DE2517383C3 - Systemweiche für Frequenzdoppelausnutzung - Google Patents
Systemweiche für FrequenzdoppelausnutzungInfo
- Publication number
- DE2517383C3 DE2517383C3 DE752517383A DE2517383A DE2517383C3 DE 2517383 C3 DE2517383 C3 DE 2517383C3 DE 752517383 A DE752517383 A DE 752517383A DE 2517383 A DE2517383 A DE 2517383A DE 2517383 C3 DE2517383 C3 DE 2517383C3
- Authority
- DE
- Germany
- Prior art keywords
- waveguide
- frequency
- double
- cross
- crossover
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000009977 dual effect Effects 0.000 title claims description 7
- 230000010287 polarization Effects 0.000 claims description 20
- 230000008878 coupling Effects 0.000 claims description 10
- 238000010168 coupling process Methods 0.000 claims description 10
- 238000005859 coupling reaction Methods 0.000 claims description 10
- 230000007704 transition Effects 0.000 claims description 7
- 239000006096 absorbing agent Substances 0.000 claims description 3
- 238000011144 upstream manufacturing Methods 0.000 claims description 2
- 238000000926 separation method Methods 0.000 description 3
- 230000005540 biological transmission Effects 0.000 description 2
- 230000006978 adaptation Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- RZWWGOCLMSGROE-UHFFFAOYSA-N n-(2,6-dichlorophenyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide Chemical compound N1=C2N=C(C)C=C(C)N2N=C1S(=O)(=O)NC1=C(Cl)C=CC=C1Cl RZWWGOCLMSGROE-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01P—WAVEGUIDES; RESONATORS, LINES, OR OTHER DEVICES OF THE WAVEGUIDE TYPE
- H01P1/00—Auxiliary devices
- H01P1/16—Auxiliary devices for mode selection, e.g. mode suppression or mode promotion; for mode conversion
- H01P1/161—Auxiliary devices for mode selection, e.g. mode suppression or mode promotion; for mode conversion sustaining two independent orthogonal modes, e.g. orthomode transducer
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01P—WAVEGUIDES; RESONATORS, LINES, OR OTHER DEVICES OF THE WAVEGUIDE TYPE
- H01P1/00—Auxiliary devices
- H01P1/20—Frequency-selective devices, e.g. filters
- H01P1/213—Frequency-selective devices, e.g. filters combining or separating two or more different frequencies
- H01P1/2131—Frequency-selective devices, e.g. filters combining or separating two or more different frequencies with combining or separating polarisations
Landscapes
- Waveguide Switches, Polarizers, And Phase Shifters (AREA)
- Waveguide Aerials (AREA)
- Control Of Motors That Do Not Use Commutators (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE752517383A DE2517383C3 (de) | 1975-04-19 | 1975-04-19 | Systemweiche für Frequenzdoppelausnutzung |
| CH397476A CH604385A5 (enExample) | 1975-04-19 | 1976-03-30 | |
| IT21853/76A IT1058935B (it) | 1975-04-19 | 1976-04-01 | Scambio di sistema per doppia utilizzazione della frequenza |
| AT273876A AT352786B (de) | 1975-04-19 | 1976-04-14 | Systemweiche fuer frequenzdoppelausnutzung |
| GB15572/76A GB1548189A (en) | 1975-04-19 | 1976-04-15 | Diplexing orthomode transducer for double utilization of frequencies |
| JP51043476A JPS5937602B2 (ja) | 1975-04-19 | 1976-04-16 | 周波数2重利用分波装置 |
| FR7611470A FR2308214A1 (fr) | 1975-04-19 | 1976-04-16 | Filtre combine pour duplexage de frequences |
| US05/678,387 US4047128A (en) | 1975-04-19 | 1976-04-19 | System filter for double frequency utilization |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE752517383A DE2517383C3 (de) | 1975-04-19 | 1975-04-19 | Systemweiche für Frequenzdoppelausnutzung |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2517383A1 DE2517383A1 (de) | 1976-10-21 |
| DE2517383B2 DE2517383B2 (de) | 1978-06-15 |
| DE2517383C3 true DE2517383C3 (de) | 1979-03-01 |
Family
ID=5944466
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE752517383A Expired DE2517383C3 (de) | 1975-04-19 | 1975-04-19 | Systemweiche für Frequenzdoppelausnutzung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4047128A (enExample) |
| JP (1) | JPS5937602B2 (enExample) |
| AT (1) | AT352786B (enExample) |
| CH (1) | CH604385A5 (enExample) |
| DE (1) | DE2517383C3 (enExample) |
| FR (1) | FR2308214A1 (enExample) |
| GB (1) | GB1548189A (enExample) |
| IT (1) | IT1058935B (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2703878A1 (de) * | 1977-01-31 | 1978-08-03 | Siemens Ag | Polarisationsweiche |
| DE2719283C2 (de) * | 1977-04-29 | 1984-02-02 | Siemens AG, 1000 Berlin und 8000 München | Antennenspeisesystem für Doppelpolarisation |
| US4176330A (en) * | 1977-12-23 | 1979-11-27 | Gte Sylvania Incorporated | Diplexer apparatus |
| US4162463A (en) * | 1977-12-23 | 1979-07-24 | Gte Sylvania Incorporated | Diplexer apparatus |
| US4167715A (en) * | 1978-06-22 | 1979-09-11 | Bell Telephone Laboratories, Incorporated | Wideband polarization coupler |
| US4228410A (en) * | 1979-01-19 | 1980-10-14 | Ford Aerospace & Communications Corp. | Microwave circular polarizer |
| US4344048A (en) * | 1979-08-11 | 1982-08-10 | Licentia Patent-Verwaltungs-G.M.B.H | Four-port network for separating two signals comprised of doubly polarized frequency bands |
| US4420756A (en) * | 1981-01-19 | 1983-12-13 | Trw Inc. | Multi-mode tracking antenna feed system |
| JPS57154901A (en) * | 1981-03-19 | 1982-09-24 | Mitsubishi Electric Corp | Cross waveguide type polarized branching filter |
| US4467294A (en) * | 1981-12-17 | 1984-08-21 | Vitalink Communications Corporation | Waveguide apparatus and method for dual polarized and dual frequency signals |
| IT1149770B (it) * | 1982-02-25 | 1986-12-10 | Italtel Spa | Circuito per separare due bande di frequenze per segnali ad altissima frequenza in doppia polarizzazione |
| IT1155664B (it) * | 1982-03-25 | 1987-01-28 | Sip | Dispositivo di guida d onda per la separazione di segnali a radiofrequenza di diversa frequenza e polarizzazione |
| DE3216708A1 (de) * | 1982-05-05 | 1984-02-09 | ANT Nachrichtentechnik GmbH, 7150 Backnang | Verfahren zur gewinnung von antennennachfuehrsignalen |
| US4491810A (en) * | 1983-01-28 | 1985-01-01 | Andrew Corporation | Multi-port, multi-frequency microwave combiner with overmoded square waveguide section |
| DE3406641A1 (de) * | 1984-02-24 | 1985-08-29 | ANT Nachrichtentechnik GmbH, 7150 Backnang | Zweiband-polarisationsweiche |
| YU201586A (en) * | 1985-12-06 | 1988-12-31 | Siemens Ag | Assembly for transmitting directed radio relay signals in two or more radio relay frequency bands |
| FR2593644B1 (fr) * | 1986-01-28 | 1988-03-11 | Alcatel Espace | Dispositif duplexeur de polarisation et de frequences a trois acces. |
| US4912436A (en) * | 1987-06-15 | 1990-03-27 | Gamma-F Corporation | Four port dual polarization frequency diplexer |
| DE3840450A1 (de) * | 1988-12-01 | 1990-06-07 | Telefunken Systemtechnik | Modenkoppler fuer monopulsanwendungen |
| US4970480A (en) * | 1989-06-09 | 1990-11-13 | Hughes Aircraft Company | Microwave diplexer |
| US5216433A (en) * | 1991-11-15 | 1993-06-01 | Hughes Aircraft Company | Polarimetric antenna |
| DE19734854A1 (de) * | 1997-08-12 | 1999-02-18 | Alsthom Cge Alcatel | Polarisationsweiche für zwei unterschiedliche Frequenzbänder |
| DE19735547A1 (de) * | 1997-08-16 | 1999-02-18 | Alsthom Cge Alcatel | Polarisationsweiche für zwei unterschiedliche Frequenzbänder |
| JP3688558B2 (ja) * | 2000-06-05 | 2005-08-31 | 三菱電機株式会社 | 導波管群分波器 |
| US6600387B2 (en) * | 2001-04-17 | 2003-07-29 | Channel Master Llc | Multi-port multi-band transceiver interface assembly |
| US6566976B2 (en) * | 2001-06-12 | 2003-05-20 | Northrop Grumman Corporation | Symmetric orthomode coupler for cellular application |
| US6496084B1 (en) | 2001-08-09 | 2002-12-17 | Andrew Corporation | Split ortho-mode transducer with high isolation between ports |
| JP3879548B2 (ja) * | 2002-03-20 | 2007-02-14 | 三菱電機株式会社 | 導波管形偏分波器 |
| US7397323B2 (en) * | 2006-07-12 | 2008-07-08 | Wide Sky Technology, Inc. | Orthomode transducer |
| ES2362761B1 (es) * | 2009-04-28 | 2012-05-23 | Ferox Comunications, S.L. | Multiplexor de polarización cruzada. |
| AU2010355229B2 (en) | 2010-06-08 | 2014-11-13 | National Research Council Of Canada | Orthomode transducer |
| MX2014009869A (es) * | 2012-02-17 | 2015-07-06 | Pro Brand Internat Europ Ltd | Aparato receptor y/o transmisor de señales de datos multibanda. |
| DE102013011651A1 (de) * | 2013-07-11 | 2015-01-15 | ESA-microwave service GmbH | Antennen-Speisesystem im Mikrowellenbereich für Reflektorantennen |
| EP3595082B8 (en) * | 2018-07-10 | 2020-11-04 | Rohde & Schwarz GmbH & Co. KG | Integrated device and manufacturing method thereof |
| IT202000007681A1 (it) | 2020-04-09 | 2021-10-09 | Picosats S R L | Trasduttore ortomodo per antenna e antenna per satelliti |
| WO2025188765A1 (en) * | 2024-03-06 | 2025-09-12 | Air Wireless, Inc. | Mechanical diplexer filter and systems and methods for use thereof |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2961618A (en) * | 1957-06-12 | 1960-11-22 | Bell Telephone Labor Inc | Selective mode transducer |
| GB887574A (en) * | 1960-01-22 | 1962-01-17 | Standard Telephones Cables Ltd | Improvements in or relating to electric wave filters |
| US3566309A (en) * | 1969-02-24 | 1971-02-23 | Hughes Aircraft Co | Dual frequency band,polarization diverse tracking feed system for a horn antenna |
| FR2182728B1 (enExample) * | 1972-05-05 | 1977-03-18 | Thomson Csf | |
| US3731236A (en) * | 1972-08-17 | 1973-05-01 | Gte Sylvania Inc | Independently adjustable dual polarized diplexer |
-
1975
- 1975-04-19 DE DE752517383A patent/DE2517383C3/de not_active Expired
-
1976
- 1976-03-30 CH CH397476A patent/CH604385A5/xx not_active IP Right Cessation
- 1976-04-01 IT IT21853/76A patent/IT1058935B/it active
- 1976-04-14 AT AT273876A patent/AT352786B/de not_active IP Right Cessation
- 1976-04-15 GB GB15572/76A patent/GB1548189A/en not_active Expired
- 1976-04-16 FR FR7611470A patent/FR2308214A1/fr active Granted
- 1976-04-16 JP JP51043476A patent/JPS5937602B2/ja not_active Expired
- 1976-04-19 US US05/678,387 patent/US4047128A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ATA273876A (de) | 1979-03-15 |
| AT352786B (de) | 1979-10-10 |
| IT1058935B (it) | 1982-05-10 |
| GB1548189A (en) | 1979-07-04 |
| DE2517383A1 (de) | 1976-10-21 |
| FR2308214A1 (fr) | 1976-11-12 |
| CH604385A5 (enExample) | 1978-09-15 |
| FR2308214B1 (enExample) | 1980-05-09 |
| US4047128A (en) | 1977-09-06 |
| JPS5937602B2 (ja) | 1984-09-11 |
| JPS51128246A (en) | 1976-11-09 |
| DE2517383B2 (de) | 1978-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2517383C3 (de) | Systemweiche für Frequenzdoppelausnutzung | |
| DE2443166C3 (de) | Systemweiche zur Trennung zweier Signale, die aus je zwei doppelt polarisierten Frequenzbändern bestehen | |
| DE3310095C2 (de) | Wellenleiteranordnung | |
| DE2632606A1 (de) | Wellentypkoppler-anordnung | |
| DE3246317A1 (de) | Wellenleiter fuer zweifach polarisierte zwei-frequenz-signale und verfahren zur wellenleitung solcher signale | |
| DE2645294A1 (de) | Mehrfachkoppler fuer aneinandergrenzende frequenzkanaele | |
| DE69904550T2 (de) | Polarisationsweiche mit doppelter Seitenwandkopplung | |
| EP2897213B1 (de) | Breitband-Signalverzweigung mit Summensignalabsorption | |
| DE69121632T2 (de) | Polarisationsweiche zwischen einem zirkularen Wellenleiter und einem Koaxialkabel | |
| EP0154692B1 (de) | Zweiband-Polarisationsweiche | |
| EP0128970A1 (de) | Viertornetzwerk für Mikrowellenantennen mit Monopulsnachführung | |
| DE3028925A1 (de) | Antennenweiche, bestehend aus wenigstens zwei parallelgeschalteten filtern fuer sehr kurze elektromagnetische wellen | |
| DE2322549A1 (de) | Antennenweiche fuer eine hoechstfrequenzantenne | |
| DE2719283C2 (de) | Antennenspeisesystem für Doppelpolarisation | |
| EP0633621B1 (de) | Antennen-Filter-Combiner | |
| DE2828047B1 (de) | Frequenzabhaengiges Koppelsystem | |
| DE2521956A1 (de) | Polarisationsweiche | |
| DE2708271C2 (de) | Polarisationsweiche | |
| DE2747632C2 (de) | Antennenspeisesystem für Doppelpolarisation | |
| DE3010360C2 (de) | Polarisationsweiche | |
| DE2828878C2 (de) | Antennenspeisesystem für Doppelpolarisation | |
| DE1289897B (de) | Anordnung zum Kombinieren zweier an zwei Eingangsklemmen angelegter HF-Signale unterschiedlicher Frequenzbaender | |
| DE202023105653U1 (de) | Kommunikationsvorrichtung | |
| EP0113901A2 (de) | Wellentypenweiche | |
| EP0280151B1 (de) | Mikrowellen-Polarisationsweiche |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: AEG-TELEFUNKEN NACHRICHTENTECHNIK GMBH, 7150 BACKN |
|
| 8327 | Change in the person/name/address of the patent owner |
Owner name: ANT NACHRICHTENTECHNIK GMBH, 7150 BACKNANG, DE |
|
| 8320 | Willingness to grant licences declared (paragraph 23) | ||
| 8339 | Ceased/non-payment of the annual fee |