DE2442391A1 - Thermoplastische polyamidformmassen - Google Patents
Thermoplastische polyamidformmassenInfo
- Publication number
- DE2442391A1 DE2442391A1 DE2442391A DE2442391A DE2442391A1 DE 2442391 A1 DE2442391 A1 DE 2442391A1 DE 2442391 A DE2442391 A DE 2442391A DE 2442391 A DE2442391 A DE 2442391A DE 2442391 A1 DE2442391 A1 DE 2442391A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- carbon atoms
- aliphatic
- bis
- dicarboxylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000465 moulding Methods 0.000 title claims description 21
- 150000001875 compounds Chemical class 0.000 title claims description 13
- 229920006345 thermoplastic polyamide Polymers 0.000 title 1
- 125000004432 carbon atom Chemical group C* 0.000 claims description 43
- 239000000203 mixture Substances 0.000 claims description 39
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 35
- 239000004952 Polyamide Substances 0.000 claims description 33
- 229920002647 polyamide Polymers 0.000 claims description 33
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 21
- 229920001634 Copolyester Polymers 0.000 claims description 20
- -1 4-aminocyclohexyl Chemical group 0.000 claims description 19
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 16
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 16
- 125000001931 aliphatic group Chemical group 0.000 claims description 15
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 150000002148 esters Chemical group 0.000 claims description 11
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 claims description 10
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 claims description 10
- 150000002009 diols Chemical class 0.000 claims description 9
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 6
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 claims description 6
- 229920001169 thermoplastic Polymers 0.000 claims description 6
- 239000004416 thermosoftening plastic Substances 0.000 claims description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 claims description 5
- 239000001361 adipic acid Substances 0.000 claims description 5
- 235000011037 adipic acid Nutrition 0.000 claims description 5
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- QLBRROYTTDFLDX-UHFFFAOYSA-N [3-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCCC(CN)C1 QLBRROYTTDFLDX-UHFFFAOYSA-N 0.000 claims description 4
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 4
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 claims description 4
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 claims description 3
- OXIKYYJDTWKERT-UHFFFAOYSA-N [4-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCC(CN)CC1 OXIKYYJDTWKERT-UHFFFAOYSA-N 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- FWQNYUYRXNWOOM-UHFFFAOYSA-N 2-nonylpropanedioic acid Chemical compound CCCCCCCCCC(C(O)=O)C(O)=O FWQNYUYRXNWOOM-UHFFFAOYSA-N 0.000 claims description 2
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 238000009757 thermoplastic moulding Methods 0.000 claims 5
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 claims 1
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 claims 1
- 101150024031 dio3 gene Proteins 0.000 claims 1
- 230000009466 transformation Effects 0.000 claims 1
- 150000004985 diamines Chemical class 0.000 description 19
- 238000000034 method Methods 0.000 description 12
- 150000001991 dicarboxylic acids Chemical class 0.000 description 10
- 150000002334 glycols Chemical class 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 10
- 235000019589 hardness Nutrition 0.000 description 7
- 238000009833 condensation Methods 0.000 description 6
- 230000005494 condensation Effects 0.000 description 5
- 230000009477 glass transition Effects 0.000 description 4
- 238000001746 injection moulding Methods 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 4
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 4
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical group C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229920006020 amorphous polyamide Polymers 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- QLBRROYTTDFLDX-YUMQZZPRSA-N [(1s,3s)-3-(aminomethyl)cyclohexyl]methanamine Chemical compound NC[C@H]1CCC[C@H](CN)C1 QLBRROYTTDFLDX-YUMQZZPRSA-N 0.000 description 2
- 229960002684 aminocaproic acid Drugs 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- VHRGRCVQAFMJIZ-UHFFFAOYSA-N cadaverine Chemical compound NCCCCCN VHRGRCVQAFMJIZ-UHFFFAOYSA-N 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 2
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 1
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-N 2,2-diethylpropanedioic acid Chemical compound CCC(CC)(C(O)=O)C(O)=O LTMRRSWNXVJMBA-UHFFFAOYSA-N 0.000 description 1
- ATYJAGSSMXWONK-UHFFFAOYSA-N 2,5-diethylhexanedioic acid Chemical compound CCC(C(O)=O)CCC(CC)C(O)=O ATYJAGSSMXWONK-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- CABMTIJINOIHOD-UHFFFAOYSA-N 2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]quinoline-3-carboxylic acid Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC2=CC=CC=C2C=C1C(O)=O CABMTIJINOIHOD-UHFFFAOYSA-N 0.000 description 1
- MCRZWYDXIGCFKO-UHFFFAOYSA-N 2-butylpropanedioic acid Chemical compound CCCCC(C(O)=O)C(O)=O MCRZWYDXIGCFKO-UHFFFAOYSA-N 0.000 description 1
- WUDDSDIHJHPJRP-UHFFFAOYSA-N 2-ethyloctanedioic acid Chemical compound CCC(C(O)=O)CCCCCC(O)=O WUDDSDIHJHPJRP-UHFFFAOYSA-N 0.000 description 1
- BUGIFNPYQVKODR-UHFFFAOYSA-N 2-methylhexane-1,6-diamine Chemical compound NCC(C)CCCCN BUGIFNPYQVKODR-UHFFFAOYSA-N 0.000 description 1
- JZUHIOJYCPIVLQ-UHFFFAOYSA-N 2-methylpentane-1,5-diamine Chemical compound NCC(C)CCCN JZUHIOJYCPIVLQ-UHFFFAOYSA-N 0.000 description 1
- LTZQJVGOFCCDQA-UHFFFAOYSA-N 3-methylhexane-1,6-diamine Chemical compound NCCC(C)CCCN LTZQJVGOFCCDQA-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 101100462138 Brassica napus OlnB1 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- WJJMNDUMQPNECX-UHFFFAOYSA-N Dipicolinic acid Natural products OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 1
- 241001082241 Lythrum hyssopifolia Species 0.000 description 1
- 239000005643 Pelargonic acid Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- ABPUBUORTRHHDZ-UHFFFAOYSA-N [4-(aminomethyl)-3-bicyclo[2.2.1]heptanyl]methanamine Chemical compound C1CC2(CN)C(CN)CC1C2 ABPUBUORTRHHDZ-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- CCQPAEQGAVNNIA-UHFFFAOYSA-N cyclobutane-1,1-dicarboxylic acid Chemical compound OC(=O)C1(C(O)=O)CCC1 CCQPAEQGAVNNIA-UHFFFAOYSA-N 0.000 description 1
- QYQADNCHXSEGJT-UHFFFAOYSA-N cyclohexane-1,1-dicarboxylate;hydron Chemical class OC(=O)C1(C(O)=O)CCCCC1 QYQADNCHXSEGJT-UHFFFAOYSA-N 0.000 description 1
- PDXRQENMIVHKPI-UHFFFAOYSA-N cyclohexane-1,1-diol Chemical compound OC1(O)CCCCC1 PDXRQENMIVHKPI-UHFFFAOYSA-N 0.000 description 1
- YQLZOAVZWJBZSY-UHFFFAOYSA-N decane-1,10-diamine Chemical compound NCCCCCCCCCCN YQLZOAVZWJBZSY-UHFFFAOYSA-N 0.000 description 1
- FOTKYAAJKYLFFN-UHFFFAOYSA-N decane-1,10-diol Chemical class OCCCCCCCCCCO FOTKYAAJKYLFFN-UHFFFAOYSA-N 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920006351 engineering plastic Polymers 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- SYLAFCZSYRXBJF-UHFFFAOYSA-N furan-3,4-dicarboxylic acid Chemical compound OC(=O)C1=COC=C1C(O)=O SYLAFCZSYRXBJF-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000005337 ground glass Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- PWSKHLMYTZNYKO-UHFFFAOYSA-N heptane-1,7-diamine Chemical compound NCCCCCCCN PWSKHLMYTZNYKO-UHFFFAOYSA-N 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical class C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002561 ketenes Chemical class 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- CWQXQMHSOZUFJS-UHFFFAOYSA-N molybdenum disulfide Chemical compound S=[Mo]=S CWQXQMHSOZUFJS-UHFFFAOYSA-N 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- WXUAQHNMJWJLTG-UHFFFAOYSA-N monomethylpersuccinic acid Natural products OC(=O)C(C)CC(O)=O WXUAQHNMJWJLTG-UHFFFAOYSA-N 0.000 description 1
- DFFZOPXDTCDZDP-UHFFFAOYSA-N naphthalene-1,5-dicarboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1C(O)=O DFFZOPXDTCDZDP-UHFFFAOYSA-N 0.000 description 1
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 1
- WPUMVKJOWWJPRK-UHFFFAOYSA-N naphthalene-2,7-dicarboxylic acid Chemical compound C1=CC(C(O)=O)=CC2=CC(C(=O)O)=CC=C21 WPUMVKJOWWJPRK-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- SXJVFQLYZSNZBT-UHFFFAOYSA-N nonane-1,9-diamine Chemical compound NCCCCCCCCCN SXJVFQLYZSNZBT-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- UHHKSVZZTYJVEG-UHFFFAOYSA-N oxepane Chemical compound C1CCCOCC1 UHHKSVZZTYJVEG-UHFFFAOYSA-N 0.000 description 1
- HZIVRQOIUMAXID-UHFFFAOYSA-N oxocane Chemical compound C1CCCOCCC1 HZIVRQOIUMAXID-UHFFFAOYSA-N 0.000 description 1
- YVQBOKCDPCUWSP-UHFFFAOYSA-N oxonane Chemical compound C1CCCCOCCC1 YVQBOKCDPCUWSP-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical class OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229920006295 polythiol Polymers 0.000 description 1
- 239000012255 powdered metal Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 229920005604 random copolymer Polymers 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920006344 thermoplastic copolyester Polymers 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- KLNPWTHGTVSSEU-UHFFFAOYSA-N undecane-1,11-diamine Chemical compound NCCCCCCCCCCCN KLNPWTHGTVSSEU-UHFFFAOYSA-N 0.000 description 1
- GKXVJHDEWHKBFH-UHFFFAOYSA-N xylylenediamine group Chemical group C=1(C(=CC=CC1)CN)CN GKXVJHDEWHKBFH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L77/00—Compositions of polyamides obtained by reactions forming a carboxylic amide link in the main chain; Compositions of derivatives of such polymers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyamides (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2442391A DE2442391A1 (de) | 1974-09-04 | 1974-09-04 | Thermoplastische polyamidformmassen |
| NL7510246A NL7510246A (nl) | 1974-09-04 | 1975-08-29 | Thermoplastische polyamide-vormmassa's. |
| IT26829/75A IT1042241B (it) | 1974-09-04 | 1975-09-02 | Masse di formatura polimmidiche termoplastiche |
| LU73299A LU73299A1 (enExample) | 1974-09-04 | 1975-09-02 | |
| CA75234750A CA1048683A (en) | 1974-09-04 | 1975-09-02 | Thermoplastic polyamide moulding compositions |
| DK393375A DK393375A (da) | 1974-09-04 | 1975-09-02 | Termoplastisk polyamidformmasse |
| US05/609,674 US4014957A (en) | 1974-09-04 | 1975-09-02 | Thermoplastic polyamide moulding compositions |
| AT680675A ATA680675A (de) | 1974-09-04 | 1975-09-03 | Thermoplastische polyamidformmasse |
| GB36264/75A GB1509959A (en) | 1974-09-04 | 1975-09-03 | Polyamide compositions |
| JP50106096A JPS5154658A (enExample) | 1974-09-04 | 1975-09-03 | |
| BE159740A BE833069A (fr) | 1974-09-04 | 1975-09-04 | Matieres a mouler thermoplastiques a base de polyamides |
| FR7527087A FR2283932A1 (fr) | 1974-09-04 | 1975-09-04 | Matieres a mouler thermoplastiques a base de polyamides |
| ZA00755651A ZA755651B (en) | 1974-09-04 | 1975-09-04 | Thermoplastic polyamide moulding compositions |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2442391A DE2442391A1 (de) | 1974-09-04 | 1974-09-04 | Thermoplastische polyamidformmassen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2442391A1 true DE2442391A1 (de) | 1976-03-18 |
Family
ID=5924874
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2442391A Withdrawn DE2442391A1 (de) | 1974-09-04 | 1974-09-04 | Thermoplastische polyamidformmassen |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4014957A (enExample) |
| JP (1) | JPS5154658A (enExample) |
| AT (1) | ATA680675A (enExample) |
| BE (1) | BE833069A (enExample) |
| CA (1) | CA1048683A (enExample) |
| DE (1) | DE2442391A1 (enExample) |
| DK (1) | DK393375A (enExample) |
| FR (1) | FR2283932A1 (enExample) |
| GB (1) | GB1509959A (enExample) |
| IT (1) | IT1042241B (enExample) |
| LU (1) | LU73299A1 (enExample) |
| NL (1) | NL7510246A (enExample) |
| ZA (1) | ZA755651B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2732111A1 (de) * | 1976-07-21 | 1978-01-26 | Anic Spa | Elastomere in form von thermoplastischen copolymerisaten |
| EP0124741A1 (de) * | 1983-04-08 | 1984-11-14 | Bayer Ag | Verfahren zur Herstellung von Polyesterpolyamidblockpolymeren |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53140350A (en) * | 1977-05-14 | 1978-12-07 | Toyobo Co Ltd | Polyamide resin composition |
| US4391951A (en) * | 1982-01-04 | 1983-07-05 | The Polymer Corporation | Nylon 6 with improved wear life |
| US4391956A (en) * | 1982-01-04 | 1983-07-05 | The Polymer Corporation | Impact modified nylon 6 |
| US4391943A (en) * | 1982-01-04 | 1983-07-05 | The Polymer Corporation | UV Stabilized nylon 6 |
| JPS5956443A (ja) * | 1982-09-24 | 1984-03-31 | Mitsubishi Gas Chem Co Inc | 成形材料用樹脂組成物 |
| US4670522A (en) * | 1985-12-18 | 1987-06-02 | Union Camp Corporation | Polymer blends |
| AU671991B2 (en) * | 1992-04-14 | 1996-09-19 | Allied-Signal Inc. | Miscible thermoplastic compositions containing polyamide/amorphous polyamide blends |
| DE69413247T2 (de) * | 1993-11-19 | 1999-03-25 | Alliedsignal Inc., Morristown, N.J. | Polyamidzusammensetzungen enthaltend aliphatisches polyamid und aromatisches polyamidoligomer mit verbesserter feuchtebestaendigkeit |
| NL1005520C2 (nl) * | 1997-03-13 | 1998-09-15 | Dsm Nv | Automobielonderdelen uit een polyamide samenstelling. |
| DE10122188B4 (de) * | 2001-05-08 | 2007-04-12 | Ems-Chemie Ag | Polyamidformmassen zur Herstellung optischer Linsen |
| DE50207620D1 (de) * | 2001-11-15 | 2006-09-07 | Ems Chemie Ag | Verfahren zum Herstellen einer Polyamidformmasse |
| NL2002382C2 (en) | 2008-12-30 | 2010-07-01 | Furanix Technologies Bv | A process for preparing a polymer having a 2,5-furandicarboxylate moiety within the polymer backbone and such (co)polymers. |
| US9731482B2 (en) * | 2011-06-27 | 2017-08-15 | Mitsubishi Gas Chemical Company, Inc. | Multilayer injection-molded body |
| US9718259B2 (en) * | 2011-06-27 | 2017-08-01 | Mitsubishi Gas Chemical Company, Inc. | Multilayer injection-molded body |
| CN103619956B (zh) * | 2011-06-27 | 2015-10-07 | 三菱瓦斯化学株式会社 | 注射成型体 |
| US20250129211A1 (en) * | 2021-08-03 | 2025-04-24 | Solvay Specialty Polymers Usa, Llc | Thermally resistant polyamide |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3551278A (en) * | 1967-01-14 | 1970-12-29 | Kanebo Ltd | Method of producing improved self-crimpable conjugate filaments,from polyamides and polyether-esters |
| DE1669490A1 (de) * | 1967-02-13 | 1970-12-03 | Kanegafuchi Spinning Co Ltd | Verfahren zur Herstellung von gemischten Faeden |
| GB1270097A (en) * | 1968-09-05 | 1972-04-12 | Ici Ltd | Polyamide and polyetheresteramide composition |
| US3584074A (en) | 1968-11-01 | 1971-06-08 | Teijin Ltd | Fibrous materials from polyethylene terephthalate polyether copolymer and polyamide |
| US3896078A (en) * | 1972-12-18 | 1975-07-22 | Du Pont | Stabilization of polymers containing poly(alkylene oxide) units |
| US3917743A (en) * | 1974-03-07 | 1975-11-04 | Du Pont | Copolyetherester blends |
-
1974
- 1974-09-04 DE DE2442391A patent/DE2442391A1/de not_active Withdrawn
-
1975
- 1975-08-29 NL NL7510246A patent/NL7510246A/xx not_active Application Discontinuation
- 1975-09-02 DK DK393375A patent/DK393375A/da unknown
- 1975-09-02 US US05/609,674 patent/US4014957A/en not_active Expired - Lifetime
- 1975-09-02 IT IT26829/75A patent/IT1042241B/it active
- 1975-09-02 LU LU73299A patent/LU73299A1/xx unknown
- 1975-09-02 CA CA75234750A patent/CA1048683A/en not_active Expired
- 1975-09-03 JP JP50106096A patent/JPS5154658A/ja active Pending
- 1975-09-03 GB GB36264/75A patent/GB1509959A/en not_active Expired
- 1975-09-03 AT AT680675A patent/ATA680675A/de not_active Application Discontinuation
- 1975-09-04 BE BE159740A patent/BE833069A/xx unknown
- 1975-09-04 FR FR7527087A patent/FR2283932A1/fr active Granted
- 1975-09-04 ZA ZA00755651A patent/ZA755651B/xx unknown
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2732111A1 (de) * | 1976-07-21 | 1978-01-26 | Anic Spa | Elastomere in form von thermoplastischen copolymerisaten |
| DE2732111C2 (de) * | 1976-07-21 | 1986-06-26 | Anic S.P.A., Palermo | Elastomere in Form von thermoplastischen Copolyesteramiden |
| EP0124741A1 (de) * | 1983-04-08 | 1984-11-14 | Bayer Ag | Verfahren zur Herstellung von Polyesterpolyamidblockpolymeren |
| US4985508A (en) * | 1983-04-08 | 1991-01-15 | Bayer Aktiengesellschaft | Process for the production of polyester-polyamide block polymers |
Also Published As
| Publication number | Publication date |
|---|---|
| LU73299A1 (enExample) | 1977-05-11 |
| FR2283932B1 (enExample) | 1978-10-27 |
| CA1048683A (en) | 1979-02-13 |
| GB1509959A (en) | 1978-05-10 |
| US4014957A (en) | 1977-03-29 |
| IT1042241B (it) | 1980-01-30 |
| DK393375A (da) | 1976-03-05 |
| JPS5154658A (enExample) | 1976-05-13 |
| NL7510246A (nl) | 1976-03-08 |
| BE833069A (fr) | 1976-03-04 |
| ATA680675A (de) | 1976-12-15 |
| FR2283932A1 (fr) | 1976-04-02 |
| ZA755651B (en) | 1976-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2442391A1 (de) | Thermoplastische polyamidformmassen | |
| EP1120443B1 (de) | Leichtfliessende transparente Polyamid-Formmasse | |
| DE2642244C2 (de) | Verfahren zur Herstellung von glasklar durchsichtigen Copolyamiden und deren Verwendung zur Herstellung von Formkörpern | |
| DE69312701T2 (de) | Thermoplastische zusammensetzungen enthaltend mischungen aus polyamiden und amorphen copolyamiden | |
| EP0331001B1 (de) | Thermoplastische Formmassen auf der Basis von Polyamiden | |
| EP0299444A2 (de) | Teilaromatische Copolyamide mit verringertem Triamingehalt | |
| EP0355315A1 (de) | Thermoplastische Formmassen auf der Basis von Polyamidmischungen | |
| DE3600015A1 (de) | Transparente copolyamide und ihre verwendung zur herstellung von formkoerpern | |
| CH634087A5 (de) | Thermoplastische formmassen auf der basis von polyamiden aus omega-aminocarbonsaeuren bzw. lactamen mit mehr als 10 kohlenstoffatomen mit hoher flexibilitaet und kaelteschlagzaehigkeit. | |
| DE2403889A1 (de) | Thermoplastische formmassen | |
| DE10259048A1 (de) | Copolyamide | |
| DE2256217A1 (de) | Mischungen thermoplastischer polyamide | |
| EP0255901B1 (de) | Flammgeschützte verstärkte Polyamidformmassen mit heller Einfärbung | |
| EP0302483B1 (de) | Feststoffmischung aus nukleierten und nicht-nukleierten Polyamiden | |
| DE68918001T2 (de) | Polyamidharz Formmasse. | |
| EP0885930B1 (de) | Schlagzähe transparente Polyamidlegierungen | |
| DE2343693C2 (de) | Thermoplastische Polyamidformmassen | |
| DE4131986A1 (de) | Unverstaerkte polyamidformmassen | |
| EP0345486B1 (de) | Thermoplastische Formmassen | |
| EP0023248B1 (de) | Formmasse aus einem hochmolekularen linearen Polyester | |
| CH626108A5 (en) | Polyamide composition | |
| DE3909215A1 (de) | Polyetheramid-schmelzklebstoffe | |
| EP0591731A1 (de) | Fliessfähige Polyamidformmassen | |
| DE1745448A1 (de) | Verfahren zur Herstellung von polymeren Esteramiden | |
| DE2402277A1 (de) | Verstaerkte thermoplastische kunststoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |