DE2458827A1 - N-(1,2,2,2-tetrachloraethyl)-formimidchlorid - Google Patents
N-(1,2,2,2-tetrachloraethyl)-formimidchloridInfo
- Publication number
- DE2458827A1 DE2458827A1 DE19742458827 DE2458827A DE2458827A1 DE 2458827 A1 DE2458827 A1 DE 2458827A1 DE 19742458827 DE19742458827 DE 19742458827 DE 2458827 A DE2458827 A DE 2458827A DE 2458827 A1 DE2458827 A1 DE 2458827A1
- Authority
- DE
- Germany
- Prior art keywords
- chloride
- formimide
- tetrachloroethyl
- reaction
- acid chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 title claims description 21
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical group ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 21
- -1 1,2,2,2-tetrachloroethyl Chemical group 0.000 claims description 20
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 18
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 17
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 14
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000003701 inert diluent Substances 0.000 claims description 4
- 150000003948 formamides Chemical class 0.000 claims description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims 1
- 230000000996 additive effect Effects 0.000 claims 1
- ACZVWYLTJHGUCP-UHFFFAOYSA-N n-(2,2,2-trichloro-1-hydroxyethyl)formamide Chemical compound ClC(Cl)(Cl)C(O)NC=O ACZVWYLTJHGUCP-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 8
- 239000003085 diluting agent Substances 0.000 description 8
- 239000007789 gas Substances 0.000 description 8
- 230000007717 exclusion Effects 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 6
- GUTALTICIZXUBM-UHFFFAOYSA-N n-(1,2,2,2-tetrachloroethyl)formamide Chemical compound ClC(Cl)(Cl)C(Cl)NC=O GUTALTICIZXUBM-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 101100520660 Drosophila melanogaster Poc1 gene Proteins 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 101100520662 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) PBA1 gene Proteins 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- FDWSIACICRBLGW-UHFFFAOYSA-N 2,4,5-trichloro-1,3-thiazole Chemical compound ClC1=NC(Cl)=C(Cl)S1 FDWSIACICRBLGW-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742458827 DE2458827A1 (de) | 1974-12-12 | 1974-12-12 | N-(1,2,2,2-tetrachloraethyl)-formimidchlorid |
| GB4375775A GB1475969A (en) | 1974-12-12 | 1975-10-24 | N-1,2,2,2-tetrachloroethyl-formimidoyl chloride |
| US05/639,137 US4013674A (en) | 1974-12-12 | 1975-12-09 | N-(1,2,2,2-tetrachloroethyl)-formimide-chloride for synthesizing trichlorothiazole |
| BE162617A BE836487A (fr) | 1974-12-12 | 1975-12-10 | Chlorure de n-(1,2,2,2-tetrachlorethyl)-formimide et sa preparation |
| JP50146479A JPS5191206A (en) | 1974-12-12 | 1975-12-10 | Nn * 1 2 2 22 tetorakuroroechiru ** horumuimidookuroraidono seizoho |
| NL7514398A NL7514398A (nl) | 1974-12-12 | 1975-12-10 | N-1,2,2,2-tetrachloorethyl)-formimidechloride. |
| FR7538200A FR2294164A1 (fr) | 1974-12-12 | 1975-12-12 | Chlorure de n-(1,2,2,2-tetrachlorethyl)-formimide et sa preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742458827 DE2458827A1 (de) | 1974-12-12 | 1974-12-12 | N-(1,2,2,2-tetrachloraethyl)-formimidchlorid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2458827A1 true DE2458827A1 (de) | 1976-06-16 |
Family
ID=5933253
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742458827 Pending DE2458827A1 (de) | 1974-12-12 | 1974-12-12 | N-(1,2,2,2-tetrachloraethyl)-formimidchlorid |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS5191206A (enrdf_load_stackoverflow) |
| BE (1) | BE836487A (enrdf_load_stackoverflow) |
| DE (1) | DE2458827A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2294164A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1475969A (enrdf_load_stackoverflow) |
| NL (1) | NL7514398A (enrdf_load_stackoverflow) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4240977A (en) * | 1977-11-29 | 1980-12-23 | Bayer Aktiengesellschaft | 2-Cyanoethyl isocyanide dichloride |
| EP0053765A1 (de) * | 1980-12-10 | 1982-06-16 | Bayer Ag | Verfahren zur Herstellung von Trichlorthiazol |
-
1974
- 1974-12-12 DE DE19742458827 patent/DE2458827A1/de active Pending
-
1975
- 1975-10-24 GB GB4375775A patent/GB1475969A/en not_active Expired
- 1975-12-10 BE BE162617A patent/BE836487A/xx unknown
- 1975-12-10 NL NL7514398A patent/NL7514398A/xx not_active Application Discontinuation
- 1975-12-10 JP JP50146479A patent/JPS5191206A/ja active Pending
- 1975-12-12 FR FR7538200A patent/FR2294164A1/fr active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4240977A (en) * | 1977-11-29 | 1980-12-23 | Bayer Aktiengesellschaft | 2-Cyanoethyl isocyanide dichloride |
| EP0053765A1 (de) * | 1980-12-10 | 1982-06-16 | Bayer Ag | Verfahren zur Herstellung von Trichlorthiazol |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7514398A (nl) | 1976-06-15 |
| JPS5191206A (en) | 1976-08-10 |
| GB1475969A (en) | 1977-06-10 |
| BE836487A (fr) | 1976-06-10 |
| FR2294164B1 (enrdf_load_stackoverflow) | 1979-03-23 |
| FR2294164A1 (fr) | 1976-07-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69813312T2 (de) | Verfahren zur herstellung von cyclopropylethyn sowie zwischenprodukte zur herstellung von cyclopropylethyn | |
| DE69403149T2 (de) | Verfahren zur Herstellung 1-substituierte-5(4H)-Tetrazolinone | |
| DE2458827A1 (de) | N-(1,2,2,2-tetrachloraethyl)-formimidchlorid | |
| DE2164176A1 (de) | Verfahren zur herstellung von sulfamidsaeurehalogeniden | |
| DE2454326C2 (de) | 4,5-Dichlor-2-(dichlormethylen)-2H-imidazol und ein Verfahren zu seiner Herstellung | |
| DE2458826A1 (de) | 1,2,2,2,-tetrachloraethylisocyaniddichlorid | |
| DE2061217A1 (de) | Cuprohalogenid-Adiponitril-Komplexe | |
| EP0000042B1 (de) | Verfahren zur Herstellung von 2,4,5-Trichlorpyrimidin | |
| DE3917904C2 (de) | Benzoylessigsäureester und Verfahren zu seiner Herstellung | |
| DE69118175T2 (de) | Neues disulfidderivat | |
| DE2401819C2 (de) | Verfahren zur Herstellung von Sulfamidsäurehalogeniden | |
| DE2819450C2 (enrdf_load_stackoverflow) | ||
| DE1618986C3 (de) | Verfahren zur Herstellung von chlorierten aromatischen Nitrilen | |
| EP0039905B1 (de) | Verfahren zur Herstellung von 2-Chlorbenzothiazol | |
| DE2458825A1 (de) | Verfahren zur herstellung von trichlorthiazol | |
| DE3329126A1 (de) | Neue benzokondensierte, tetrachlorierte, heterocyclische verbindungen und ein verfahren zu ihrer herstellung | |
| DE2901334A1 (de) | Neue harnstoffderivate | |
| DE3224666C2 (enrdf_load_stackoverflow) | ||
| DE3006154A1 (de) | Fungizide 3-(n-acyl-n-arylamino)- und 3-(n-thionoacyl-n-arylamino)- gamma -butyrolactone und - gamma -thiobutyrolactone | |
| EP0053765A1 (de) | Verfahren zur Herstellung von Trichlorthiazol | |
| DE2458824A1 (de) | Verfahren zur herstellung von trichlorthiazol | |
| DE1801862C (de) | Verfahren zur Herstellung von 1-Dimethylamino-S-dimethylimonio^-cyan-3-chlor-4-azapentadien-(l,3)-perchlorat | |
| DE2451634A1 (de) | Trichloraethyliden-bis(isocyaniddichlorid) | |
| AT372940B (de) | Verfahren zur herstellung von (d)-(-)-phydroxyphenylglycylchlorid-hydrochlorid | |
| DE2852274A1 (de) | Verfahren zur herstellung von sulfamidsaeurehalogeniden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |