DE2731609C2 - Wasser-in-Öl-Emulsionssprengstoffmischung - Google Patents
Wasser-in-Öl-EmulsionssprengstoffmischungInfo
- Publication number
- DE2731609C2 DE2731609C2 DE2731609A DE2731609A DE2731609C2 DE 2731609 C2 DE2731609 C2 DE 2731609C2 DE 2731609 A DE2731609 A DE 2731609A DE 2731609 A DE2731609 A DE 2731609A DE 2731609 C2 DE2731609 C2 DE 2731609C2
- Authority
- DE
- Germany
- Prior art keywords
- explosive mixture
- mixture according
- water
- waxes
- nitrate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000002360 explosive Substances 0.000 title claims description 50
- 239000000203 mixture Substances 0.000 title claims description 48
- 239000007762 w/o emulsion Substances 0.000 title claims description 14
- 239000000446 fuel Substances 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 19
- 239000003921 oil Substances 0.000 claims description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 239000003995 emulsifying agent Substances 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 13
- 239000011521 glass Substances 0.000 claims description 12
- 229910001959 inorganic nitrate Inorganic materials 0.000 claims description 11
- 239000001993 wax Substances 0.000 claims description 11
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 10
- 230000001590 oxidative effect Effects 0.000 claims description 9
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 8
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 7
- 235000019198 oils Nutrition 0.000 claims description 7
- 235000019271 petrolatum Nutrition 0.000 claims description 6
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical group [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 6
- 229910001484 inorganic perchlorate Inorganic materials 0.000 claims description 5
- 239000002245 particle Substances 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 239000011324 bead Substances 0.000 claims description 4
- 241000238631 Hexapoda Species 0.000 claims description 3
- 229910002651 NO3 Inorganic materials 0.000 claims description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 3
- 239000004264 Petrolatum Substances 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 239000012164 animal wax Substances 0.000 claims description 3
- 239000004200 microcrystalline wax Substances 0.000 claims description 3
- 235000019808 microcrystalline wax Nutrition 0.000 claims description 3
- 239000012184 mineral wax Substances 0.000 claims description 3
- 239000012188 paraffin wax Substances 0.000 claims description 3
- 235000019809 paraffin wax Nutrition 0.000 claims description 3
- 229940066842 petrolatum Drugs 0.000 claims description 3
- 239000003208 petroleum Substances 0.000 claims description 3
- 235000010344 sodium nitrate Nutrition 0.000 claims description 3
- 239000004317 sodium nitrate Substances 0.000 claims description 3
- 235000015112 vegetable and seed oil Nutrition 0.000 claims description 3
- 239000008158 vegetable oil Substances 0.000 claims description 3
- 239000000839 emulsion Substances 0.000 description 25
- -1 amine nitrate compounds Chemical class 0.000 description 10
- 238000005422 blasting Methods 0.000 description 10
- 239000004005 microsphere Substances 0.000 description 9
- 239000007789 gas Substances 0.000 description 7
- 239000007800 oxidant agent Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 235000013871 bee wax Nutrition 0.000 description 2
- 239000012166 beeswax Substances 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 description 2
