DE3540918A1 - Verfahren zur selektiven hydrierung ungesaettigter verbindungen - Google Patents
Verfahren zur selektiven hydrierung ungesaettigter verbindungenInfo
- Publication number
- DE3540918A1 DE3540918A1 DE19853540918 DE3540918A DE3540918A1 DE 3540918 A1 DE3540918 A1 DE 3540918A1 DE 19853540918 DE19853540918 DE 19853540918 DE 3540918 A DE3540918 A DE 3540918A DE 3540918 A1 DE3540918 A1 DE 3540918A1
- Authority
- DE
- Germany
- Prior art keywords
- weight
- unsaturated
- hydrogenation
- reducible groups
- nitrogenous
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 14
- 230000036571 hydration Effects 0.000 title 1
- 238000006703 hydration reaction Methods 0.000 title 1
- 238000005984 hydrogenation reaction Methods 0.000 claims description 21
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 14
- 150000002825 nitriles Chemical class 0.000 claims description 11
- 239000003054 catalyst Substances 0.000 claims description 9
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 150000001993 dienes Chemical class 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229920001577 copolymer Polymers 0.000 claims description 4
- 239000003446 ligand Substances 0.000 claims description 4
- 150000002576 ketones Chemical class 0.000 claims description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 3
- OGGXGZAMXPVRFZ-UHFFFAOYSA-N dimethylarsinic acid Chemical compound C[As](C)(O)=O OGGXGZAMXPVRFZ-UHFFFAOYSA-N 0.000 claims description 2
- 239000000178 monomer Substances 0.000 claims description 2
- -1 Cationic ruthenium complexes Chemical class 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000010948 rhodium Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 229910052703 rhodium Inorganic materials 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical group [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 4
- 229910052707 ruthenium Inorganic materials 0.000 description 4
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000002560 nitrile group Chemical group 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 238000004566 IR spectroscopy Methods 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 229920000459 Nitrile rubber Polymers 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- NTXGQCSETZTARF-UHFFFAOYSA-N buta-1,3-diene;prop-2-enenitrile Chemical compound C=CC=C.C=CC#N NTXGQCSETZTARF-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 239000002815 homogeneous catalyst Substances 0.000 description 2
- 238000009905 homogeneous catalytic hydrogenation reaction Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- VWSSOSUSCXKKKL-UHFFFAOYSA-N phenyl-bis(2,3,4-trimethoxyphenyl)phosphane Chemical compound COC1=C(OC)C(OC)=CC=C1P(C=1C(=C(OC)C(OC)=CC=1)OC)C1=CC=CC=C1 VWSSOSUSCXKKKL-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 238000004321 preservation Methods 0.000 description 2
- 150000003283 rhodium Chemical class 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- XJOLBNJKWACAKB-UHFFFAOYSA-N (2,3-dimethoxyphenyl)-diphenylphosphane Chemical compound COC1=CC=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1OC XJOLBNJKWACAKB-UHFFFAOYSA-N 0.000 description 1
- RGVUOOXMJUYRPP-UHFFFAOYSA-N (2,3-dimethylphenyl)-diphenylphosphane Chemical compound CC1=CC=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1C RGVUOOXMJUYRPP-UHFFFAOYSA-N 0.000 description 1
- NVZWEEGUWXZOKI-UHFFFAOYSA-N 1-ethenyl-2-methylbenzene Chemical compound CC1=CC=CC=C1C=C NVZWEEGUWXZOKI-UHFFFAOYSA-N 0.000 description 1
- JZHGRUMIRATHIU-UHFFFAOYSA-N 1-ethenyl-3-methylbenzene Chemical compound CC1=CC=CC(C=C)=C1 JZHGRUMIRATHIU-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- YGRVCNYIEKLRED-UHFFFAOYSA-N 4,4-diphenylbutylphosphane Chemical compound C=1C=CC=CC=1C(CCCP)C1=CC=CC=C1 YGRVCNYIEKLRED-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- SFUCQIUDZBXOOP-UHFFFAOYSA-N 4-bis(4-cyanophenyl)phosphanylbenzonitrile Chemical compound C1=CC(C#N)=CC=C1P(C=1C=CC(=CC=1)C#N)C1=CC=C(C#N)C=C1 SFUCQIUDZBXOOP-UHFFFAOYSA-N 0.000 description 1
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 239000005922 Phosphane Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000008360 acrylonitriles Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical class [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- 229910000066 arsane Inorganic materials 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- WTHLGKYLKTXPBE-UHFFFAOYSA-N benzhydrylphosphane Chemical compound C=1C=CC=CC=1C(P)C1=CC=CC=C1 WTHLGKYLKTXPBE-UHFFFAOYSA-N 0.000 description 1
- DGJOCBJPCSLLKK-UHFFFAOYSA-N bis(2,3-dimethoxyphenyl)-phenylphosphane Chemical compound COC1=CC=CC(P(C=2C=CC=CC=2)C=2C(=C(OC)C=CC=2)OC)=C1OC DGJOCBJPCSLLKK-UHFFFAOYSA-N 0.000 description 1
- FOZRTQVZEZIVAK-UHFFFAOYSA-N bis(2,3-dimethylphenyl)-phenylphosphane Chemical class CC1=CC=CC(P(C=2C=CC=CC=2)C=2C(=C(C)C=CC=2)C)=C1C FOZRTQVZEZIVAK-UHFFFAOYSA-N 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- VBWIZSYFQSOUFQ-UHFFFAOYSA-N cyclohexanecarbonitrile Chemical compound N#CC1CCCCC1 VBWIZSYFQSOUFQ-UHFFFAOYSA-N 0.000 description 1
- GTMWGXABXQTZRJ-UHFFFAOYSA-N cyclohexene-1-carbonitrile Chemical compound N#CC1=CCCCC1 GTMWGXABXQTZRJ-UHFFFAOYSA-N 0.000 description 1
- IQIRNRBHGWXSLV-UHFFFAOYSA-N cyclohexyl(diphenyl)arsane Chemical compound C1CCCCC1[As](C=1C=CC=CC=1)C1=CC=CC=C1 IQIRNRBHGWXSLV-UHFFFAOYSA-N 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- WIWBLJMBLGWSIN-UHFFFAOYSA-L dichlorotris(triphenylphosphine)ruthenium(ii) Chemical compound [Cl-].[Cl-].[Ru+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 WIWBLJMBLGWSIN-UHFFFAOYSA-L 0.000 description 1
- MUBZDQFQOYOFBM-UHFFFAOYSA-N diethyl(phenyl)arsane Chemical compound CC[As](CC)C1=CC=CC=C1 MUBZDQFQOYOFBM-UHFFFAOYSA-N 0.000 description 1
- LVTCZSBUROAWTE-UHFFFAOYSA-N diethyl(phenyl)phosphane Chemical compound CCP(CC)C1=CC=CC=C1 LVTCZSBUROAWTE-UHFFFAOYSA-N 0.000 description 1
- WXACOVNAZWPSJM-UHFFFAOYSA-N diphenyl(trifluoromethyl)phosphane Chemical compound C=1C=CC=CC=1P(C(F)(F)F)C1=CC=CC=C1 WXACOVNAZWPSJM-UHFFFAOYSA-N 0.000 description 1
- VPHDWBWBTVPDAZ-UHFFFAOYSA-N diphenyl-(2,3,4-trimethoxyphenyl)phosphane Chemical compound COC1=C(OC)C(OC)=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 VPHDWBWBTVPDAZ-UHFFFAOYSA-N 0.000 description 1
- PFLORXVMVNHPEC-UHFFFAOYSA-N diphenyl-(2,3,4-trimethylphenyl)phosphane Chemical compound CC1=C(C)C(C)=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 PFLORXVMVNHPEC-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000005670 ethenylalkyl group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000009904 heterogeneous catalytic hydrogenation reaction Methods 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- ZJAKNSASNSLIOG-UHFFFAOYSA-N methyl 4-bis(4-methoxycarbonylphenyl)phosphanylbenzoate Chemical compound C1=CC(C(=O)OC)=CC=C1P(C=1C=CC(=CC=1)C(=O)OC)C1=CC=C(C(=O)OC)C=C1 ZJAKNSASNSLIOG-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 229910052762 osmium Chemical group 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical group [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical class CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 1
- 238000010060 peroxide vulcanization Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- OHUBTNCFAYBUKT-UHFFFAOYSA-N phenyl-bis(2,3,4-trimethylphenyl)phosphane Chemical compound CC1=C(C)C(C)=CC=C1P(C=1C(=C(C)C(C)=CC=1)C)C1=CC=CC=C1 OHUBTNCFAYBUKT-UHFFFAOYSA-N 0.000 description 1
- 229910000064 phosphane Inorganic materials 0.000 description 1
- GTBPUYSGSDIIMM-UHFFFAOYSA-N phosphane;ruthenium Chemical class P.[Ru] GTBPUYSGSDIIMM-UHFFFAOYSA-N 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000010059 sulfur vulcanization Methods 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- DMEUUKUNSVFYAA-UHFFFAOYSA-N trinaphthalen-1-ylphosphane Chemical compound C1=CC=C2C(P(C=3C4=CC=CC=C4C=CC=3)C=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 DMEUUKUNSVFYAA-UHFFFAOYSA-N 0.000 description 1
- BPLUKJNHPBNVQL-UHFFFAOYSA-N triphenylarsine Chemical compound C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1 BPLUKJNHPBNVQL-UHFFFAOYSA-N 0.000 description 1
- JRIXTOAARDBEIG-UHFFFAOYSA-N tris(2,3,4-trimethoxyphenyl)phosphane Chemical compound COC1=C(OC)C(OC)=CC=C1P(C=1C(=C(OC)C(OC)=CC=1)OC)C1=CC=C(OC)C(OC)=C1OC JRIXTOAARDBEIG-UHFFFAOYSA-N 0.000 description 1
- PADOFXALCIVUFS-UHFFFAOYSA-N tris(2,3-dimethoxyphenyl)phosphane Chemical class COC1=CC=CC(P(C=2C(=C(OC)C=CC=2)OC)C=2C(=C(OC)C=CC=2)OC)=C1OC PADOFXALCIVUFS-UHFFFAOYSA-N 0.000 description 1
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 1
- VSFCYBMPSJKBDJ-UHFFFAOYSA-N tris(4-ethoxyphenyl)arsane Chemical compound C1=CC(OCC)=CC=C1[As](C=1C=CC(OCC)=CC=1)C1=CC=C(OCC)C=C1 VSFCYBMPSJKBDJ-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08C—TREATMENT OR CHEMICAL MODIFICATION OF RUBBERS
- C08C19/00—Chemical modification of rubber
- C08C19/02—Hydrogenation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F15/00—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table
- C07F15/0006—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table compounds of the platinum group
- C07F15/0046—Ruthenium compounds
- C07F15/0053—Ruthenium compounds without a metal-carbon linkage
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/04—Reduction, e.g. hydrogenation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853540918 DE3540918A1 (de) | 1985-11-19 | 1985-11-19 | Verfahren zur selektiven hydrierung ungesaettigter verbindungen |
| EP86115305A EP0223151B1 (de) | 1985-11-19 | 1986-11-05 | Verfahren zur selektiven Hydrierung ungesättigter Verbindungen |
| DE8686115305T DE3674342D1 (de) | 1985-11-19 | 1986-11-05 | Verfahren zur selektiven hydrierung ungesaettigter verbindungen. |
| JP61267867A JPS62125858A (ja) | 1985-11-19 | 1986-11-12 | 不飽和化合物の選択的水素添加方法 |
| CA000523076A CA1257876A (en) | 1985-11-19 | 1986-11-17 | Process for the selective hydrogenation of unsaturated compounds |
| US07/195,513 US4978771A (en) | 1985-11-19 | 1988-05-18 | Process for the selective hydrogenation of unsatuated compounds |
| US07/922,011 USRE34548E (en) | 1985-11-19 | 1992-07-29 | Process for the selective hydrogenation of unsaturated compounds |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853540918 DE3540918A1 (de) | 1985-11-19 | 1985-11-19 | Verfahren zur selektiven hydrierung ungesaettigter verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3540918A1 true DE3540918A1 (de) | 1987-05-21 |
Family
ID=6286321
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19853540918 Withdrawn DE3540918A1 (de) | 1985-11-19 | 1985-11-19 | Verfahren zur selektiven hydrierung ungesaettigter verbindungen |
| DE8686115305T Expired - Lifetime DE3674342D1 (de) | 1985-11-19 | 1986-11-05 | Verfahren zur selektiven hydrierung ungesaettigter verbindungen. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8686115305T Expired - Lifetime DE3674342D1 (de) | 1985-11-19 | 1986-11-05 | Verfahren zur selektiven hydrierung ungesaettigter verbindungen. |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4978771A (OSRAM) |
| EP (1) | EP0223151B1 (OSRAM) |
| JP (1) | JPS62125858A (OSRAM) |
| CA (1) | CA1257876A (OSRAM) |
| DE (2) | DE3540918A1 (OSRAM) |
Cited By (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5049693A (en) * | 1989-06-29 | 1991-09-17 | Bayer Aktiengesellschaft | Process for the selective hydrogenation of olefins containing nitrile groups |
| WO2002100905A1 (en) | 2001-06-12 | 2002-12-19 | Bayer Inc. | Process for the preparation of low molecular weight hydrogenated nitrile rubber |
| EP1762593A1 (de) | 2005-09-06 | 2007-03-14 | Lanxess Deutschland GmbH | Vernetzbare Zusammensetzungen, daraus erhältliche thermoplastische Elastomere und deren Verwendung |
| EP2028195A1 (en) | 2007-08-21 | 2009-02-25 | Lanxess Deutschland GmbH | Metathesis of nitrile rubbers in the presence of transition metal complex catalysts |
| EP2027920A1 (de) | 2007-08-21 | 2009-02-25 | Lanxess Deutschland GmbH | Katalysatoren für Metathese-Reaktionen |
| DE102007039527A1 (de) | 2007-08-21 | 2009-02-26 | Lanxess Deutschland Gmbh | Katalysatoren für Metathese-Reaktionen |
| DE102007039695A1 (de) | 2007-08-22 | 2009-02-26 | Lanxess Deutschland Gmbh | Katalysatoren für Metathese-Reaktionen |
| DE102007039525A1 (de) | 2007-08-21 | 2009-02-26 | Lanxess Deutschland Gmbh | Verfahren zum Metathese-Abbau von Nitrilkautschuk |
| DE102007039526A1 (de) | 2007-08-21 | 2009-02-26 | Lanxess Deutschland Gmbh | Katalysator-Systeme und deren Verwendung für Metathese-Reaktionen |
| EP2145920A1 (en) | 2008-07-15 | 2010-01-20 | Lanxess Deutschland GmbH | Vulcanizable polymer compositions |
| EP2145681A1 (de) | 2008-07-08 | 2010-01-20 | Lanxess Deutschland GmbH | Verfahren zum Molekulargewichtsabbau von Nitrilkautschuk |
| EP2147933A1 (en) | 2008-07-24 | 2010-01-27 | LANXESS Inc. | Process for the continuous hydrogenation of carbon-carbon double bonds in an unsaturated polymer to produce a hydrogenated polymer |
| EP2147931A1 (en) | 2008-07-24 | 2010-01-27 | LANXESS Inc. | Process for the continuous hydrogenation of carbon-carbon double bonds in an unsaturated polymer |
| EP2289623A1 (en) | 2009-08-31 | 2011-03-02 | LANXESS Deutschland GmbH | Metathesis of nitrile rubbers in the presence of transition metal catalysts |
| WO2011023771A1 (en) | 2009-08-31 | 2011-03-03 | Lanxess Deutschland Gmbh | Vulcanizable polymer composition comprising a low molecular weight optionally hydrogenated nitrile rubber |
| WO2011023674A1 (en) | 2009-08-31 | 2011-03-03 | Lanxess Deutschland Gmbh | Ruthenium based catalysts for the metathesis of nitrile rubbers |
| EP2292687A1 (en) | 2009-09-03 | 2011-03-09 | Rhein Chemie Rheinau GmbH | Improved vulcanisable guanidine-free mixtures containing ethylene acrylate (AEM), polyacrylate (ACM) and/or hydrogenated acrylnitrile (HNBR)-based rubbers compounds, vulcanisates, prepared by cross-linking this vulcanisable mixtures and their use |
| EP2298824A1 (de) | 2009-09-17 | 2011-03-23 | LANXESS Deutschland GmbH | Nitrilkautschuke und deren Herstellung in organischen Lösungsmitteln |
| WO2011032832A1 (de) | 2009-09-17 | 2011-03-24 | Lanxess Deutschland Gmbh | Nitrilkautschuke und deren herstellung in organischen lösungsmitteln |
| EP2316860A1 (de) | 2009-11-03 | 2011-05-04 | LANXESS Deutschland GmbH | Nitrilkautschuke |
| EP2368917A1 (en) | 2010-03-25 | 2011-09-28 | LANXESS International SA | Process for the production of water and solvent-free hydrogenated nitrile rubbers |
| EP2385074A1 (de) | 2010-05-07 | 2011-11-09 | LANXESS Deutschland GmbH | Nitrilkautschuke und deren Herstellung in organischen Lösungsmitteln |
| EP2386600A1 (de) | 2010-04-15 | 2011-11-16 | LANXESS Deutschland GmbH | Isocyanatgruppen-enthaltende Vernetzer für Nitrilkautschuke |
| EP2392610A1 (de) | 2010-06-02 | 2011-12-07 | Lanxess Deutschland GmbH | Neue Thermoplast-Kautschuk-Mehrkomponenten-Systeme |
| EP2418225A1 (de) | 2010-08-09 | 2012-02-15 | LANXESS Deutschland GmbH | Teilhydrierte Nitrilkautschuke |
| EP2423238A1 (de) | 2010-08-31 | 2012-02-29 | LANXESS Deutschland GmbH | Verfahren zur Herstellung von Nitrilkautschuken in organischen Lösungsmitteln |
| EP2423235A1 (de) | 2010-08-31 | 2012-02-29 | LANXESS Deutschland GmbH | Verfahren zur Herstellung von Nitrilkautschuken in organischen Lösungsmitteln |
| EP2423234A1 (de) | 2010-08-31 | 2012-02-29 | LANXESS Deutschland GmbH | Kautschukblends aus verschiedenen Nitrilkautschuken |
| EP2471852A1 (de) | 2010-12-29 | 2012-07-04 | Lanxess Deutschland GmbH | Vulkanisierbare Zusammensetzungen auf Basis Epoxygruppen-haltiger Nitrilkautschuke |
| EP2471851A1 (de) | 2010-12-29 | 2012-07-04 | LANXESS Deutschland GmbH | Vulkanisierbare Zusammensetzungen auf Basis Epoxygruppen-haltiger Nitrilkautschuke |
| EP2484700A1 (de) | 2011-02-04 | 2012-08-08 | LANXESS Deutschland GmbH | Funktionalisierte Nitrilkautschuke und ihre Herstellung |
| WO2012175725A1 (en) | 2011-06-24 | 2012-12-27 | Lanxess Deutschland Gmbh | Solution polymerization/co-polymerization of dienes, hydrogenation of dienerubbers and hydrogenated dienerubbers |
| EP2554558A1 (de) | 2011-08-02 | 2013-02-06 | Lanxess Deutschland GmbH | Verfahren zur Herstellung von Nitrilkautschuken in organischen Lösungsmitteln |
| EP2565229A1 (de) | 2011-09-02 | 2013-03-06 | LANXESS Deutschland GmbH | Vulkanisierbare Zusammensetzungen auf Basis von Epoxygruppen-haltigen Ethylenvinylacetat-Copolymerisaten |
| EP2581409A1 (de) | 2011-10-11 | 2013-04-17 | Lanxess Deutschland GmbH | Vulkanisierbare Zusammensetzungen auf Basis Epoxygruppen-haltiger Nitrilkautschuke |
| WO2013053763A1 (de) | 2011-10-11 | 2013-04-18 | Lanxess Deutschland Gmbh | Vulkanisierbare zusammensetzungen auf basis epoxygruppen-haltiger nitrilkautschuke |
| WO2013057289A2 (en) | 2011-10-21 | 2013-04-25 | Lanxess Deutschland Gmbh | Catalyst compositions and their use for hydrogenation of nitrile rubber |
| WO2013057286A1 (en) | 2011-10-21 | 2013-04-25 | Lanxess Deutschland Gmbh | Catalyst compositions and their use for hydrogenation of nitrile rubber |
| WO2013057285A1 (en) | 2011-10-21 | 2013-04-25 | Lanxess Deutschland Gmbh | Catalyst compositions and their use for hydrogenation of nitrile rubber |
| WO2013057295A2 (en) | 2011-10-21 | 2013-04-25 | Lanxess Deutschland Gmbh | Catalyst compositions and their use for hydrogenation of nitrile rubber |
| WO2013160470A1 (en) | 2012-04-28 | 2013-10-31 | Lanxess Deutschland Gmbh | Hydrogenation of nitrile rubber |
| EP3034518A1 (de) | 2014-12-19 | 2016-06-22 | Lanxess Deutschland GmbH | Farbstabile Nitrilkautschuke |
| EP3196239A1 (de) | 2016-01-25 | 2017-07-26 | ARLANXEO Deutschland GmbH | Vulkanisierbare zusammensetzungen auf basis von hydriertem nitrilkautschuk, verfahren zu deren herstellung und deren verwendung |
| EP3255088A1 (de) | 2016-06-07 | 2017-12-13 | ARLANXEO Deutschland GmbH | Verwendung von vulkanisierbaren zusammensetzungen und vulkanisaten in kontakt mit kühlmittel enthaltend silan-beschichteten wollastonit |
| WO2019034572A1 (de) | 2017-08-16 | 2019-02-21 | Arlanxeo Deutschland Gmbh | Vulkanisierbare zusammensetzungen enthaltend hydrierten nitrilkautschuk, daraus hergestellte vulkanisate und deren verwendung |
| WO2019057703A1 (de) | 2017-09-20 | 2019-03-28 | Arlanxeo Deutschland Gmbh | Vulkanisierbare hnbr-zusammensetzung mit hoher wärmeleitfähigkeit |
| WO2019110658A1 (de) | 2017-12-08 | 2019-06-13 | Arlanxeo Deutschland Gmbh | Verfahren zur herstellung von nitrilkautschuken mit ruthenium-komplexkatalysatoren |
| WO2019207096A1 (en) | 2018-04-27 | 2019-10-31 | Arlanxeo Deutschland Gmbh | Use of ruthenium and osmium catalysts for the metathesis of nitrile rubber |
| WO2020020677A1 (en) | 2018-07-23 | 2020-01-30 | Arlanxeo Deutschland Gmbh | Method for producing hydrogenated nitrile rubber and hnbr compositions thereof |
| WO2020020630A2 (en) | 2018-07-23 | 2020-01-30 | Arlanxeo Deutschland Gmbh | Hydrogenation of nitrile rubber |
| WO2020020629A1 (en) | 2018-07-23 | 2020-01-30 | Arlanxeo Deutschland Gmbh | Use of catalysts for the metathesis of nitrile rubber |
| WO2020120207A2 (en) | 2018-12-12 | 2020-06-18 | Arlanxeo Deutschland Gmbh | Catalyst system containing a metathesis catalyst and at least one phenolic compound and a process for metathesis of nitrile-butadiene rubber (nbr) using the catalyst system |
| WO2020126343A1 (en) | 2018-12-19 | 2020-06-25 | Arlanxeo Deutschland Gmbh | Electrode composition for a cathode of a cell of a lithium-ion battery, a cathode slurry composition, a cathode and the battery incorporating it |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2732273B2 (ja) * | 1988-12-29 | 1998-03-25 | 日本ゼオン株式会社 | ニトリル基含有水素化重合体の製造方法 |
| US5651995A (en) * | 1994-09-30 | 1997-07-29 | Nippon Zeon Co., Ltd. | Highly saturated nitrile rubber, process for producing same, vulcanizable rubber composition, aqueous emulsion and adhesive composition |
| JP3496292B2 (ja) * | 1994-09-30 | 2004-02-09 | 日本ゼオン株式会社 | ニトリル基含有高飽和共重合体ゴムと繊維との複合体 |
| JP3477849B2 (ja) | 1994-09-30 | 2003-12-10 | 日本ゼオン株式会社 | ニトリル基含有高飽和共重合体ゴムとエチレン系飽和型共重合体ゴムとからなるゴム組成物 |
| JP3770285B2 (ja) | 1996-09-27 | 2006-04-26 | 日本ゼオン株式会社 | カルボキシル化ニトリル基含有高飽和共重合体ゴム |
| CA2317364A1 (en) * | 2000-08-25 | 2002-02-25 | Bayer Aktiengesellschaft | Hydrogenated nitrile rubbers with improved low-temperature properties |
| CA2329551A1 (en) | 2000-12-22 | 2002-06-22 | Bayer Inc. | Process for the production of hydrogenated nitrile rubber |
| CA2462011A1 (en) * | 2004-02-23 | 2005-08-23 | Bayer Inc. | Process for the preparation of low molecular weight nitrile rubber |
| EP1757623A1 (en) * | 2005-07-14 | 2007-02-28 | Lanxess Inc. | Process for the preparation of low mooney nitrile terpolymers |
| EP1760093B1 (de) * | 2005-08-30 | 2011-12-21 | LANXESS Deutschland GmbH | Verwendung von Katalysatoren für den Metatheseabbau von Nitrilkautschuk |
| DE102005047115A1 (de) * | 2005-09-30 | 2007-04-05 | Lanxess Deutschland Gmbh | Vernetzbare Zusammensetzungen, Verfahren zu deren Herstellung und deren Verwendung |
| DE102005059625A1 (de) * | 2005-12-14 | 2007-06-21 | Lanxess Deutschland Gmbh | Mikrogel-enthaltende vulkanisierbare Zusammensetzung auf Basis von hydriertem Nitrilkautschuk |
| DE102005061628A1 (de) * | 2005-12-21 | 2007-06-28 | Lanxess Deutschland Gmbh | Hydrierter Nitrilkautschuk mit enger Molekulargewichtsverteilung, ein Verfahren zu seiner Herstellung und seine Verwendung |
| DE102005061627A1 (de) * | 2005-12-21 | 2007-06-28 | Lanxess Deutschland Gmbh | Synthetischer Kautschuk mit enger Molekulargewichtsverteilung, ein Verfahren zu seiner Herstellung und seine Verwendung |
| DE102006008520A1 (de) | 2006-02-22 | 2007-08-23 | Lanxess Deutschland Gmbh | Neue Katalysator-Systeme und deren Verwendung für Metathese-Reaktionen |
| DE102006008521A1 (de) * | 2006-02-22 | 2007-08-23 | Lanxess Deutschland Gmbh | Verwendung von Katalysatoren mit erhöhter Aktivität für die NBR-Metathese |
| US7666950B2 (en) * | 2006-06-01 | 2010-02-23 | Lanxess Deutschland Gmbh | Process for preparing hydrogenated nitrile rubbers |
| DE102006040569A1 (de) * | 2006-08-30 | 2008-03-06 | Lanxess Deutschland Gmbh | Verfahren zum Metathese-Abbau von Nitrilkautschuken |
| DE102007024010A1 (de) * | 2007-05-22 | 2008-11-27 | Lanxess Deutschland Gmbh | Nitrilkautschuke |
| DE102007024011A1 (de) * | 2007-05-22 | 2008-11-27 | Lanxess Deutschland Gmbh | Nitrilkautschuke |
| DE102007024008A1 (de) * | 2007-05-22 | 2008-11-27 | Lanxess Deutschland Gmbh | Nitrilkautschuke |
| BRPI0907377B1 (pt) * | 2008-01-29 | 2019-09-03 | Arlanxeo Deutschland Gmbh | borracha nitrílica, processo para a produção de borrachas nitrílicas, utilização de borrachas nitrílicas, mistura vulcanizável, processo para a produção de uma mistura vulcanizável, e processo para a produção de moldados |
| KR101233891B1 (ko) * | 2008-01-29 | 2013-02-15 | 란세스 도이치란트 게엠베하 | 알킬티오 말단기를 임의로 함유하고 임의로 수소화된 니트릴 고무 |
| ES2523715T3 (es) * | 2008-01-29 | 2014-12-01 | Lanxess Deutschland Gmbh | Cauchos de nitrilo opcionalmente hidrogenados que contienen opcionalmente grupos terminales alquiltio |
| EP2143489A1 (de) * | 2008-07-08 | 2010-01-13 | Lanxess Deutschland GmbH | Katalysator-Systeme und deren Verwendung für Metathese-Reaktionen |
| EP2199326B1 (en) * | 2008-12-19 | 2014-10-29 | LANXESS Deutschland GmbH | Vulcanizable polymer compositions |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3489786A (en) * | 1964-12-10 | 1970-01-13 | Shell Oil Co | Hydrogenation process |
| GB1138601A (en) * | 1964-12-15 | 1969-01-01 | Geoffrey Wilkinson | Improvements in catalytic reactions |
| GB1135979A (en) * | 1965-06-11 | 1968-12-11 | Ici Ltd | Hydrogenation process |
| US3480659A (en) * | 1965-07-19 | 1969-11-25 | Shell Oil Co | Hydrogenation process |
| US3454644A (en) * | 1966-05-09 | 1969-07-08 | Shell Oil Co | Homogeneous hydrogenation process employing a complex of ruthenium or osmium as catalyst |
| US3700637A (en) * | 1970-05-08 | 1972-10-24 | Shell Oil Co | Diene-nitrile rubbers |
| US3700748A (en) * | 1970-05-22 | 1972-10-24 | Shell Oil Co | Selectively hydrogenated block copolymers |
| US3700633A (en) * | 1971-05-05 | 1972-10-24 | Shell Oil Co | Selectively hydrogenated block copolymers |
| JPS5224559B2 (OSRAM) * | 1973-12-14 | 1977-07-01 | ||
| DE2539132C2 (de) * | 1975-09-03 | 1987-04-09 | Bayer Ag, 5090 Leverkusen | Verwendung hydrierter Dien-Copolymere als temperaturbeständige Materialien auf dem Dichtungssektor |
| DE3329974A1 (de) * | 1983-08-19 | 1985-02-28 | Bayer Ag, 5090 Leverkusen | Herstellung von hydrierten nitrilkautschuken |
| DE3337294A1 (de) * | 1983-10-13 | 1985-04-25 | Bayer Ag, 5090 Leverkusen | Verfahren zur selektiven hydrierung von c-c-doppelbindungen in gegenwart von reduzierbaren, stickstoffhaltigen gruppen und neue ruthenium-komplexverbindungen |
| DE3433392A1 (de) * | 1984-09-12 | 1986-03-20 | Bayer Ag, 5090 Leverkusen | Hydrierung nitrilgruppenhaltiger ungesaettigter polymerer |
| DE3529252A1 (de) * | 1985-08-16 | 1987-02-19 | Bayer Ag | Verfahren zur selektiven hydrierung ungesaettigter verbindungen |
| DE3541689A1 (de) * | 1985-11-26 | 1987-05-27 | Bayer Ag | Verfahren zur selektiven hydrierung nitrilgruppenhaltiger ungesaettigter polymerer |
| US4816525A (en) * | 1987-07-06 | 1989-03-28 | University Of Waterloo | Polymer hydrogenation process |
| US4812528A (en) * | 1987-07-06 | 1989-03-14 | University Of Waterloo | Polymer hydrogenation process |
-
1985
