DE2840771A1 - Hochdruckentladungslampe mit metallhalogeniden - Google Patents
Hochdruckentladungslampe mit metallhalogenidenInfo
- Publication number
- DE2840771A1 DE2840771A1 DE19782840771 DE2840771A DE2840771A1 DE 2840771 A1 DE2840771 A1 DE 2840771A1 DE 19782840771 DE19782840771 DE 19782840771 DE 2840771 A DE2840771 A DE 2840771A DE 2840771 A1 DE2840771 A1 DE 2840771A1
- Authority
- DE
- Germany
- Prior art keywords
- discharge vessel
- lamp
- discharge lamp
- discharge
- pressure
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 229910052751 metal Inorganic materials 0.000 title claims description 4
- 239000002184 metal Substances 0.000 title claims description 4
- 229910001507 metal halide Inorganic materials 0.000 claims description 7
- 150000005309 metal halides Chemical class 0.000 claims description 7
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 239000011630 iodine Substances 0.000 claims description 6
- 238000009825 accumulation Methods 0.000 claims description 5
- 238000005530 etching Methods 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 238000005338 heat storage Methods 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 238000009877 rendering Methods 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 238000007792 addition Methods 0.000 claims description 2
- -1 sodium halide Chemical class 0.000 claims description 2
- 150000004694 iodide salts Chemical class 0.000 claims 2
- 150000001649 bromium compounds Chemical class 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910003437 indium oxide Inorganic materials 0.000 description 1
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000012858 resilient material Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Inorganic materials [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/04—Electrodes; Screens; Shields
- H01J61/10—Shields, screens, or guides for influencing the discharge
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/125—Selection of substances for gas fillings; Specified operating pressure or temperature having an halogenide as principal component
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamp (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782840771 DE2840771A1 (de) | 1978-09-19 | 1978-09-19 | Hochdruckentladungslampe mit metallhalogeniden |
| FR7922188A FR2437063A2 (fr) | 1978-09-19 | 1979-09-05 | Lampe a decharge a haute pression et a halogenures |
| JP11887479A JPS5543794A (en) | 1978-09-19 | 1979-09-18 | High voltage discharge lamp |
| IT68831/79A IT1165228B (it) | 1978-09-19 | 1979-09-18 | Lampada a scarica ad alta pressione con alogenuri metallici |
| GB7932259A GB2035679A (en) | 1978-09-19 | 1979-09-18 | High pressure metal vapour discharge lamps |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782840771 DE2840771A1 (de) | 1978-09-19 | 1978-09-19 | Hochdruckentladungslampe mit metallhalogeniden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2840771A1 true DE2840771A1 (de) | 1980-03-27 |
| DE2840771C2 DE2840771C2 (it) | 1988-03-24 |
Family
ID=6049862
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782840771 Granted DE2840771A1 (de) | 1978-09-19 | 1978-09-19 | Hochdruckentladungslampe mit metallhalogeniden |
Country Status (5)
| Country | Link |
|---|---|
| JP (1) | JPS5543794A (it) |
| DE (1) | DE2840771A1 (it) |
| FR (1) | FR2437063A2 (it) |
| GB (1) | GB2035679A (it) |
| IT (1) | IT1165228B (it) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3242752A1 (de) * | 1982-01-19 | 1983-09-08 | Jenoptik Jena Gmbh, Ddr 6900 Jena | Elektrodenstabilisierte hochdruckentladungslampe mit leuchtzusaetzen |
| US4935660A (en) * | 1988-03-22 | 1990-06-19 | Patent Treuhand Gesellschaft Fur Elektrische Gluhlampen M.B.H. | Single-ended compact halogen discharge lamp and reflector combination |
| EP0492726A1 (en) * | 1990-12-27 | 1992-07-01 | Koninklijke Philips Electronics N.V. | High pressure sodium reflector lamp |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR8205196A (pt) * | 1981-09-03 | 1983-08-16 | Gen Electric | Lampada de metal alcalino de alta pressao com eficacia aperfeicoada |
| US4467238A (en) * | 1981-09-03 | 1984-08-21 | General Electric Company | High-pressure sodium lamp with improved IR reflector |
| EP0101519B1 (en) * | 1982-02-10 | 1986-12-30 | Mitsubishi Denki Kabushiki Kaisha | Metal vapor discharge lamp |
| US4580989A (en) * | 1982-08-18 | 1986-04-08 | Gte Products Corporation | Metal halide arc discharge lamp with means for suppressing convection currents within the outer envelope and methods of operating and constructing same |
| US4499396A (en) * | 1982-08-18 | 1985-02-12 | Gte Products Corporation | Metal halide arc discharge lamp with means for suppressing convection currents within the outer envelope and methods of operating same |
| DE3321479A1 (de) * | 1983-06-14 | 1984-12-20 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe |
| JPS60221949A (ja) * | 1985-04-01 | 1985-11-06 | Hitachi Ltd | メタルハライドランプ |
| US4791334A (en) * | 1987-05-07 | 1988-12-13 | Gte Products Corporation | Metal-halide lamp having heat redistribution means |
| US5136208A (en) * | 1989-02-07 | 1992-08-04 | Toshiba Lighting & Technology Corporation | Metal halide lamp maintaining a high lumen maintenance factor over an extended operation period |
| EP0682356B1 (en) * | 1994-05-12 | 2000-01-26 | Iwasaki Electric Co., Ltd. | Metal halide lamp |
| EP1649491A2 (en) * | 2003-07-22 | 2006-04-26 | Philips Intellectual Property & Standards GmbH | High-pressure discharge lamp |
| CN105240712B (zh) * | 2015-11-06 | 2017-05-24 | 武汉九鼎光电子科技有限公司 | 一种泛光聚光可调式组合配光照明灯泡及其制造方法 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2116720A (en) * | 1935-05-14 | 1938-05-10 | Gen Electric | Electric discharge device |
| DE2619674A1 (de) * | 1976-05-04 | 1977-11-24 | Patra Patent Treuhand | Halogen-metalldampfentladungslampe |
| DE2655167C2 (de) * | 1976-12-06 | 1986-12-18 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe mit Metallhalogeniden |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL269925A (it) * | 1961-10-04 | |||
| GB1541437A (en) * | 1975-02-13 | 1979-02-28 | Thorn Electrical Ind Ltd | Electrical discharge lamp |
-
1978
- 1978-09-19 DE DE19782840771 patent/DE2840771A1/de active Granted
-
1979
- 1979-09-05 FR FR7922188A patent/FR2437063A2/fr active Granted
- 1979-09-18 JP JP11887479A patent/JPS5543794A/ja active Pending
- 1979-09-18 GB GB7932259A patent/GB2035679A/en not_active Withdrawn
- 1979-09-18 IT IT68831/79A patent/IT1165228B/it active
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2116720A (en) * | 1935-05-14 | 1938-05-10 | Gen Electric | Electric discharge device |
| DE2619674A1 (de) * | 1976-05-04 | 1977-11-24 | Patra Patent Treuhand | Halogen-metalldampfentladungslampe |
| DE2655167C2 (de) * | 1976-12-06 | 1986-12-18 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe mit Metallhalogeniden |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3242752A1 (de) * | 1982-01-19 | 1983-09-08 | Jenoptik Jena Gmbh, Ddr 6900 Jena | Elektrodenstabilisierte hochdruckentladungslampe mit leuchtzusaetzen |
| US4935660A (en) * | 1988-03-22 | 1990-06-19 | Patent Treuhand Gesellschaft Fur Elektrische Gluhlampen M.B.H. | Single-ended compact halogen discharge lamp and reflector combination |
| EP0492726A1 (en) * | 1990-12-27 | 1992-07-01 | Koninklijke Philips Electronics N.V. | High pressure sodium reflector lamp |
Also Published As
| Publication number | Publication date |
|---|---|
| IT1165228B (it) | 1987-04-22 |
| IT7968831A0 (it) | 1979-09-18 |
| DE2840771C2 (it) | 1988-03-24 |
| FR2437063B2 (it) | 1983-04-15 |
| GB2035679A (en) | 1980-06-18 |
| JPS5543794A (en) | 1980-03-27 |
| FR2437063A2 (fr) | 1980-04-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2840771A1 (de) | Hochdruckentladungslampe mit metallhalogeniden | |
| DE2655167C2 (de) | Hochdruckentladungslampe mit Metallhalogeniden | |
| DE1940539A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogenidzusatz | |
| DE2455277C2 (de) | Hochdruck-Zinnhalogenidentladungslampe | |
| DE19609328A1 (de) | Elliptischer Mantel für elektrische Lampen | |
| DE69228357T2 (de) | Lichtbogenkammer für eine Lampe die eine quecksilberfreie Füllung enthält | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE1076814B (de) | Entladungslampe | |
| DE4433040A1 (de) | Elektrodenlose Entladungslampe hoher Intensität | |
| DE2619674C2 (de) | Halogen-Metalldampfentladungslampe | |
| DE2616893A1 (de) | Bestrahlungslampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE8601283U1 (de) | Kraftfahrzeugentladungslampe | |
| DE2225308A1 (de) | Hochdruckgasentladungslampe | |
| DE1489445B1 (de) | Elektrode fuer eine Quecksilberdampfhochdrucklampe mit Halogenidfuellung | |
| DE2106447A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE7827876U1 (de) | Hochdruckentladungslampe mit metallhalogeniden | |
| DE2134133C3 (de) | Halogen-Glühlampe | |
| DE2114804A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogenidzusatz | |
| DE2535922A1 (de) | Quecksilberdampf-hochdruckentladungslampe fuer horizontale brennlage | |
| DE2846816A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE3346130A1 (de) | Entladungslampe hoher intensitaet mit gesteuerter radialer verteilung | |
| DE1994024U (de) | Kurzbogen-quecksilberdampf - entladungslampe. | |
| DE1957978C3 (de) | Natriumdampfhochdruck- oder Halogeiunetalldampfentladungslampe | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2655167 Format of ref document f/p: P |
|
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2655167 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |