DE3423921C2 - - Google Patents
Info
- Publication number
- DE3423921C2 DE3423921C2 DE3423921A DE3423921A DE3423921C2 DE 3423921 C2 DE3423921 C2 DE 3423921C2 DE 3423921 A DE3423921 A DE 3423921A DE 3423921 A DE3423921 A DE 3423921A DE 3423921 C2 DE3423921 C2 DE 3423921C2
- Authority
- DE
- Germany
- Prior art keywords
- housing
- measuring tube
- flow meter
- sealing surface
- meter according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000007789 sealing Methods 0.000 claims description 33
- 239000000919 ceramic Substances 0.000 claims description 12
- 238000004804 winding Methods 0.000 claims description 7
- 230000002093 peripheral effect Effects 0.000 claims description 5
- 239000002775 capsule Substances 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 229910052574 oxide ceramic Inorganic materials 0.000 description 1
- 239000011224 oxide ceramic Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01F—MEASURING VOLUME, VOLUME FLOW, MASS FLOW OR LIQUID LEVEL; METERING BY VOLUME
- G01F1/00—Measuring the volume flow or mass flow of fluid or fluent solid material wherein the fluid passes through a meter in a continuous flow
- G01F1/56—Measuring the volume flow or mass flow of fluid or fluent solid material wherein the fluid passes through a meter in a continuous flow by using electric or magnetic effects
- G01F1/58—Measuring the volume flow or mass flow of fluid or fluent solid material wherein the fluid passes through a meter in a continuous flow by using electric or magnetic effects by electromagnetic flowmeters
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Fluid Mechanics (AREA)
- General Physics & Mathematics (AREA)
- Measuring Volume Flow (AREA)
- Measuring Fluid Pressure (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843423921 DE3423921A1 (de) | 1984-06-29 | 1984-06-29 | Elektromagnetischer durchflussmesser |
| CH2280/85A CH666962A5 (de) | 1984-06-29 | 1985-05-30 | Elektromagnetischer durchflussmesser. |
| CA000483561A CA1244671A (en) | 1984-06-29 | 1985-06-10 | Electromagnetic flow meter |
| US06/744,230 US4641536A (en) | 1984-06-29 | 1985-06-13 | Electromagnetic flow meter |
| DK276285A DK157950C (da) | 1984-06-29 | 1985-06-19 | Elektromagnetisk gennemstroemningsmaaler |
| NL8501828A NL193003C (nl) | 1984-06-29 | 1985-06-25 | Elektromagnetische doorstroommeter. |
| JP60139235A JPS6118822A (ja) | 1984-06-29 | 1985-06-27 | 電磁式の流量計 |
| IT67599/85A IT1183910B (it) | 1984-06-29 | 1985-06-28 | Misuratore elettromagnetico di portata |
| FR858509945A FR2566900B1 (fr) | 1984-06-29 | 1985-06-28 | Debitmetre electromagnetique |
| IT8553559U IT8553559V0 (it) | 1984-06-29 | 1985-06-28 | Misuratore elettromagnetico di portata |
| GB08516487A GB2160982B (en) | 1984-06-29 | 1985-06-28 | Electromagnetic flow meter |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843423921 DE3423921A1 (de) | 1984-06-29 | 1984-06-29 | Elektromagnetischer durchflussmesser |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3423921A1 DE3423921A1 (de) | 1986-01-02 |
| DE3423921C2 true DE3423921C2 (enExample) | 1987-08-13 |
Family
ID=6239414
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843423921 Granted DE3423921A1 (de) | 1984-06-29 | 1984-06-29 | Elektromagnetischer durchflussmesser |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4641536A (enExample) |
| JP (1) | JPS6118822A (enExample) |
| CA (1) | CA1244671A (enExample) |
| CH (1) | CH666962A5 (enExample) |
| DE (1) | DE3423921A1 (enExample) |
| DK (1) | DK157950C (enExample) |
| FR (1) | FR2566900B1 (enExample) |
| GB (1) | GB2160982B (enExample) |
| IT (2) | IT1183910B (enExample) |
| NL (1) | NL193003C (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3805574A1 (de) * | 1988-02-23 | 1989-08-31 | Fischer & Porter Gmbh | Magnetisch-induktiver durchflussmessaufnehmer |
| DE4239956A1 (en) * | 1991-11-29 | 1993-06-03 | Hitachi Ltd | Electromagnetic flowmeter with ceramic measurement tube - has earthing ring of stepped construction combining rare metal plate region and second plate region holding seals |
| DE10347878A1 (de) * | 2003-10-10 | 2005-05-04 | Abb Patent Gmbh | Magnetisch-induktives Messgerät für strömende Stoffe und Verfahren zu dessen Herstellung |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4722231A (en) * | 1985-05-14 | 1988-02-02 | Yamatake-Honeywell Co., Ltd. | Electromagnetic flowmeter |
| DE3735515C2 (de) * | 1987-10-20 | 1998-04-09 | Fischer & Porter Gmbh | Vorrichtung zur induktiven Durchflußmessung mit einem Meßrohr aus Keramik, Glas, Metall oder Kunststoff |
| JPH0619285B2 (ja) * | 1987-10-23 | 1994-03-16 | 株式会社日立製作所 | 外筒を有するセラミック導管 |
| NL8900021A (nl) * | 1989-01-05 | 1990-08-01 | Rheometron Ag | Elektromagnetische doorstroommeter. |
| EP0554059B1 (en) * | 1992-01-31 | 2002-07-24 | Kabushiki Kaisha Toshiba | Electromagnetic flowmeter |
| JP2770675B2 (ja) * | 1992-09-30 | 1998-07-02 | 株式会社日立製作所 | 静電容量式電磁流量計 |
| EP0649005B1 (de) * | 1993-10-14 | 1997-04-23 | Endress + Hauser Flowtec AG | Magnetisch-induktive Durchflussaufnehmer |
| GB2328021B (en) | 1997-08-01 | 2001-11-28 | Abb Kent Taylor Ltd | Electromagnetic flow sensor and assembly method |
| RU2272998C2 (ru) * | 2004-05-24 | 2006-03-27 | Закрытое акционерное общество "Взлет" | Электромагнитный расходомер |
| RU2277699C1 (ru) * | 2004-12-27 | 2006-06-10 | Открытое акционерное общество Акционерная холдинговая компания "Всероссийский научно-исследовательский и проектно-конструкторский институт металлургического машиностроения имени академика Целикова" (ОАО АХК "ВНИИМЕТМАШ") | Электромагнитный датчик расхода |
| EP1710545A1 (de) * | 2005-04-07 | 2006-10-11 | Endress + Hauser Flowtec AG | Messaufnehmer mit Überdruckschutzvorrichtung |
| US7363811B2 (en) * | 2005-04-07 | 2008-04-29 | Endress + Hauser Flowtec Ag | Measurement pickup |
| US7562913B1 (en) * | 2005-05-20 | 2009-07-21 | Anheuser-Busch, Inc. | Magmeter flange adapter |
| JP4808088B2 (ja) * | 2006-06-16 | 2011-11-02 | 宮脇車輌工業株式会社 | パレット溶着装置 |
| RU2349880C2 (ru) * | 2007-04-18 | 2009-03-20 | Закрытое акционерное общество "Научно-производственное объединение "Тепловизор" | Электромагнитный преобразователь расхода |
| JP2011248709A (ja) | 2010-05-28 | 2011-12-08 | Funai Electric Co Ltd | 販売システム |
| DE102015116672A1 (de) * | 2015-01-05 | 2016-07-07 | Krohne Ag | Durchflussmessgerät |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3213685A (en) * | 1962-01-23 | 1965-10-26 | Fischer & Porter Co | Magnetic flowmeter |
| GB1043594A (en) * | 1962-03-21 | 1966-09-21 | Vincent Jerome Cushing | Magnetic flowmeter apparatus |
| US3286522A (en) * | 1963-08-13 | 1966-11-22 | Vincent J Cushing | Magnetoelectric flowmeter apparatus |
| GB1077129A (en) * | 1963-09-30 | 1967-07-26 | Hokushin Electric Works | Improvements in or relating to electromagnetic flowmeters |
| GB1156875A (en) * | 1967-07-07 | 1969-07-02 | Mawdsley S Ltd | Improvements in or relating to Electromagnetic Flowmeters. |
| GB1221963A (en) * | 1968-03-27 | 1971-02-10 | Kent Ltd G | Improvements in or relating to electromagnetic flowmeter heads |
| US3610040A (en) * | 1970-03-31 | 1971-10-05 | Tokyo Shibaura Electric Co | Electromagnetic flowmeter |
| GB1301331A (enExample) * | 1970-04-10 | 1972-12-29 | ||
| DE2052051A1 (de) * | 1970-10-23 | 1972-04-27 | Steffens, Willi, 5208 Eitorf | Behälter mit Dosiereinrichtung für rieselfähige pulvrige bis körnige Feststoffe |
| US3750468A (en) * | 1971-04-08 | 1973-08-07 | Fischer & Porter Co | Lined flow tube for electromagnetic flowmeter |
| CS150831B1 (enExample) * | 1971-04-09 | 1973-09-17 | ||
| US3695104A (en) * | 1971-05-28 | 1972-10-03 | Fischer & Porter Co | Electromagnetic flowmeter having removable liner |
| US3824856A (en) * | 1973-01-22 | 1974-07-23 | Fischer & Porter Co | High-pressure electromagnetic flowmeter |
| US3924466A (en) * | 1974-10-21 | 1975-12-09 | Honeywell Inc | Magnetic flowmeter with improved field coil |
| US4253340A (en) * | 1979-09-12 | 1981-03-03 | Fischer & Porter Co. | Unitary electromagnetic flowmeter |
| US4420982A (en) * | 1977-02-23 | 1983-12-20 | Fischer & Porter Company | Unitary electromagnetic flowmeter with sealed coils |
| US4358963A (en) * | 1979-09-12 | 1982-11-16 | Fischer & Porter Company | Unitary electromagnetic flowmeter with sealed coils |
| US4470309A (en) * | 1981-07-06 | 1984-09-11 | Tokyo Shibaura Denki Kabushiki Kaisha | Electromagnetic flowmeter |
| DE3172074D1 (en) * | 1981-11-27 | 1985-10-03 | Rheometron Ag | Measuring head for an electro-magnetic flow meter |
| DE3364847D1 (en) * | 1983-03-23 | 1986-09-04 | Rheometron Ag | Pick-up device for magneto-inductive flow meters |
-
1984
- 1984-06-29 DE DE19843423921 patent/DE3423921A1/de active Granted
-
1985
- 1985-05-30 CH CH2280/85A patent/CH666962A5/de not_active IP Right Cessation
- 1985-06-10 CA CA000483561A patent/CA1244671A/en not_active Expired
- 1985-06-13 US US06/744,230 patent/US4641536A/en not_active Expired - Lifetime
- 1985-06-19 DK DK276285A patent/DK157950C/da not_active IP Right Cessation
- 1985-06-25 NL NL8501828A patent/NL193003C/nl not_active IP Right Cessation
- 1985-06-27 JP JP60139235A patent/JPS6118822A/ja active Granted
- 1985-06-28 IT IT67599/85A patent/IT1183910B/it active
- 1985-06-28 GB GB08516487A patent/GB2160982B/en not_active Expired
- 1985-06-28 FR FR858509945A patent/FR2566900B1/fr not_active Expired - Lifetime
- 1985-06-28 IT IT8553559U patent/IT8553559V0/it unknown
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3805574A1 (de) * | 1988-02-23 | 1989-08-31 | Fischer & Porter Gmbh | Magnetisch-induktiver durchflussmessaufnehmer |
| DE3805574C2 (de) * | 1988-02-23 | 1998-04-16 | Fischer & Porter Gmbh | Magnetisch-induktiver Durchflußmeßaufnehmer |
| DE4239956A1 (en) * | 1991-11-29 | 1993-06-03 | Hitachi Ltd | Electromagnetic flowmeter with ceramic measurement tube - has earthing ring of stepped construction combining rare metal plate region and second plate region holding seals |
| DE10347878A1 (de) * | 2003-10-10 | 2005-05-04 | Abb Patent Gmbh | Magnetisch-induktives Messgerät für strömende Stoffe und Verfahren zu dessen Herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| IT8567599A0 (it) | 1985-06-28 |
| FR2566900B1 (fr) | 1990-04-20 |
| DE3423921A1 (de) | 1986-01-02 |
| IT8553559V0 (it) | 1985-06-28 |
| DK276285D0 (da) | 1985-06-19 |
| NL193003C (nl) | 1998-07-03 |
| GB8516487D0 (en) | 1985-07-31 |
| JPH0471445B2 (enExample) | 1992-11-13 |
| DK276285A (da) | 1985-12-30 |
| GB2160982B (en) | 1988-06-22 |
| CH666962A5 (de) | 1988-08-31 |
| DK157950B (da) | 1990-03-05 |
| JPS6118822A (ja) | 1986-01-27 |
| CA1244671A (en) | 1988-11-15 |
| IT1183910B (it) | 1987-10-22 |
| NL8501828A (nl) | 1986-01-16 |
| DK157950C (da) | 1990-08-13 |
| FR2566900A1 (fr) | 1986-01-03 |
| NL193003B (nl) | 1998-03-02 |
| US4641536A (en) | 1987-02-10 |
| GB2160982A (en) | 1986-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3423921C2 (enExample) | ||
| DE3335335C2 (enExample) | ||
| DE2040682C3 (de) | Induktiver Durchflußmesser mit einem in einer vom Medium durchströmten Rohrleitung zwischen Gegenflanschen deren benachbarter Rohrleitungsteile lösbar gehaltenen Meßrohr aus isolierendem Kunstharz | |
| DE2637727A1 (de) | Elektrischer druchfuehrungsverbinder | |
| DE3908698C2 (enExample) | ||
| DE3145426A1 (de) | Einstufige ferrofluiddichtung | |
| DE3239345C2 (enExample) | ||
| CH668476A5 (de) | Elektromagnetischer durchflussmesser. | |
| DE29502825U1 (de) | Piezoresistiver Drucksensor oder Druckaufnehmer | |
| DE3042097A1 (de) | Flanschdichtung | |
| DE4018638A1 (de) | Druckmessumformer mit einem rotationssymmetrischen drucksensor aus keramik | |
| DE2914195B1 (de) | Induktiver Messumformer fuer ein fluidisches Stellglied | |
| DE2800402C2 (de) | Hohlraumresonatormagnetron mit einem Antennenauskoppelsystem | |
| DE2440829C3 (de) | Vakuumschaltrohr | |
| DE4041992A1 (de) | Verfahren zum herstellen eines fluidischen hubzylinders sowie eine kolben-zylinder-einheit | |
| DE2123577C3 (de) | Magnetron | |
| DE19952721B4 (de) | Verbindungsbereich an einer gekapselten, gasisolierten Hochspannungsanlage | |
| DE3036398C2 (de) | Schutzvorrichtung für bruchgefährdete Abschnitte von Rohrleitungen | |
| DE3635551A1 (de) | Druckdichter elektro-hubmagnet | |
| EP0157726B1 (de) | Druck- oder Druckdifferenzmessgerät | |
| DE9113953U1 (de) | Dichtungsanordnung für eine Flanschdichtung bei einer Rohrleitung | |
| EP0167672A2 (de) | Gaslaserrohr und Verfahren zu seiner Herstellung | |
| EP0037367B1 (de) | Gas- oder flüssigkeitsisolierter Messwandler | |
| DE2227166A1 (de) | Magnetventil mit magnetspule und kunststoff-fuehrungsrohr | |
| DE2161386C2 (de) | Ventilgehäuse, insbesondere hydraulisches Wegeventilgehäuse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8365 | Fully valid after opposition proceedings | ||
| 8380 | Miscellaneous part iii |
Free format text: SPALTE 1, ZEILE 29 "2." AENDERN IN "5." |
|
| 8339 | Ceased/non-payment of the annual fee |