- 1985-11-19 DE DE19853540918 patent/DE3540918A1/de not_active Withdrawn
-
1986
- 1986-11-05 DE DE8686115305T patent/DE3674342D1/de not_active Expired - Lifetime
- 1986-11-05 EP EP86115305A patent/EP0223151B1/de not_active Expired - Lifetime
- 1986-11-12 JP JP61267867A patent/JPS62125858A/ja active Granted
- 1986-11-17 CA CA000523076A patent/CA1257876A/en not_active Expired
-
1988
- 1988-05-18 US US07/195,513 patent/US4978771A/en not_active Ceased
Cited By (77)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5049693A (en) * | 1989-06-29 | 1991-09-17 | Bayer Aktiengesellschaft | Process for the selective hydrogenation of olefins containing nitrile groups |
| WO2002100905A1 (en) | 2001-06-12 | 2002-12-19 | Bayer Inc. | Process for the preparation of low molecular weight hydrogenated nitrile rubber |
| EP1762593A1 (de) | 2005-09-06 | 2007-03-14 | Lanxess Deutschland GmbH | Vernetzbare Zusammensetzungen, daraus erhältliche thermoplastische Elastomere und deren Verwendung |
| EP2028195A1 (en) | 2007-08-21 | 2009-02-25 | Lanxess Deutschland GmbH | Metathesis of nitrile rubbers in the presence of transition metal complex catalysts |
| EP2027920A1 (de) | 2007-08-21 | 2009-02-25 | Lanxess Deutschland GmbH | Katalysatoren für Metathese-Reaktionen |
| DE102007039527A1 (de) | 2007-08-21 | 2009-02-26 | Lanxess Deutschland Gmbh | Katalysatoren für Metathese-Reaktionen |
| DE102007039525A1 (de) | 2007-08-21 | 2009-02-26 | Lanxess Deutschland Gmbh | Verfahren zum Metathese-Abbau von Nitrilkautschuk |
| DE102007039526A1 (de) | 2007-08-21 | 2009-02-26 | Lanxess Deutschland Gmbh | Katalysator-Systeme und deren Verwendung für Metathese-Reaktionen |
| DE102007039695A1 (de) | 2007-08-22 | 2009-02-26 | Lanxess Deutschland Gmbh | Katalysatoren für Metathese-Reaktionen |
| EP2145681A1 (de) | 2008-07-08 | 2010-01-20 | Lanxess Deutschland GmbH | Verfahren zum Molekulargewichtsabbau von Nitrilkautschuk |
| EP2145920A1 (en) | 2008-07-15 | 2010-01-20 | Lanxess Deutschland GmbH | Vulcanizable polymer compositions |
| EP2145921A1 (en) | 2008-07-15 | 2010-01-20 | Lanxess Deutschland GmbH | Vulcanizable polymer compositions |
| EP2147933A1 (en) | 2008-07-24 | 2010-01-27 | LANXESS Inc. | Process for the continuous hydrogenation of carbon-carbon double bonds in an unsaturated polymer to produce a hydrogenated polymer |
| EP2147931A1 (en) | 2008-07-24 | 2010-01-27 | LANXESS Inc. | Process for the continuous hydrogenation of carbon-carbon double bonds in an unsaturated polymer |
| EP2147932A1 (en) | 2008-07-24 | 2010-01-27 | LANXESS Inc. | Process for the continuous hydrogenation of carbon-carbon double bonds in an unsaturated polymer to produce a hydrogenated polymer |
| EP2151455A1 (en) | 2008-07-24 | 2010-02-10 | LANXESS Inc. | Process for the continuous hydrogenation of carbon-carbon double bonds in an unsaturated polymer |
| EP2289623A1 (en) | 2009-08-31 | 2011-03-02 | LANXESS Deutschland GmbH | Metathesis of nitrile rubbers in the presence of transition metal catalysts |
| WO2011023771A1 (en) | 2009-08-31 | 2011-03-03 | Lanxess Deutschland Gmbh | Vulcanizable polymer composition comprising a low molecular weight optionally hydrogenated nitrile rubber |
| WO2011023763A1 (en) | 2009-08-31 | 2011-03-03 | Lanxess Deutschland Gmbh | Metathesis of nitrile rubbers in the presence of transition metal catalysts |
| WO2011023674A1 (en) | 2009-08-31 | 2011-03-03 | Lanxess Deutschland Gmbh | Ruthenium based catalysts for the metathesis of nitrile rubbers |
| EP2292687A1 (en) | 2009-09-03 | 2011-03-09 | Rhein Chemie Rheinau GmbH | Improved vulcanisable guanidine-free mixtures containing ethylene acrylate (AEM), polyacrylate (ACM) and/or hydrogenated acrylnitrile (HNBR)-based rubbers compounds, vulcanisates, prepared by cross-linking this vulcanisable mixtures and their use |
| EP2298824A1 (de) | 2009-09-17 | 2011-03-23 | LANXESS Deutschland GmbH | Nitrilkautschuke und deren Herstellung in organischen Lösungsmitteln |
| WO2011032832A1 (de) | 2009-09-17 | 2011-03-24 | Lanxess Deutschland Gmbh | Nitrilkautschuke und deren herstellung in organischen lösungsmitteln |
| EP2316860A1 (de) | 2009-11-03 | 2011-05-04 | LANXESS Deutschland GmbH | Nitrilkautschuke |
| EP2316861A1 (de) | 2009-11-03 | 2011-05-04 | LANXESS Deutschland GmbH | Nitrilkautschuke |
| EP2368917A1 (en) | 2010-03-25 | 2011-09-28 | LANXESS International SA | Process for the production of water and solvent-free hydrogenated nitrile rubbers |
| WO2011117214A1 (en) | 2010-03-25 | 2011-09-29 | Lanxess Deutschland Gmbh | Process for the production of water and solvent-free hydrogenated nitrile rubbers |
| EP2386600A1 (de) | 2010-04-15 | 2011-11-16 | LANXESS Deutschland GmbH | Isocyanatgruppen-enthaltende Vernetzer für Nitrilkautschuke |
| WO2011141275A2 (de) | 2010-04-15 | 2011-11-17 | Lanxess Deutschland Gmbh | Isocyanatgruppen-enthaltende vernetzer für nitrilkautschuke |
| EP2385074A1 (de) | 2010-05-07 | 2011-11-09 | LANXESS Deutschland GmbH | Nitrilkautschuke und deren Herstellung in organischen Lösungsmitteln |
| EP2392610A1 (de) | 2010-06-02 | 2011-12-07 | Lanxess Deutschland GmbH | Neue Thermoplast-Kautschuk-Mehrkomponenten-Systeme |
| EP2418225A1 (de) | 2010-08-09 | 2012-02-15 | LANXESS Deutschland GmbH | Teilhydrierte Nitrilkautschuke |
| WO2012019978A1 (de) | 2010-08-09 | 2012-02-16 | Lanxess Deutschland Gmbh | Teilhydrierte nitrilkautschuke |
| WO2012028501A1 (de) | 2010-08-31 | 2012-03-08 | Lanxess Deutschland Gmbh | Verfahren zur herstellung von nitrilkautschuken in organischen lösungsmitteln |
| EP2423235A1 (de) | 2010-08-31 | 2012-02-29 | LANXESS Deutschland GmbH | Verfahren zur Herstellung von Nitrilkautschuken in organischen Lösungsmitteln |
| EP2423234A1 (de) | 2010-08-31 | 2012-02-29 | LANXESS Deutschland GmbH | Kautschukblends aus verschiedenen Nitrilkautschuken |
| WO2012028503A1 (de) | 2010-08-31 | 2012-03-08 | Lanxess Deutschland Gmbh | Verfahren zur herstellung von nitrilkautschuken in organischen lösungsmitteln |
| WO2012028506A1 (de) | 2010-08-31 | 2012-03-08 | Lanxess Deutschland Gmbh | Kautschukblends aus verschiedenen nitrilkautschuken |
| EP2423238A1 (de) | 2010-08-31 | 2012-02-29 | LANXESS Deutschland GmbH | Verfahren zur Herstellung von Nitrilkautschuken in organischen Lösungsmitteln |
| EP2471852A1 (de) | 2010-12-29 | 2012-07-04 | Lanxess Deutschland GmbH | Vulkanisierbare Zusammensetzungen auf Basis Epoxygruppen-haltiger Nitrilkautschuke |
| EP2471851A1 (de) | 2010-12-29 | 2012-07-04 | LANXESS Deutschland GmbH | Vulkanisierbare Zusammensetzungen auf Basis Epoxygruppen-haltiger Nitrilkautschuke |
| WO2012089817A1 (de) | 2010-12-29 | 2012-07-05 | Lanxess Deutschland Gmbh | Vulkanisierbare zusammensetzungen auf basis epoxygruppen-haltiger nitrilkautschuke |
| WO2012089804A1 (de) | 2010-12-29 | 2012-07-05 | Lanxess Deutschland Gmbh | Vulkanisierbare zusammensetzungen auf basis epoxygruppen-haltiger nitrilkautschuke |
| EP2484700A1 (de) | 2011-02-04 | 2012-08-08 | LANXESS Deutschland GmbH | Funktionalisierte Nitrilkautschuke und ihre Herstellung |
| WO2012104183A1 (de) | 2011-02-04 | 2012-08-09 | Lanxess Deutschland Gmbh | Funktionalisierte nitrilkautschuke und ihre herstellung |
| WO2012175725A1 (en) | 2011-06-24 | 2012-12-27 | Lanxess Deutschland Gmbh | Solution polymerization/co-polymerization of dienes, hydrogenation of dienerubbers and hydrogenated dienerubbers |
| EP2554558A1 (de) | 2011-08-02 | 2013-02-06 | Lanxess Deutschland GmbH | Verfahren zur Herstellung von Nitrilkautschuken in organischen Lösungsmitteln |
| WO2013017610A1 (de) | 2011-08-02 | 2013-02-07 | Lanxess Deutschland Gmbh | Verfahren zur herstellung von nitrilkautschuken in organischen lösungsmitteln |
| EP2565229A1 (de) | 2011-09-02 | 2013-03-06 | LANXESS Deutschland GmbH | Vulkanisierbare Zusammensetzungen auf Basis von Epoxygruppen-haltigen Ethylenvinylacetat-Copolymerisaten |
| WO2013030352A1 (de) | 2011-09-02 | 2013-03-07 | Lanxess Deutschland Gmbh | Vulkanisierbare zusammensetzungen auf basis von epoxygruppen-haltigen ethylen-vinylacetat-copolymerisaten |
| EP2581409A1 (de) | 2011-10-11 | 2013-04-17 | Lanxess Deutschland GmbH | Vulkanisierbare Zusammensetzungen auf Basis Epoxygruppen-haltiger Nitrilkautschuke |
| WO2013053763A1 (de) | 2011-10-11 | 2013-04-18 | Lanxess Deutschland Gmbh | Vulkanisierbare zusammensetzungen auf basis epoxygruppen-haltiger nitrilkautschuke |
| WO2013053761A1 (de) | 2011-10-11 | 2013-04-18 | Lanxess Deutschland Gmbh | Vulkanisierbare zusammensetzungen auf basis epoxygruppen-haltiger nitrilkautschuke |
| WO2013057286A1 (en) | 2011-10-21 | 2013-04-25 | Lanxess Deutschland Gmbh | Catalyst compositions and their use for hydrogenation of nitrile rubber |
| WO2013057289A2 (en) | 2011-10-21 | 2013-04-25 | Lanxess Deutschland Gmbh | Catalyst compositions and their use for hydrogenation of nitrile rubber |
| WO2013057285A1 (en) | 2011-10-21 | 2013-04-25 | Lanxess Deutschland Gmbh | Catalyst compositions and their use for hydrogenation of nitrile rubber |
| WO2013057295A2 (en) | 2011-10-21 | 2013-04-25 | Lanxess Deutschland Gmbh | Catalyst compositions and their use for hydrogenation of nitrile rubber |
| WO2013160470A1 (en) | 2012-04-28 | 2013-10-31 | Lanxess Deutschland Gmbh | Hydrogenation of nitrile rubber |
| EP3034518A1 (de) | 2014-12-19 | 2016-06-22 | Lanxess Deutschland GmbH | Farbstabile Nitrilkautschuke |
| EP3196239A1 (de) | 2016-01-25 | 2017-07-26 | ARLANXEO Deutschland GmbH | Vulkanisierbare zusammensetzungen auf basis von hydriertem nitrilkautschuk, verfahren zu deren herstellung und deren verwendung |
| WO2017129494A1 (de) | 2016-01-25 | 2017-08-03 | Arlanxeo Deutschland Gmbh | Vulkanisierbare zusammensetzungen auf basis von hydriertem nitrilkautschuk, verfahren zu deren herstellung und deren verwendung |
| EP3255088A1 (de) | 2016-06-07 | 2017-12-13 | ARLANXEO Deutschland GmbH | Verwendung von vulkanisierbaren zusammensetzungen und vulkanisaten in kontakt mit kühlmittel enthaltend silan-beschichteten wollastonit |
| WO2017211645A1 (de) | 2016-06-07 | 2017-12-14 | Arlanxeo Deutschland Gmbh | Verwendung von vulkanisierbaren zusammensetzungen und vulkanisaten in kontakt mit kühlmittel enthaltend silan-beschichteten wollastonit |