- 238000005474 detonation Methods 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 229910017053 inorganic salt Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- DSEKYWAQQVUQTP-XEWMWGOFSA-N (2r,4r,4as,6as,6as,6br,8ar,12ar,14as,14bs)-2-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-2,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydro-1h-picen-3-one Chemical compound C([C@H]1[C@]2(C)CC[C@@]34C)C(C)(C)CC[C@]1(C)CC[C@]2(C)[C@H]4CC[C@@]1(C)[C@H]3C[C@@H](O)C(=O)[C@@H]1C DSEKYWAQQVUQTP-XEWMWGOFSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- CMCBDXRRFKYBDG-UHFFFAOYSA-N 1-dodecoxydodecane Chemical compound CCCCCCCCCCCCOCCCCCCCCCCCC CMCBDXRRFKYBDG-UHFFFAOYSA-N 0.000 description 1
- WHQOKFZWSDOTQP-UHFFFAOYSA-N 2,3-dihydroxypropyl 4-aminobenzoate Chemical compound NC1=CC=C(C(=O)OCC(O)CO)C=C1 WHQOKFZWSDOTQP-UHFFFAOYSA-N 0.000 description 1
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 description 1
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 206010019233 Headaches Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 1
- 239000000026 Pentaerythritol tetranitrate Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- IYFATESGLOUGBX-YVNJGZBMSA-N Sorbitan monopalmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O IYFATESGLOUGBX-YVNJGZBMSA-N 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 239000004163 Spermaceti wax Substances 0.000 description 1
- IJCWFDPJFXGQBN-RYNSOKOISA-N [(2R)-2-[(2R,3R,4S)-4-hydroxy-3-octadecanoyloxyoxolan-2-yl]-2-octadecanoyloxyethyl] octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCCCCCCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCCCCCCCCCCCC IJCWFDPJFXGQBN-RYNSOKOISA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 231100000869 headache Toxicity 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012170 montan wax Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000009972 noncorrosive effect Effects 0.000 description 1
- 150000002918 oxazolines Chemical class 0.000 description 1
- 229960004321 pentaerithrityl tetranitrate Drugs 0.000 description 1
- 239000012169 petroleum derived wax Substances 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000005373 porous glass Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 239000001570 sorbitan monopalmitate Substances 0.000 description 1
- 235000011071 sorbitan monopalmitate Nutrition 0.000 description 1
- 229940031953 sorbitan monopalmitate Drugs 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- 239000001589 sorbitan tristearate Substances 0.000 description 1
- 235000011078 sorbitan tristearate Nutrition 0.000 description 1
- 229960004129 sorbitan tristearate Drugs 0.000 description 1
- 235000019385 spermaceti wax Nutrition 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000003438 strontium compounds Chemical class 0.000 description 1
- 239000000015 trinitrotoluene Substances 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 229940099259 vaseline Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
- C06B47/145—Water in oil emulsion type explosives in which a carbonaceous fuel forms the continuous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Chemistry (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Colloid Chemistry (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US74009476A | 1976-11-09 | 1976-11-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2731609A1 DE2731609A1 (de) | 1978-05-18 |
| DE2731609C2 true DE2731609C2 (de) | 1991-07-25 |
Family
ID=24975010
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2731609A Expired - Lifetime DE2731609C2 (de) | 1976-11-09 | 1977-07-13 | Wasser-in-Öl-Emulsionssprengstoffmischung |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4110134A (enExample) |
| JP (1) | JPS54110308A (enExample) |
| AU (1) | AU515896B2 (enExample) |
| BE (1) | BE860491A (enExample) |
| BR (1) | BR7706169A (enExample) |
| CA (1) | CA1094324A (enExample) |
| DE (1) | DE2731609C2 (enExample) |
| FR (1) | FR2370015A1 (enExample) |
| GB (1) | GB1593163A (enExample) |
| IT (1) | IT1079679B (enExample) |
| MX (1) | MX146517A (enExample) |
| MY (1) | MY8200192A (enExample) |
| NO (1) | NO147984C (enExample) |
| SE (2) | SE441262B (enExample) |
| ZA (1) | ZA773582B (enExample) |
| ZM (1) | ZM6277A1 (enExample) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4218272A (en) * | 1978-12-04 | 1980-08-19 | Atlas Powder Company | Water-in-oil NCN emulsion blasting agent |
| CA1096173A (en) * | 1978-12-08 | 1981-02-24 | Rejean Binet | Water-in -oil emulsion blasting agent |
| US4216040A (en) * | 1979-01-19 | 1980-08-05 | Ireco Chemicals | Emulsion blasting composition |
| JPS55160057A (en) * | 1979-04-09 | 1980-12-12 | Nippon Oil & Fats Co Ltd | Water-in-oil emulsion type explosive composition |
| US4287010A (en) * | 1979-08-06 | 1981-09-01 | E. I. Du Pont De Nemours & Company | Emulsion-type explosive composition and method for the preparation thereof |
| US4231821A (en) * | 1979-05-21 | 1980-11-04 | Ireco Chemicals | Emulsion blasting agent sensitized with perlite |
| US4322258A (en) * | 1979-11-09 | 1982-03-30 | Ireco Chemicals | Thermally stable emulsion explosive composition |
| JPS56155087A (en) * | 1980-04-28 | 1981-12-01 | Nippon Kayaku Kk | Stable explosive composition |
| US4431468A (en) * | 1980-05-21 | 1984-02-14 | Angus Chemical Company | TL-170 Blasting agent |
| US4394198A (en) * | 1980-08-25 | 1983-07-19 | Nippon Oil And Fats Company, Limited | Water-in-oil emulsion explosive composition |
| US4371408A (en) * | 1980-10-27 | 1983-02-01 | Atlas Powder Company | Low water emulsion explosive compositions optionally containing inert salts |
| US4383873A (en) * | 1980-10-27 | 1983-05-17 | Atlas Powder Company | Sensitive low water emulsion explosive compositions |
| JPS57117306A (en) * | 1981-01-12 | 1982-07-21 | Nippon Oil & Fats Co Ltd | Water-in-oil emulsion type explosive composition |
| FR2503139A1 (fr) * | 1981-04-01 | 1982-10-08 | Sifa | Perfectionnements apportes a la fabrication des allumettes dites de surete |
| US4414044A (en) * | 1981-05-11 | 1983-11-08 | Nippon Oil And Fats, Co., Ltd. | Water-in-oil emulsion explosive composition |
| JPS57188482A (en) * | 1981-05-11 | 1982-11-19 | Nippon Oils & Fats Co Ltd | Water-in-oil emulsion explosive composition |
| ZW9182A1 (en) * | 1981-05-26 | 1983-01-05 | Aeci Ltd | Explosive |
| JPS6028796B2 (ja) * | 1982-01-27 | 1985-07-06 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬の製造法 |
| SE457952B (sv) * | 1982-09-15 | 1989-02-13 | Nitro Nobel Ab | Spraengaemne |
| EP0123008B1 (fr) * | 1983-03-18 | 1989-08-02 | PRB NOBEL EXPLOSIFS, Société Anonyme | Compositions du type "émulsion explosive" procédé pour leur fabrication et application de ces compositions |
| CA1188898A (en) * | 1983-04-21 | 1985-06-18 | Howard A. Bampfield | Water-in-wax emulsion blasting agents |
| JPS59207889A (ja) * | 1983-05-10 | 1984-11-26 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬組成物 |
| GB2139616B (en) * | 1983-05-13 | 1987-04-01 | Glaverbel | Gas-filled glass beads |
| SE452003B (sv) * | 1983-06-10 | 1987-11-09 | Fluidcrystal I Malmo Ab | Sett for stabilisering av emulsionssprengemnen |
| US4474628A (en) * | 1983-07-11 | 1984-10-02 | Ireco Chemicals | Slurry explosive with high strength hollow spheres |
| JPS6090887A (ja) * | 1983-10-21 | 1985-05-22 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬組成物 |
| US4525225A (en) * | 1984-03-05 | 1985-06-25 | Atlas Powder Company | Solid water-in-oil emulsion explosives compositions and processes |
| GB2156799B (en) * | 1984-03-21 | 1987-12-16 | Ici Plc | Emulsion explosive |
| US4708753A (en) * | 1985-12-06 | 1987-11-24 | The Lubrizol Corporation | Water-in-oil emulsions |
| US4844756A (en) * | 1985-12-06 | 1989-07-04 | The Lubrizol Corporation | Water-in-oil emulsions |
| JPH0717473B2 (ja) * | 1986-01-14 | 1995-03-01 | 三洋化成工業株式会社 | 油中水滴型エマルジヨン爆薬 |
| JPH0637344B2 (ja) * | 1986-03-10 | 1994-05-18 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬組成物 |
| US4693765A (en) * | 1986-05-22 | 1987-09-15 | Stromquist Donald M | Gel type slurry explosive and matrix and method for making same |
| US5527491A (en) * | 1986-11-14 | 1996-06-18 | The Lubrizol Corporation | Emulsifiers and explosive emulsions containing same |
| US4828633A (en) * | 1987-12-23 | 1989-05-09 | The Lubrizol Corporation | Salt compositions for explosives |
| US5047175A (en) * | 1987-12-23 | 1991-09-10 | The Lubrizol Corporation | Salt composition and explosives using same |
| US4863534A (en) * | 1987-12-23 | 1989-09-05 | The Lubrizol Corporation | Explosive compositions using a combination of emulsifying salts |
| US4840687A (en) * | 1986-11-14 | 1989-06-20 | The Lubrizol Corporation | Explosive compositions |
| US5129972A (en) * | 1987-12-23 | 1992-07-14 | The Lubrizol Corporation | Emulsifiers and explosive emulsions containing same |
| CA1325724C (en) * | 1988-11-07 | 1994-01-04 | C-I-L Inc. | Aromatic hydrocarbon-based emulsion explosive composition |
| CA1325723C (en) * | 1988-12-05 | 1994-01-04 | Anh D. Nguyen | Nitroalkane-based emulsion explosive composition |
| US5007973A (en) * | 1989-10-12 | 1991-04-16 | Atlas Powder Company | Multicomponent explosives |
| NO176140C (no) * | 1992-08-19 | 1996-04-09 | Dyno Ind As Sivile Sprengstoff | Sprengstoff for anvendelse i bulk eller patronert form |
| US5366571A (en) * | 1993-01-15 | 1994-11-22 | The United States Of America As Represented By The Secretary Of The Interior | High pressure-resistant nonincendive emulsion explosive |
| RU2123488C1 (ru) * | 1994-02-01 | 1998-12-20 | Государственный научно-исследовательский институт "Кристалл" | Эмульсионный взрывчатый состав |
| US5589660A (en) * | 1995-08-03 | 1996-12-31 | United Technologies Corportion | Enhanced performance blasting agent |
| US6651564B1 (en) * | 2000-07-17 | 2003-11-25 | Schlumberger Technology Corporation | High energy explosive for seismic methods |
| KR100576180B1 (ko) * | 2002-07-27 | 2006-05-03 | 주식회사 한화 | 비폭발성 에멀젼 조성물 |
| RU2305673C1 (ru) * | 2006-06-01 | 2007-09-10 | Общество с ограниченной ответственностью "Промтехвзрыв" | Способ ведения взрывных работ в обводненной скважине зарядом эмульсионного взрывчатого вещества |
| RU2326100C1 (ru) * | 2006-11-07 | 2008-06-10 | Федеральное Государственное Унитарное Предприятие "Красноармейский Научно-Исследовательский Институт Механизации" | Эмульсионный взрывчатый состав и способ его получения |
| US10494312B2 (en) | 2014-07-18 | 2019-12-03 | Jeffrey S. Senules | Noble gas infused emulsion explosive |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US28060A (en) * | 1860-05-01 | Musical reed | ||
| US3456589A (en) * | 1967-03-20 | 1969-07-22 | Dow Chemical Co | High pressure explosive compositions and method using hollow glass spheres |
| US3447978A (en) * | 1967-08-03 | 1969-06-03 | Atlas Chem Ind | Ammonium nitrate emulsion blasting agent and method of preparing same |
| US3674578A (en) * | 1970-02-17 | 1972-07-04 | Du Pont | Water-in-oil emulsion type blasting agent |
| CA964466A (en) * | 1970-08-18 | 1975-03-18 | E. I. Du Pont De Nemours And Company | Emulsion type blasting agent |
| US3770522A (en) * | 1970-08-18 | 1973-11-06 | Du Pont | Emulsion type explosive composition containing ammonium stearate or alkali metal stearate |
| US3715247A (en) * | 1970-09-03 | 1973-02-06 | Ici America Inc | Water-in-oil emulsion explosive containing entrapped gas |
| US3765964A (en) * | 1972-10-06 | 1973-10-16 | Ici America Inc | Water-in-oil emulsion type explosive compositions having strontium-ion detonation catalysts |
| US4008108A (en) * | 1975-04-22 | 1977-02-15 | E. I. Du Pont De Nemours And Company | Formation of foamed emulsion-type blasting agents |
-
1977
- 1977-05-10 AU AU25043/77A patent/AU515896B2/en not_active Withdrawn - After Issue
- 1977-06-01 IT IT49671/77A patent/IT1079679B/it active
- 1977-06-09 FR FR7717691A patent/FR2370015A1/fr not_active Withdrawn
- 1977-06-10 MX MX169420A patent/MX146517A/es unknown
- 1977-06-14 ZA ZA00773582A patent/ZA773582B/xx unknown
- 1977-07-06 CA CA282,160A patent/CA1094324A/en not_active Expired
- 1977-07-13 DE DE2731609A patent/DE2731609C2/de not_active Expired - Lifetime
- 1977-08-03 SE SE7708851A patent/SE441262B/xx not_active IP Right Cessation
- 1977-08-11 ZM ZM62/77A patent/ZM6277A1/xx unknown
- 1977-09-15 BR BR7706169A patent/BR7706169A/pt unknown
- 1977-10-28 NO NO773694A patent/NO147984C/no unknown
- 1977-11-03 US US05/848,333 patent/US4110134A/en not_active Expired - Lifetime
- 1977-11-04 BE BE182351A patent/BE860491A/xx unknown
- 1977-11-05 JP JP13298877A patent/JPS54110308A/ja active Granted
- 1977-11-09 GB GB225501/77A patent/GB1593163A/en not_active Expired
-
1982
- 1982-12-30 MY MY192/82A patent/MY8200192A/xx unknown
-
1985
- 1985-04-19 SE SE8501924A patent/SE469629B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ZM6277A1 (en) | 1978-04-21 |
| JPS54110308A (en) | 1979-08-29 |
| DE2731609A1 (de) | 1978-05-18 |
| SE8501924L (sv) | 1985-04-19 |
| GB1593163A (en) | 1981-07-15 |
| BE860491A (fr) | 1978-05-05 |
| AU515896B2 (en) | 1981-05-07 |
| SE441262B (sv) | 1985-09-23 |
| SE7708851L (sv) | 1978-05-10 |
| IT1079679B (it) | 1985-05-13 |
| CA1094324A (en) | 1981-01-27 |
| SE8501924D0 (sv) | 1985-04-19 |
| BR7706169A (pt) | 1978-07-04 |
| MY8200192A (en) | 1982-12-31 |
| JPS6214518B2 (enExample) | 1987-04-02 |
| FR2370015A1 (fr) | 1978-06-02 |
| NO147984C (no) | 1987-10-28 |
| MX146517A (es) | 1982-07-07 |
| NO773694L (no) | 1978-05-10 |
| ZA773582B (en) | 1978-12-27 |
| NO147984B (no) | 1983-04-11 |
| SE469629B (sv) | 1993-08-09 |
| AU2504377A (en) | 1978-11-16 |
| US4110134A (en) | 1978-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2731609C2 (de) | Wasser-in-Öl-Emulsionssprengstoffmischung | |
| DE2947982C3 (de) | Wasser-in-Öl-Sprengmittelemulsionen | |
| DE2948465C2 (enExample) | ||
| DE3141979C2 (enExample) | ||
| DE3141980C2 (enExample) | ||
| DE2948332C2 (de) | Wasser-in-Öl-Sprengmittelemulsion | |
| DE2350200A1 (de) | Explosivmaterialien | |
| US4149917A (en) | Cap sensitive emulsions without any sensitizer other than occluded air | |
| DE2948463A1 (de) | Sprengmittelzusammensetzung in form von wasser-in-oel-emulsionen | |
| US4149916A (en) | Cap sensitive emulsions containing perchlorates and occluded air and method | |
| CA1166016A (en) | Emulsion explosives containing high concentrations of calcium nitrate | |
| DE4001917A1 (de) | Sprengstoffzusammensetzung | |
| DE3786115T2 (de) | Gegossene sprengstoffzusammensetzung und verfahren. | |
| DE69730819T2 (de) | Zweiphasige Emulsion für Sprengstoffzusammensetzungen | |
| DE3700783C2 (de) | Wasser-in-Öl-Emulsionssprengstoff | |
| DE3108803A1 (de) | Wasser-in-oel-emulsions-sprengstoff | |
| DE69005735T2 (de) | Emulsionssprengstoff vom Wasser-in-Öl-Typ. | |
| US4664729A (en) | Water-in-oil explosive emulsion composition | |
| DE69032230T2 (de) | Wasser-in-öl-emulsion-sprengstoffzusammensetzung | |
| DE69233506T2 (de) | Gegossene Initialladung und Sprengstoffzusammensetzung mit geringem Durchmesser und Verfahren zu deren Herstellung | |
| US4308081A (en) | Water-in-oil emulsion blasting agent | |
| DE2832737A1 (de) | Wasser-in-oel-emulsionssprengstoffmischung | |
| DE69906626T2 (de) | Patronierte energetische Emulsionssprengstoffe | |
| DE1009990B (de) | Plastischer Sicherheitssprengstoff mit ausgeglichener Sauerstoffbilanz | |
| DE69014096T2 (de) | Schockbeständiger Emulsionssprengstoff mit niedriger Dichte. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8366 | Restricted maintained after opposition proceedings | ||
| 8305 | Restricted maintenance of patent after opposition | ||
| D4 | Patent maintained restricted |