DE2443793C2 - Kombiniertes Anzündhütchen - Google Patents
Kombiniertes AnzündhütchenInfo
- Publication number
- DE2443793C2 DE2443793C2 DE2443793A DE2443793A DE2443793C2 DE 2443793 C2 DE2443793 C2 DE 2443793C2 DE 2443793 A DE2443793 A DE 2443793A DE 2443793 A DE2443793 A DE 2443793A DE 2443793 C2 DE2443793 C2 DE 2443793C2
- Authority
- DE
- Germany
- Prior art keywords
- ignition
- pole piece
- primer
- combined
- recess
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000009527 percussion Methods 0.000 claims description 8
- 238000009413 insulation Methods 0.000 claims description 5
- 238000010079 rubber tapping Methods 0.000 claims description 5
- 230000001960 triggered effect Effects 0.000 claims description 5
- 239000012811 non-conductive material Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000000576 coating method Methods 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 239000003380 propellant Substances 0.000 description 4
- 230000035939 shock Effects 0.000 description 4
- 229910001369 Brass Inorganic materials 0.000 description 3
- 239000010951 brass Substances 0.000 description 3
- 238000010292 electrical insulation Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000000919 ceramic Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- -1 polyethylene Polymers 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- 238000007740 vapor deposition Methods 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910021346 calcium silicide Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- JUWSSMXCCAMYGX-UHFFFAOYSA-N gold platinum Chemical compound [Pt].[Au] JUWSSMXCCAMYGX-UHFFFAOYSA-N 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 230000001535 kindling effect Effects 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- WETZJIOEDGMBMA-UHFFFAOYSA-L lead styphnate Chemical compound [Pb+2].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C([O-])=C1[N+]([O-])=O WETZJIOEDGMBMA-UHFFFAOYSA-L 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000011224 oxide ceramic Substances 0.000 description 1
- 229910052574 oxide ceramic Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910021332 silicide Inorganic materials 0.000 description 1
- FVBUAEGBCNSCDD-UHFFFAOYSA-N silicide(4-) Chemical compound [Si-4] FVBUAEGBCNSCDD-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- YPMOSINXXHVZIL-UHFFFAOYSA-N sulfanylideneantimony Chemical compound [Sb]=S YPMOSINXXHVZIL-UHFFFAOYSA-N 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- MZLGASXMSKOWSE-UHFFFAOYSA-N tantalum nitride Chemical compound [Ta]#N MZLGASXMSKOWSE-UHFFFAOYSA-N 0.000 description 1
- 150000004655 tetrazenes Chemical class 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/12—Primers; Detonators electric
- F42C19/14—Primers; Detonators electric operable also in the percussion mode
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B3/00—Blasting cartridges, i.e. case and explosive
- F42B3/10—Initiators therefor
- F42B3/12—Bridge initiators
- F42B3/125—Bridge initiators characterised by the configuration of the bridge initiator case
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/0815—Intermediate ignition capsules, i.e. self-contained primary pyrotechnic module transmitting the initial firing signal to the secondary explosive, e.g. using electric, radio frequency, optical or percussion signals to the secondary explosive
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/10—Percussion caps
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/12—Primers; Detonators electric
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Air Bags (AREA)
- Spark Plugs (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2443793A DE2443793C2 (de) | 1974-09-13 | 1974-09-13 | Kombiniertes Anzündhütchen |
| US05/606,448 US4014264A (en) | 1974-09-13 | 1975-08-21 | Combined igniter cap |
| GB36753/75A GB1500597A (en) | 1974-09-13 | 1975-09-05 | Primer device capable of ignition electrically and by an alternative ignition mode |
| BE159759A BE833098A (fr) | 1974-09-13 | 1975-09-05 | Amorce explosive combinee |
| CH1166875A CH612751A5 (OSRAM) | 1974-09-13 | 1975-09-09 | |
| IT51318/75A IT1047104B (it) | 1974-09-13 | 1975-09-12 | Capsula d accensione combinata |
| FR7528108A FR2284860A1 (fr) | 1974-09-13 | 1975-09-12 | Amorce explosive combinee |
| NL7510774A NL7510774A (nl) | 1974-09-13 | 1975-09-12 | Samengesteld ontstekingshoedje. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2443793A DE2443793C2 (de) | 1974-09-13 | 1974-09-13 | Kombiniertes Anzündhütchen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2443793A1 DE2443793A1 (de) | 1976-03-25 |
| DE2443793C2 true DE2443793C2 (de) | 1986-05-07 |
Family
ID=5925634
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2443793A Expired DE2443793C2 (de) | 1974-09-13 | 1974-09-13 | Kombiniertes Anzündhütchen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4014264A (OSRAM) |
| BE (1) | BE833098A (OSRAM) |
| CH (1) | CH612751A5 (OSRAM) |
| DE (1) | DE2443793C2 (OSRAM) |
| FR (1) | FR2284860A1 (OSRAM) |
| GB (1) | GB1500597A (OSRAM) |
| IT (1) | IT1047104B (OSRAM) |
| NL (1) | NL7510774A (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1063490A2 (de) | 1999-06-24 | 2000-12-27 | Diehl Munitionssysteme GmbH & Co. KG | Elektrische Anzündeinrichtung für die Treibladung einer Patrone |
| WO2008083937A1 (de) | 2007-01-11 | 2008-07-17 | Rheinmetall Waffe Munition Gmbh | Anzündmittel |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2504907A1 (de) * | 1975-02-06 | 1976-08-19 | Dynamit Nobel Ag | Treibladungsanzuender mit schlagstueck |
| SE427216B (sv) * | 1979-09-03 | 1983-03-14 | Bofors Ab | Eltenddon, foretredesvis for artilleriammunition |
| DE3113406A1 (de) * | 1981-04-03 | 1982-12-16 | Bundesrepublik Deutschland, vertreten durch den Bundesminister der Verteidigung, dieser vertreten durch den Präsidenten des Bundesamtes für Wehrtechnik und Beschaffung, 5400 Koblenz | "anzuendkette fuer treibladungen von rohrwaffen" |
| FR2538099B1 (fr) * | 1982-12-15 | 1986-10-03 | France Etat | Amorce electrique a element resistif |
| EP0143071A1 (de) * | 1983-11-18 | 1985-05-29 | Fela E. Uhlmann Aktiengesellschaft für gedruckte Schaltungen | Verfahren zur Herstellung einer elektrischen Zündvorrichtung, danach hergestellte Zündvorrichtung und deren Verwendung |
| CH663089A5 (de) * | 1984-05-21 | 1987-11-13 | Inventa Ag | Polkoerper fuer eine elektrische zuendvorrichtung, verfahren zu seiner herstellung und dessen verwendung. |
| ZA852777B (en) * | 1984-05-24 | 1985-11-27 | Inventa Ag | Pole body for an electric fuze,method of manufacturing and method of using the pole body |
| US5831203A (en) * | 1997-03-07 | 1998-11-03 | The Ensign-Bickford Company | High impedance semiconductor bridge detonator |
| US6131515A (en) | 1997-12-11 | 2000-10-17 | Remington Arms Company, Inc. | Electric primer |
| US7546805B2 (en) * | 2001-07-17 | 2009-06-16 | Schlumberger Technology Corporation | Detonator |
| US6598532B2 (en) * | 2001-08-14 | 2003-07-29 | Donald G. Gerard | Electric circuit for an electrically dischargeable primer |
| AT410592B (de) * | 2001-11-08 | 2003-06-25 | Obermayer Harald Ing | Elektrisches zündhütchen |
| RU2196957C1 (ru) * | 2002-01-31 | 2003-01-20 | Федеральное государственное унитарное предприятие "Научно-производственное предприятие "Краснознаменец" | Капсюль-воспламенитель для патронов стрелкового оружия |
| UA74640C2 (en) * | 2003-11-27 | 2006-01-16 | Oleksandr Vasyliovych Petrenko | Ignition cap |
| RU2256148C1 (ru) * | 2004-03-24 | 2005-07-10 | ФГУП НМЗ "Искра" | Капсюль-воспламенитель для патронов охотничьих и спортивных ружей |
| RU2273820C1 (ru) * | 2005-01-27 | 2006-04-10 | Федеральное государственное унитарное предприятие "Научно-производственное предприятие "Краснознаменец" | Капсюль-воспламенитель для патронов стрелкового оружия |
| DE102008057769A1 (de) * | 2008-11-17 | 2010-05-20 | Rheinmetall Waffe Munition Gmbh | Zündeinrichtung |
| KR101921167B1 (ko) * | 2013-08-05 | 2018-11-22 | 루아그 암모텍 게엠베하 | 소구경 탄환용 전기적 점화 캡 |
| HRP20181390T1 (hr) * | 2013-08-05 | 2018-12-14 | Ruag Ammotec Gmbh | Elektromehanička kapsula |
| RU2597649C1 (ru) * | 2015-08-20 | 2016-09-20 | Акционерное общество "Научно-производственное предприятие "Краснознамёнец" | Капсюль-воспламенитель |
| RU2598257C1 (ru) * | 2015-08-26 | 2016-09-20 | Михаил Александрович Кислин | Капсюлированная гильза к нарезному и гладкоствольному патронам для комбинированных ружей со сменными парами стволов |
| US20190128656A1 (en) * | 2017-10-30 | 2019-05-02 | Spectre Enterprises, Inc. | Primer Cup for a Primer Having Deposited Ignitable Material |
| US10837747B2 (en) * | 2018-02-15 | 2020-11-17 | Goodrich Corporation | High explosive firing mechanism |
| US10976144B1 (en) | 2018-03-05 | 2021-04-13 | Vista Outdoor Operations Llc | High pressure rifle cartridge with primer |
| DE102019106357B4 (de) * | 2019-03-13 | 2022-09-22 | Ruag Ammotec Gmbh | Anzündhütchen |
| US10989510B2 (en) * | 2019-05-13 | 2021-04-27 | Spectre Enterprises, Inc. | Primer housing for firearms and other munitions |
| WO2021011453A1 (en) * | 2019-07-12 | 2021-01-21 | Erico International Corporation | Ignitor for exothermic welding |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US712826A (en) * | 1902-06-09 | 1902-11-04 | Winchester Repeating Arms Co | Combined percussion and electric primer. |
| BE593464A (fr) * | 1959-08-22 | 1960-11-14 | Dynamit Nobel Ag | Amorce pour amorçage électrique et mécanique. |
| US3611939A (en) * | 1962-11-29 | 1971-10-12 | Hans Stadler | Primer |
| US3363565A (en) * | 1966-08-10 | 1968-01-16 | Navy Usa | Recessed ammunition primer |
| NO126817B (OSRAM) * | 1969-07-11 | 1973-03-26 | Dynamit Nobel Ag | |
| DE2245308C3 (de) * | 1972-09-15 | 1981-05-07 | Dynamit Nobel Ag, 5210 Troisdorf | Elektrisches Brückenzündmittel |
-
1974
- 1974-09-13 DE DE2443793A patent/DE2443793C2/de not_active Expired
-
1975
- 1975-08-21 US US05/606,448 patent/US4014264A/en not_active Expired - Lifetime
- 1975-09-05 GB GB36753/75A patent/GB1500597A/en not_active Expired
- 1975-09-05 BE BE159759A patent/BE833098A/xx unknown
- 1975-09-09 CH CH1166875A patent/CH612751A5/xx not_active IP Right Cessation
- 1975-09-12 NL NL7510774A patent/NL7510774A/xx unknown
- 1975-09-12 FR FR7528108A patent/FR2284860A1/fr active Granted
- 1975-09-12 IT IT51318/75A patent/IT1047104B/it active
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1063490A2 (de) | 1999-06-24 | 2000-12-27 | Diehl Munitionssysteme GmbH & Co. KG | Elektrische Anzündeinrichtung für die Treibladung einer Patrone |
| WO2008083937A1 (de) | 2007-01-11 | 2008-07-17 | Rheinmetall Waffe Munition Gmbh | Anzündmittel |
| DE102007017679A1 (de) | 2007-01-11 | 2008-07-17 | Rheinmetall Waffe Munition Gmbh | Anzündmittel |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2284860B1 (OSRAM) | 1980-05-23 |
| IT1047104B (it) | 1980-09-10 |
| CH612751A5 (OSRAM) | 1979-08-15 |
| DE2443793A1 (de) | 1976-03-25 |
| FR2284860A1 (fr) | 1976-04-09 |
| BE833098A (fr) | 1975-12-31 |
| NL7510774A (nl) | 1976-03-16 |
| GB1500597A (en) | 1978-02-08 |
| US4014264A (en) | 1977-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2443793C2 (de) | Kombiniertes Anzündhütchen | |
| DE69834939T2 (de) | Elektrisches Zündelement | |
| CH623409A5 (OSRAM) | ||
| DE69308004T2 (de) | Pyrotechnische elektrische Anzünder | |
| DE60213709T2 (de) | Geschossboden für eine mit einem elektrischen Zünder versehene Munition | |
| DE2020016A1 (de) | Metallschichtzuendmittel | |
| DE4106186A1 (de) | Elektrisch zuendbares patronensystem | |
| DE2245308C3 (de) | Elektrisches Brückenzündmittel | |
| DE3004047A1 (de) | Panzerbrechendes geschoss | |
| DE3033155C2 (OSRAM) | ||
| CH634915A5 (de) | Elektrische zuendvorrichtung. | |
| EP0158121A2 (de) | Patronierte Munition für Rohrwaffen | |
| DE2504907A1 (de) | Treibladungsanzuender mit schlagstueck | |
| DE2206468A1 (de) | Huelsenlose patrone fuer elektrische zuendung | |
| DE2364272A1 (de) | Anzuendhuetchen fuer mechanische und elektrische zuendung | |
| DE102019106357B4 (de) | Anzündhütchen | |
| DE102005031673A1 (de) | Initialsprengstofffreies Zündsystem | |
| DE2655886C2 (de) | Elektrischer Zünder für Geschosse | |
| DE2255547B2 (de) | Schalteinrichtung an elektrischen Geschoßzündern | |
| DE3223775C2 (de) | Zündkette mit einer Sicherungsvorrichtung | |
| EP0185875B1 (de) | Kraftelement | |
| DE1200171B (de) | Elektrische Zuendschraube | |
| EP0217229A1 (de) | Aufschlagschalter für Zünder | |
| DE1935376C (de) | Kombiniertes Zündhütchen | |
| DE2305676C1 (de) | Elektrischer Aufschlagzünder |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |