DE2542669B2 - Schaltungsplatte, Verfahren zu deren Herstellung und deren Verwendung - Google Patents
Schaltungsplatte, Verfahren zu deren Herstellung und deren VerwendungInfo
- Publication number
- DE2542669B2 DE2542669B2 DE2542669A DE2542669A DE2542669B2 DE 2542669 B2 DE2542669 B2 DE 2542669B2 DE 2542669 A DE2542669 A DE 2542669A DE 2542669 A DE2542669 A DE 2542669A DE 2542669 B2 DE2542669 B2 DE 2542669B2
- Authority
- DE
- Germany
- Prior art keywords
- circuit board
- ink
- board according
- circuit
- radiation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 230000008569 process Effects 0.000 title description 2
- 229920005989 resin Polymers 0.000 claims description 33
- 239000011347 resin Substances 0.000 claims description 33
- 239000000203 mixture Substances 0.000 claims description 32
- 239000011230 binding agent Substances 0.000 claims description 25
- 229910052751 metal Inorganic materials 0.000 claims description 24
- 239000002184 metal Substances 0.000 claims description 24
- 239000000758 substrate Substances 0.000 claims description 23
- 239000000463 material Substances 0.000 claims description 19
- 230000005855 radiation Effects 0.000 claims description 18
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 16
- 229910052709 silver Inorganic materials 0.000 claims description 16
- 239000004332 silver Substances 0.000 claims description 16
- 239000004793 Polystyrene Substances 0.000 claims description 10
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 10
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 claims description 10
- 229920002223 polystyrene Polymers 0.000 claims description 7
- 229920000728 polyester Polymers 0.000 claims description 5
- 229910001923 silver oxide Inorganic materials 0.000 claims description 5
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 claims description 4
- 239000011236 particulate material Substances 0.000 claims description 4
- 238000007639 printing Methods 0.000 claims description 4
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 claims description 3
- 239000012964 benzotriazole Substances 0.000 claims description 3
- 229920000620 organic polymer Polymers 0.000 claims description 3
- 230000004580 weight loss Effects 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 238000010894 electron beam technology Methods 0.000 claims description 2
- 239000011159 matrix material Substances 0.000 claims description 2
- 229920001225 polyester resin Polymers 0.000 claims description 2
- 239000004645 polyester resin Substances 0.000 claims description 2
- 238000007650 screen-printing Methods 0.000 claims description 2
- 238000010586 diagram Methods 0.000 claims 1
- 239000002491 polymer binding agent Substances 0.000 claims 1
- 239000000976 ink Substances 0.000 description 41
- 238000012360 testing method Methods 0.000 description 12
- -1 allyl ethers Chemical class 0.000 description 9
- 239000003822 epoxy resin Substances 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 229920000647 polyepoxide Polymers 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 239000011231 conductive filler Substances 0.000 description 5
- 239000004020 conductor Substances 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 238000001723 curing Methods 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 150000002739 metals Chemical class 0.000 description 5
- 239000003504 photosensitizing agent Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 239000011324 bead Substances 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- 239000002736 nonionic surfactant Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 230000035945 sensitivity Effects 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 150000001565 benzotriazoles Chemical class 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 229920000058 polyacrylate Polymers 0.000 description 3
- 229940100890 silver compound Drugs 0.000 description 3
- 150000003379 silver compounds Chemical class 0.000 description 3
- 150000005846 sugar alcohols Polymers 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- ZXSQEZNORDWBGZ-UHFFFAOYSA-N 1,3-dihydropyrrolo[2,3-b]pyridin-2-one Chemical compound C1=CN=C2NC(=O)CC2=C1 ZXSQEZNORDWBGZ-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- NPFYZDNDJHZQKY-UHFFFAOYSA-N 4-Hydroxybenzophenone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 NPFYZDNDJHZQKY-UHFFFAOYSA-N 0.000 description 2
- OECTYKWYRCHAKR-UHFFFAOYSA-N 4-vinylcyclohexene dioxide Chemical compound C1OC1C1CC2OC2CC1 OECTYKWYRCHAKR-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- 229920000896 Ethulose Polymers 0.000 description 2
- 239000001859 Ethyl hydroxyethyl cellulose Substances 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 244000028419 Styrax benzoin Species 0.000 description 2
- 235000000126 Styrax benzoin Nutrition 0.000 description 2
- 235000008411 Sumatra benzointree Nutrition 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 235000019326 ethyl hydroxyethyl cellulose Nutrition 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 238000009415 formwork Methods 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 235000019382 gum benzoic Nutrition 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000011810 insulating material Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 239000011049 pearl Substances 0.000 description 2
- QCCDLTOVEPVEJK-UHFFFAOYSA-N phenylacetone Chemical compound CC(=O)CC1=CC=CC=C1 QCCDLTOVEPVEJK-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 238000007747 plating Methods 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- LKZMBDSASOBTPN-UHFFFAOYSA-L silver carbonate Substances [Ag].[O-]C([O-])=O LKZMBDSASOBTPN-UHFFFAOYSA-L 0.000 description 2
- 229910001958 silver carbonate Inorganic materials 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- ZWAJLVLEBYIOTI-OLQVQODUSA-N (1s,6r)-7-oxabicyclo[4.1.0]heptane Chemical compound C1CCC[C@@H]2O[C@@H]21 ZWAJLVLEBYIOTI-OLQVQODUSA-N 0.000 description 1
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 1
- MIOKJIDWWJEJDE-UHFFFAOYSA-N (4-dodecyl-2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC(CCCCCCCCCCCC)=CC=C1C(=O)C1=CC=CC=C1 MIOKJIDWWJEJDE-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical class C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- VUBUXALTYMBEQO-UHFFFAOYSA-N 2,2,3,3,3-pentafluoro-1-phenylpropan-1-one Chemical compound FC(F)(F)C(F)(F)C(=O)C1=CC=CC=C1 VUBUXALTYMBEQO-UHFFFAOYSA-N 0.000 description 1
- QYXHDJJYVDLECA-UHFFFAOYSA-N 2,5-diphenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=C(C=2C=CC=CC=2)C(=O)C=C1C1=CC=CC=C1 QYXHDJJYVDLECA-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- DBBSWURSQHDBEQ-UHFFFAOYSA-N 2-butan-2-yloxy-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(OC(C)CC)C(=O)C1=CC=CC=C1 DBBSWURSQHDBEQ-UHFFFAOYSA-N 0.000 description 1
- BQZJOQXSCSZQPS-UHFFFAOYSA-N 2-methoxy-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(OC)C(=O)C1=CC=CC=C1 BQZJOQXSCSZQPS-UHFFFAOYSA-N 0.000 description 1
- DCCXSCIRSRPUJX-UHFFFAOYSA-N 2-oxopropanoic acid;silver Chemical compound [Ag].CC(=O)C(O)=O DCCXSCIRSRPUJX-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- KQOONMHVLXAXSH-UHFFFAOYSA-N 3-hydroxy-1,2-diphenyl-2-propan-2-yloxypropan-1-one Chemical compound C=1C=CC=CC=1C(CO)(OC(C)C)C(=O)C1=CC=CC=C1 KQOONMHVLXAXSH-UHFFFAOYSA-N 0.000 description 1
- CMGDVUCDZOBDNL-UHFFFAOYSA-N 4-methyl-2h-benzotriazole Chemical compound CC1=CC=CC2=NNN=C12 CMGDVUCDZOBDNL-UHFFFAOYSA-N 0.000 description 1
- RBHIUNHSNSQJNG-UHFFFAOYSA-N 6-methyl-3-(2-methyloxiran-2-yl)-7-oxabicyclo[4.1.0]heptane Chemical compound C1CC2(C)OC2CC1C1(C)CO1 RBHIUNHSNSQJNG-UHFFFAOYSA-N 0.000 description 1
- BNDNAARXJVXTED-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]heptan-4-yl 4-methyl-7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1CC2OC2CC1OC(=O)C1(C)CC2OC2CC1 BNDNAARXJVXTED-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 229920001479 Hydroxyethyl methyl cellulose Polymers 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920002319 Poly(methyl acrylate) Polymers 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000008360 acrylonitriles Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001227 electron beam curing Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- IAJNXBNRYMEYAZ-UHFFFAOYSA-N ethyl 2-cyano-3,3-diphenylprop-2-enoate Chemical compound C=1C=CC=CC=1C(=C(C#N)C(=O)OCC)C1=CC=CC=C1 IAJNXBNRYMEYAZ-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 239000002923 metal particle Substances 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- YCIMNLLNPGFGHC-UHFFFAOYSA-N o-dihydroxy-benzene Natural products OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 1
- FMJSMJQBSVNSBF-UHFFFAOYSA-N octocrylene Chemical compound C=1C=CC=CC=1C(=C(C#N)C(=O)OCC(CC)CCCC)C1=CC=CC=C1 FMJSMJQBSVNSBF-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 125000005375 organosiloxane group Chemical group 0.000 description 1
- DXGLGDHPHMLXJC-UHFFFAOYSA-N oxybenzone Chemical compound OC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 DXGLGDHPHMLXJC-UHFFFAOYSA-N 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000003847 radiation curing Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011342 resin composition Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- CHACQUSVOVNARW-LNKPDPKZSA-M silver;(z)-4-oxopent-2-en-2-olate Chemical compound [Ag+].C\C([O-])=C\C(C)=O CHACQUSVOVNARW-LNKPDPKZSA-M 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000004250 tert-Butylhydroquinone Substances 0.000 description 1
- 235000019281 tert-butylhydroquinone Nutrition 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 125000005323 thioketone group Chemical group 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05K—PRINTED CIRCUITS; CASINGS OR CONSTRUCTIONAL DETAILS OF ELECTRIC APPARATUS; MANUFACTURE OF ASSEMBLAGES OF ELECTRICAL COMPONENTS
- H05K1/00—Printed circuits
- H05K1/02—Details
- H05K1/09—Use of materials for the conductive, e.g. metallic pattern
- H05K1/092—Dispersed materials, e.g. conductive pastes or inks
- H05K1/095—Dispersed materials, e.g. conductive pastes or inks for polymer thick films, i.e. having a permanent organic polymeric binder
Landscapes
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Parts Printed On Printed Circuit Boards (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Manufacturing Of Printed Wiring (AREA)
- Discharge-Lamp Control Circuits And Pulse- Feed Circuits (AREA)
- Manufacturing Of Printed Circuit Boards (AREA)
- Printing Methods (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/509,893 US3988647A (en) | 1974-09-27 | 1974-09-27 | Method for making a circuit board and article made thereby |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2542669A1 DE2542669A1 (de) | 1976-04-01 |
| DE2542669B2 true DE2542669B2 (de) | 1979-06-13 |
| DE2542669C3 DE2542669C3 (enExample) | 1983-11-10 |
Family
ID=24028535
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2542669A Granted DE2542669B2 (de) | 1974-09-27 | 1975-09-25 | Schaltungsplatte, Verfahren zu deren Herstellung und deren Verwendung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3988647A (enExample) |
| JP (1) | JPS5147273A (enExample) |
| BE (1) | BE833858A (enExample) |
| CA (1) | CA1040318A (enExample) |
| DE (1) | DE2542669B2 (enExample) |
| GB (1) | GB1525725A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3741918A1 (de) * | 1987-12-10 | 1989-06-22 | Heino Pachschwoell | Verfahren zur herstellung einer elektronischen schaltungsvorrichtung |
| DE102008031893A1 (de) * | 2008-07-08 | 2010-01-14 | W.C. Heraeus Gmbh | Verfahren zur Fügung von Metallflächen |
Families Citing this family (57)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE30274E (en) * | 1974-09-27 | 1980-05-13 | General Electric Company | Method for making a circuit board and article made thereby |
| NL7507857A (nl) * | 1975-07-02 | 1977-01-04 | Philips Nv | Flitspakket met een hoogspanningsverbrandingsflits- lamp. |
| JPS531865A (en) * | 1976-06-25 | 1978-01-10 | Sharp Kk | Method of producing printed circuit board |
| US4080155A (en) * | 1977-03-18 | 1978-03-21 | General Electric Company | Switching devices for photoflash unit |
| US4141055A (en) * | 1977-04-27 | 1979-02-20 | Bell Telephone Laboratories, Incorporated | Crossover structure for microelectronic circuits |
| FR2402379A1 (fr) * | 1977-08-31 | 1979-03-30 | Cayrol Pierre Henri | Perfectionnements apportes aux circuits imprimes |
| US4182608A (en) * | 1977-12-01 | 1980-01-08 | General Electric Company | Photoflash lamp unit utilizing radiation and voltage responsive switch devices |
| US4182607A (en) * | 1977-12-01 | 1980-01-08 | General Electric Company | Photoflash lamp unit utilizing radiation and voltage responsive switch devices |
| US4257764A (en) * | 1978-05-18 | 1981-03-24 | Westinghouse Electric Corp. | Flash lamp array with improved switch mounting |
| US4240786A (en) * | 1978-06-08 | 1980-12-23 | Westinghouse Electric Corp. | Switching devices for a flash lamp array and method |
| US4234304A (en) * | 1978-07-11 | 1980-11-18 | Westinghouse Electric Corp. | Circuit board having conductor runs resistant to formation of non-conductive localized areas and method |
| USD279670S (en) | 1978-07-31 | 1985-07-16 | Lukits John J | Component side of a printed circuit board |
| US4238543A (en) * | 1978-11-22 | 1980-12-09 | General Electric Company | Electrical connection means for a linear photoflash lamp array |
| US4299558A (en) * | 1979-05-21 | 1981-11-10 | General Electric Company | Switching devices for photoflash unit |
| US4290747A (en) * | 1979-11-09 | 1981-09-22 | General Electric Company | Photoflash lamp array circuit board having radiation sensitive fuse elements |
| US4290748A (en) * | 1979-11-09 | 1981-09-22 | General Electric Company | Photoflash lamp array circuit board having radiation sensitive fuse elements |
| US4261773A (en) * | 1979-12-20 | 1981-04-14 | General Electric Company | Electrical connection means for a linear photoflash lamp array |
| US4320572A (en) * | 1980-03-19 | 1982-03-23 | Gte Products Corporation | Die-stamped circuit board assembly having relief means-method of making |
| US4345895A (en) * | 1980-03-19 | 1982-08-24 | Gte Products Corporation | Photoflash device having die-stamped circuit board assembly with flexure means to prevent switch cutting |
| US4325771A (en) * | 1980-03-19 | 1982-04-20 | Gte Products Corporation | Method of making a die-stamped circuit board assembly for photoflash devices |
| US4330821A (en) * | 1980-05-09 | 1982-05-18 | Gte Products Corporation | Radiation switch for photoflash unit |
| US4336570A (en) * | 1980-05-09 | 1982-06-22 | Gte Products Corporation | Radiation switch for photoflash unit |
| JPS57125087A (en) * | 1981-01-28 | 1982-08-04 | Toppan Printing Co Ltd | Thick film printing |
| JPS5824032B2 (ja) * | 1981-04-16 | 1983-05-18 | 北陸電気工業株式会社 | Cu粉末導電塗料を用いた印刷配線基板の製造方法 |
| CA1190736A (en) * | 1981-06-03 | 1985-07-23 | Robert J. Moneta | Copper conductor composition for porcelain enamel steel substrates |
| US4521329A (en) * | 1983-06-20 | 1985-06-04 | E. I. Du Pont De Nemours And Company | Copper conductor compositions |
| US4514321A (en) * | 1983-08-25 | 1985-04-30 | E. I. Du Pont De Nemours And Company | Thick film conductor compositions |
| US4540604A (en) * | 1983-08-25 | 1985-09-10 | E. I. Du Pont De Nemours And Company | Thick film conductor compositions |
| US4661058A (en) * | 1984-06-22 | 1987-04-28 | Gte Products Corporation | Stabilized silver compound switch |
| US4659307A (en) * | 1984-06-22 | 1987-04-21 | Gte Products Corporation | Aluminum hydroxide stabilized switch |
| US4594181A (en) * | 1984-09-17 | 1986-06-10 | E. I. Du Pont De Nemours And Company | Metal oxide-coated copper powder |
| US4600604A (en) * | 1984-09-17 | 1986-07-15 | E. I. Du Pont De Nemours And Company | Metal oxide-coated copper powder |
| US4554033A (en) * | 1984-10-04 | 1985-11-19 | Amp Incorporated | Method of forming an electrical interconnection means |
| US4725478A (en) * | 1985-09-04 | 1988-02-16 | W. R. Grace & Co. | Heat-miniaturizable printed circuit board |
| US4868034A (en) * | 1988-02-11 | 1989-09-19 | Heraeus Incorporated Cermalloy Division | Non-oxidizing copper thick film conductors |
| TW227518B (enExample) * | 1992-06-30 | 1994-08-01 | Toa Gosei Chem Ind | |
| US7157507B2 (en) * | 1999-04-14 | 2007-01-02 | Allied Photochemical, Inc. | Ultraviolet curable silver composition and related method |
| US6290881B1 (en) | 1999-04-14 | 2001-09-18 | Allied Photochemical, Inc. | Ultraviolet curable silver composition and related method |
| CA2385041C (en) | 1999-10-06 | 2009-11-24 | Uv Specialities, Inc. | Uv curable compositions for producing electroluminescent coatings |
| US6767577B1 (en) | 1999-10-06 | 2004-07-27 | Allied Photochemical, Inc. | Uv curable compositions for producing electroluminescent coatings |
| US6509389B1 (en) * | 1999-11-05 | 2003-01-21 | Uv Specialties, Inc. | UV curable compositions for producing mar resistant coatings and method for depositing same |
| US6500877B1 (en) | 1999-11-05 | 2002-12-31 | Krohn Industries, Inc. | UV curable paint compositions and method of making and applying same |
| MXPA02005257A (es) * | 1999-12-06 | 2003-09-22 | Slidekote Inc | Composiciones curables por uv. |
| US20060100302A1 (en) * | 1999-12-06 | 2006-05-11 | Krohn Roy C | UV curable compositions for producing multilayer paint coatings |
| AU4139501A (en) | 1999-12-06 | 2001-06-12 | Krohn Industries, Inc. | Uv curable compositions for producing multilayer pain coatings |
| US6805917B1 (en) | 1999-12-06 | 2004-10-19 | Roy C. Krohn | UV curable compositions for producing decorative metallic coatings |
| EP1263892A1 (en) * | 2000-01-13 | 2002-12-11 | UV Specialties, Inc. | Uv curable transparent conductive compositions |
| EP1263891A1 (en) * | 2000-01-13 | 2002-12-11 | UV Specialties, Inc. | Uv curable ferromagnetic compositions |
| US7323499B2 (en) | 2000-09-06 | 2008-01-29 | Allied Photochemical, Inc. | UV curable silver chloride compositions for producing silver coatings |
| EP1325171A2 (en) * | 2000-09-06 | 2003-07-09 | Allied Photochemical, Inc. | Uv curable silver chloride compositions for producing silver coatings |
| WO2002080637A1 (en) | 2001-04-02 | 2002-10-10 | Nashua Corporation | Circuit elements having an embedded conductive trace and methods of manufacture |
| JP3805996B2 (ja) * | 2001-04-20 | 2006-08-09 | シャープ株式会社 | 採光型合わせガラス構造太陽電池モジュール及び採光型複層構造太陽電池モジュール |
| US6652956B2 (en) * | 2001-07-24 | 2003-11-25 | International Business Machines Corporation | X-ray printing personalization technique |
| EP1383364A3 (en) * | 2002-05-23 | 2006-01-04 | Nashua Corporation | Circuit elements having an ink receptive coating and a conductive trace and methods of manufacture |
| US6946628B2 (en) | 2003-09-09 | 2005-09-20 | Klai Enterprises, Inc. | Heating elements deposited on a substrate and related method |
| US20050101686A1 (en) * | 2003-11-07 | 2005-05-12 | Krohn Roy C. | UV curable composition for forming dielectric coatings and related method |
| US20050101685A1 (en) * | 2003-11-07 | 2005-05-12 | Allied Photochemical, Inc. | UV curable composition for forming dielectric coatings and related method |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB690478A (en) * | 1948-11-12 | 1953-04-22 | Ward Blenkinsop & Co Ltd | Improvements in or relating to electrical resistors |
| US3280741A (en) * | 1958-12-31 | 1966-10-25 | Burroughs Corp | Electrostatic recording |
| US3202483A (en) * | 1963-05-28 | 1965-08-24 | Socony Mobil Oil Co Inc | Testing of solutions |
| NL154332B (nl) * | 1966-06-04 | 1977-08-15 | Philips Nv | Serieflitsarmatuur met achtereenvolgens te ontsteken flitslampen. |
| FR1531272A (fr) * | 1966-07-18 | 1968-06-28 | Ici Ltd | Compositions de polymères contenant un matériau conducteur de l'électricité |
| US3551311A (en) * | 1967-11-24 | 1970-12-29 | Sun Chemical Corp | Radiation-curable compositions |
| US3535148A (en) * | 1968-08-07 | 1970-10-20 | Continental Can Co | Process for preparing polymerized aminoplast surface coatings using ionizing radiation |
| US3573230A (en) * | 1968-10-16 | 1971-03-30 | Acheson Ind Inc | Electrically conductive,low friction fluorocarbon polymer coating method |
| US3608451A (en) * | 1969-09-18 | 1971-09-28 | Lester S Kelem | Structure for exposing photographic film with flash illumination |
| DE1963286C3 (de) * | 1969-12-17 | 1974-03-14 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Paste zur Herstellung von Dickfilmverdrahtungen |
| US3726728A (en) * | 1970-04-20 | 1973-04-10 | Us Navy | Binderless cast photoflash compositions |
| US3801364A (en) * | 1971-02-03 | 1974-04-02 | Matsushita Electric Industrial Co Ltd | Method for making printed circuits which include printed resistors |
| US3937946A (en) * | 1974-03-06 | 1976-02-10 | General Electric Company | Multiple flash lamp unit |
| US3912442A (en) * | 1974-08-21 | 1975-10-14 | Gen Electric | Connector for photoflash array |
-
1974
- 1974-09-27 US US05/509,893 patent/US3988647A/en not_active Expired - Lifetime
-
1975
- 1975-08-22 JP JP50101291A patent/JPS5147273A/ja active Granted
- 1975-09-09 GB GB37021/75A patent/GB1525725A/en not_active Expired
- 1975-09-25 CA CA236,432A patent/CA1040318A/en not_active Expired
- 1975-09-25 DE DE2542669A patent/DE2542669B2/de active Granted
- 1975-09-26 BE BE160402A patent/BE833858A/xx not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3741918A1 (de) * | 1987-12-10 | 1989-06-22 | Heino Pachschwoell | Verfahren zur herstellung einer elektronischen schaltungsvorrichtung |
| DE102008031893A1 (de) * | 2008-07-08 | 2010-01-14 | W.C. Heraeus Gmbh | Verfahren zur Fügung von Metallflächen |
Also Published As
| Publication number | Publication date |
|---|---|
| US3988647A (en) | 1976-10-26 |
| JPS5621273B2 (enExample) | 1981-05-18 |
| GB1525725A (en) | 1978-09-20 |
| CA1040318A (en) | 1978-10-10 |
| DE2542669C3 (enExample) | 1983-11-10 |
| JPS5147273A (en) | 1976-04-22 |
| BE833858A (fr) | 1976-01-16 |
| DE2542669A1 (de) | 1976-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2542669B2 (de) | Schaltungsplatte, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2542737C3 (de) | Strahlungshärtbare Tinte | |
| USRE30274E (en) | Method for making a circuit board and article made thereby | |
| DE2518639C3 (de) | Härtbare Zusammensetzungen | |
| US4049844A (en) | Method for making a circuit board and article made thereby | |
| CA1049254A (en) | Radiation curable inks | |
| DE60305333T2 (de) | Druckprozess und lötmaskenfarbstoffzusammensetzung | |
| US3989644A (en) | Radiation curable inks | |
| DE68912018T2 (de) | UV-härtbare Polymerzusammensetzung. | |
| DE2346424C2 (de) | Strahlungshärtbare, nicht gelierte Massen | |
| EP0106628B1 (en) | Printing ink | |
| DE3717199C2 (enExample) | ||
| DE3511615A1 (de) | Positive polysilan-photoresistmaterialien und verfahren zu deren verwendung | |
| DE2411398A1 (de) | Verfahren zur herstellung einer photohaertbaren zusammensetzung fuer den siebdruck | |
| DE69734510T2 (de) | Lichtempfindliche zusammensetzung und weisse beschichtung | |
| DE2458508A1 (de) | Verfahren zum erzeugen einer hydrophoben oberflaeche | |
| EP0562393B1 (de) | Verfahren zur Verbesserung der Haftfestigkeit von stromlos abgeschiedenen Metallschichten | |
| DE3317912A1 (de) | Verfahren zur herstellung einer leitfaehigen pigmentbeschichteten oberflaeche | |
| DE112017002573T5 (de) | Tintenstrahlharzzusammensetzung und gedruckte Leiterplatte, die dieselbe verwendet | |
| DE1570748A1 (de) | Photopolymer | |
| DE2833648A1 (de) | Photohaertbare zusammensetzungen und haertungsverfahren | |
| DE4435376A1 (de) | Zusammensetzung zur Bildung leitfähiger Filme | |
| DE2427656A1 (de) | Photohaertbare pastenzusammensetzungen mit hoher rasterschaerfe | |
| DE2949349A1 (de) | Durch belichten haertbare, elektrisch leitfaehige beschichtungsmasse und verfahren zur herstellung von silberaggregatteilchen fuer eine solche masse | |
| DE1770629A1 (de) | Fotoelektrisches Polymerisationsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8281 | Inventor (new situation) |
Free format text: BOLON, DONALD ALLEN, SCOTIA, N.Y., US LUCAS, GARY MORGAN, SCHENECTADY, N.Y., US BARTHOLOMEW, RALPH LEE, PAINESVILLE, OHIO, US |
|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |