DE2704825C3 - Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer Materialien - Google Patents
Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer MaterialienInfo
- Publication number
- DE2704825C3 DE2704825C3 DE2704825A DE2704825A DE2704825C3 DE 2704825 C3 DE2704825 C3 DE 2704825C3 DE 2704825 A DE2704825 A DE 2704825A DE 2704825 A DE2704825 A DE 2704825A DE 2704825 C3 DE2704825 C3 DE 2704825C3
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- hydroxy
- volume
- triazolyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 20
- 239000007850 fluorescent dye Substances 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title description 5
- 239000011368 organic material Substances 0.000 title 1
- 239000000463 material Substances 0.000 claims description 11
- 230000002087 whitening effect Effects 0.000 claims description 5
- -1 aralkyl radical Chemical class 0.000 description 48
- 229920002239 polyacrylonitrile Polymers 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 20
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 20
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 19
- 229960002218 sodium chlorite Drugs 0.000 description 19
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N benzo-alpha-pyrone Natural products C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 18
- 229960000956 coumarin Drugs 0.000 description 18
- 235000001671 coumarin Nutrition 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 150000001875 compounds Chemical class 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 14
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 14
- 235000002639 sodium chloride Nutrition 0.000 description 14
- 150000004775 coumarins Chemical class 0.000 description 13
- 239000011780 sodium chloride Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 11
- 239000000835 fiber Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 239000002657 fibrous material Substances 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 8
- 229920000728 polyester Polymers 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- NTCCNERMXRIPTR-UHFFFAOYSA-N 2-hydroxy-1-naphthaldehyde Chemical compound C1=CC=CC2=C(C=O)C(O)=CC=C21 NTCCNERMXRIPTR-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000007844 bleaching agent Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- 239000004793 Polystyrene Substances 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical class ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 238000004043 dyeing Methods 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 238000005956 quaternization reaction Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 229940073608 benzyl chloride Drugs 0.000 description 3
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 3
- 229940008406 diethyl sulfate Drugs 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 238000009987 spinning Methods 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 125000000542 sulfonic acid group Chemical group 0.000 description 3
- 210000002268 wool Anatomy 0.000 description 3
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 2
- NARVIWMVBMUEOG-UHFFFAOYSA-N 2-Hydroxy-propylene Natural products CC(O)=C NARVIWMVBMUEOG-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- GXBYFVGCMPJVJX-UHFFFAOYSA-N Epoxybutene Chemical compound C=CC1CO1 GXBYFVGCMPJVJX-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000005530 etching Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 2
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical group COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical class ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- NVLHGZIXTRYOKT-UHFFFAOYSA-N 1-chloro-2,3-dimethylbenzene Chemical class CC1=CC=CC(Cl)=C1C NVLHGZIXTRYOKT-UHFFFAOYSA-N 0.000 description 1
- RZWHKKIXMPLQEM-UHFFFAOYSA-N 1-chloropropan-1-ol Chemical compound CCC(O)Cl RZWHKKIXMPLQEM-UHFFFAOYSA-N 0.000 description 1
- CUYXXRMGJIMOMK-UHFFFAOYSA-N 2-(1-phenylmethoxypropan-2-yloxy)propoxymethylbenzene Chemical compound C=1C=CC=CC=1COCC(C)OC(C)COCC1=CC=CC=C1 CUYXXRMGJIMOMK-UHFFFAOYSA-N 0.000 description 1
- CUIODKLCVPKRIF-UHFFFAOYSA-N 2-butoxy-3-methyloxirane Chemical compound CCCCOC1OC1C CUIODKLCVPKRIF-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- OOARGXHXVLNBMI-UHFFFAOYSA-N 2-ethoxy-3-methyloxirane Chemical compound CCOC1OC1C OOARGXHXVLNBMI-UHFFFAOYSA-N 0.000 description 1
- NAGJMKOANVHPEJ-UHFFFAOYSA-N 2-methoxy-3-methyloxirane Chemical compound COC1OC1C NAGJMKOANVHPEJ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- CIXRKWKWHFMSIT-UHFFFAOYSA-N 4-formyl-3-hydroxy-n,n-dimethylnaphthalene-2-carboxamide Chemical compound C1=CC=C2C(C=O)=C(O)C(C(=O)N(C)C)=CC2=C1 CIXRKWKWHFMSIT-UHFFFAOYSA-N 0.000 description 1
- LYZCKRNGGORSTQ-UHFFFAOYSA-N 4-hydroxynaphthalene-2-carbonitrile Chemical compound C1=CC=C2C(O)=CC(C#N)=CC2=C1 LYZCKRNGGORSTQ-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- LMEDOLJKVASKTP-UHFFFAOYSA-N dibutyl sulfate Chemical compound CCCCOS(=O)(=O)OCCCC LMEDOLJKVASKTP-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- VRZVPALEJCLXPR-UHFFFAOYSA-N ethyl 4-methylbenzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC=C(C)C=C1 VRZVPALEJCLXPR-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000005027 hydroxyaryl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 239000000990 laser dye Substances 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/02—Coumarine dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Pyrane Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Detergent Compositions (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2704825A DE2704825C3 (de) | 1977-02-05 | 1977-02-05 | Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer Materialien |
| IN524/DEL/77A IN147054B (forum.php) | 1977-02-05 | 1977-12-28 | |
| BR7800647A BR7800647A (pt) | 1977-02-05 | 1978-02-02 | Corantes fluorescente,processo para sua obtencao,e processo para o alvejante de materiais organicos,macromoleculare |
| GB4274/78A GB1555453A (en) | 1977-02-05 | 1978-02-02 | Fluorescent dystuffs |
| ES466626A ES466626A1 (es) | 1977-02-05 | 1978-02-03 | Procedimiento para la obtencion de colorantes fluorescentes. |
| JP53010631A JPS5821936B2 (ja) | 1977-02-05 | 1978-02-03 | 螢光染料 |
| IT7819991A IT7819991A0 (it) | 1977-02-05 | 1978-02-03 | Coloranti a fluorescenza. |
| FR7803111A FR2379581A1 (fr) | 1977-02-05 | 1978-02-03 | Colorants fluorescents derives de la coumarine |
| BE184886A BE863634A (fr) | 1977-02-05 | 1978-02-03 | Colorants fluorescents derives de la coumarine |
| CH122878A CH621450B (de) | 1977-02-05 | 1978-02-03 | Fluoreszenzfarbstoffe. |
| US06/043,247 US4256900A (en) | 1977-02-05 | 1979-05-29 | Fluorescent azolyl benzocoumarin dyestuffs |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2704825A DE2704825C3 (de) | 1977-02-05 | 1977-02-05 | Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer Materialien |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2704825A1 DE2704825A1 (de) | 1978-08-10 |
| DE2704825B2 DE2704825B2 (de) | 1979-04-05 |
| DE2704825C3 true DE2704825C3 (de) | 1979-11-29 |
Family
ID=6000433
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2704825A Expired DE2704825C3 (de) | 1977-02-05 | 1977-02-05 | Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer Materialien |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4256900A (forum.php) |
| JP (1) | JPS5821936B2 (forum.php) |
| BE (1) | BE863634A (forum.php) |
| BR (1) | BR7800647A (forum.php) |
| CH (1) | CH621450B (forum.php) |
| DE (1) | DE2704825C3 (forum.php) |
| ES (1) | ES466626A1 (forum.php) |
| FR (1) | FR2379581A1 (forum.php) |
| GB (1) | GB1555453A (forum.php) |
| IN (1) | IN147054B (forum.php) |
| IT (1) | IT7819991A0 (forum.php) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3408028A1 (de) * | 1984-03-05 | 1985-09-12 | Kernforschungszentrum Karlsruhe Gmbh, 7500 Karlsruhe | Verwendung von substituierten und unsubstituierten ringueberbrueckten para-oligophenylenen als uv-laserfarbstoffe |
| US5041238A (en) * | 1986-02-18 | 1991-08-20 | Exciton Chemical Company | o,o'-Bridged oligophenylene laser dyes, dyestuff lasers and methods of lasing therewith |
| US5037578A (en) * | 1986-02-18 | 1991-08-06 | Exciton Chemical Company | O,O'-bridged oligophenylene laser dyes and dyestuff lasers and method of lasing therewith |
| EP0374668A3 (de) * | 1988-12-16 | 1992-02-05 | A.W. Faber - Castell GmbH & Co. | Fluoreszierende Markierungsflüssigkeit |
| JP3779604B2 (ja) * | 2001-01-15 | 2006-05-31 | 独立行政法人科学技術振興機構 | 放射線検出装置 |
| US7694887B2 (en) | 2001-12-24 | 2010-04-13 | L-1 Secure Credentialing, Inc. | Optically variable personalized indicia for identification documents |
| AU2002353174A1 (en) * | 2001-12-24 | 2003-07-15 | Digimarc Id Systems, Llc | Laser engraving methods and compositions |
| US7815124B2 (en) * | 2002-04-09 | 2010-10-19 | L-1 Secure Credentialing, Inc. | Image processing techniques for printing identification cards and documents |
| AU2002364036A1 (en) | 2001-12-24 | 2003-07-15 | Digimarc Id Systems, Llc | Laser etched security features for identification documents and methods of making same |
| AU2002364255A1 (en) | 2001-12-24 | 2003-07-15 | Digimarc Id Systems, Llc | Covert variable information on id documents and methods of making same |
| US7728048B2 (en) | 2002-12-20 | 2010-06-01 | L-1 Secure Credentialing, Inc. | Increasing thermal conductivity of host polymer used with laser engraving methods and compositions |
| WO2003056507A1 (en) * | 2001-12-24 | 2003-07-10 | Digimarc Id Systems, Llc | Systems, compositions, and methods for full color laser engraving of id documents |
| US7824029B2 (en) | 2002-05-10 | 2010-11-02 | L-1 Secure Credentialing, Inc. | Identification card printer-assembler for over the counter card issuing |
| WO2004049242A2 (en) | 2002-11-26 | 2004-06-10 | Digimarc Id Systems | Systems and methods for managing and detecting fraud in image databases used with identification documents |
| US7763179B2 (en) * | 2003-03-21 | 2010-07-27 | Digimarc Corporation | Color laser engraving and digital watermarking |
| DE602004030434D1 (de) | 2003-04-16 | 2011-01-20 | L 1 Secure Credentialing Inc | Dreidimensionale datenspeicherung |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL133761C (forum.php) * | 1961-08-19 | |||
| CH508691A (de) * | 1968-06-26 | 1971-06-15 | Ciba Geigy Ag | Verwendung von Verbindungen der 3-Phenyl-7-(4'-chlor-pyrazolyl-(1'))-cumarin-Reihe als optische Aufheller in nichttextilen Materialien |
| BE755136A (fr) * | 1969-08-23 | 1971-02-01 | Bayer Ag | Agents eclaircissants optiques a base de composes de 4-chloropyrazolyl |
| DE2050726A1 (de) * | 1970-10-15 | 1972-04-20 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Aufhellungsmittel |
| CH566359A5 (forum.php) * | 1972-06-21 | 1975-09-15 | Ciba Geigy Ag |
-
1977
- 1977-02-05 DE DE2704825A patent/DE2704825C3/de not_active Expired
- 1977-12-28 IN IN524/DEL/77A patent/IN147054B/en unknown
-
1978
- 1978-02-02 GB GB4274/78A patent/GB1555453A/en not_active Expired
- 1978-02-02 BR BR7800647A patent/BR7800647A/pt unknown
- 1978-02-03 BE BE184886A patent/BE863634A/xx not_active IP Right Cessation
- 1978-02-03 CH CH122878A patent/CH621450B/xx not_active IP Right Cessation
- 1978-02-03 IT IT7819991A patent/IT7819991A0/it unknown
- 1978-02-03 FR FR7803111A patent/FR2379581A1/fr not_active Withdrawn
- 1978-02-03 JP JP53010631A patent/JPS5821936B2/ja not_active Expired
- 1978-02-03 ES ES466626A patent/ES466626A1/es not_active Expired
-
1979
- 1979-05-29 US US06/043,247 patent/US4256900A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2379581A1 (fr) | 1978-09-01 |
| JPS5821936B2 (ja) | 1983-05-04 |
| GB1555453A (en) | 1979-11-07 |
| BE863634A (fr) | 1978-08-03 |
| DE2704825A1 (de) | 1978-08-10 |
| JPS5397025A (en) | 1978-08-24 |
| US4256900A (en) | 1981-03-17 |
| IT7819991A0 (it) | 1978-02-03 |
| CH621450B (de) | |
| CH621450GA3 (forum.php) | 1981-02-13 |
| IN147054B (forum.php) | 1979-10-27 |
| BR7800647A (pt) | 1978-09-12 |
| ES466626A1 (es) | 1978-10-01 |
| DE2704825B2 (de) | 1979-04-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2704825C3 (de) | Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer Materialien | |
| DE2262633B2 (de) | Sulfogruppen und v-Triazolylreste enthaltende 4,4'-Divinyldiphenyl-Verbindungen und deren Salze | |
| EP0014344A1 (de) | Cumarinverbindungen, Verfahren zu ihrer Herstellung und deren Verwendung als Weisstöner und Laserfarbstoffe | |
| DE1296121B (de) | Optische Aufhellungsmittel | |
| DE2939916A1 (de) | Quaternierte, verbrueckte benzimidazolyl-benzimidazole, verfahren zu deren herstellung und deren verwendung | |
| DE1470242C3 (de) | 7-Arenotriazolyl-3-phenyl-cumarine, deren Herstellung und Verwendung | |
| CH634077A5 (de) | Kationische aufheller. | |
| US4271293A (en) | Benzofuranyl-benzimidazoles | |
| EP0011824B1 (de) | Benzofuranyl-benzimidazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| DE2921641C2 (forum.php) | ||
| EP0248356B1 (de) | Schwefelsäureester-Gruppen enthaltende Naphthalimide, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2039492A1 (de) | Kationische Farbstoffe | |
| EP0005172B1 (de) | Cumarin-Verbindungen und ihre Verwendung als Aufheller für organische hochmolekulare Materialien | |
| DE1469223C (de) | Optische Aufhellungsmittel | |
| DE1670852B2 (de) | 5-arylotriazolyl-2-styrylbenzotriazole | |
| DE1444660A1 (de) | Azofarbstoffe | |
| DE1262206B (de) | Optische Aufhellungsmittel | |
| DE1594822C (de) | Optische Aufhellmittel | |
| DE1278983B (de) | Optische Aufhellmittel | |
| AT233507B (de) | Optische Aufhellungsmittel | |
| DE2011916A1 (en) | 1 2 4 -triazolyl-(1) derivs as optical bright- - ners for varnishes synthetic fibres | |
| CH243868A (de) | Schieblehre. | |
| CH628064A5 (de) | Verfahren zur herstellung von neuen alkoxy- bzw. alkylthiosubstituierten pyrimidin(thiono)-(thiol)-phosphor(phosphon)-saeureestern. | |
| CH625822A5 (en) | Process for preparing hydrazone dyes | |
| CH640243A5 (en) | Cationic brighteners |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |