DE2550964A1 - Hydantoinderivate - Google Patents
HydantoinderivateInfo
- Publication number
- DE2550964A1 DE2550964A1 DE19752550964 DE2550964A DE2550964A1 DE 2550964 A1 DE2550964 A1 DE 2550964A1 DE 19752550964 DE19752550964 DE 19752550964 DE 2550964 A DE2550964 A DE 2550964A DE 2550964 A1 DE2550964 A1 DE 2550964A1
- Authority
- DE
- Germany
- Prior art keywords
- hydantoin
- dichloro
- phenyl
- carbamoyl
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical class O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 title claims description 23
- 229940053195 antiepileptics hydantoin derivative Drugs 0.000 title claims description 6
- 229940091173 hydantoin Drugs 0.000 claims description 37
- -1 2-Tetrahydropyranyl-carbamoyl Chemical group 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000000417 fungicide Substances 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 230000000855 fungicidal effect Effects 0.000 claims description 5
- 150000001469 hydantoins Chemical class 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 241000233866 Fungi Species 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims description 2
- URFDSEBDUGSCLZ-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)imidazolidine-2,4-dione Chemical compound ClC1=CC(Cl)=CC(N2C(NC(=O)C2)=O)=C1 URFDSEBDUGSCLZ-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 230000003032 phytopathogenic effect Effects 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical group [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 36
- 239000000203 mixture Substances 0.000 description 13
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 238000005507 spraying Methods 0.000 description 5
- OGCORJSEYZKHIN-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)imidazolidine-2,4-dione Chemical compound ClC1=CC(Cl)=CC(N2C(NCC2=O)=O)=C1 OGCORJSEYZKHIN-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 206010061217 Infestation Diseases 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 241001480061 Blumeria graminis Species 0.000 description 3
- 241000209219 Hordeum Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 125000004188 dichlorophenyl group Chemical group 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241000218993 Begonia Species 0.000 description 2
- 241001465180 Botrytis Species 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229920001807 Urea-formaldehyde Polymers 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000012990 dithiocarbamate Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 230000017074 necrotic cell death Effects 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- QEGMOLVYSCOVJX-UHFFFAOYSA-N 1,1-dichloro-1,3,3,3-tetrafluoropropan-2-one Chemical compound FC(F)(F)C(=O)C(F)(Cl)Cl QEGMOLVYSCOVJX-UHFFFAOYSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- OZOMQRBLCMDCEG-VIZOYTHASA-N 1-[(e)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(O1)=CC=C1\C=N\N1C(=O)NC(=O)C1 OZOMQRBLCMDCEG-VIZOYTHASA-N 0.000 description 1
- SVMHBOVTFNUJNI-UHFFFAOYSA-N 1-chloro-2-isocyanatopropane Chemical compound ClCC(C)N=C=O SVMHBOVTFNUJNI-UHFFFAOYSA-N 0.000 description 1
- YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- YTOPFCCWCSOHFV-UHFFFAOYSA-N 2,6-dimethyl-4-tridecylmorpholine Chemical compound CCCCCCCCCCCCCN1CC(C)OC(C)C1 YTOPFCCWCSOHFV-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- UPTVJAJPBGIRLZ-UHFFFAOYSA-N 2-(trichloromethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical compound C1CC=CC2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C21 UPTVJAJPBGIRLZ-UHFFFAOYSA-N 0.000 description 1
- QRNATDQRFAUDKF-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate Chemical compound NC(=S)SCCSC(N)=S QRNATDQRFAUDKF-UHFFFAOYSA-N 0.000 description 1
- YAUCKEPYKXHCFF-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;manganese Chemical compound [Mn].NC(=S)SCCSC(N)=S YAUCKEPYKXHCFF-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical class OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- ZRDUSMYWDRPZRM-UHFFFAOYSA-N 2-sec-butyl-4,6-dinitrophenyl 3-methylbut-2-enoate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)C=C(C)C ZRDUSMYWDRPZRM-UHFFFAOYSA-N 0.000 description 1
- FOGYNLXERPKEGN-UHFFFAOYSA-N 3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfopropyl)phenoxy]propane-1-sulfonic acid Chemical compound COC1=CC=CC(CC(CS(O)(=O)=O)OC=2C(=CC(CCCS(O)(=O)=O)=CC=2)OC)=C1O FOGYNLXERPKEGN-UHFFFAOYSA-N 0.000 description 1
- ZJLQKSJSOGUHKZ-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-n-(2-ethylsulfanylethyl)-2,4-dioxoimidazolidine-1-carboxamide Chemical compound O=C1N(C(=O)NCCSCC)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 ZJLQKSJSOGUHKZ-UHFFFAOYSA-N 0.000 description 1
- AYMPHZGPDVLNIV-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-n-(2-methylsulfanylpropan-2-yl)-2,4-dioxoimidazolidine-1-carboxamide Chemical compound O=C1N(C(=O)NC(C)(C)SC)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 AYMPHZGPDVLNIV-UHFFFAOYSA-N 0.000 description 1
- JMORHHAQLBPSIZ-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-n-(oxan-2-yl)-2,4-dioxoimidazolidine-1-carboxamide Chemical compound ClC1=CC(Cl)=CC(N2C(N(C(=O)NC3OCCCC3)CC2=O)=O)=C1 JMORHHAQLBPSIZ-UHFFFAOYSA-N 0.000 description 1
- AQDMDSZWPQNPOG-UHFFFAOYSA-N 4-cyclodecyl-2,6-dimethylmorpholine Chemical compound C1C(C)OC(C)CN1C1CCCCCCCCC1 AQDMDSZWPQNPOG-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000005739 Bordeaux mixture Substances 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- HDWLUGYOLUHEMN-UHFFFAOYSA-N Dinobuton Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)OC(C)C HDWLUGYOLUHEMN-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241001363490 Monilia Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 241001377010 Pila Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 208000029221 Primary intralymphatic angioendothelioma Diseases 0.000 description 1
- 241000813090 Rhizoctonia solani Species 0.000 description 1
- 241000221662 Sclerotinia Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 230000009102 absorption Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- LJOZMWRYMKECFF-UHFFFAOYSA-N benodanil Chemical compound IC1=CC=CC=C1C(=O)NC1=CC=CC=C1 LJOZMWRYMKECFF-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- OOCMUZJPDXYRFD-UHFFFAOYSA-L calcium;2-dodecylbenzenesulfonate Chemical compound [Ca+2].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O OOCMUZJPDXYRFD-UHFFFAOYSA-L 0.000 description 1
- JHZKHCQYNONGAM-UHFFFAOYSA-N carbamothioylsulfanyl carbamodithioate;zinc Chemical compound [Zn].NC(=S)SSC(N)=S JHZKHCQYNONGAM-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- TWFZGCMQGLPBSX-UHFFFAOYSA-N carbendazim Chemical compound C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- PFIADAMVCJPXSF-UHFFFAOYSA-N chloroneb Chemical compound COC1=CC(Cl)=C(OC)C=C1Cl PFIADAMVCJPXSF-UHFFFAOYSA-N 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- WHDGWKAJBYRJJL-UHFFFAOYSA-K ferbam Chemical compound [Fe+3].CN(C)C([S-])=S.CN(C)C([S-])=S.CN(C)C([S-])=S WHDGWKAJBYRJJL-UHFFFAOYSA-K 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- CKAPSXZOOQJIBF-UHFFFAOYSA-N hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 125000005358 mercaptoalkyl group Chemical group 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- IFCXSMYJHPAWDK-UHFFFAOYSA-N n-(2-chloroethyl)-3-(3,5-dichlorophenyl)-2,4-dioxoimidazolidine-1-carboxamide Chemical compound O=C1N(C(=O)NCCCl)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 IFCXSMYJHPAWDK-UHFFFAOYSA-N 0.000 description 1
- OYRIKLVYHTWHCZ-UHFFFAOYSA-N n-cyclohexyl-2,5-dimethylfuran-3-carboxamide Chemical compound O1C(C)=CC(C(=O)NC2CCCCC2)=C1C OYRIKLVYHTWHCZ-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- LKPLKUMXSAEKID-UHFFFAOYSA-N pentachloronitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LKPLKUMXSAEKID-UHFFFAOYSA-N 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- FGVVTMRZYROCTH-UHFFFAOYSA-N pyridine-2-thiol N-oxide Chemical compound [O-][N+]1=CC=CC=C1S FGVVTMRZYROCTH-UHFFFAOYSA-N 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- YFNCATAIYKQPOO-UHFFFAOYSA-N thiophanate Chemical compound CCOC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OCC YFNCATAIYKQPOO-UHFFFAOYSA-N 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- DUBNHZYBDBBJHD-UHFFFAOYSA-L ziram Chemical compound [Zn+2].CN(C)C([S-])=S.CN(C)C([S-])=S DUBNHZYBDBBJHD-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
- C07D233/80—Two oxygen atoms, e.g. hydantoin with hetero atoms or acyl radicals directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752550964 DE2550964A1 (de) | 1975-11-13 | 1975-11-13 | Hydantoinderivate |
| IL50533A IL50533A (en) | 1975-11-13 | 1976-09-22 | Hydantoin derivatives and their use as fungicides |
| US05/725,843 US4071685A (en) | 1975-11-13 | 1976-09-23 | 1-Alkylcarbamoyl-3-(3,5-dichlorophenyl)-hydantoins |
| BE172073A BE847978A (fr) | 1975-11-13 | 1976-11-04 | Derives de l'hydantoine, |
| JP51131813A JPS5259159A (en) | 1975-11-13 | 1976-11-04 | Hydantoin derivatives and pasteurizing agent containing same |
| CH1417276A CH622510A5 (https=) | 1975-11-13 | 1976-11-10 | |
| HU76BA3485A HU176197B (en) | 1975-11-13 | 1976-11-11 | Fungicide compositions containing hidantoine derivative and process for producing the active agents |
| SU762418257A SU622386A3 (ru) | 1975-11-13 | 1976-11-11 | Фунгицидное средство |
| NL7612624A NL7612624A (nl) | 1975-11-13 | 1976-11-12 | Hydantoine-derivaten. |
| AT845076A AT348831B (de) | 1975-11-13 | 1976-11-12 | Fungizid |
| GB47162/76A GB1557689A (en) | 1975-11-13 | 1976-11-12 | 1 alkylcarbamyl 3 3,5dihalophenyl hydantoins and their as fungicides |
| FR7634145A FR2331559A1 (fr) | 1975-11-13 | 1976-11-12 | Nouveaux derives de l'hydantoine utiles comme fongicides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752550964 DE2550964A1 (de) | 1975-11-13 | 1975-11-13 | Hydantoinderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2550964A1 true DE2550964A1 (de) | 1977-08-04 |
Family
ID=5961648
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752550964 Withdrawn DE2550964A1 (de) | 1975-11-13 | 1975-11-13 | Hydantoinderivate |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4071685A (https=) |
| JP (1) | JPS5259159A (https=) |
| AT (1) | AT348831B (https=) |
| BE (1) | BE847978A (https=) |
| CH (1) | CH622510A5 (https=) |
| DE (1) | DE2550964A1 (https=) |
| FR (1) | FR2331559A1 (https=) |
| GB (1) | GB1557689A (https=) |
| HU (1) | HU176197B (https=) |
| IL (1) | IL50533A (https=) |
| NL (1) | NL7612624A (https=) |
| SU (1) | SU622386A3 (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3210188A1 (de) * | 1981-03-20 | 1982-09-30 | Rhône-Poulenc Agrochimie, 69009 Lyon | Fungizide zusammensetzung auf basis von 1-isopropyl-carbamoyl-3-(3,5-dichlorphenyl)-hydantoin |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2483414A1 (fr) * | 1980-05-29 | 1981-12-04 | Rhone Poulenc Agrochimie | Procede de preparation de carbamoyl-1(dichloro-3,5-phenyl)-3-hydantoines et chlorocarbonyl-1(dichloro-3,5-phenyl)-3-hydantoine intermediaire utilisable pour ce procede |
| DE3165038D1 (en) * | 1980-05-29 | 1984-08-30 | Rhone Poulenc Agrochimie | Process for the preparation of 1-carbamoyl-3-(3,5-dichlorophenyl)-hydantoin, and 1-chlorocarbonyl-3-(3,5-dichlorophenyl) hydantoin as intermediate in this process |
| FR2501966A1 (fr) * | 1981-03-20 | 1982-09-24 | Rhone Poulenc Agrochimie | Composition fongicide huileuse a base d'iprodione |
| FR2520975B2 (fr) * | 1982-02-05 | 1986-01-03 | Rhone Poulenc Agrochimie | Composition fongicide a base d'iprodione |
| FR2664269B1 (fr) * | 1990-07-05 | 1992-10-02 | Roussel Uclaf | Nouveaux derives n-substitues d'alpha-mercapto alkylamines, leur procede de preparation, leur application a titre de medicaments et les compositions les renfermant. |
| CN106008352B (zh) * | 2016-06-08 | 2019-06-21 | 中国农业科学院植物保护研究所 | 一种乙内酰脲衍生物及其制备方法和应用 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3716552A (en) * | 1969-10-09 | 1973-02-13 | Sumitomo Chemical Co | N'-alkanoyl-n''-dihalophenyl imidazolidinediones |
| FR2148868A6 (https=) * | 1970-10-06 | 1973-03-23 | Rhone Poulenc Sa |
-
1975
- 1975-11-13 DE DE19752550964 patent/DE2550964A1/de not_active Withdrawn
-
1976
- 1976-09-22 IL IL50533A patent/IL50533A/xx unknown
- 1976-09-23 US US05/725,843 patent/US4071685A/en not_active Expired - Lifetime
- 1976-11-04 JP JP51131813A patent/JPS5259159A/ja active Pending
- 1976-11-04 BE BE172073A patent/BE847978A/xx unknown
- 1976-11-10 CH CH1417276A patent/CH622510A5/de not_active IP Right Cessation
- 1976-11-11 SU SU762418257A patent/SU622386A3/ru active
- 1976-11-11 HU HU76BA3485A patent/HU176197B/hu unknown
- 1976-11-12 GB GB47162/76A patent/GB1557689A/en not_active Expired
- 1976-11-12 AT AT845076A patent/AT348831B/de not_active IP Right Cessation
- 1976-11-12 NL NL7612624A patent/NL7612624A/xx not_active Application Discontinuation
- 1976-11-12 FR FR7634145A patent/FR2331559A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3210188A1 (de) * | 1981-03-20 | 1982-09-30 | Rhône-Poulenc Agrochimie, 69009 Lyon | Fungizide zusammensetzung auf basis von 1-isopropyl-carbamoyl-3-(3,5-dichlorphenyl)-hydantoin |
Also Published As
| Publication number | Publication date |
|---|---|
| AT348831B (de) | 1979-03-12 |
| JPS5259159A (en) | 1977-05-16 |
| BE847978A (fr) | 1977-05-04 |
| CH622510A5 (https=) | 1981-04-15 |
| FR2331559B1 (https=) | 1979-08-31 |
| ATA845076A (de) | 1978-07-15 |
| GB1557689A (en) | 1979-12-12 |
| US4071685A (en) | 1978-01-31 |
| SU622386A3 (ru) | 1978-08-30 |
| HU176197B (en) | 1981-01-28 |
| NL7612624A (nl) | 1977-05-17 |
| IL50533A (en) | 1980-01-31 |
| FR2331559A1 (fr) | 1977-06-10 |
| IL50533A0 (en) | 1976-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3308806A1 (de) | Fungizide mittel, substituierte glucopyranosylamine und verfahren zur bekaempfung von pilzen | |
| DE2723942C2 (de) | ω-(1,2,4-Triazol-1-yl) acetophenonoximäther | |
| DD147043A5 (de) | Fungizide mittel | |
| EP0007479A1 (de) | N-Arylpropyl-substituierte cyclische Amine, Fungizide, die diese Verbindungen enthalten und Verfahren zu ihrer Herstellung | |
| CH635481A5 (de) | Fungizides mittel. | |
| EP0069330B1 (de) | Pyridincarbinole, Verfahren zu ihrer Herstellung und diese enthaltende Fungizide | |
| EP0130366B1 (de) | Arylalkylimidazolium- und -triazoliumsalze, Verfahren zu ihrer Herstellung und ihre Verwendung als Mikrozide | |
| EP0159584B1 (de) | N-(Azolylcarbamoyl)-hydroxylamine und diese enthaltende Fungizide | |
| DE2550964A1 (de) | Hydantoinderivate | |
| DE2634511A1 (de) | Beta-azolylketone | |
| DE2324591A1 (de) | Oxazolidin-derivate | |
| DE2611601A1 (de) | Nicotinsaeureanilide | |
| DE2926096A1 (de) | Fungizide beta -triazolylether, ihre herstellung und verwendung | |
| EP0057362B1 (de) | Dibenzofuranderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Pilzen | |
| DE2556319A1 (de) | Substituierte triazol-aether | |
| DE3003933A1 (de) | (beta) -imidazolylalkohole, verfahren zu ihrer herstellung, diese enthaltende fungizide und verfahren zur bekaempfung von pilzen mit ihnen | |
| EP0061037A1 (de) | Fungizide Mittel auf Basis von 1,2-Oxazolylalkylphosphaten und die Verwendung dieser Wirkstoffe zur Bekämpfung von Pilzen | |
| DE2918801A1 (de) | Carbinolether | |
| EP0071095B1 (de) | Phenylketenacetale und diese enthaltende Fungizide | |
| EP0056125B1 (de) | Keten-O,N-acetale, Verfahren zu ihrer Herstellung, diese enthaltende Fungizide und ihre Verwendung zur Bekämpfung von Pilzen | |
| DE3100260A1 (de) | Substituierte azolyl-glykolsulfonate, diese enthaltende fungizide und verfahren zu ihrer herstellung | |
| DE3021834A1 (de) | Azolyl-4-nitro-2-trichlormethyl-benzolsulfone, ihre herstellung und verwendung | |
| DE2611902A1 (de) | N-(fluordichlormethylthio)-benzoesaeureanilide | |
| EP0094562B1 (de) | Diaminderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| DE2540872A1 (de) | Hydantoin-derivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |