DE3020689A1 - Celluloseaether - Google Patents
CelluloseaetherInfo
- Publication number
- DE3020689A1 DE3020689A1 DE19803020689 DE3020689A DE3020689A1 DE 3020689 A1 DE3020689 A1 DE 3020689A1 DE 19803020689 DE19803020689 DE 19803020689 DE 3020689 A DE3020689 A DE 3020689A DE 3020689 A1 DE3020689 A1 DE 3020689A1
- Authority
- DE
- Germany
- Prior art keywords
- water
- cellulose
- soluble
- modified
- cellulose ether
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 229920003086 cellulose ether Polymers 0.000 claims description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 29
- -1 hydroxypropyl residues Chemical group 0.000 claims description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 12
- 229930195733 hydrocarbon Natural products 0.000 claims description 11
- 239000004215 Carbon black (E152) Substances 0.000 claims description 10
- 150000002430 hydrocarbons Chemical class 0.000 claims description 10
- 238000006467 substitution reaction Methods 0.000 claims description 9
- 230000004048 modification Effects 0.000 claims description 8
- 238000012986 modification Methods 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 238000006116 polymerization reaction Methods 0.000 claims description 5
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- 239000000047 product Substances 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- 239000004094 surface-active agent Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 12
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 12
- 229920000642 polymer Polymers 0.000 description 12
- 238000000034 method Methods 0.000 description 11
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 150000002118 epoxides Chemical class 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 7
- 239000004615 ingredient Substances 0.000 description 7
- 239000010665 pine oil Substances 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 229920002678 cellulose Polymers 0.000 description 6
- 239000001913 cellulose Substances 0.000 description 6
- 239000002002 slurry Substances 0.000 description 6
- 239000004593 Epoxy Substances 0.000 description 5
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 150000002170 ethers Chemical class 0.000 description 5
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 5
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000000470 constituent Substances 0.000 description 4
- 238000006266 etherification reaction Methods 0.000 description 4
- 229920000609 methyl cellulose Polymers 0.000 description 4
- 239000001923 methylcellulose Substances 0.000 description 4
- 235000010981 methylcellulose Nutrition 0.000 description 4
- 239000002453 shampoo Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229960000776 sodium tetradecyl sulfate Drugs 0.000 description 3
- UPUIQOIQVMNQAP-UHFFFAOYSA-M sodium;tetradecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O UPUIQOIQVMNQAP-UHFFFAOYSA-M 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 229920000896 Ethulose Polymers 0.000 description 2
- 239000001859 Ethyl hydroxyethyl cellulose Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical class OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Chemical class 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 235000019326 ethyl hydroxyethyl cellulose Nutrition 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Substances OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 230000008719 thickening Effects 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 206010015946 Eye irritation Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229920001479 Hydroxyethyl methyl cellulose Polymers 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- 229920003106 Methocel™ A4C Polymers 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- WBOXZLRDVULSGV-UHFFFAOYSA-N azanium;ethyl sulfate Chemical compound [H+].N.CCOS([O-])(=O)=O WBOXZLRDVULSGV-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- JZKFHQMONDVVNF-UHFFFAOYSA-N dodecyl sulfate;tris(2-hydroxyethyl)azanium Chemical compound OCCN(CCO)CCO.CCCCCCCCCCCCOS(O)(=O)=O JZKFHQMONDVVNF-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 231100000013 eye irritation Toxicity 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- VMPHSYLJUKZBJJ-UHFFFAOYSA-N lauric acid triglyceride Natural products CCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCC)COC(=O)CCCCCCCCCCC VMPHSYLJUKZBJJ-UHFFFAOYSA-N 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 230000006855 networking Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007613 slurry method Methods 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08B—POLYSACCHARIDES; DERIVATIVES THEREOF
- C08B11/00—Preparation of cellulose ethers
- C08B11/193—Mixed ethers, i.e. ethers with two or more different etherifying groups
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Materials Engineering (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/045,819 US4243802A (en) | 1979-06-06 | 1979-06-06 | Surfactant-soluble cellulose derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3020689A1 true DE3020689A1 (de) | 1981-01-22 |
| DE3020689C2 DE3020689C2 (https=) | 1991-07-11 |
Family
ID=21940046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803020689 Granted DE3020689A1 (de) | 1979-06-06 | 1980-05-30 | Celluloseaether |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4243802A (https=) |
| JP (1) | JPS56801A (https=) |
| CA (1) | CA1137080A (https=) |
| DE (1) | DE3020689A1 (https=) |
| GB (1) | GB2053225B (https=) |
| NL (1) | NL190121C (https=) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4529523A (en) * | 1982-06-08 | 1985-07-16 | Hercules Incorporated | Hydrophobically modified polymers |
| US4458068A (en) * | 1983-03-25 | 1984-07-03 | The Dow Chemical Company | Water-soluble, ternary cellulose ethers |
| US4663159A (en) | 1985-02-01 | 1987-05-05 | Union Carbide Corporation | Hydrophobe substituted, water-soluble cationic polysaccharides |
| US4683004A (en) * | 1985-08-20 | 1987-07-28 | Union Carbide Corporation | Foamable compositions and processes for use thereof |
| US4845207A (en) * | 1987-06-17 | 1989-07-04 | Aqualon Company | 3-alkoxy-2-hydroxypropylhydroxyethylcellulose and building composition containing the same |
| US4939192A (en) * | 1987-06-17 | 1990-07-03 | Aqualon Company | Building composition containing 3-alkoxy-2-hydroxypropylhydroxyethyl cellulose |
| US4826970A (en) * | 1987-09-17 | 1989-05-02 | Hercules Incorporated | Carboxymethyl hydrophobically modified hydroxyethylcellulose |
| US4892589A (en) * | 1987-10-30 | 1990-01-09 | Aqualon Company | Composition comprising water-soluble, nonionic hydrophobically modified hydroxyethyl cellulose and water-soluble, nonionic hydroxyethyl cellulose |
| ATE108190T1 (de) | 1989-01-31 | 1994-07-15 | Union Carbide Chem Plastic | Polysaccharide mit alkaryl- oder aralkyl- hydrophoben und latexzusammensetzungen, die die polysaccharide enthalten. |
| SE463313B (sv) * | 1989-03-10 | 1990-11-05 | Berol Nobel Stenungssund Ab | Vattenloesliga, nonjoniska cellulosaetrar och deras anvaendning i maalarfaerger |
| US5062969A (en) * | 1989-05-22 | 1991-11-05 | Halliburton Company | Crosslinkable interpolymers |
| US5100658A (en) * | 1989-08-07 | 1992-03-31 | The Procter & Gamble Company | Vehicle systems for use in cosmetic compositions |
| US5104646A (en) * | 1989-08-07 | 1992-04-14 | The Procter & Gamble Company | Vehicle systems for use in cosmetic compositions |
| US5106609A (en) * | 1990-05-01 | 1992-04-21 | The Procter & Gamble Company | Vehicle systems for use in cosmetic compositions |
| US5093142A (en) * | 1989-09-19 | 1992-03-03 | Nabisco Brands, Inc. | Alcohol amine esters as low calorie fat mimetics |
| US5124445A (en) * | 1989-10-30 | 1992-06-23 | Aqualon Company | Alkylaryl hydrophobically modified cellulose ethers |
| US5120838A (en) * | 1989-10-30 | 1992-06-09 | Aqualon Company | Alkylaryl hydrophobically modified cellulose ethers |
| US4994112A (en) * | 1989-10-30 | 1991-02-19 | Aqualon Company | Hydrophobically modified cellulosic thickeners for paper coating |
| US5100657A (en) * | 1990-05-01 | 1992-03-31 | The Procter & Gamble Company | Clean conditioning compositions for hair |
| US5512091A (en) * | 1990-08-13 | 1996-04-30 | Steiner; Carol A. | Associative polymer hydrogels |
| US5807543A (en) * | 1993-08-27 | 1998-09-15 | The Procter & Gamble Co. | Cosmetic compositions containing hydrophobically modified nonionic polymer and unsaturated quaternary ammonium surfactant |
| EP0576578B1 (en) * | 1991-03-19 | 1995-12-06 | The Procter & Gamble Company | Cosmetic compositions containing hydrophobically modified nonionic polymer and unsaturated quaternary ammonium surfactant |
| EP0587755B1 (en) | 1991-06-07 | 1996-07-24 | The Procter & Gamble Company | Hair styling agents and compositions containing hydrophobic hair styling polymers |
| US5277899A (en) * | 1991-10-15 | 1994-01-11 | The Procter & Gamble Company | Hair setting composition with combination of cationic conditioners |
| CZ265895A3 (en) * | 1993-04-15 | 1996-03-13 | Akzo Nobel Nv | Amidation process of a material having at least one polysaccharide containing carboxylic acids, the material per se and its use |
| EP0799292A4 (en) * | 1994-12-03 | 2000-03-08 | Procter & Gamble | CLEANING SUPPLIES |
| GB9424476D0 (en) * | 1994-12-03 | 1995-01-18 | Procter & Gamble | Cleansing compositions |
| US5612397A (en) * | 1994-12-19 | 1997-03-18 | Rohm And Haas Company | Composition having wet state clarity |
| US5504123A (en) * | 1994-12-20 | 1996-04-02 | Union Carbide Chemicals & Plastics Technology Corporation | Dual functional cellulosic additives for latex compositions |
| WO1998023647A1 (fr) * | 1996-11-27 | 1998-06-04 | Kao Corporation | Derives polysaccharidiques et compositions hydrauliques |
| US6093217A (en) * | 1997-02-05 | 2000-07-25 | Akzo Nobel N.V. | Sizing of paper |
| US5804166A (en) * | 1997-05-09 | 1998-09-08 | Hercules Incorporated | Low VOC hair sprays containing cellulose ethers |
| RU2191194C2 (ru) | 1997-06-13 | 2002-10-20 | Акцо Нобель Н.В. | Гидрофобизированные анионные простые эфиры целлюлозы |
| SE514347C2 (sv) * | 1998-08-06 | 2001-02-12 | Akzo Nobel Nv | Nonjonisk cellulosaeter och dess användning som förtjockningsmedel i färgkompositioner |
| US6162877A (en) * | 1998-12-04 | 2000-12-19 | Hercules Incorporated | Hydrophobically modified comb copolymers |
| KR100717231B1 (ko) * | 1999-07-28 | 2007-05-11 | 킴벌리-클라크 월드와이드, 인크. | 페이싱 및 라이너용 cd 신장 가능한 천과 같은 부직 물질 |
| US6417268B1 (en) | 1999-12-06 | 2002-07-09 | Hercules Incorporated | Method for making hydrophobically associative polymers, methods of use and compositions |
| US20030045844A1 (en) * | 2000-04-14 | 2003-03-06 | Taylor Jack Draper | Dimensionally stable, breathable, stretch-thinned, elastic films |
| US6405801B1 (en) * | 2000-12-08 | 2002-06-18 | Halliburton Energy Services, Inc. | Environmentally acceptable well cement fluid loss control additives, compositions and methods |
| FR2818539B1 (fr) † | 2000-12-22 | 2004-04-30 | Oreal | Composition pour la teinture d'oxydation des fibres keratiniques comprenant au moins 4,5 ou 3,4 diamino pyrazole ou triamino pyrazole et au moins un compose cellulosique particulier, et procede de teinture |
| US7018945B2 (en) * | 2002-07-02 | 2006-03-28 | Kimberly-Clark Worldwide, Inc. | Composition and method for treating fibers and nonwoven substrates |
| US20040110442A1 (en) * | 2002-08-30 | 2004-06-10 | Hannong Rhim | Stretchable nonwoven materials with controlled retraction force and methods of making same |
| US6881375B2 (en) * | 2002-08-30 | 2005-04-19 | Kimberly-Clark Worldwide, Inc. | Method of forming a 3-dimensional fiber into a web |
| US6896843B2 (en) * | 2002-08-30 | 2005-05-24 | Kimberly-Clark Worldwide, Inc. | Method of making a web which is extensible in at least one direction |
| WO2004020174A1 (en) * | 2002-08-30 | 2004-03-11 | Kimberly-Clark Worldwide, Inc. | Device and process for treating flexible web by stretching between intermeshing forming surfaces |
| US20040043214A1 (en) * | 2002-08-30 | 2004-03-04 | Kimberly-Clark Worldwide, Inc. | Method of forming a 3-dimensional fiber and a web formed from such fibers |
| US20040121675A1 (en) * | 2002-12-23 | 2004-06-24 | Kimberly-Clark Worklwide, Inc. | Treatment of substrates for improving ink adhesion to the substrates |
| US7226880B2 (en) * | 2002-12-31 | 2007-06-05 | Kimberly-Clark Worldwide, Inc. | Breathable, extensible films made with two-component single resins |
| US7932196B2 (en) | 2003-08-22 | 2011-04-26 | Kimberly-Clark Worldwide, Inc. | Microporous stretch thinned film/nonwoven laminates and limited use or disposable product applications |
| US7270723B2 (en) | 2003-11-07 | 2007-09-18 | Kimberly-Clark Worldwide, Inc. | Microporous breathable elastic film laminates, methods of making same, and limited use or disposable product applications |
| US7220478B2 (en) * | 2003-08-22 | 2007-05-22 | Kimberly-Clark Worldwide, Inc. | Microporous breathable elastic films, methods of making same, and limited use or disposable product applications |
| US20060147716A1 (en) * | 2004-12-30 | 2006-07-06 | Jaime Braverman | Elastic films with reduced roll blocking capability, methods of making same, and limited use or disposable product applications incorporating same |
| US8236385B2 (en) * | 2005-04-29 | 2012-08-07 | Kimberly Clark Corporation | Treatment of substrates for improving ink adhesion to the substrates |
| JP5696740B2 (ja) * | 2012-12-13 | 2015-04-08 | キヤノンマーケティングジャパン株式会社 | 滅菌装置、滅菌方法、プログラム |
| CN105209122B (zh) | 2013-03-15 | 2018-07-17 | 赫尔克里士公司 | 组合物和制备具有提高的沉积性能的个人护理组合物的方法 |
| JP2021063228A (ja) * | 2020-12-24 | 2021-04-22 | 花王株式会社 | エーテル化セルロース繊維及び水を含有する組成物 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3435027A (en) * | 1965-12-13 | 1969-03-25 | Hercules Inc | Cellulose ether-esters and process |
| DE1814598A1 (de) * | 1967-12-18 | 1969-07-24 | James Ellingboe | Verfahren zur Herstellung von lipophil-hydrophoben Stoffen aus Polysacchariden |
| US3824085A (en) * | 1972-02-01 | 1974-07-16 | Anheuser Busch | Esters of polymeric hydroxypropyl carbohydrates and method of using same as gelling agent for organic solvents |
| DE3004161A1 (de) * | 1979-02-12 | 1980-08-21 | Hercules Inc | Cellulosederivate |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2010818A (en) * | 1932-06-02 | 1935-08-13 | Du Pont | Etherification of cellulose |
| US3091542A (en) * | 1960-09-20 | 1963-05-28 | Dow Chemical Co | Insolubilization of water-soluble cellulose ethers |
| US3272640A (en) * | 1960-12-22 | 1966-09-13 | Hercules Powder Co Ltd | Water insolubilizing and insensitizing process |
| US3894839A (en) * | 1972-09-21 | 1975-07-15 | Us Of Amercia As Represented B | Process for acylating functional groups bearing active hydrogen with isopropenyl esters of long chain fatty acids |
| US3960514A (en) * | 1974-04-01 | 1976-06-01 | Anheuser-Busch, Incorporated | Synergistic organic solvent gellant |
| US4107426A (en) * | 1976-07-06 | 1978-08-15 | Roy Gerald Gordon | Process for treating cellulose |
| JPS5515906A (en) * | 1978-07-12 | 1980-02-04 | Toshiba Corp | Glass joining method |
-
1979
- 1979-06-06 US US06/045,819 patent/US4243802A/en not_active Expired - Lifetime
-
1980
- 1980-03-25 CA CA000348330A patent/CA1137080A/en not_active Expired
- 1980-05-30 DE DE19803020689 patent/DE3020689A1/de active Granted
- 1980-06-04 NL NLAANVRAGE8003241,A patent/NL190121C/xx not_active IP Right Cessation
- 1980-06-05 GB GB8018468A patent/GB2053225B/en not_active Expired
- 1980-06-06 JP JP7653680A patent/JPS56801A/ja active Granted
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3435027A (en) * | 1965-12-13 | 1969-03-25 | Hercules Inc | Cellulose ether-esters and process |
| DE1568804A1 (de) * | 1965-12-13 | 1970-07-30 | Hercules Inc | Wasserloesliche AEther-Ester von Cellulose |
| DE1814598A1 (de) * | 1967-12-18 | 1969-07-24 | James Ellingboe | Verfahren zur Herstellung von lipophil-hydrophoben Stoffen aus Polysacchariden |
| US3824085A (en) * | 1972-02-01 | 1974-07-16 | Anheuser Busch | Esters of polymeric hydroxypropyl carbohydrates and method of using same as gelling agent for organic solvents |
| DE3004161A1 (de) * | 1979-02-12 | 1980-08-21 | Hercules Inc | Cellulosederivate |
Non-Patent Citations (4)
| Title |
|---|
| British Polymer Journal, 23, (1990), S. 315-326 * |
| High Polymers, Volume V, "Cellulose and Cellulose Derivatives", Port. III, Ed. Emil Ott, Harald M. Spurlin, Interscience Publishers, New York, London 1955(2. Ed.), S. 1451-1460 * |
| J. Polymer. Sci. Part C, No. 36, S. 491-508(1971) * |
| ULLMANN: Encyklopädie der technischen Chemie, 4. Aufl. Bd. 9, S. 195-197 * |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2053225A (en) | 1981-02-04 |
| DE3020689C2 (https=) | 1991-07-11 |
| GB2053225B (en) | 1983-03-02 |
| US4243802A (en) | 1981-01-06 |
| JPS56801A (en) | 1981-01-07 |
| NL190121C (nl) | 1993-11-01 |
| JPH0128042B2 (https=) | 1989-05-31 |
| NL190121B (nl) | 1993-06-01 |
| NL8003241A (nl) | 1980-12-09 |
| CA1137080A (en) | 1982-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3020689A1 (de) | Celluloseaether | |
| DE3004161C2 (https=) | ||
| DE2358150C2 (de) | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen Celluloseethern | |
| DE69408454T3 (de) | Verfahren zur herstellung von amid-modifiziertem carboxyl enthaltenden polysaccharid und so erzeugtes fettsäureamid modifiziertes polysaccharid | |
| DE3008413C2 (de) | Verfahren zur Herstellung von Äthylcarboxymethylcellulose | |
| DE69129608T2 (de) | Niedrigviskose-Polysaccharidzusammensetzung mit hohem Festkörpergehalt | |
| DE3712246C2 (https=) | ||
| WO1996030411A1 (de) | Verfahren zur aktivierung von polysacchariden, danach hergestellte polysaccharide und deren verwendung | |
| DE1468017A1 (de) | Verfahren zur Herstellung von Hydroxypropylcellulose | |
| DE2840011A1 (de) | Polysaccharidderivate und verfahren zu deren herstellung | |
| EP0126959A1 (de) | Verfahren zur Herstellung von wasserlöslichen Cellulosemischethern | |
| EP3048119A1 (de) | Reversibel vernetzte celluloseether und verfahren zu deren herstellung durch selektive oxidation von vicinalen oh-gruppen | |
| EP1002804B1 (de) | Wasserlösliche sulfoalkylgruppenhaltige hydrophob modifizierte Celluloseether, Verfahren zu deren Herstellung sowie deren Verwendung als Schutzkolloide bei Polymerisationen | |
| DE2415155C2 (de) | Verfahren zur Herstellung von 2,3-Dihydroxypropylcellulose | |
| EP0117490B1 (de) | Verfahren zur Herstellung von Celluloseethern mit einem Dimethoxyethan enthaltenden Dispergierhilfsmittel | |
| DE3872346T2 (de) | Ionenaustauscher aus basis von vernetztem glukomannan. | |
| DE69508933T2 (de) | Wässrige suspension einer cellulose-ether, verfahren zu deren herstellung und zusammensetzung | |
| DD212969A1 (de) | Verfahren zur modifizierung von carboxymethylcellulose | |
| DE1518576A1 (de) | Verfahren zur Herstellung von Alkalicarboxymethylcellulose | |
| DE19646213C2 (de) | Verfahren zur Herstellung von Cellulosederivaten | |
| DE1443396A1 (de) | Verfahren zur Herstellung von hochmolekularen Vernetzungsprodukten von Polysacchariden oder deren Derivaten oder Polyvinylalkohol und Verwendung der Produkte als Ionenaustauscher | |
| DE3786927T2 (de) | Antithrombotische arzneimittel und deren herstellung. | |
| EP0719793B1 (de) | Verfahren zur Herstellung von wasserlöslichen Aminoalkylderivaten von Polysacchariden | |
| EP0038925A2 (de) | Verfahren zur Herstellung von wasserarmer Alkalicellulose | |
| DE3009149C2 (https=) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: LEDERER, F., DIPL.-CHEM. DR., PAT.-ANW., 8000 MUEN |
|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: C08B 11/193 |
|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8365 | Fully valid after opposition proceedings |