DE2739980A1 - Generatoranordnung - Google Patents
GeneratoranordnungInfo
- Publication number
- DE2739980A1 DE2739980A1 DE19772739980 DE2739980A DE2739980A1 DE 2739980 A1 DE2739980 A1 DE 2739980A1 DE 19772739980 DE19772739980 DE 19772739980 DE 2739980 A DE2739980 A DE 2739980A DE 2739980 A1 DE2739980 A1 DE 2739980A1
- Authority
- DE
- Germany
- Prior art keywords
- impeller
- generator
- ing
- rotor
- shaft
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000012530 fluid Substances 0.000 claims description 22
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 claims description 3
- 230000009467 reduction Effects 0.000 claims description 3
- 101100520151 Mus musculus Pirt gene Proteins 0.000 claims 1
- 101150083416 torD gene Proteins 0.000 claims 1
- 238000004804 winding Methods 0.000 description 40
- 125000006850 spacer group Chemical group 0.000 description 10
- 210000000078 claw Anatomy 0.000 description 7
- 239000002826 coolant Substances 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 238000007493 shaping process Methods 0.000 description 4
- 230000007423 decrease Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 239000003990 capacitor Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 230000002093 peripheral effect Effects 0.000 description 2
- 230000036316 preload Effects 0.000 description 2
- 241000272184 Falconiformes Species 0.000 description 1
- 240000004093 Mitragyna parvifolia Species 0.000 description 1
- 229910000792 Monel Inorganic materials 0.000 description 1
- 229910001069 Ti alloy Inorganic materials 0.000 description 1
- 230000004323 axial length Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- KPLQYGBQNPPQGA-UHFFFAOYSA-N cobalt samarium Chemical compound [Co].[Sm] KPLQYGBQNPPQGA-UHFFFAOYSA-N 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 229910000938 samarium–cobalt magnet Inorganic materials 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02K—DYNAMO-ELECTRIC MACHINES
- H02K7/00—Arrangements for handling mechanical energy structurally associated with dynamo-electric machines, e.g. structural association with mechanical driving motors or auxiliary dynamo-electric machines
- H02K7/18—Structural association of electric generators with mechanical driving motors, e.g. with turbines
- H02K7/1807—Rotary generators
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02K—DYNAMO-ELECTRIC MACHINES
- H02K7/00—Arrangements for handling mechanical energy structurally associated with dynamo-electric machines, e.g. structural association with mechanical driving motors or auxiliary dynamo-electric machines
- H02K7/10—Structural association with clutches, brakes, gears, pulleys or mechanical starters
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02P—CONTROL OR REGULATION OF ELECTRIC MOTORS, ELECTRIC GENERATORS OR DYNAMO-ELECTRIC CONVERTERS; CONTROLLING TRANSFORMERS, REACTORS OR CHOKE COILS
- H02P29/00—Arrangements for regulating or controlling electric motors, appropriate for both AC and DC motors
- H02P29/0016—Control of angular speed of one shaft without controlling the prime mover
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Connection Of Motors, Electrical Generators, Mechanical Devices, And The Like (AREA)
- Synchronous Machinery (AREA)
- Control Of Eletrric Generators (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3714176A GB1586963A (en) | 1976-09-08 | 1976-09-08 | Electric generator arrangement |
| GB1561777 | 1977-04-14 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2739980A1 true DE2739980A1 (de) | 1978-03-09 |
| DE2739980C2 DE2739980C2 (cg-RX-API-DMAC7.html) | 1987-08-27 |
Family
ID=26251433
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772739980 Granted DE2739980A1 (de) | 1976-09-08 | 1977-09-06 | Generatoranordnung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4278928A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5333311A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2739980A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2364560A1 (cg-RX-API-DMAC7.html) |
| IT (1) | IT1084763B (cg-RX-API-DMAC7.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2839618A1 (de) * | 1977-11-17 | 1979-05-23 | Sundstrand Corp | Mehrkanalgenerator-antriebssystem |
| FR2433258A1 (fr) * | 1978-08-11 | 1980-03-07 | Sundstrand Corp | Generatrice et ses dispositifs d'entrainement incorpores dans un groupe modulaire |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60152238A (ja) * | 1984-01-18 | 1985-08-10 | 三菱電機株式会社 | フライホイ−ル式エネルギ−貯蔵装置 |
| US4609842A (en) * | 1984-11-23 | 1986-09-02 | Sundstrand Corporation | In-line constant speed drive and generator |
| GB8429974D0 (en) * | 1984-11-28 | 1985-01-09 | Lucas Ind Plc | Rotary electrical machines |
| GB8525096D0 (en) * | 1985-10-11 | 1985-11-13 | Lucas Ind Plc | Speed control unit |
| US4713982A (en) * | 1985-12-27 | 1987-12-22 | Sundstrand Corporation | Integral gear box and electrical generating system |
| US4743776A (en) * | 1986-09-02 | 1988-05-10 | Sundstrand Corporation | Starter-generator for engines |
| GB8623279D0 (en) * | 1986-09-27 | 1986-10-29 | Lucas Ind Plc | Differential gear arrangement |
| US4699171A (en) * | 1986-12-19 | 1987-10-13 | Sundstrand Corporation | Multiple port relief valve |
| US4734590A (en) * | 1986-12-30 | 1988-03-29 | Sundstrand Corporation | Integrated drive generator with common center line |
| US4817459A (en) * | 1987-12-24 | 1989-04-04 | Sundstrand Corporation | Engine starting and power generating system |
| US4922119A (en) * | 1988-11-29 | 1990-05-01 | Sundstrand Corporation | Integrated starting system |
| US5097163A (en) * | 1989-12-22 | 1992-03-17 | Sundstrand Corporation | Electrical power generating system having reduced conducted emissions in output power |
| US6105464A (en) * | 1996-04-04 | 2000-08-22 | Kanzaki Kokyukoki Mfg. Co., Ltd. | Housing for an axle driving apparatus |
| DE19843386C1 (de) * | 1998-09-22 | 1999-12-02 | Piller Gmbh | Unterbrechungsfreie Stromversorgung mit einer elektrischen Maschine und einem Schwungrad |
| WO2001028065A1 (de) * | 1999-10-08 | 2001-04-19 | Piller Gmbh | Vorrichtung zur unterbrechungsfreien stromversorgung mit einer elektrischen maschine und einem schwungrad |
| DE10017548B4 (de) * | 2000-04-08 | 2016-12-01 | Renk Aktiengesellschaft | Generatorgetriebe |
| US6579202B2 (en) * | 2000-12-18 | 2003-06-17 | General Motors Corporation | Lubrication and cooling system for power receiving and delivery units in an electro-mechanical vehicular transmission |
| US7109622B2 (en) * | 2003-06-06 | 2006-09-19 | Pentadyne Power Corporation | Flywheel system with synchronous reluctance and permanent magnet generators |
| FR2890609B1 (fr) * | 2005-09-12 | 2007-10-19 | Valeo Equip Electr Moteur | Systeme d'entrainement electrique d'equipements associes a un moteur thermique |
| US7658065B2 (en) * | 2006-01-30 | 2010-02-09 | Caterpillar Inc. | Hydraulic system having in-sump energy recovery device |
| US20090048053A1 (en) * | 2007-08-16 | 2009-02-19 | Ruppert Rex Leroy | Auxiliary transmission for a continously variable transmission with active speed control |
| US8845486B2 (en) | 2008-03-18 | 2014-09-30 | Briggs & Stratton Corporation | Transmission for outdoor power equipment |
| US8267835B2 (en) * | 2008-03-18 | 2012-09-18 | Briggs And Stratton Corporation | Generator set |
| US8754558B2 (en) | 2010-10-06 | 2014-06-17 | Ramiro Casas | Kinetic energy to electric power converter |
| US9840143B1 (en) | 2015-05-20 | 2017-12-12 | Hydro-Gear Limited Partnership | Cooling pump assembly and cooling system for utility vehicle |
| US10106027B1 (en) * | 2015-06-01 | 2018-10-23 | Hydro-Gear Limited Partnership | Generator/cooling assembly and system for utility vehicle |
| US10391854B1 (en) | 2015-06-15 | 2019-08-27 | Hydro-Gear Limited Partnership | Drive and cooling system for utility vehicle |
| US10541634B2 (en) * | 2017-03-17 | 2020-01-21 | Hamilton Sundstrand Corporation | Generator arrangements and methods of controlling generator arrangements |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1149099B (de) * | 1958-10-28 | 1963-05-22 | Siemens Ag | Erregeranordnung fuer elektrische Maschinen |
| DE2044441A1 (de) * | 1969-09-05 | 1971-04-01 | Sundstrand Corp | Integrierte Antriebs und Generatorver bindung |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1453166A (en) * | 1919-10-23 | 1923-04-24 | Nobuhara Kantaro | Rotary electric machine |
| GB485225A (en) | 1936-02-29 | 1938-05-17 | Hans Moser | Improvements in or relating to electric motors |
| US2518129A (en) * | 1943-10-23 | 1950-08-08 | Honeywell Regulator Co | Control device |
| US2474706A (en) * | 1944-01-29 | 1949-06-28 | Sundstrand Machine Tool Co | Hydraulic transmission |
| US2485126A (en) * | 1947-01-10 | 1949-10-18 | Garrett Corp | Hydraulically controlled variablespeed transmission |
| US2634907A (en) * | 1950-06-24 | 1953-04-14 | Sharples Corp | Process and apparatus for centrifugal deaeration |
| US2885566A (en) * | 1951-12-04 | 1959-05-05 | Sundstrand Machine Tool Co | Control means |
| US2803112A (en) * | 1951-12-04 | 1957-08-20 | Sundstrand Machine Tool Co | Control means for constant speed hydraulic pump and motor transmission |
| US2731569A (en) * | 1952-07-08 | 1956-01-17 | Sundstrand Machine Tool Co | Hydraulic transmission and control |
| US2810844A (en) * | 1954-06-22 | 1957-10-22 | Wayne J Morrill | Gearing arrangement for dynamoelectric machines |
| US2890604A (en) * | 1955-06-20 | 1959-06-16 | Gen Dynamics Corp | Constant speed system |
| GB871575A (en) * | 1958-01-14 | 1961-06-28 | Hobson Ltd H M | Improvements in constant speed gear units |
| CA643632A (en) * | 1958-06-12 | 1962-06-26 | M. Potter Frederick | Constant frequency generator system |
| US3023638A (en) * | 1959-11-10 | 1962-03-06 | Hobson Ltd H M | Constant speed units |
| US3187250A (en) * | 1961-09-11 | 1965-06-01 | American Brake Shoe Co | Frequency control system for a. c. generating apparatus |
| US3274855A (en) * | 1962-06-19 | 1966-09-27 | Sundstrand Corp | Starter-drive system |
| GB1062631A (en) * | 1963-01-11 | 1967-03-22 | Plessey Uk Ltd | Improvements in or relating to composite hydromechanical constant-speed drives |
| US3365981A (en) * | 1964-12-28 | 1968-01-30 | Sandstrand Corp | Combined fluid and mechanical drive |
| US3462625A (en) * | 1966-02-21 | 1969-08-19 | Carrier Corp | Rotor cooling arrangement |
| GB1217855A (en) | 1967-07-14 | 1970-12-31 | Rotax Ltd | Dynamo electric machines |
| US3626787A (en) * | 1969-11-24 | 1971-12-14 | White Motor Corp | Continuously variable transmission |
| JPS5233522Y2 (cg-RX-API-DMAC7.html) * | 1971-08-14 | 1977-07-30 | ||
| US3733924A (en) * | 1972-01-24 | 1973-05-22 | Sundstrand Corp | Hydromechanical transmission |
| JPS5424066B2 (cg-RX-API-DMAC7.html) * | 1972-04-28 | 1979-08-18 | ||
| US3786696A (en) * | 1972-09-11 | 1974-01-22 | Sundstrand Corp | Starter-drive |
| US3942961A (en) * | 1974-09-17 | 1976-03-09 | Joseph Lucas (Industries) Limited | Pumps |
| GB1535221A (en) * | 1975-02-25 | 1978-12-13 | Lucas Industries Ltd | Electric current generator arrangements |
-
1977
- 1977-09-06 IT IT27275/77A patent/IT1084763B/it active
- 1977-09-06 DE DE19772739980 patent/DE2739980A1/de active Granted
- 1977-09-07 US US05/831,105 patent/US4278928A/en not_active Expired - Lifetime
- 1977-09-08 FR FR7727254A patent/FR2364560A1/fr active Granted
- 1977-09-08 JP JP10734577A patent/JPS5333311A/ja active Pending
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1149099B (de) * | 1958-10-28 | 1963-05-22 | Siemens Ag | Erregeranordnung fuer elektrische Maschinen |
| DE2044441A1 (de) * | 1969-09-05 | 1971-04-01 | Sundstrand Corp | Integrierte Antriebs und Generatorver bindung |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2839618A1 (de) * | 1977-11-17 | 1979-05-23 | Sundstrand Corp | Mehrkanalgenerator-antriebssystem |
| FR2433258A1 (fr) * | 1978-08-11 | 1980-03-07 | Sundstrand Corp | Generatrice et ses dispositifs d'entrainement incorpores dans un groupe modulaire |
Also Published As
| Publication number | Publication date |
|---|---|
| US4278928A (en) | 1981-07-14 |
| IT1084763B (it) | 1985-05-28 |
| FR2364560B1 (cg-RX-API-DMAC7.html) | 1983-01-07 |
| JPS5333311A (en) | 1978-03-29 |
| FR2364560A1 (fr) | 1978-04-07 |
| DE2739980C2 (cg-RX-API-DMAC7.html) | 1987-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2739980A1 (de) | Generatoranordnung | |
| WO2020043602A1 (de) | Kühlvorrichtung, motorgehäuse und motoreinheit | |
| DE69923553T2 (de) | Antriebsvorrichtung mit einem flüssigkeitsgekühlten elektrischen Motor und Planetengetriebe | |
| DE102011012586B4 (de) | Gerotorpumpe mit Außenringantrieb | |
| DE102012202460A1 (de) | Elektromotorische Getriebevorrichtung mit einstückigem Gehäuse | |
| DE1952966A1 (de) | Kraftuebertragungsvorrichtung | |
| DE2049027A1 (de) | Integrierte Antriebs und Generator verbindung Ausscheidung aus 2044441 | |
| EP0660492B1 (de) | Kühlsystem für einen Motor | |
| DE102007018999A1 (de) | Leistungsverzweigungsgetriebe | |
| DE10354604A1 (de) | Stufenlos schaltbares, magnetodynamisches Getriebe | |
| DE2209152A1 (de) | Verfahren zur Verwirklichung eines besonderen Leistungsbereiches eines hydraulischen Motors und Motor zur Durchführung dieses Verfahrens | |
| DE102020206000A1 (de) | Elektrische Maschine mit Bypass-Kühlkanal | |
| DE2406659A1 (de) | Verstellbarer, als pumpe, motor oder getriebe verwendbarer stroemungswandler | |
| EP2304194A2 (de) | Strömungsmaschine, verfahren und modulsystem zur herstellung einer solchen strömungsmaschine | |
| DE102005010447A1 (de) | Getriebevorrichtung eines Fahrzeugs | |
| DE3202993A1 (de) | Drehkolbenmaschine | |
| DE102009031801A1 (de) | Hydraulische Verstelleinrichtung für ein stufenlos verstellbares Getriebe, insbesondere für ein Kurbel-CVT-Getriebe | |
| WO2010136445A1 (de) | Verfahren zur herstellung einer ständerwicklung einer elektrischen maschine, insbesondere eines wechselstromgenerators | |
| DE102005010448A1 (de) | Getriebevorrichtung eines Fahrzeugs | |
| EP0319464B1 (de) | Turbine mit Steuerung und Verwendung der Turbine | |
| DE2900556A1 (de) | Kuehleinrichtung fuer maschinenoel | |
| DE19860705B4 (de) | Hydrodynamischer Retarder mit integrierten Mitteln zur Kühlung des Retarderarbeitsmediums | |
| DE1955689A1 (de) | Asynchronmotor mit Hilfsphase | |
| AT407563B (de) | Ölpumpe für eine brennkraftmaschine mit innerer verbrennung | |
| DE8914171U1 (de) | Einrichtung zur Umwandlung von Wärmeenergie in mechanische Energie |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |