DE2607028A1 - Reaktivfarbstoffe - Google Patents
ReaktivfarbstoffeInfo
- Publication number
- DE2607028A1 DE2607028A1 DE19762607028 DE2607028A DE2607028A1 DE 2607028 A1 DE2607028 A1 DE 2607028A1 DE 19762607028 DE19762607028 DE 19762607028 DE 2607028 A DE2607028 A DE 2607028A DE 2607028 A1 DE2607028 A1 DE 2607028A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- dyes
- sulfonic acid
- metal
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000003086 colorant Substances 0.000 title 1
- -1 bicyclic aryl radical Chemical class 0.000 claims description 23
- 239000000975 dye Substances 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 14
- 150000002367 halogens Chemical class 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 11
- 150000003254 radicals Chemical class 0.000 claims description 10
- 239000000985 reactive dye Substances 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 238000004043 dyeing Methods 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 125000000542 sulfonic acid group Chemical group 0.000 claims 1
- 239000002253 acid Substances 0.000 description 15
- 239000000460 chlorine Substances 0.000 description 14
- 230000008878 coupling Effects 0.000 description 14
- 238000010168 coupling process Methods 0.000 description 14
- 238000005859 coupling reaction Methods 0.000 description 14
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- POJOORKDYOPQLS-UHFFFAOYSA-L barium(2+) 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate Chemical compound [Ba+2].C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O.C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O POJOORKDYOPQLS-UHFFFAOYSA-L 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 125000004442 acylamino group Chemical group 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 206010039587 Scarlet Fever Diseases 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 3
- 125000000449 nitro group Chemical class [O-][N+](*)=O 0.000 description 3
- 150000003918 triazines Chemical class 0.000 description 3
- VOWZNBNDMFLQGM-UHFFFAOYSA-N 2,5-dimethylaniline Chemical compound CC1=CC=C(C)C(N)=C1 VOWZNBNDMFLQGM-UHFFFAOYSA-N 0.000 description 2
- GWIAAIUASRVOIA-UHFFFAOYSA-N 2-aminonaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 GWIAAIUASRVOIA-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- JXZGTFLJFKLVAX-UHFFFAOYSA-N 5-amino-2-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C=C1S(O)(=O)=O JXZGTFLJFKLVAX-UHFFFAOYSA-N 0.000 description 2
- GOYNRDSJTYLXBU-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Cl)C(F)=N1 GOYNRDSJTYLXBU-UHFFFAOYSA-N 0.000 description 2
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XAQCYASNAMYTQA-UHFFFAOYSA-N 2,4-diamino-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(N)C=C1N XAQCYASNAMYTQA-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- HUIFFRHUIIATQH-UHFFFAOYSA-N 2-amino-3,5-dimethoxybenzenesulfonic acid Chemical compound COC1=CC(OC)=C(N)C(S(O)(=O)=O)=C1 HUIFFRHUIIATQH-UHFFFAOYSA-N 0.000 description 1
- LHIOGENQCVAALC-UHFFFAOYSA-N 2-amino-4-(trifluoromethyl)benzenesulfonic acid Chemical compound NC1=CC(C(F)(F)F)=CC=C1S(O)(=O)=O LHIOGENQCVAALC-UHFFFAOYSA-N 0.000 description 1
- BDCJBCKISOZMBR-UHFFFAOYSA-N 2-amino-4-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(S(O)(=O)=O)C(N)=C1 BDCJBCKISOZMBR-UHFFFAOYSA-N 0.000 description 1
- FJHGMUDVUAXUEK-UHFFFAOYSA-N 2-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C(N)=C1 FJHGMUDVUAXUEK-UHFFFAOYSA-N 0.000 description 1
- YMJXNYUOEJPKHH-UHFFFAOYSA-N 2-amino-4-nitrobenzenesulfonic acid Chemical compound NC1=CC([N+]([O-])=O)=CC=C1S(O)(=O)=O YMJXNYUOEJPKHH-UHFFFAOYSA-N 0.000 description 1
- FGQDYDZVRHQDIN-UHFFFAOYSA-N 2-amino-5-(4-aminophenyl)benzenesulfonic acid Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C(S(O)(=O)=O)=C1 FGQDYDZVRHQDIN-UHFFFAOYSA-N 0.000 description 1
- VYZCFAPUHSSYCC-UHFFFAOYSA-N 2-amino-5-chloro-4-methylbenzenesulfonic acid Chemical compound CC1=CC(N)=C(S(O)(=O)=O)C=C1Cl VYZCFAPUHSSYCC-UHFFFAOYSA-N 0.000 description 1
- ZCGVPUAAMCMLTM-UHFFFAOYSA-N 2-amino-5-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C=C1S(O)(=O)=O ZCGVPUAAMCMLTM-UHFFFAOYSA-N 0.000 description 1
- KZKGEEGADAWJFS-UHFFFAOYSA-N 2-amino-5-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C(S(O)(=O)=O)=C1 KZKGEEGADAWJFS-UHFFFAOYSA-N 0.000 description 1
- LTPSRQRIPCVMKQ-UHFFFAOYSA-N 2-amino-5-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C(S(O)(=O)=O)=C1 LTPSRQRIPCVMKQ-UHFFFAOYSA-N 0.000 description 1
- LTASFWDWBYFZQQ-UHFFFAOYSA-N 2-amino-5-nitrobenzenesulfonic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O LTASFWDWBYFZQQ-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- AKLDPNVZTZIVFA-UHFFFAOYSA-N 2-azaniumyl-4,5-dichlorobenzenesulfonate Chemical compound NC1=CC(Cl)=C(Cl)C=C1S(O)(=O)=O AKLDPNVZTZIVFA-UHFFFAOYSA-N 0.000 description 1
- CMOQNSVFSKVGJA-UHFFFAOYSA-N 2-methoxy-n,5-dimethylaniline Chemical compound CNC1=CC(C)=CC=C1OC CMOQNSVFSKVGJA-UHFFFAOYSA-N 0.000 description 1
- NSWDWUHBMOIGOA-UHFFFAOYSA-N 3,5-diaminobenzenesulfonic acid Chemical compound NC1=CC(N)=CC(S(O)(=O)=O)=C1 NSWDWUHBMOIGOA-UHFFFAOYSA-N 0.000 description 1
- IRMGVBTVFRYBGN-UHFFFAOYSA-N 3-(methoxymethyl)aniline Chemical compound COCC1=CC=CC(N)=C1 IRMGVBTVFRYBGN-UHFFFAOYSA-N 0.000 description 1
- ZFMZSZMUFWRAOG-UHFFFAOYSA-N 3-methoxy-n-methylaniline Chemical compound CNC1=CC=CC(OC)=C1 ZFMZSZMUFWRAOG-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- WMPOWTWJFGZRIG-UHFFFAOYSA-N 4,5,6-tribromotriazine Chemical compound BrC1=NN=NC(Br)=C1Br WMPOWTWJFGZRIG-UHFFFAOYSA-N 0.000 description 1
- LZKGFGLOQNSMBS-UHFFFAOYSA-N 4,5,6-trichlorotriazine Chemical compound ClC1=NN=NC(Cl)=C1Cl LZKGFGLOQNSMBS-UHFFFAOYSA-N 0.000 description 1
- XRTJYEIMLZALBD-UHFFFAOYSA-N 4-(6-methyl-1,3-benzothiazol-2-yl)aniline Chemical compound S1C2=CC(C)=CC=C2N=C1C1=CC=C(N)C=C1 XRTJYEIMLZALBD-UHFFFAOYSA-N 0.000 description 1
- DRVYRUSLNIWBBL-UHFFFAOYSA-N 4-acetamido-2-amino-5-methylbenzenesulfonic acid Chemical compound CC(=O)NC1=CC(N)=C(S(O)(=O)=O)C=C1C DRVYRUSLNIWBBL-UHFFFAOYSA-N 0.000 description 1
- FOINSAWEWXUXPQ-UHFFFAOYSA-N 4-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(S(O)(=O)=O)C(N)=C1 FOINSAWEWXUXPQ-UHFFFAOYSA-N 0.000 description 1
- SJCTXIKOXTUQHC-UHFFFAOYSA-N 4-amino-2,5-dichlorobenzenesulfonic acid Chemical compound NC1=CC(Cl)=C(S(O)(=O)=O)C=C1Cl SJCTXIKOXTUQHC-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- PHRVJZNHPVJYOM-UHFFFAOYSA-N 5-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(N)C(S(O)(=O)=O)=C1 PHRVJZNHPVJYOM-UHFFFAOYSA-N 0.000 description 1
- VAANUEHPYNAMQR-UHFFFAOYSA-N 5-amino-2-(4-aminophenyl)cyclohexa-2,4-diene-1,1-disulfonic acid Chemical compound OS(=O)(=O)C1(S(O)(=O)=O)CC(N)=CC=C1C1=CC=C(N)C=C1 VAANUEHPYNAMQR-UHFFFAOYSA-N 0.000 description 1
- REJHVSOVQBJEBF-OWOJBTEDSA-N 5-azaniumyl-2-[(e)-2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-OWOJBTEDSA-N 0.000 description 1
- HBZVNWNSRNTWPS-UHFFFAOYSA-N 6-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(N)=CC=C21 HBZVNWNSRNTWPS-UHFFFAOYSA-N 0.000 description 1
- KZCSUEYBKAPKNH-UHFFFAOYSA-N 6-aminonaphthalene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KZCSUEYBKAPKNH-UHFFFAOYSA-N 0.000 description 1
- GFPQSWFFPRQEHH-UHFFFAOYSA-N 7-aminonaphthalene-1,3,6-trisulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(N)=CC2=C1S(O)(=O)=O GFPQSWFFPRQEHH-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 125000003830 C1- C4 alkylcarbonylamino group Chemical group 0.000 description 1
- REJHVSOVQBJEBF-UHFFFAOYSA-N DSD-acid Natural products OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- SQYUJKVKVFILNB-UHFFFAOYSA-N methyl 2-amino-4-[(2,5-dichlorophenyl)carbamoyl]benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1C(=O)NC1=CC(Cl)=CC=C1Cl SQYUJKVKVFILNB-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MWOUGPLLVVEUMM-UHFFFAOYSA-N n-ethyl-2-methylaniline Chemical compound CCNC1=CC=CC=C1C MWOUGPLLVVEUMM-UHFFFAOYSA-N 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- ILWOTYMRULOZEU-UHFFFAOYSA-N phenoxymethylsulfonylmethoxybenzene Chemical compound C=1C=CC=CC=1OCS(=O)(=O)COC1=CC=CC=C1 ILWOTYMRULOZEU-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/022—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring the heterocyclic ring being alternatively specified
- C09B62/026—Azo dyes
- C09B62/028—Monoazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762607028 DE2607028A1 (de) | 1976-02-20 | 1976-02-20 | Reaktivfarbstoffe |
| CH192677A CH614732A5 (en) | 1976-02-20 | 1977-02-16 | Process for preparing reactive dyes |
| GB646977A GB1530104A (en) | 1976-02-20 | 1977-02-16 | Reactive dyestuffs containing triazine and pyrimidine rings |
| BR7701000A BR7701000A (pt) | 1976-02-20 | 1977-02-17 | Corantes reativos isentos de metal,processo para a sua preparacao e seu emprego |
| FR7704761A FR2341626A1 (fr) | 1976-02-20 | 1977-02-18 | Colorants reactifs |
| JP1628777A JPS52102335A (en) | 1976-02-20 | 1977-02-18 | Reactive dyestuffs* process for manufacture thereof and utilization thereof |
| ES456030A ES456030A1 (es) | 1976-02-20 | 1977-02-18 | Procedimiento para la obtencion de colorantes reactivos li- bres de metal. |
| BE175058A BE851584A (fr) | 1976-02-20 | 1977-02-18 | Colorants reactifs |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762607028 DE2607028A1 (de) | 1976-02-20 | 1976-02-20 | Reaktivfarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2607028A1 true DE2607028A1 (de) | 1977-08-25 |
Family
ID=5970498
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762607028 Withdrawn DE2607028A1 (de) | 1976-02-20 | 1976-02-20 | Reaktivfarbstoffe |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS52102335A (enExample) |
| BE (1) | BE851584A (enExample) |
| BR (1) | BR7701000A (enExample) |
| CH (1) | CH614732A5 (enExample) |
| DE (1) | DE2607028A1 (enExample) |
| ES (1) | ES456030A1 (enExample) |
| FR (1) | FR2341626A1 (enExample) |
| GB (1) | GB1530104A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2749597A1 (de) * | 1977-11-05 | 1979-05-10 | Bayer Ag | Metallkomplex-reaktivfarbstoffe |
| DE3545555A1 (de) * | 1984-12-31 | 1986-07-10 | Sandoz-Patent-GmbH, 7850 Lörrach | Faserreaktive monoazoverbindungen |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2838274A1 (de) | 1978-09-01 | 1980-03-13 | Bayer Ag | Verfahren zum faerben und bedrucken von cellulosefasern mit reaktivfarbstoffen |
| DE2914142A1 (de) | 1979-04-07 | 1980-11-13 | Bayer Ag | Verfahren zum einbadigen, einstufigen faerben oder bedrucken von cellulosefasern mit faserreaktiven dispersionsfarbstoffen |
| DE3027546A1 (de) | 1980-07-21 | 1982-02-18 | Bayer Ag, 5090 Leverkusen | Reaktivfaerbeverfahren |
| EP0097119A3 (de) * | 1982-06-11 | 1984-09-05 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| DE3466555D1 (en) * | 1983-06-17 | 1987-11-05 | Ciba Geigy Ag | Reactive dyes, their preparation and their use |
| CH666298A5 (de) * | 1984-12-31 | 1988-07-15 | Sandoz Ag | Faserreaktive monoazoverbindungen. |
| US5227476A (en) * | 1987-01-14 | 1993-07-13 | Sandoz Ltd. | 2-(3,6,8-trisulfonaphth-2-ylazo)-5-[2-chloro-4-[2-(5-chloro-2,4-difluoropyrimid-6-ylamino)-2-methyl-ethyl]amino-1,3,5-triazin-6-ylamino]phenyl urea salts thereof |
| FR2609468B1 (fr) * | 1987-01-14 | 1989-07-13 | Sandoz Sa | Nouveaux composes monoazoiques, leur preparation et leur utilisation comme colorants reactifs |
| DE3918653C2 (de) * | 1988-06-14 | 2003-01-16 | Clariant Finance Bvi Ltd | Chromophore Verbindung mit heterocyclischem Reaktivrest |
| US5227477A (en) * | 1988-06-14 | 1993-07-13 | Sandoz Ltd. | Dyes having one or two 2,4- or 4,6-dichloro-5-cyanopyrimidyl groups linked through bridging radicals containing at least two nitrogen atoms to chloro-1,3,5-triazinyl groups |
| DE3910649A1 (de) * | 1989-04-01 | 1990-10-11 | Basf Ag | Reaktivfarbstoffe, die zwei oder drei stickstoffhaltige halogenheterocyclen als anker aufweisen |
| US5245020A (en) * | 1989-04-01 | 1993-09-14 | Basf Aktiengesellschaft | Reactive dyes with two or three nitrogen-containing haloheterocycles as reactive system |
| EP0513622B1 (de) * | 1991-05-15 | 1996-08-28 | Bayer Ag | Reaktivfarbstoffe |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH437574A (de) * | 1964-12-12 | 1967-06-15 | Siemens Ag | Schweissdrahtzuführungseinrichtung |
| BE787122A (fr) * | 1971-08-04 | 1973-02-05 | Ciba Geigy | Composes azoiques, leur preparation et leur utilisation |
-
1976
- 1976-02-20 DE DE19762607028 patent/DE2607028A1/de not_active Withdrawn
-
1977
- 1977-02-16 CH CH192677A patent/CH614732A5/xx not_active IP Right Cessation
- 1977-02-16 GB GB646977A patent/GB1530104A/en not_active Expired
- 1977-02-17 BR BR7701000A patent/BR7701000A/pt unknown
- 1977-02-18 BE BE175058A patent/BE851584A/xx unknown
- 1977-02-18 FR FR7704761A patent/FR2341626A1/fr active Granted
- 1977-02-18 ES ES456030A patent/ES456030A1/es not_active Expired
- 1977-02-18 JP JP1628777A patent/JPS52102335A/ja active Pending
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2749597A1 (de) * | 1977-11-05 | 1979-05-10 | Bayer Ag | Metallkomplex-reaktivfarbstoffe |
| DE3545555A1 (de) * | 1984-12-31 | 1986-07-10 | Sandoz-Patent-GmbH, 7850 Lörrach | Faserreaktive monoazoverbindungen |
Also Published As
| Publication number | Publication date |
|---|---|
| CH614732A5 (en) | 1979-12-14 |
| BR7701000A (pt) | 1977-10-18 |
| GB1530104A (en) | 1978-10-25 |
| ES456030A1 (es) | 1978-02-01 |
| FR2341626A1 (fr) | 1977-09-16 |
| FR2341626B1 (enExample) | 1980-09-19 |
| BE851584A (fr) | 1977-08-18 |
| JPS52102335A (en) | 1977-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0144766A2 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| DE2607028A1 (de) | Reaktivfarbstoffe | |
| EP0497174B1 (de) | Vinylsulfon/Pyrimidingruppenhaltige bifunktionelle Reaktivfarbstoffe | |
| EP0783028A1 (de) | Wasserlösliche Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0652262B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| DE3201114A1 (de) | Disazoreaktivfarbstoffe | |
| EP0513622B1 (de) | Reaktivfarbstoffe | |
| DE2331518A1 (de) | Neue farbstoffe, deren herstellung und verwendung | |
| EP0395951B1 (de) | Polyfunktionelle faserreaktive Farbstoffe | |
| EP0318785B1 (de) | Reaktivfarbstoffe | |
| JPH04288371A (ja) | 水溶性トリスアゾ染料 | |
| EP0641838B1 (de) | Reaktivfarbstoffe auf Basis einer substituierten Barbitursäure | |
| EP0133270A1 (de) | Reaktivfarbstoffe | |
| EP1490440A1 (de) | Wasserlösliche reaktive mono- und disazofarbstoffe | |
| DE69324430T2 (de) | Reaktivfarbstoffe | |
| EP0418664B1 (de) | Reaktivfarbstoffe | |
| DE3217312A1 (de) | Wasserloesliche disazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe | |
| DE69803988T2 (de) | Reaktive diamin-verknüpfte azofarbstoffe | |
| KR20030064892A (ko) | 종이를 염색하기 위한 디스아조 염료 및 이의 구리 착물 | |
| DE3502104A1 (de) | Azo-reaktivfarbstoffe | |
| EP0125650B1 (de) | Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Substraten | |
| EP0554746A1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| DE2603670A1 (de) | Reaktivfarbstoffe | |
| JPH07258567A (ja) | ジスアゾ染料 | |
| EP0013879A1 (de) | Reaktivfarbstoffe sowie deren Herstellung und Verwendung zum Färben von OH- und Amidgruppen enthaltenden Materialien |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |