DE2834607A1 - Verfahren zur herstellung von indoleninen - Google Patents
Verfahren zur herstellung von indoleninenInfo
- Publication number
- DE2834607A1 DE2834607A1 DE19782834607 DE2834607A DE2834607A1 DE 2834607 A1 DE2834607 A1 DE 2834607A1 DE 19782834607 DE19782834607 DE 19782834607 DE 2834607 A DE2834607 A DE 2834607A DE 2834607 A1 DE2834607 A1 DE 2834607A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- compounds
- formula
- indolenines
- producing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 12
- 239000000460 chlorine Chemical group 0.000 claims description 10
- 150000004820 halides Chemical class 0.000 claims description 8
- 239000002841 Lewis acid Substances 0.000 claims description 6
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine group Chemical group N1=CCC2=CC=CC=C12 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 6
- 150000007517 lewis acids Chemical class 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000011592 zinc chloride Substances 0.000 description 4
- 235000005074 zinc chloride Nutrition 0.000 description 4
- 238000009835 boiling Methods 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical class O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- -1 methoxy, ethoxy Chemical group 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- IVWSGOOPQGMALJ-UHFFFAOYSA-N 2,3,3-trimethyl-1,2-dihydroindole Chemical compound C1=CC=C2C(C)(C)C(C)NC2=C1 IVWSGOOPQGMALJ-UHFFFAOYSA-N 0.000 description 1
- YPFNIPKMNMDDDB-UHFFFAOYSA-K 2-[2-[bis(carboxylatomethyl)amino]ethyl-(2-hydroxyethyl)amino]acetate;iron(3+) Chemical compound [Fe+3].OCCN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O YPFNIPKMNMDDDB-UHFFFAOYSA-K 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- LGZMBJHWVNMMNU-UHFFFAOYSA-N 4,4-dimethyl-5-methylidene-1,3-oxazolidin-2-one Chemical compound CC1(C)NC(=O)OC1=C LGZMBJHWVNMMNU-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000267722 Genidens Species 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical compound [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/58—[b]- or [c]-condensed
- C07D209/60—Naphtho [b] pyrroles; Hydrogenated naphtho [b] pyrroles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/36—One oxygen atom
- C07D263/38—One oxygen atom attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
- Catalysts (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782834607 DE2834607A1 (de) | 1978-08-07 | 1978-08-07 | Verfahren zur herstellung von indoleninen |
| EP79102806A EP0008097B1 (de) | 1978-08-07 | 1979-08-04 | Verfahren zur Herstellung von Indoleninen |
| DE7979102806T DE2961068D1 (en) | 1978-08-07 | 1979-08-04 | Process for the preparation of indolenines |
| JP9952179A JPS5524176A (en) | 1978-08-07 | 1979-08-06 | Manufacture of indolenine |
| US06/064,981 US4240963A (en) | 1978-08-07 | 1979-08-09 | Preparation of indolenines |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782834607 DE2834607A1 (de) | 1978-08-07 | 1978-08-07 | Verfahren zur herstellung von indoleninen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2834607A1 true DE2834607A1 (de) | 1980-02-28 |
Family
ID=6046441
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782834607 Pending DE2834607A1 (de) | 1978-08-07 | 1978-08-07 | Verfahren zur herstellung von indoleninen |
| DE7979102806T Expired DE2961068D1 (en) | 1978-08-07 | 1979-08-04 | Process for the preparation of indolenines |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979102806T Expired DE2961068D1 (en) | 1978-08-07 | 1979-08-04 | Process for the preparation of indolenines |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4240963A (enExample) |
| EP (1) | EP0008097B1 (enExample) |
| JP (1) | JPS5524176A (enExample) |
| DE (2) | DE2834607A1 (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5036093A (en) * | 1987-10-09 | 1991-07-30 | Du Pont Merck Pharmaceutical | Aminomethyl oxooxazolidinyl azacycloalkylbenzene derivatives useful as antibacterial agents |
| GB9002834D0 (en) * | 1990-02-08 | 1990-04-04 | Ici America Inc | Compounds |
| DE4112841A1 (de) * | 1991-04-19 | 1992-10-22 | Basf Ag | Verfahren zur herstellung von indoleninen |
| US5288877A (en) * | 1991-07-03 | 1994-02-22 | Ppg Industries, Inc. | Continuous process for preparing indolenine compounds |
| KR950702216A (ko) * | 1992-06-30 | 1995-06-19 | 조셉 씨, 호간 | 옥사졸론 유도물질(oxazlone derived materials) |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2304589A1 (de) * | 1973-01-31 | 1974-08-01 | Bayer Ag | 3-alkyloxazolinone-(2) |
| IT1015908B (it) * | 1974-04-05 | 1977-05-20 | Snam Progetti | Procedimento per la sintesi di indolenine alchil sostituite |
| JPS5439073A (en) | 1977-08-29 | 1979-03-24 | Chisso Corp | Preparation of 2,3,3-trimethylindolenine |
-
1978
- 1978-08-07 DE DE19782834607 patent/DE2834607A1/de active Pending
-
1979
- 1979-08-04 EP EP79102806A patent/EP0008097B1/de not_active Expired
- 1979-08-04 DE DE7979102806T patent/DE2961068D1/de not_active Expired
- 1979-08-06 JP JP9952179A patent/JPS5524176A/ja active Granted
- 1979-08-09 US US06/064,981 patent/US4240963A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6221780B2 (enExample) | 1987-05-14 |
| US4240963A (en) | 1980-12-23 |
| EP0008097A3 (en) | 1980-03-19 |
| EP0008097B1 (de) | 1981-10-21 |
| JPS5524176A (en) | 1980-02-21 |
| EP0008097A2 (de) | 1980-02-20 |
| DE2961068D1 (en) | 1981-12-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3502935A1 (de) | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung | |
| DE2834607A1 (de) | Verfahren zur herstellung von indoleninen | |
| DE60209171T2 (de) | Verfahren zur Herstellung von Bromfluorenen | |
| EP0368008A1 (de) | Fluor enthaltende Phenole | |
| EP0758643B1 (de) | Verfahren zur Herstellung von ortho-Nitro-benzonitrilen | |
| DE3642256A1 (de) | Verfahren zur herstellung fluorsubstituierter 1,3-benzodioxole | |
| DE2503699C2 (de) | Verfahren zur Herstellung von 1,2- Benzisothiazolen | |
| DE102007045759B4 (de) | Difluorbenzol-Derivat und Herstellungsverfahren dafür | |
| DE1668794B2 (de) | Im alkylrest perfluorierte organische amine | |
| DE2125229C3 (de) | Verfahren zur Herstellung von Chinazolinen | |
| EP0693466A1 (de) | Verfahren zur Herstellung von aromatischen fluorierten Verbindungen und neue Diamide | |
| DE3111421A1 (de) | Verfahren zur herstellung von gegebenenfalls substituierten fluornitro-benzaldehyden | |
| DE2512498B1 (de) | Verfahren zur herstellung von sulfonsaeurefluoriden | |
| EP0041923A1 (de) | Verfahren zur Herstellung von N-(1'-Alkoxycarbonyläthyl)-2,6-dialkylanilinen | |
| DE2330241C3 (de) | Chlorthio-N-phthalimid, Verfahren zu seiner Herstellung und seine Verwendung | |
| EP1418171A1 (de) | Perfluoralkylaniline | |
| EP0095067B1 (de) | Verfahren zur Herstellung gegebenenfalls substituierter 1,2,3,4-Tetrahydro-9-cyanmethyl-carbazol-1-onen | |
| EP0310732B1 (de) | Verfahren zur Herstellung von N-Acyl-N-alkyl-2,6-dialkyl-3-chloranilinen | |
| DE2460821A1 (de) | Verfahren zur herstellung von carbonsaeurefluoriden | |
| DE69010348T2 (de) | Verfahren zur Herstellung von Ditertioalkyldicarbonat. | |
| DE2027202C3 (de) | 4-Amino-7-nitro-1 ^-benzisothiazole und Verfahren zu ihrer Herstellung | |
| DE3431416A1 (de) | Verfahren zur herstellung von 2-hydroxy-5,6,7,8-tetrahydrocarbazol, die alkali- und erdalkalisalze des 2-hydroxy-5,6,7,8-tetrahydrocarbazols und deren verwendung | |
| DE2851514A1 (de) | Verfahren zur herstellung von nitrodiphenylamin-derivaten | |
| AT329052B (de) | Verfahren zur herstellung neuer phthalimidinderivate | |
| DE1543581A1 (de) | Verfahren zur Herstellung neuartiger alpha-chlorierter tertiaerer Amine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |