DE2840119C2 - - Google Patents
Info
- Publication number
- DE2840119C2 DE2840119C2 DE2840119A DE2840119A DE2840119C2 DE 2840119 C2 DE2840119 C2 DE 2840119C2 DE 2840119 A DE2840119 A DE 2840119A DE 2840119 A DE2840119 A DE 2840119A DE 2840119 C2 DE2840119 C2 DE 2840119C2
- Authority
- DE
- Germany
- Prior art keywords
- group
- phenyl
- formula
- amino
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 carboxy, carbamoyl Chemical group 0.000 claims description 91
- 125000000217 alkyl group Chemical group 0.000 claims description 38
- 150000001875 compounds Chemical class 0.000 claims description 33
- 238000005859 coupling reaction Methods 0.000 claims description 28
- 238000004043 dyeing Methods 0.000 claims description 27
- 230000008878 coupling Effects 0.000 claims description 26
- 238000010168 coupling process Methods 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 24
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 22
- 125000003545 alkoxy group Chemical group 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 18
- 125000000623 heterocyclic group Chemical group 0.000 claims description 16
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 239000002657 fibrous material Substances 0.000 claims description 14
- 125000001424 substituent group Chemical group 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 125000001931 aliphatic group Chemical group 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 claims description 10
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 9
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 8
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 8
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 8
- 239000000835 fiber Substances 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 125000003282 alkyl amino group Chemical group 0.000 claims description 6
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 6
- 125000005521 carbonamide group Chemical group 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- 235000010288 sodium nitrite Nutrition 0.000 claims description 5
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 5
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 150000001989 diazonium salts Chemical class 0.000 claims description 4
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 2
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 claims description 2
- APOQJOYBYOTQRN-UHFFFAOYSA-N 2-nitramido-2-oxoacetic acid Chemical compound [N+](=O)([O-])NC(=O)C(=O)O APOQJOYBYOTQRN-UHFFFAOYSA-N 0.000 claims description 2
- WREXGNDJZBDHPT-UHFFFAOYSA-N 5-naphthalen-1-yl-1h-pyrazol-3-amine Chemical compound N1N=C(N)C=C1C1=CC=CC2=CC=CC=C12 WREXGNDJZBDHPT-UHFFFAOYSA-N 0.000 claims description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 150000008049 diazo compounds Chemical class 0.000 claims description 2
- 239000012954 diazonium Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- LKVXQCKDIYHFGZ-UHFFFAOYSA-N n-naphthalen-1-yl-3-oxobutanamide Chemical compound C1=CC=C2C(NC(=O)CC(=O)C)=CC=CC2=C1 LKVXQCKDIYHFGZ-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 150000008064 anhydrides Chemical class 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 239000000460 chlorine Substances 0.000 description 20
- 229910052801 chlorine Inorganic materials 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 18
- 239000000975 dye Substances 0.000 description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 17
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- 150000003254 radicals Chemical class 0.000 description 14
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 9
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 9
- 229910000029 sodium carbonate Inorganic materials 0.000 description 9
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 229920000742 Cotton Polymers 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 239000003086 colorant Substances 0.000 description 6
- 210000002268 wool Anatomy 0.000 description 6
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 5
- DKHPLIFEGBASME-UHFFFAOYSA-N OS(=O)(=O)C1=CC(N)=CC=C1C1=C(N)C(S(O)(=O)=O)=C(N)C2=C1C(=O)C1=CC=CC=C1C2=O Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C1=C(N)C(S(O)(=O)=O)=C(N)C2=C1C(=O)C1=CC=CC=C1C2=O DKHPLIFEGBASME-UHFFFAOYSA-N 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- VOWZNBNDMFLQGM-UHFFFAOYSA-N 2,5-dimethylaniline Chemical compound CC1=CC=C(C)C(N)=C1 VOWZNBNDMFLQGM-UHFFFAOYSA-N 0.000 description 4
- GKTWIIVEUYLSCS-UHFFFAOYSA-N 5-bromo-2,4,6-trichloropyrimidine Chemical compound ClC1=NC(Cl)=C(Br)C(Cl)=N1 GKTWIIVEUYLSCS-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 125000000664 diazo group Chemical class [N-]=[N+]=[*] 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- RWJZUKGDCZBROA-UHFFFAOYSA-N 1,4,4-trifluorocyclobutene Chemical compound FC1=CCC1(F)F RWJZUKGDCZBROA-UHFFFAOYSA-N 0.000 description 3
- UEDDCBVNWFONCB-UHFFFAOYSA-N 2,4-dibromopyrimidine-5-carboxylic acid Chemical compound OC(=O)C1=CN=C(Br)N=C1Br UEDDCBVNWFONCB-UHFFFAOYSA-N 0.000 description 3
- 229920003043 Cellulose fiber Polymers 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000004104 aryloxy group Chemical group 0.000 description 3
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 239000004627 regenerated cellulose Substances 0.000 description 3
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 125000001302 tertiary amino group Chemical group 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- AYPIRKONZQARGN-UHFFFAOYSA-N 1,4-dichloro-2h-pyrimidine Chemical compound ClN1CN=C(Cl)C=C1 AYPIRKONZQARGN-UHFFFAOYSA-N 0.000 description 2
- FFIYVIOYHWWVFY-UHFFFAOYSA-N 2,4,5,6-tetrachloro-1h-pyridazine Chemical compound ClN1NC(Cl)=C(Cl)C(Cl)=C1 FFIYVIOYHWWVFY-UHFFFAOYSA-N 0.000 description 2
- KZMWBUVUQLGBBP-UHFFFAOYSA-N 2,4,5,6-tetrafluoropyrimidine Chemical compound FC1=NC(F)=C(F)C(F)=N1 KZMWBUVUQLGBBP-UHFFFAOYSA-N 0.000 description 2
- LYBDHGMSPQBSNW-UHFFFAOYSA-N 2,4,5-trifluoropyrimidine Chemical compound FC1=NC=C(F)C(F)=N1 LYBDHGMSPQBSNW-UHFFFAOYSA-N 0.000 description 2
- QGFWFWSBFMRDNP-UHFFFAOYSA-N 2,4,6-trichloro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(Cl)N=C(Cl)N=C1Cl QGFWFWSBFMRDNP-UHFFFAOYSA-N 0.000 description 2
- IAJCAZVXGKGAQK-UHFFFAOYSA-N 2,4,6-trichloropyrimidine-5-carbonitrile Chemical compound ClC1=NC(Cl)=C(C#N)C(Cl)=N1 IAJCAZVXGKGAQK-UHFFFAOYSA-N 0.000 description 2
- RXAURVMWXQUURQ-UHFFFAOYSA-N 2,4,6-tris(methylsulfonyl)-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 RXAURVMWXQUURQ-UHFFFAOYSA-N 0.000 description 2
- UYIYVVDCJJPRAT-UHFFFAOYSA-N 2,4-dibromo-5-(bromomethyl)-6-methylpyrimidine Chemical compound CC1=NC(Br)=NC(Br)=C1CBr UYIYVVDCJJPRAT-UHFFFAOYSA-N 0.000 description 2
- NBCOZXBHPKSFSA-UHFFFAOYSA-N 2,4-dichloro-6-methyl-5-nitropyrimidine Chemical compound CC1=NC(Cl)=NC(Cl)=C1[N+]([O-])=O NBCOZXBHPKSFSA-UHFFFAOYSA-N 0.000 description 2
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 2
- IVIHUCXXDVVSBH-UHFFFAOYSA-N 2,4-dichloropyrimidine-5-carboxylic acid Chemical compound OC(=O)C1=CN=C(Cl)N=C1Cl IVIHUCXXDVVSBH-UHFFFAOYSA-N 0.000 description 2
- BHKZJIBMUGCBNJ-UHFFFAOYSA-N 2,4-dichloropyrimidine-5-sulfonic acid Chemical compound OS(=O)(=O)C1=CN=C(Cl)N=C1Cl BHKZJIBMUGCBNJ-UHFFFAOYSA-N 0.000 description 2
- HTEYWULAUMDASA-UHFFFAOYSA-N 2,6-bis(methylsulfonyl)pyridine-4-carboxylic acid Chemical compound CS(=O)(=O)C1=CC(C(O)=O)=CC(S(C)(=O)=O)=N1 HTEYWULAUMDASA-UHFFFAOYSA-N 0.000 description 2
- DPYKMFHQTULSCQ-UHFFFAOYSA-N 2,6-dibromopyrimidine-4-carboxylic acid Chemical compound OC(=O)C1=CC(Br)=NC(Br)=N1 DPYKMFHQTULSCQ-UHFFFAOYSA-N 0.000 description 2
- MOXUTXQEKYPKKS-UHFFFAOYSA-N 2,6-dichloropyrimidine-4-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=NC(Cl)=N1 MOXUTXQEKYPKKS-UHFFFAOYSA-N 0.000 description 2
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical compound CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- OBCQPUSRAUNDAB-UHFFFAOYSA-N 2-bromoprop-2-enoyl chloride Chemical compound ClC(=O)C(Br)=C OBCQPUSRAUNDAB-UHFFFAOYSA-N 0.000 description 2
- MLPVBIWIRCKMJV-UHFFFAOYSA-N 2-ethylaniline Chemical compound CCC1=CC=CC=C1N MLPVBIWIRCKMJV-UHFFFAOYSA-N 0.000 description 2
- FRCXPDWDMAYSCE-UHFFFAOYSA-N 3,6-dichloropyridazine-4-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=NN=C1Cl FRCXPDWDMAYSCE-UHFFFAOYSA-N 0.000 description 2
- VFJVVDICAXPJFQ-UHFFFAOYSA-N 3-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid Chemical compound OC(=O)CCN1N=CC(Cl)=C(Cl)C1=O VFJVVDICAXPJFQ-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- NZXOCWXWWQNPOF-UHFFFAOYSA-N 4,5-dichloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1Cl NZXOCWXWWQNPOF-UHFFFAOYSA-N 0.000 description 2
- UYCCTQPHCSKTTN-UHFFFAOYSA-N 4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=CC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 UYCCTQPHCSKTTN-UHFFFAOYSA-N 0.000 description 2
- GOYNRDSJTYLXBU-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Cl)C(F)=N1 GOYNRDSJTYLXBU-UHFFFAOYSA-N 0.000 description 2
- DQNOKARDYNQFLN-UHFFFAOYSA-N 5-chloro-4,6-difluoropyrimidine Chemical compound FC1=NC=NC(F)=C1Cl DQNOKARDYNQFLN-UHFFFAOYSA-N 0.000 description 2
- FCMIDLUGAKOJNR-UHFFFAOYSA-N 5-chloro-4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=C1Cl FCMIDLUGAKOJNR-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- RATHONVFTIGEQV-UHFFFAOYSA-N [C].ClC1=NC2=CC=CC=C2C(=N1)Cl Chemical compound [C].ClC1=NC2=CC=CC=C2C(=N1)Cl RATHONVFTIGEQV-UHFFFAOYSA-N 0.000 description 2
- RCKSMQVNJRDVQU-UHFFFAOYSA-N [C].ClC1=NC2=CC=CC=C2N=C1Cl Chemical compound [C].ClC1=NC2=CC=CC=C2N=C1Cl RCKSMQVNJRDVQU-UHFFFAOYSA-N 0.000 description 2
- MXMILWNKCHGGEZ-UHFFFAOYSA-N [C].ClC1=NN=C(C2=CC=CC=C12)Cl Chemical compound [C].ClC1=NN=C(C2=CC=CC=C12)Cl MXMILWNKCHGGEZ-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000985 reactive dye Substances 0.000 description 2
- 235000015424 sodium Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 230000001180 sulfating effect Effects 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- ZNXSFVXZQBETRJ-UHFFFAOYSA-N (3-aminophenyl)urea Chemical compound NC(=O)NC1=CC=CC(N)=C1 ZNXSFVXZQBETRJ-UHFFFAOYSA-N 0.000 description 1
- ZQHJVIHCDHJVII-OWOJBTEDSA-N (e)-2-chlorobut-2-enedioic acid Chemical compound OC(=O)\C=C(\Cl)C(O)=O ZQHJVIHCDHJVII-OWOJBTEDSA-N 0.000 description 1
- KBQPIDSATRHKJR-OWOJBTEDSA-N (e)-4-chlorobut-2-enoyl chloride Chemical compound ClC\C=C\C(Cl)=O KBQPIDSATRHKJR-OWOJBTEDSA-N 0.000 description 1
- XOXSGPSRBHNAOK-UHFFFAOYSA-N 1,3-diamino-4-(4-amino-3-sulfophenyl)-9,10-dioxoanthracene-2-sulfonic acid Chemical compound NC1=C(C(=C(C=2C(C3=CC=CC=C3C(C12)=O)=O)C1=CC(=C(C=C1)N)S(=O)(=O)O)N)S(=O)(=O)O XOXSGPSRBHNAOK-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- IHCXLFVGVATAND-UHFFFAOYSA-N 1,4-dichloro-2h-phthalazine-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)(Cl)NN=C(Cl)C2=C1 IHCXLFVGVATAND-UHFFFAOYSA-N 0.000 description 1
- VWGNFIQXBYRDCH-UHFFFAOYSA-N 1,4-diethoxybenzene Chemical compound CCOC1=CC=C(OCC)C=C1 VWGNFIQXBYRDCH-UHFFFAOYSA-N 0.000 description 1
- WSYWQFNIYCGPFK-UHFFFAOYSA-N 1-(2,4,6-trichloropyrimidin-5-yl)ethanone Chemical compound CC(=O)C1=C(Cl)N=C(Cl)N=C1Cl WSYWQFNIYCGPFK-UHFFFAOYSA-N 0.000 description 1
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 1
- XBGXIWFUHLXTTR-UHFFFAOYSA-N 1-amino-4-bromo-9,10-dioxo-2h-anthracene-1-sulfonic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)(S(O)(=O)=O)CC=C2Br XBGXIWFUHLXTTR-UHFFFAOYSA-N 0.000 description 1
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 1
- KESAPMAPWGLLQL-UHFFFAOYSA-N 2,2,3,3-tetrafluorocyclobutane-1-carbonyl chloride Chemical compound FC1(F)CC(C(Cl)=O)C1(F)F KESAPMAPWGLLQL-UHFFFAOYSA-N 0.000 description 1
- VGVRPFIJEJYOFN-UHFFFAOYSA-N 2,3,4,6-tetrachlorophenol Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1Cl VGVRPFIJEJYOFN-UHFFFAOYSA-N 0.000 description 1
- DEGITALZYFYBSL-UHFFFAOYSA-N 2,3-dichloro-1h-quinoxaline-2-carboxylic acid Chemical compound C1=CC=C2N=C(Cl)C(C(=O)O)(Cl)NC2=C1 DEGITALZYFYBSL-UHFFFAOYSA-N 0.000 description 1
- FYSHPROTETTWKB-UHFFFAOYSA-N 2,4,5,6-tetrabromopyrimidine Chemical compound BrC1=NC(Br)=C(Br)C(Br)=N1 FYSHPROTETTWKB-UHFFFAOYSA-N 0.000 description 1
- VHYBUUMUUNCHCK-UHFFFAOYSA-N 2,4,6-tribromo-1,3,5-triazine Chemical compound BrC1=NC(Br)=NC(Br)=N1 VHYBUUMUUNCHCK-UHFFFAOYSA-N 0.000 description 1
- XGHDYDDFXRLPLQ-UHFFFAOYSA-N 2,4-dibromo-1,3,5-triazine Chemical compound BrC1=NC=NC(Br)=N1 XGHDYDDFXRLPLQ-UHFFFAOYSA-N 0.000 description 1
- OASGOHGVLUSVBZ-UHFFFAOYSA-N 2,4-dibromo-5-(bromomethyl)pyrimidine Chemical compound BrCC1=CN=C(Br)N=C1Br OASGOHGVLUSVBZ-UHFFFAOYSA-N 0.000 description 1
- OMRXVBREYFZQHU-UHFFFAOYSA-N 2,4-dichloro-1,3,5-triazine Chemical compound ClC1=NC=NC(Cl)=N1 OMRXVBREYFZQHU-UHFFFAOYSA-N 0.000 description 1
- LGHNAWJLGALXRN-UHFFFAOYSA-N 2,4-dichloro-1H-quinazoline-2-carboxylic acid Chemical compound C1=CC=C2C(Cl)=NC(C(=O)O)(Cl)NC2=C1 LGHNAWJLGALXRN-UHFFFAOYSA-N 0.000 description 1
- XPHHRYQLVDQYDR-UHFFFAOYSA-N 2,4-dichloro-5-(chloromethyl)-6-methylpyrimidine Chemical compound CC1=NC(Cl)=NC(Cl)=C1CCl XPHHRYQLVDQYDR-UHFFFAOYSA-N 0.000 description 1
- HSYWYCGJNMVGKA-UHFFFAOYSA-N 2,4-dichloro-6-(trichloromethyl)pyrimidine Chemical compound ClC1=CC(C(Cl)(Cl)Cl)=NC(Cl)=N1 HSYWYCGJNMVGKA-UHFFFAOYSA-N 0.000 description 1
- DZTIFMWYYHCREC-UHFFFAOYSA-N 2,4-dichloropyrimidine-5-carbonyl chloride Chemical compound ClC(=O)C1=CN=C(Cl)N=C1Cl DZTIFMWYYHCREC-UHFFFAOYSA-N 0.000 description 1
- WHZJEWWPCJZGOC-UHFFFAOYSA-N 2,4-difluoro-1,3,5-triazine Chemical compound FC1=NC=NC(F)=N1 WHZJEWWPCJZGOC-UHFFFAOYSA-N 0.000 description 1
- YSKSNCNLMXAQLP-UHFFFAOYSA-N 2,6-bis(methylsulfonyl)pyridine-4-carbonyl chloride Chemical compound CS(=O)(=O)C1=CC(C(Cl)=O)=CC(S(C)(=O)=O)=N1 YSKSNCNLMXAQLP-UHFFFAOYSA-N 0.000 description 1
- YDQRUSXGXMVAHN-UHFFFAOYSA-N 2,6-dibromopyrimidine-4-carboxamide Chemical class NC(=O)C1=CC(Br)=NC(Br)=N1 YDQRUSXGXMVAHN-UHFFFAOYSA-N 0.000 description 1
- NUYJCMGJLNVOML-UHFFFAOYSA-N 2,6-dichloropyrimidine-4-carbonyl chloride Chemical compound ClC(=O)C1=CC(Cl)=NC(Cl)=N1 NUYJCMGJLNVOML-UHFFFAOYSA-N 0.000 description 1
- DXKBANUVKQKRTI-UHFFFAOYSA-N 2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoyl chloride Chemical compound ClC=1C=NN(C(C=1Cl)=O)C(C(=O)Cl)C DXKBANUVKQKRTI-UHFFFAOYSA-N 0.000 description 1
- KNSMESOQTNXAHP-UHFFFAOYSA-N 2-amino-5-(2,4-diamino-9,10-dioxo-3-sulfoanthracen-1-yl)benzene-1,4-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(N)=CC(S(O)(=O)=O)=C1C1=C(N)C(S(O)(=O)=O)=C(N)C2=C1C(=O)C1=CC=CC=C1C2=O KNSMESOQTNXAHP-UHFFFAOYSA-N 0.000 description 1
- SYZRZLUNWVNNNV-UHFFFAOYSA-N 2-bromoacetyl chloride Chemical compound ClC(=O)CBr SYZRZLUNWVNNNV-UHFFFAOYSA-N 0.000 description 1
- NFIGVDJXMRCMOA-UHFFFAOYSA-N 2-chloro-1,3-benzothiazole-6-carbonyl chloride Chemical compound ClC(=O)C1=CC=C2N=C(Cl)SC2=C1 NFIGVDJXMRCMOA-UHFFFAOYSA-N 0.000 description 1
- QLAKWSXVXQRGDB-UHFFFAOYSA-N 2-chloro-1,3-benzothiazole-6-carboxylic acid Chemical compound OC(=O)C1=CC=C2N=C(Cl)SC2=C1 QLAKWSXVXQRGDB-UHFFFAOYSA-N 0.000 description 1
- IVIONYSRTCLTPZ-UHFFFAOYSA-N 2-chloro-1,3-benzothiazole-6-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2N=C(Cl)SC2=C1 IVIONYSRTCLTPZ-UHFFFAOYSA-N 0.000 description 1
- RLPMZVSKBOCSMU-UHFFFAOYSA-N 2-chloro-1,3-benzothiazole-6-sulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=C2SC(Cl)=NC2=C1 RLPMZVSKBOCSMU-UHFFFAOYSA-N 0.000 description 1
- WXOKMMPZBQJDNF-UHFFFAOYSA-N 2-chloro-3h-1,3-benzoxazole-2-carbonyl chloride Chemical class C1=CC=C2OC(C(=O)Cl)(Cl)NC2=C1 WXOKMMPZBQJDNF-UHFFFAOYSA-N 0.000 description 1
- VKPPFDPXZWFDFA-UHFFFAOYSA-N 2-chloroethanamine Chemical compound NCCCl VKPPFDPXZWFDFA-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- AEIOZWYBDBVCGW-UHFFFAOYSA-N 2-tert-butylaniline Chemical compound CC(C)(C)C1=CC=CC=C1N AEIOZWYBDBVCGW-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- UGKIAJNNQAMSHX-UHFFFAOYSA-N 3,6-dichloropyridazine-4-carbonyl chloride Chemical compound ClC(=O)C1=CC(Cl)=NN=C1Cl UGKIAJNNQAMSHX-UHFFFAOYSA-N 0.000 description 1
- DNPFVNDXMLQWQB-UHFFFAOYSA-N 3-(2,2,3,3-tetrafluorocyclobutyl)prop-2-enoyl chloride Chemical compound FC1(F)CC(C=CC(Cl)=O)C1(F)F DNPFVNDXMLQWQB-UHFFFAOYSA-N 0.000 description 1
- RMKDFOIZRBERJZ-UHFFFAOYSA-N 3-(2-chloroethylsulfonyl)benzoyl chloride Chemical compound ClCCS(=O)(=O)C1=CC=CC(C(Cl)=O)=C1 RMKDFOIZRBERJZ-UHFFFAOYSA-N 0.000 description 1
- VUUHXRVVDUAGOL-UHFFFAOYSA-N 3-(3-methylanilino)propanenitrile Chemical compound CC1=CC=CC(NCCC#N)=C1 VUUHXRVVDUAGOL-UHFFFAOYSA-N 0.000 description 1
- UNJNPBSWRQIBGH-UHFFFAOYSA-N 3-(4-aminophenyl)propanenitrile Chemical compound NC1=CC=C(CCC#N)C=C1 UNJNPBSWRQIBGH-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- CXJAFLQWMOMYOW-UHFFFAOYSA-N 3-chlorofuran-2,5-dione Chemical compound ClC1=CC(=O)OC1=O CXJAFLQWMOMYOW-UHFFFAOYSA-N 0.000 description 1
- WEZAHYDFZNTGKE-UHFFFAOYSA-N 3-ethoxyaniline Chemical compound CCOC1=CC=CC(N)=C1 WEZAHYDFZNTGKE-UHFFFAOYSA-N 0.000 description 1
- AMKPQMFZCBTTAT-UHFFFAOYSA-N 3-ethylaniline Chemical compound CCC1=CC=CC(N)=C1 AMKPQMFZCBTTAT-UHFFFAOYSA-N 0.000 description 1
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 1
- ZUQOBHTUMCEQBG-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 ZUQOBHTUMCEQBG-UHFFFAOYSA-N 0.000 description 1
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 1
- ALVPDCHBQRCKRQ-UHFFFAOYSA-N 4-chloro-3,5-dinitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1 ALVPDCHBQRCKRQ-UHFFFAOYSA-N 0.000 description 1
- RPKWNMFDAOACCX-UHFFFAOYSA-N 4-chloro-3-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 RPKWNMFDAOACCX-UHFFFAOYSA-N 0.000 description 1
- OLOLDTJCNAOMQJ-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=CC(Cl)=NC(S(C)(=O)=O)=N1 OLOLDTJCNAOMQJ-UHFFFAOYSA-N 0.000 description 1
- KAXXAAPAQUSNTN-UHFFFAOYSA-N 5-(bromomethyl)-2,4-dichloropyrimidine Chemical compound ClC1=NC=C(CBr)C(Cl)=N1 KAXXAAPAQUSNTN-UHFFFAOYSA-N 0.000 description 1
- IZNPFDIKQHGNSK-UHFFFAOYSA-N 5-amino-6-ethoxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=C(N)C(OCC)=CC=C21 IZNPFDIKQHGNSK-UHFFFAOYSA-N 0.000 description 1
- OXQJOAGKNHVOAI-UHFFFAOYSA-N 5-amino-6-methoxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=C(N)C(OC)=CC=C21 OXQJOAGKNHVOAI-UHFFFAOYSA-N 0.000 description 1
- UWPJYQYRSWYIGZ-UHFFFAOYSA-N 5-aminonaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(N)=CC=CC2=C1 UWPJYQYRSWYIGZ-UHFFFAOYSA-N 0.000 description 1
- UMDNRKCXSUJMCY-UHFFFAOYSA-N 5-methyl-4-phenyl-1h-pyrazol-3-amine Chemical compound N1N=C(N)C(C=2C=CC=CC=2)=C1C UMDNRKCXSUJMCY-UHFFFAOYSA-N 0.000 description 1
- HBZVNWNSRNTWPS-UHFFFAOYSA-N 6-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(N)=CC=C21 HBZVNWNSRNTWPS-UHFFFAOYSA-N 0.000 description 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- QEZZCWMQXHXAFG-UHFFFAOYSA-N 8-aminonaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=CC=CC2=C1 QEZZCWMQXHXAFG-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- SUZRRICLUFMAQD-UHFFFAOYSA-N N-Methyltaurine Chemical compound CNCCS(O)(=O)=O SUZRRICLUFMAQD-UHFFFAOYSA-N 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- OCXRSJGVPRBIDH-UHFFFAOYSA-N [C].ClC=1SC2=C(N1)C=CC=C2 Chemical compound [C].ClC=1SC2=C(N1)C=CC=C2 OCXRSJGVPRBIDH-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- WNNBGLYZPXMVJG-UHFFFAOYSA-N amino(phenyl)sulfamic acid Chemical compound OS(=O)(=O)N(N)C1=CC=CC=C1 WNNBGLYZPXMVJG-UHFFFAOYSA-N 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- QKZIVVMOMKTVIK-UHFFFAOYSA-N anilinomethanesulfonic acid Chemical compound OS(=O)(=O)CNC1=CC=CC=C1 QKZIVVMOMKTVIK-UHFFFAOYSA-N 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- VSANMHWDSONVEE-UHFFFAOYSA-N carbyl sulfate Chemical compound O=S1(=O)CCOS(=O)(=O)O1 VSANMHWDSONVEE-UHFFFAOYSA-N 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- VCUTZKXVJISYPQ-UHFFFAOYSA-N ethyl 2,6-dibromopyrimidine-4-carboxylate Chemical compound CCOC(=O)C1=CC(Br)=NC(Br)=N1 VCUTZKXVJISYPQ-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 210000004209 hair Anatomy 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 229940018564 m-phenylenediamine Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- SQYUJKVKVFILNB-UHFFFAOYSA-N methyl 2-amino-4-[(2,5-dichlorophenyl)carbamoyl]benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1C(=O)NC1=CC(Cl)=CC=C1Cl SQYUJKVKVFILNB-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- SJWQCBCAGCEWCV-UHFFFAOYSA-N n-(3-amino-4-methoxyphenyl)acetamide Chemical compound COC1=CC=C(NC(C)=O)C=C1N SJWQCBCAGCEWCV-UHFFFAOYSA-N 0.000 description 1
- VSHTWPWTCXQLQN-UHFFFAOYSA-N n-butylaniline Chemical compound CCCCNC1=CC=CC=C1 VSHTWPWTCXQLQN-UHFFFAOYSA-N 0.000 description 1
- GUYMMHOQXYZMJQ-UHFFFAOYSA-N n-ethyl-3-methylaniline Chemical compound CCNC1=CC=CC(C)=C1 GUYMMHOQXYZMJQ-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- RBXVOQPAMPBADW-UHFFFAOYSA-N nitrous acid;phenol Chemical class ON=O.OC1=CC=CC=C1 RBXVOQPAMPBADW-UHFFFAOYSA-N 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920006306 polyurethane fiber Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- 150000003152 propanolamines Chemical class 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003568 thioethers Chemical group 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
- C09B62/0068—Azodyes dyes containing in the molecule at least one azo group and at least one other chromophore group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782840119 DE2840119A1 (de) | 1978-09-15 | 1978-09-15 | Anthrachinon-azoverbindungen, ihre herstellung und verwendung als farbstoffe |
| IN940/CAL/79A IN153568B (enExample) | 1978-09-15 | 1979-09-10 | |
| IT7925680A IT1165306B (it) | 1978-09-15 | 1979-09-12 | Azocomposti antrachinonici,loro produzione ed impiego come coloranti |
| CH8260/79A CH649571A5 (de) | 1978-09-15 | 1979-09-12 | Anthrachinon-azoverbindungen und ihre herstellung. |
| JP11745579A JPS5540791A (en) | 1978-09-15 | 1979-09-14 | Anthraquinoneeazo compound* its manufacture and method of employing said compound as dyestuff |
| GB7931973A GB2032941B (en) | 1978-09-15 | 1979-09-14 | Anthraquinone-azo compounds their preparation and their use as dyestuffs |
| CA335,641A CA1114811A (en) | 1978-09-15 | 1979-09-14 | Anthraquinone-azo compounds, their preparation and their use as dyestuffs |
| BE0/197169A BE878817A (fr) | 1978-09-15 | 1979-09-17 | Composes azoiques anthraquinoniques utilisables comme colorants, et leur preparation |
| FR7923096A FR2436168A1 (fr) | 1978-09-15 | 1979-09-17 | Composes azoiques anthraquinoniques utilisables comme colorants, et leur preparation |
| IN713/CAL/83A IN155239B (enExample) | 1978-09-15 | 1983-06-04 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782840119 DE2840119A1 (de) | 1978-09-15 | 1978-09-15 | Anthrachinon-azoverbindungen, ihre herstellung und verwendung als farbstoffe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2840119A1 DE2840119A1 (de) | 1980-03-27 |
| DE2840119C2 true DE2840119C2 (enExample) | 1988-05-11 |
Family
ID=6049488
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782840119 Granted DE2840119A1 (de) | 1978-09-15 | 1978-09-15 | Anthrachinon-azoverbindungen, ihre herstellung und verwendung als farbstoffe |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS5540791A (enExample) |
| BE (1) | BE878817A (enExample) |
| CA (1) | CA1114811A (enExample) |
| CH (1) | CH649571A5 (enExample) |
| DE (1) | DE2840119A1 (enExample) |
| FR (1) | FR2436168A1 (enExample) |
| GB (1) | GB2032941B (enExample) |
| IN (2) | IN153568B (enExample) |
| IT (1) | IT1165306B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5926641A (ja) * | 1982-07-31 | 1984-02-10 | Sanwa Tekki Corp | 和動増速型慣性制振装置 |
| JPS5940038A (ja) * | 1982-08-31 | 1984-03-05 | Sanwa Tekki Corp | 増速機構付慣性制振装置 |
| JPS6095232A (ja) * | 1983-10-31 | 1985-05-28 | Sanwa Tekki Corp | 増速機構付慣性制振装置 |
| EP1055709A1 (de) * | 1999-05-25 | 2000-11-29 | Clariant International Ltd. | Anthrachinon-Azofarbstoffe sowie Farbgebung unter Verwendung von solchen Verbindungenn |
| CN105670332B (zh) * | 2016-01-29 | 2017-11-03 | 深圳市国华光电科技有限公司 | 绿色染料及其制备方法、油墨和电润湿显示器 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB781930A (en) * | 1954-11-29 | 1957-08-28 | Ici Ltd | New anthraquinonoid dyestuffs |
| GB1019771A (en) * | 1961-05-24 | 1966-02-09 | Ici Ltd | New reactive dyestuffs containing halogenotriazine residues |
| DE1289929B (de) * | 1963-06-10 | 1969-02-27 | Hoechst Ag | Verfahren zur Herstellung von faserreaktiven organischen Farbstoffen |
| CH536349A (de) * | 1969-02-13 | 1973-04-30 | Ciba Geigy Ag | Verfahren zur Herstellung reaktiver Azoverbindungen |
| CH562305A5 (enExample) * | 1970-12-18 | 1975-05-30 | Ciba Geigy Ag |
-
1978
- 1978-09-15 DE DE19782840119 patent/DE2840119A1/de active Granted
-
1979
- 1979-09-10 IN IN940/CAL/79A patent/IN153568B/en unknown
- 1979-09-12 CH CH8260/79A patent/CH649571A5/de not_active IP Right Cessation
- 1979-09-12 IT IT7925680A patent/IT1165306B/it active
- 1979-09-14 JP JP11745579A patent/JPS5540791A/ja active Pending
- 1979-09-14 CA CA335,641A patent/CA1114811A/en not_active Expired
- 1979-09-14 GB GB7931973A patent/GB2032941B/en not_active Expired
- 1979-09-17 FR FR7923096A patent/FR2436168A1/fr active Granted
- 1979-09-17 BE BE0/197169A patent/BE878817A/fr not_active IP Right Cessation
-
1983
- 1983-06-04 IN IN713/CAL/83A patent/IN155239B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2840119A1 (de) | 1980-03-27 |
| FR2436168B1 (enExample) | 1984-08-17 |
| GB2032941A (en) | 1980-05-14 |
| JPS5540791A (en) | 1980-03-22 |
| GB2032941B (en) | 1982-12-01 |
| BE878817A (fr) | 1980-03-17 |
| CA1114811A (en) | 1981-12-22 |
| IN153568B (enExample) | 1984-07-28 |
| CH649571A5 (de) | 1985-05-31 |
| IT1165306B (it) | 1987-04-22 |
| IT7925680A0 (it) | 1979-09-12 |
| IN155239B (enExample) | 1985-01-12 |
| FR2436168A1 (fr) | 1980-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0511523B1 (de) | Azofarbstoffe mit mehreren reaktiven Ankergruppen | |
| EP0074928A2 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| EP0538785B1 (de) | Wasserlösliche faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0629667A1 (de) | Wasserlöslichse faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2840119C2 (enExample) | ||
| EP0071168B1 (de) | Wasserlösliche Disazoverbindungen und neue Bis-(aminophenoxy)-äthan-Verbindungen mit faserreaktiven Gruppen als Tetrazokomponenten, Verfahren zur Herstellung dieser Verbindungen und Verwendung der Disazoverbindungen als Farbstoffe | |
| EP0079563B1 (de) | Wasserlösliche 1:2-Metallkomplex-Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE2840120C3 (de) | Anthrachinon-Azoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| EP0094019B1 (de) | Wasserlösliche Disazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| DE3843014A1 (de) | Wasserloesliche farbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| EP0189081B1 (de) | Azo-Reaktivfarbstoffe | |
| EP0507801B1 (de) | Azoverbindung, verfahren zu deren herstellung und ihre verwendung als farbstoffe | |
| EP0196536B1 (de) | Wasserlösliche Azoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| EP0069376B1 (de) | Kupferkomplex-Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0507822B1 (de) | Azoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe | |
| EP0377166A1 (de) | Wasserlösliche faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE3843605A1 (de) | Wasserloesliche faserreaktive farbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2054198A1 (de) | Neue wasserlösliche faserreaktive Azofarbstoffe und Verfahren zu ihrer Herstellung | |
| EP0929610A1 (de) | Reaktivfarbstoffe mit einem heterocyclischen anker | |
| EP0433764A1 (de) | Reaktivfarbstoffe mit Triazin- und Chlorbutinylanker | |
| DE3825658A1 (de) | Wasserloesliche faserreaktive farbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| EP0198350B1 (de) | Disazoreaktivfarbstoffe | |
| EP0641841A1 (de) | Azo-Reaktivfarbstoffe | |
| EP0385426A1 (de) | Wasserlösliche faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE19521589A1 (de) | Polyfunktionelle Azoreaktivfarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |