DE2539781A1 - Kondensator mit einem kondensatorwickelelement und verfahren zur herstellung des kondensatorwickelelements - Google Patents
Kondensator mit einem kondensatorwickelelement und verfahren zur herstellung des kondensatorwickelelementsInfo
- Publication number
- DE2539781A1 DE2539781A1 DE19752539781 DE2539781A DE2539781A1 DE 2539781 A1 DE2539781 A1 DE 2539781A1 DE 19752539781 DE19752539781 DE 19752539781 DE 2539781 A DE2539781 A DE 2539781A DE 2539781 A1 DE2539781 A1 DE 2539781A1
- Authority
- DE
- Germany
- Prior art keywords
- winding
- capacitor
- strips
- dielectric
- solid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000004804 winding Methods 0.000 title claims description 115
- 239000003990 capacitor Substances 0.000 title claims description 82
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 239000007788 liquid Substances 0.000 claims description 28
- 239000004743 Polypropylene Substances 0.000 claims description 25
- -1 polypropylene Polymers 0.000 claims description 25
- 229920001155 polypropylene Polymers 0.000 claims description 25
- 239000007787 solid Substances 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 21
- 230000035515 penetration Effects 0.000 claims description 11
- 239000004593 Epoxy Substances 0.000 claims description 5
- 229920003002 synthetic resin Polymers 0.000 claims description 5
- 239000000057 synthetic resin Substances 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 2
- 239000012811 non-conductive material Substances 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims 1
- 230000000996 additive effect Effects 0.000 claims 1
- 239000003381 stabilizer Substances 0.000 claims 1
- 239000010408 film Substances 0.000 description 25
- 239000011162 core material Substances 0.000 description 14
- 239000000463 material Substances 0.000 description 9
- 239000007789 gas Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 239000004359 castor oil Substances 0.000 description 6
- 235000019438 castor oil Nutrition 0.000 description 6
- 238000000576 coating method Methods 0.000 description 6
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 6
- 238000005470 impregnation Methods 0.000 description 6
- 239000012530 fluid Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- 239000003989 dielectric material Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000003628 erosive effect Effects 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical class OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000011538 cleaning material Substances 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000011104 metalized film Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 235000008113 selfheal Nutrition 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01G—CAPACITORS; CAPACITORS, RECTIFIERS, DETECTORS, SWITCHING DEVICES, LIGHT-SENSITIVE OR TEMPERATURE-SENSITIVE DEVICES OF THE ELECTROLYTIC TYPE
- H01G4/00—Fixed capacitors; Processes of their manufacture
- H01G4/32—Wound capacitors
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01G—CAPACITORS; CAPACITORS, RECTIFIERS, DETECTORS, SWITCHING DEVICES, LIGHT-SENSITIVE OR TEMPERATURE-SENSITIVE DEVICES OF THE ELECTROLYTIC TYPE
- H01G2/00—Details of capacitors not covered by a single one of groups H01G4/00-H01G11/00
- H01G2/08—Cooling arrangements; Heating arrangements; Ventilating arrangements
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Manufacturing & Machinery (AREA)
- Fixed Capacitors And Capacitor Manufacturing Machines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/506,461 US3987348A (en) | 1974-09-16 | 1974-09-16 | Partially impregnated capacitor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2539781A1 true DE2539781A1 (de) | 1976-04-01 |
| DE2539781C2 DE2539781C2 (US20050065096A1-20050324-C00069.png) | 1989-07-20 |
Family
ID=24014689
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752539781 Granted DE2539781A1 (de) | 1974-09-16 | 1975-09-06 | Kondensator mit einem kondensatorwickelelement und verfahren zur herstellung des kondensatorwickelelements |
Country Status (7)
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2623474A1 (de) * | 1976-05-25 | 1977-12-01 | Siemens Ag | Regenerierfaehiger elektrischer kondensator |
| DE3304672A1 (de) * | 1983-02-11 | 1984-08-16 | ANT Nachrichtentechnik GmbH, 7150 Backnang | Verfahren zur kontaktierung von koerpern |
| DE3418181A1 (de) * | 1984-05-16 | 1985-11-28 | Standard Elektrik Lorenz Ag, 7000 Stuttgart | Elektrischer wickelkondensator |
| EP0182181B1 (de) | 1984-11-15 | 1989-05-31 | Siemens Aktiengesellschaft | Elektrischer Wickelkondensator |
| DE102019217976A1 (de) * | 2019-08-26 | 2021-03-04 | Wolfgang Westermann | Folienkondensator für Leistungselektronik |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2703636C3 (de) * | 1977-01-28 | 1985-10-10 | Siemens AG, 1000 Berlin und 8000 München | Regenerierfähiger elektrischer Kondensator und Verfahren zu seiner Herstellung |
| JPS5536972A (en) * | 1978-09-06 | 1980-03-14 | Nichicon Capacitor Ltd | Metalized film capacitor |
| US4229777A (en) * | 1978-12-15 | 1980-10-21 | General Electric Company | High voltage dual dielectric capacitor roll |
| US4317159A (en) * | 1979-12-10 | 1982-02-23 | Sprague Electric Company | AC Capacitor and impregnant therefor |
| US4348713A (en) * | 1980-05-07 | 1982-09-07 | General Electric Company | Impregnants for metallized paper electrode capacitors |
| US4538208A (en) * | 1980-09-22 | 1985-08-27 | Emhart Industries, Inc. | Alternating current capacitor |
| US4422962A (en) * | 1981-02-19 | 1983-12-27 | General Electric Company | Polyglycol dielectric capacitor fluid |
| US4388669A (en) * | 1981-02-19 | 1983-06-14 | General Electric Company | Polyglycol dielectric capacitor fluid |
| US4482931A (en) * | 1981-08-24 | 1984-11-13 | General Electric Company | Metallized capacitor with improved bilayer electrodes |
| US4480285A (en) * | 1982-12-15 | 1984-10-30 | General Electric Company | Capacitor |
| JPS62101224U (US20050065096A1-20050324-C00069.png) * | 1985-12-12 | 1987-06-27 | ||
| US4819115A (en) * | 1988-01-28 | 1989-04-04 | Westinghouse Electric Corp. | End connections for wound capacitors and methods of making the same |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE874046C (de) * | 1951-09-02 | 1953-04-20 | Wilhelm Westermann | Elektrischer Wickelkondensator |
| FR1125012A (fr) * | 1955-04-20 | 1956-10-23 | Lignes Telegraph Telephon | Perfectionnements aux condensateurs électriques et à leurs procédés de fabrication |
| DE960654C (de) * | 1952-08-10 | 1957-03-28 | N S F Nuernberger Schraubenfab | Verfahren zur Herstellung elektrischer Wickelkondensatroen |
| DE974887C (de) * | 1944-05-16 | 1961-06-08 | Siemens Ag | Elektrischer Wickelkondensator mit laengs- und quergereckten Kunststoffolien als Dielektrikum |
| US3153180A (en) * | 1961-11-15 | 1964-10-13 | Gen Electric | Electrical capacitor and method of making the same |
| US3363156A (en) * | 1966-10-19 | 1968-01-09 | Gen Electric | Capacitor with a polyolefin dielectric |
| DE2208602A1 (de) * | 1971-03-02 | 1972-09-21 | Plessey Handel Investment Ag | Trockenkondensator und Verfahren zu seiner Herstellung |
| US3754173A (en) * | 1972-08-16 | 1973-08-21 | J Eustance | Stabilized ester impregnated capacitor |
| DE2316414A1 (de) * | 1972-04-05 | 1973-10-18 | Asea Ab | Kondensatorelement fuer kraftkondensatoren |
| DE1564561C2 (de) * | 1966-04-06 | 1974-08-22 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Verfahren zur Herstellung eines Wickelkondensators mit Kunststoffolien als Dielektrikum |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2492210A (en) * | 1944-10-19 | 1949-12-27 | Gen Electric | Dielectric composition |
| US2597429A (en) * | 1946-01-24 | 1952-05-20 | Cornell Dubilier Electric | Capacitance device |
| US2764718A (en) * | 1951-12-28 | 1956-09-25 | Sprague Electric Co | Electrical condensers |
| US2797373A (en) * | 1952-08-28 | 1957-06-25 | Sprague Electric Co | Metallized film capacitors |
| US3251115A (en) * | 1963-12-02 | 1966-05-17 | Gudeman Company | Method of making wound capacitors |
| US3391313A (en) * | 1967-01-31 | 1968-07-02 | Du Pont | Capacitor and method of making the same |
| US3457478A (en) * | 1967-10-26 | 1969-07-22 | Du Pont | Wound film capacitors |
| CH551081A (de) * | 1972-05-31 | 1974-06-28 | Kapsch Telephon Telegraph | Wickelkondensator. |
-
1974
- 1974-09-16 US US05/506,461 patent/US3987348A/en not_active Expired - Lifetime
-
1975
- 1975-08-19 GB GB34483/75A patent/GB1523892A/en not_active Expired
- 1975-09-06 DE DE19752539781 patent/DE2539781A1/de active Granted
- 1975-09-12 IT IT27185/75A patent/IT1042512B/it active
- 1975-09-15 CA CA235,486A patent/CA1044340A/en not_active Expired
- 1975-09-16 JP JP50111019A patent/JPS5914883B2/ja not_active Expired
- 1975-09-17 BR BR7505984A patent/BR7505984A/pt unknown
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE974887C (de) * | 1944-05-16 | 1961-06-08 | Siemens Ag | Elektrischer Wickelkondensator mit laengs- und quergereckten Kunststoffolien als Dielektrikum |
| DE874046C (de) * | 1951-09-02 | 1953-04-20 | Wilhelm Westermann | Elektrischer Wickelkondensator |
| DE960654C (de) * | 1952-08-10 | 1957-03-28 | N S F Nuernberger Schraubenfab | Verfahren zur Herstellung elektrischer Wickelkondensatroen |
| FR1125012A (fr) * | 1955-04-20 | 1956-10-23 | Lignes Telegraph Telephon | Perfectionnements aux condensateurs électriques et à leurs procédés de fabrication |
| US3153180A (en) * | 1961-11-15 | 1964-10-13 | Gen Electric | Electrical capacitor and method of making the same |
| DE1564561C2 (de) * | 1966-04-06 | 1974-08-22 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Verfahren zur Herstellung eines Wickelkondensators mit Kunststoffolien als Dielektrikum |
| US3363156A (en) * | 1966-10-19 | 1968-01-09 | Gen Electric | Capacitor with a polyolefin dielectric |
| DE2208602A1 (de) * | 1971-03-02 | 1972-09-21 | Plessey Handel Investment Ag | Trockenkondensator und Verfahren zu seiner Herstellung |
| DE2316414A1 (de) * | 1972-04-05 | 1973-10-18 | Asea Ab | Kondensatorelement fuer kraftkondensatoren |
| US3754173A (en) * | 1972-08-16 | 1973-08-21 | J Eustance | Stabilized ester impregnated capacitor |
Non-Patent Citations (3)
| Title |
|---|
| DE-AN N 8757 VIII c/21g, b.g. am 30. Mai 1956 * |
| DE-Z.: NTZ, 1970, H. 10, S. 532-536 * |
| DE-Z.: Wiedemann Annalen der Physik und Chemie, Bd. 37, 1889, S. 69-96 * |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2623474A1 (de) * | 1976-05-25 | 1977-12-01 | Siemens Ag | Regenerierfaehiger elektrischer kondensator |
| DE3304672A1 (de) * | 1983-02-11 | 1984-08-16 | ANT Nachrichtentechnik GmbH, 7150 Backnang | Verfahren zur kontaktierung von koerpern |
| DE3418181A1 (de) * | 1984-05-16 | 1985-11-28 | Standard Elektrik Lorenz Ag, 7000 Stuttgart | Elektrischer wickelkondensator |
| EP0182181B1 (de) | 1984-11-15 | 1989-05-31 | Siemens Aktiengesellschaft | Elektrischer Wickelkondensator |
| DE102019217976A1 (de) * | 2019-08-26 | 2021-03-04 | Wolfgang Westermann | Folienkondensator für Leistungselektronik |
| DE102019217976B4 (de) | 2019-08-26 | 2021-09-02 | Wolfgang Westermann | Folienkondensator für Leistungselektronik |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5156953A (US20050065096A1-20050324-C00069.png) | 1976-05-19 |
| CA1044340A (en) | 1978-12-12 |
| GB1523892A (en) | 1978-09-06 |
| IT1042512B (it) | 1980-01-30 |
| JPS5914883B2 (ja) | 1984-04-06 |
| BR7505984A (pt) | 1977-03-22 |
| US3987348A (en) | 1976-10-19 |
| DE2539781C2 (US20050065096A1-20050324-C00069.png) | 1989-07-20 |
| USB506461I5 (US20050065096A1-20050324-C00069.png) | 1976-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2539781C2 (US20050065096A1-20050324-C00069.png) | ||
| DE69836059T2 (de) | Elektrolytkondensator | |
| DE19641249C2 (de) | Kondensator | |
| DE2932781A1 (de) | Anregungssystem fuer schnelle gepulste entladung | |
| CH181908A (de) | Elektrostatischer Kondensator. | |
| DE1589827A1 (de) | Elektrischer Kondensator | |
| DE2446422A1 (de) | Fluessige dielektrische impraegnierungszubereitung fuer elektrische apparate | |
| DE1813371C3 (de) | Verfahren zur Herstellung eines mit Rizinusöl imprägnierten elektrischen Kondensators | |
| DE3105794A1 (de) | Dielektrisches medium fuer einen elektrischen kondensator sowie kondensator mit einem derartigen dielektrischen medium | |
| DE2503799A1 (de) | Elektrischer kondensator und verfahren zu seiner herstellung | |
| DE1640188B2 (de) | Elektrischer Kondensator | |
| DE2421717A1 (de) | Elektrolytischer folienkondensator mit mehreren abschnitten | |
| EP0325919B1 (de) | Aluminium-Electrolytkondensator und Verfahren zu seiner Herstellung | |
| DD151383A5 (de) | Bipolarer elektrolyt-kondensator | |
| DE2232292C3 (de) | Entladungsröhre für Gaslasergeneratoren | |
| DE2103040A1 (de) | Verbesserungen bei Elektrolytkon densatoren | |
| DE2310807A1 (de) | Kondensatoren und hierfuer geeignete dielektrische materialien | |
| DE2704458A1 (de) | Elektrischer kondensator | |
| DE1163454B (de) | Verfahren zur Herstellung elektrischer Kondesatoren. | |
| DE913452C (de) | Aus mehreren poroesen Trennschichten gebildeter Abstandhalter fuer die gegenpoligen Belegungen elektrolytischer Kondensatoren und Elektrolytkondensator mit derartigem Abstandhalter | |
| DE1164571B (de) | Verfahren zur Herstellung elektrischer Kondensatoren. | |
| DE3036692C2 (de) | Gasimprägnierter Wickelkondensator | |
| DE2846018A1 (de) | Elektrischer kondensator | |
| DE938078C (de) | Elektrische UEberspannungsschutzvorrichtung | |
| EP0149761B1 (de) | Imprägnierter elektrischer Wickelkondensator |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |