2 DE3731134C2 DE19873731134 DE3731134A DE3731134C2 DE 3731134 C2 DE3731134 C2 DE 3731134C2 DE 19873731134 DE19873731134 DE 19873731134 DE 3731134 A DE3731134 A DE 3731134A DE 3731134 C2 DE3731134 C2 DE 3731134C2
- Authority
- DE
- Germany
- Prior art keywords
- metal halide
- discharge vessel
- discharge lamp
- halide
- discharge
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Revoked
Links
- 229910001507 metal halide Inorganic materials 0.000 title claims description 17
- 150000005309 metal halides Chemical class 0.000 title claims description 17
- 238000009877 rendering Methods 0.000 title claims description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 16
- 229910052708 sodium Inorganic materials 0.000 claims description 16
- 150000004820 halides Chemical class 0.000 claims description 11
- 229910052692 Dysprosium Inorganic materials 0.000 claims description 9
- 229910052689 Holmium Inorganic materials 0.000 claims description 8
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 8
- 229910052753 mercury Inorganic materials 0.000 claims description 8
- 239000000654 additive Substances 0.000 claims description 6
- 229910052756 noble gas Inorganic materials 0.000 claims description 5
- 238000002844 melting Methods 0.000 claims description 3
- 229910001511 metal iodide Inorganic materials 0.000 claims 1
- 239000011734 sodium Substances 0.000 description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- 239000010453 quartz Substances 0.000 description 7
- 229910052761 rare earth metal Inorganic materials 0.000 description 6
- 150000002910 rare earth metals Chemical class 0.000 description 6
- 239000007789 gas Substances 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 description 4
- 229910052716 thallium Inorganic materials 0.000 description 4
- -1 thallium halide Chemical class 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- KJZYNXUDTRRSPN-UHFFFAOYSA-N holmium atom Chemical compound [Ho] KJZYNXUDTRRSPN-UHFFFAOYSA-N 0.000 description 3
- QKEOZZYXWAIQFO-UHFFFAOYSA-M mercury(1+);iodide Chemical compound [Hg]I QKEOZZYXWAIQFO-UHFFFAOYSA-M 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 3
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 3
- 229910052721 tungsten Inorganic materials 0.000 description 3
- 239000010937 tungsten Substances 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052792 caesium Inorganic materials 0.000 description 2
- 230000002596 correlated effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 2
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 2
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 229910052765 Lutetium Inorganic materials 0.000 description 1
- 229910052779 Neodymium Inorganic materials 0.000 description 1
- 229910052777 Praseodymium Inorganic materials 0.000 description 1
- 229910052775 Thulium Inorganic materials 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- DNXNYEBMOSARMM-UHFFFAOYSA-N alumane;zirconium Chemical compound [AlH3].[Zr] DNXNYEBMOSARMM-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- XQPRBTXUXXVTKB-UHFFFAOYSA-M caesium iodide Chemical compound [I-].[Cs+] XQPRBTXUXXVTKB-UHFFFAOYSA-M 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- NDPNROHECXQBPK-UHFFFAOYSA-N dysprosium holmium Chemical compound [Dy][Ho] NDPNROHECXQBPK-UHFFFAOYSA-N 0.000 description 1
- 229910003440 dysprosium oxide Inorganic materials 0.000 description 1
- AMCZDBWELCASLD-UHFFFAOYSA-N dysprosium(3+) holmium(3+) oxygen(2-) Chemical compound [O-2].[Ho+3].[Dy+3].[O-2].[O-2] AMCZDBWELCASLD-UHFFFAOYSA-N 0.000 description 1
- NLQFUUYNQFMIJW-UHFFFAOYSA-N dysprosium(iii) oxide Chemical compound O=[Dy]O[Dy]=O NLQFUUYNQFMIJW-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- JYTUFVYWTIKZGR-UHFFFAOYSA-N holmium oxide Inorganic materials [O][Ho]O[Ho][O] JYTUFVYWTIKZGR-UHFFFAOYSA-N 0.000 description 1
- OWCYYNSBGXMRQN-UHFFFAOYSA-N holmium(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Ho+3].[Ho+3] OWCYYNSBGXMRQN-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- OHSVLFRHMCKCQY-UHFFFAOYSA-N lutetium atom Chemical compound [Lu] OHSVLFRHMCKCQY-UHFFFAOYSA-N 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 description 1
- PUDIUYLPXJFUGB-UHFFFAOYSA-N praseodymium atom Chemical compound [Pr] PUDIUYLPXJFUGB-UHFFFAOYSA-N 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- QPBYLOWPSRZOFX-UHFFFAOYSA-J tin(iv) iodide Chemical compound I[Sn](I)(I)I QPBYLOWPSRZOFX-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
Landscapes
- Discharge Lamp (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU20387A HU196861B (en) | 1987-01-23 | 1987-01-23 | Low colour-temperature high-pressure metal-halide lamp with good colour reproduction |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3731134A1 DE3731134A1 (de) | 1988-08-04 |
| DE3731134C2 true DE3731134C2 (de) | 1994-06-16 |
Family
ID=10948459
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19873731134 Revoked DE3731134C2 (de) | 1987-01-23 | 1987-09-16 | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe |
Country Status (5)
| Country | Link |
|---|---|
| JP (1) | JPS6419671A (enExample) |
| DE (1) | DE3731134C2 (enExample) |
| HU (1) | HU196861B (enExample) |
| NL (1) | NL8702513A (enExample) |
| SE (1) | SE8703229L (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4013039A1 (de) * | 1990-04-24 | 1991-10-31 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe |
| RU2071619C1 (ru) * | 1995-03-22 | 1997-01-10 | Акционерное общество закрытого типа Научно-техническое агентство "Интеллект" | Способ получения оптического излучения и разрядная лампа для его осуществления |
| AU2003286305A1 (en) * | 2002-12-20 | 2004-07-14 | Koninklijke Philips Electronics N.V. | High-pressure gas discharge lamp |
| DE102004019185A1 (de) * | 2004-04-16 | 2005-11-10 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3334261A (en) * | 1965-10-24 | 1967-08-01 | Sylvania Electric Prod | High pressure discharge device having a fill including iodine mercury and at least one rare earth metal |
| GB1370020A (en) * | 1971-01-21 | 1974-10-09 | Westinghouse Electric Corp | Arc-discharge lamp |
| DE2106447C2 (de) * | 1971-02-11 | 1983-02-17 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden |
| DE2114804B2 (de) * | 1971-03-26 | 1978-09-14 | Patent-Treuhand-Gesellschaft Fuer Elektrische Gluehlampen Mbh, 8000 Muenchen | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden |
| DE2114805A1 (de) * | 1971-03-26 | 1972-10-05 | Patra Patent Treuhand | Hochdruckentladungslampe |
| DE2519377A1 (de) * | 1975-04-30 | 1976-11-11 | Patra Patent Treuhand | Quecksilberdampf-hochdruckentladungslampe |
| DE2655167C2 (de) * | 1976-12-06 | 1986-12-18 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe mit Metallhalogeniden |
| NL8005456A (nl) * | 1980-10-02 | 1982-05-03 | Philips Nv | Hogedrukkwikdampontladingslamp. |
| DE3427280C2 (de) * | 1984-07-24 | 1986-06-12 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Metallhalogenid-Hochdruckentladungslampe |
-
1987
- 1987-01-23 HU HU20387A patent/HU196861B/hu not_active IP Right Cessation
- 1987-08-20 SE SE8703229A patent/SE8703229L/ not_active Application Discontinuation
- 1987-09-16 DE DE19873731134 patent/DE3731134C2/de not_active Revoked
- 1987-10-21 NL NL8702513A patent/NL8702513A/nl not_active Application Discontinuation
-
1988
- 1988-01-22 JP JP1100288A patent/JPS6419671A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6419671A (en) | 1989-01-23 |
| NL8702513A (nl) | 1988-08-16 |
| SE8703229L (sv) | 1988-07-24 |
| JPH0555973B2 (enExample) | 1993-08-18 |
| DE3731134A1 (de) | 1988-08-04 |
| SE8703229D0 (sv) | 1987-08-20 |
| HUT46167A (en) | 1988-09-28 |
| HU196861B (en) | 1989-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2655167C2 (de) | Hochdruckentladungslampe mit Metallhalogeniden | |
| EP0535311B1 (de) | Hochdruckentladungslampe kleiner Leistung | |
| EP0453893B1 (de) | Hochdruckentladungslampe | |
| DE1940539C3 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden | |
| DE2455277C2 (de) | Hochdruck-Zinnhalogenidentladungslampe | |
| DE2519377A1 (de) | Quecksilberdampf-hochdruckentladungslampe | |
| DE3813421A1 (de) | Hochdruck-quecksilberdampfentladungslampe | |
| DE3506295A1 (de) | Kompakte hochdruckentladungslampe | |
| DE19645959A1 (de) | Metallhalogenid-Hochdruckentladungslampe | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE69618313T2 (de) | Verfahren zum Betreiben einer Metallhalogenidlampe | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2707204A1 (de) | Hochdruck-entladungslampe mit metallhaloid-zusatz | |
| DE2422576C3 (de) | Quecksilberdampflampe | |
| DE2106447C2 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE2201831A1 (de) | Bogenentladungsvorrichtung | |
| DE3733217C2 (enExample) | ||
| DE1489406C3 (de) | Hochdruck-Quecksilberdampf entladungslampe | |
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE68916346T2 (de) | Metallhalogenidentladungslampe mit verbesserter Farbwiedergabe. | |
| DE69625143T2 (de) | Metallhalogenidlampe | |
| DE3044121A1 (de) | Natriumhochdrucklampe | |
| DE2535922A1 (de) | Quecksilberdampf-hochdruckentladungslampe fuer horizontale brennlage | |
| DE2009684A1 (de) | Bogenentladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BESZEDES, S., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 85221 DACHAU |
|
| 8331 | Complete revocation |