| WO2019034572A1 (de) | 2017-08-16 | 2019-02-21 | Arlanxeo Deutschland Gmbh | Vulkanisierbare zusammensetzungen enthaltend hydrierten nitrilkautschuk, daraus hergestellte vulkanisate und deren verwendung |
| WO2019057703A1 (de) | 2017-09-20 | 2019-03-28 | Arlanxeo Deutschland Gmbh | Vulkanisierbare hnbr-zusammensetzung mit hoher wärmeleitfähigkeit |
| WO2019110658A1 (de) | 2017-12-08 | 2019-06-13 | Arlanxeo Deutschland Gmbh | Verfahren zur herstellung von nitrilkautschuken mit ruthenium-komplexkatalysatoren |
| US11407843B2 (en) | 2017-12-08 | 2022-08-09 | Arlanxeo Deutschland Gmbh | Process for producing nitrile rubbers using ruthenium complex catalysts |
| WO2019207096A1 (en) | 2018-04-27 | 2019-10-31 | Arlanxeo Deutschland Gmbh | Use of ruthenium and osmium catalysts for the metathesis of nitrile rubber |
| US11203679B2 (en) | 2018-04-27 | 2021-12-21 | Arlanxeo Deutschland Gmbh | Use of ruthenium and osmium catalysts for the metathesis of nitrile rubber |
| WO2020020677A1 (en) | 2018-07-23 | 2020-01-30 | Arlanxeo Deutschland Gmbh | Method for producing hydrogenated nitrile rubber and hnbr compositions thereof |
| WO2020020630A2 (en) | 2018-07-23 | 2020-01-30 | Arlanxeo Deutschland Gmbh | Hydrogenation of nitrile rubber |
| WO2020020629A1 (en) | 2018-07-23 | 2020-01-30 | Arlanxeo Deutschland Gmbh | Use of catalysts for the metathesis of nitrile rubber |
| US11311868B2 (en) | 2018-07-23 | 2022-04-26 | Arlanxeo Deutschland Gmbh | Use of catalysts for the metathesis of nitrile rubber |
| US11312791B2 (en) | 2018-07-23 | 2022-04-26 | Arlanxeo Deutschland Gmbh | Hydrogenation of nitrile rubber |
| WO2020120207A2 (en) | 2018-12-12 | 2020-06-18 | Arlanxeo Deutschland Gmbh | Catalyst system containing a metathesis catalyst and at least one phenolic compound and a process for metathesis of nitrile-butadiene rubber (nbr) using the catalyst system |
| US11673130B2 (en) | 2018-12-12 | 2023-06-13 | Arlanxeo Deutschland Gmbh | Catalyst system containing a metathesis catalyst and at least one phenolic compound and a process for metathesis of nitrile-butadiene rubber (NBR) using the catalyst system |
| WO2020126343A1 (en) | 2018-12-19 | 2020-06-25 | Arlanxeo Deutschland Gmbh | Electrode composition for a cathode of a cell of a lithium-ion battery, a cathode slurry composition, a cathode and the battery incorporating it |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0374131B2 (OSRAM) | 1991-11-26 |
| CA1257876A (en) | 1989-07-25 |
| US4978771A (en) | 1990-12-18 |
| EP0223151A3 (en) | 1988-01-13 |
| DE3674342D1 (de) | 1990-10-25 |
| EP0223151A2 (de) | 1987-05-27 |
| JPS62125858A (ja) | 1987-06-08 |
| EP0223151B1 (de) | 1990-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0223151B1 (de) | Verfahren zur selektiven Hydrierung ungesättigter Verbindungen | |
| EP0213422B1 (de) | Verfahren zur selektiven Hydrierung ungesättigter Verbindungen | |
| EP0224139B1 (de) | Verfahren zur selektiven Hydrierung nitrilgruppenhaltiger ungesättigter Polymerer | |
| EP0174576B1 (de) | Hydrierung nitrilgruppenhaltiger ungesättigter Polymerer | |
| DE3851793T2 (de) | Verfahren zur Hydrierung von Polymeren. | |
| DE3046251C2 (de) | Verfahren zur Herstellung eines partiell hydrierten konjugierten Dienpolymeren | |
| DE3401983A1 (de) | Verfahren zur selektiven hydrierung von polymeren oder copolymeren von konjugierten dienen | |
| DE3538130A1 (de) | Verfahren und katalysator zur herstellung von syndiotaktischem 1,2-polybutadien | |
| EP0405266B1 (de) | Hydrierung nitrilgruppenhaltiger ungesättigter Polymerer | |
| DE3905432C2 (OSRAM) | ||
| DE3871898T2 (de) | Verfahren zur selektiven monohydroformylierung von diolefinen. | |
| DE2459901A1 (de) | Katalysator zur hydrierung, isomerisierung und hydrosilylierung von alkenen und dessen herstellungsverfahren | |
| USRE34548E (en) | Process for the selective hydrogenation of unsaturated compounds | |
| EP0405268B1 (de) | Verfahren zur selektiven Hydrierung nitrilgruppenhaltiger Olefine | |
| DE69113105T2 (de) | Polymerhydrierungsverfahren unter Verwendung von Rutheniumkomplexen. | |
| DE1176864B (de) | Verfahren zum Polymerisieren von Verbindungen mit polymerisierbaren Doppelbindungen | |
| DE69611270T2 (de) | Hydrierung von Diencopolymeren | |
| EP3720885B1 (de) | Verfahren zur herstellung von nitrilkautschuken mit ruthenium-komplexkatalysatoren | |
| DE1595154B2 (de) | Verfahren zur Herstellung von Polybutadien mit einer Eigenviskosität von mindestens 2,3 und von reinen Butan- Buten-Gemischen aus einer C4 -Kohlenwasserstoff-Fraktion | |
| DE1810185B2 (de) | Nickel (0)-katalysatoren, Verfahren zu deren Herstellung und deren Verwendung zur Oligomerisation von Butadien | |
| DE68905614T2 (de) | Verfahren zur behandlung von polymerisatloesungen. | |
| DE1493221C (OSRAM) | ||
| DE1468271A1 (de) | Verfahren zur Herstellung von Zyklododekatrienen-1,5,9 | |
| DE2052730A1 (de) | Verfahren zur Herstellung von aliphatischen Aminonitrilen | |
| DE1593565C (de) | Verfahren zur Herstellung von neuen Sauer«toffkomplexen des nullwertigen Nickels |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |