DE2945714C2 - - Google Patents
Info
- Publication number
- DE2945714C2 DE2945714C2 DE2945714A DE2945714A DE2945714C2 DE 2945714 C2 DE2945714 C2 DE 2945714C2 DE 2945714 A DE2945714 A DE 2945714A DE 2945714 A DE2945714 A DE 2945714A DE 2945714 C2 DE2945714 C2 DE 2945714C2
- Authority
- DE
- Germany
- Prior art keywords
- vol
- mixture
- lamp
- helium
- argon
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims description 55
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 44
- 229910052734 helium Inorganic materials 0.000 claims description 35
- 229910052786 argon Inorganic materials 0.000 claims description 26
- 239000001307 helium Substances 0.000 claims description 23
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical group [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 claims description 23
- 229910052743 krypton Inorganic materials 0.000 claims description 20
- 229910052756 noble gas Inorganic materials 0.000 claims description 18
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 claims description 13
- 229910052754 neon Inorganic materials 0.000 claims description 13
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 claims description 13
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 12
- 229910052724 xenon Inorganic materials 0.000 claims description 12
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 claims description 12
- 238000010586 diagram Methods 0.000 claims description 10
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 5
- PCTMTFRHKVHKIS-BMFZQQSSSA-N (1s,3r,4e,6e,8e,10e,12e,14e,16e,18s,19r,20r,21s,25r,27r,30r,31r,33s,35r,37s,38r)-3-[(2r,3s,4s,5s,6r)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10 Chemical compound C1C=C2C[C@@H](OS(O)(=O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2.O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 PCTMTFRHKVHKIS-BMFZQQSSSA-N 0.000 claims description 3
- 229910052753 mercury Inorganic materials 0.000 claims description 3
- 239000007789 gas Substances 0.000 description 6
- 230000004907 flux Effects 0.000 description 4
- 230000000694 effects Effects 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000002835 noble gases Chemical class 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 238000004544 sputter deposition Methods 0.000 description 2
- 229910052693 Europium Inorganic materials 0.000 description 1
- 229910052771 Terbium Inorganic materials 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- SIWVEOZUMHYXCS-UHFFFAOYSA-N oxo(oxoyttriooxy)yttrium Chemical compound O=[Y]O[Y]=O SIWVEOZUMHYXCS-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
- H01J61/20—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent mercury vapour
Landscapes
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7811351A NL7811351A (nl) | 1978-11-17 | 1978-11-17 | Lagedrukkwikdampontladingslamp. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2945714A1 DE2945714A1 (de) | 1980-05-29 |
| DE2945714C2 true DE2945714C2 (cg-RX-API-DMAC7.html) | 1988-03-24 |
Family
ID=19831913
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792945714 Granted DE2945714A1 (de) | 1978-11-17 | 1979-11-13 | Niederdruckquecksilberdampfentladungslampe |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4277720A (cg-RX-API-DMAC7.html) |
| JP (2) | JPS5572354A (cg-RX-API-DMAC7.html) |
| BE (1) | BE880094A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1141419A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2945714A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2441920A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2042254B (cg-RX-API-DMAC7.html) |
| IT (1) | IT1125691B (cg-RX-API-DMAC7.html) |
| NL (1) | NL7811351A (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE29606857U1 (de) * | 1996-04-16 | 1998-01-29 | Weth, Gosbert, Dr.med. Dr.rer.nat., 95346 Stadtsteinach | Leuchtmittel für therapeutische Zwecke |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE457761B (sv) * | 1985-05-23 | 1989-01-23 | Lumalampan Ab | Kompaktlysroer |
| US4902933A (en) * | 1988-09-20 | 1990-02-20 | General Electric Company | High efficacy discharge lamp having large anodes |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB302643A (en) * | 1927-12-19 | 1930-01-06 | Claude Neon Lights Inc | Improvements in electric discharge devices |
| FR720784A (fr) * | 1930-11-05 | 1932-02-24 | Claude Lumiere Sa | Appareil d'éclairage à décharge électrique |
| US2622221A (en) * | 1945-11-23 | 1952-12-16 | Westinghouse Electric Corp | Fluorescent discharge lamp |
| BE558655A (cg-RX-API-DMAC7.html) * | 1956-06-27 | |||
| US3052813A (en) * | 1959-06-30 | 1962-09-04 | Sylvania Electric Prod | Helium-argon lamp |
| CA921541A (en) * | 1970-03-03 | 1973-02-20 | Suoh Masatake | Small-sized fluorescent lamp |
| US3886393A (en) * | 1972-08-11 | 1975-05-27 | Owens Illinois Inc | Gas mixture for gas discharge device |
| US4032814A (en) * | 1974-08-19 | 1977-06-28 | Duro-Test Corporation | Fluorescent lamp with reduced wattage consumption |
| JPS53114279A (en) * | 1977-03-17 | 1978-10-05 | Matsushita Electronics Corp | Fluorescent lamp |
| DE2722694C2 (de) * | 1977-05-18 | 1985-01-10 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Quecksilberdampf-Niederdruckentladungslampe |
-
1978
- 1978-11-17 NL NL7811351A patent/NL7811351A/nl not_active Application Discontinuation
-
1979
- 1979-09-28 FR FR7924242A patent/FR2441920A1/fr active Granted
- 1979-11-13 DE DE19792945714 patent/DE2945714A1/de active Granted
- 1979-11-14 IT IT27282/79A patent/IT1125691B/it active
- 1979-11-14 GB GB7939378A patent/GB2042254B/en not_active Expired
- 1979-11-15 US US06/095,128 patent/US4277720A/en not_active Expired - Lifetime
- 1979-11-15 CA CA000339919A patent/CA1141419A/en not_active Expired
- 1979-11-16 BE BE0/198158A patent/BE880094A/fr not_active IP Right Cessation
- 1979-11-16 JP JP14788579A patent/JPS5572354A/ja active Pending
-
1987
- 1987-05-25 JP JP1987077432U patent/JPH0120764Y2/ja not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE29606857U1 (de) * | 1996-04-16 | 1998-01-29 | Weth, Gosbert, Dr.med. Dr.rer.nat., 95346 Stadtsteinach | Leuchtmittel für therapeutische Zwecke |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS62198658U (cg-RX-API-DMAC7.html) | 1987-12-17 |
| GB2042254A (en) | 1980-09-17 |
| US4277720A (en) | 1981-07-07 |
| IT7927282A0 (it) | 1979-11-14 |
| DE2945714A1 (de) | 1980-05-29 |
| NL7811351A (nl) | 1980-05-20 |
| GB2042254B (en) | 1983-02-16 |
| FR2441920A1 (fr) | 1980-06-13 |
| IT1125691B (it) | 1986-05-14 |
| CA1141419A (en) | 1983-02-15 |
| FR2441920B1 (cg-RX-API-DMAC7.html) | 1982-08-20 |
| BE880094A (fr) | 1980-05-16 |
| JPH0120764Y2 (cg-RX-API-DMAC7.html) | 1989-06-22 |
| JPS5572354A (en) | 1980-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0834905B1 (de) | Natriumhochdrucklampe kleiner Leistung | |
| DE10291427B4 (de) | Halogen-Metalldampflampe für einen Kraftfahrzeugscheinwerfer | |
| DE2815014C2 (de) | Hochdrucknatriumdampfentladungslampe | |
| DE1589171B1 (de) | Natriumdampflampe hoher intensitaet mit quecksilber | |
| DE10243867A1 (de) | Quecksilberfreie Bogenentladungsröhre für Entladungslampeneinheit | |
| DE10245000B4 (de) | Quecksilberfreie Lichtbogenröhre für Entladungslampeneinheit | |
| DE3110812C2 (cg-RX-API-DMAC7.html) | ||
| EP0736222A1 (de) | Halogenglühlampe | |
| DE2945714C2 (cg-RX-API-DMAC7.html) | ||
| DE69032825T2 (de) | Niederdruckedelgasentladungslampe | |
| DE2028781A1 (de) | Hochdruck-Quecksilberdampf Jodid-Entladungslampe | |
| DE68915506T2 (de) | Hochdrucknatriumentladungslampe. | |
| DE3110818C2 (cg-RX-API-DMAC7.html) | ||
| DE1804545A1 (de) | Quecksilber-Niederdrucklampe mit einer Anordnung fuer die Steuerung des Quecksilberdampfdruckes | |
| EP0347529B1 (de) | Verfahren zum Betreiben einer Natriumdampf-Hochdrucklampe | |
| DE69608089T2 (de) | Metallhalogenidlampe | |
| DE69201339T2 (de) | Metalldampfentladungslampe. | |
| DE2729052A1 (de) | Verfahren zum betreiben von gasentladungslampen | |
| DE19632220B4 (de) | Elektrodenlose Entladungslampe | |
| DE3632430A1 (de) | Magnesiumdampf-entladungslampe | |
| DE2722694A1 (de) | Quecksilberdampf-niederdruckentladungslampe | |
| DE69814288T2 (de) | Metallhalogenidlampe | |
| DE3024012C2 (cg-RX-API-DMAC7.html) | ||
| DE1639113B1 (de) | Dampfentladungslampe fuer photochemische Zwecke | |
| DE69214631T2 (de) | Negativglimmentladungslampe mit drahtanode |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: PHILIPS ELECTRONICS N.V., EINDHOVEN, NL |
|
| 8339 | Ceased/non-payment of the annual fee |