DE2422411A1 - Hochdruckquecksilberdampfentladungslampe - Google Patents
HochdruckquecksilberdampfentladungslampeInfo
- Publication number
- DE2422411A1 DE2422411A1 DE19742422411 DE2422411A DE2422411A1 DE 2422411 A1 DE2422411 A1 DE 2422411A1 DE 19742422411 DE19742422411 DE 19742422411 DE 2422411 A DE2422411 A DE 2422411A DE 2422411 A1 DE2422411 A1 DE 2422411A1
- Authority
- DE
- Germany
- Prior art keywords
- halides
- volatile
- discharge vessel
- high pressure
- pressure mercury
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 title claims description 20
- 150000004820 halides Chemical class 0.000 claims description 32
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 229910052753 mercury Inorganic materials 0.000 claims description 9
- 150000002739 metals Chemical class 0.000 claims description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 8
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 6
- 229910052782 aluminium Inorganic materials 0.000 claims description 5
- 229910052738 indium Inorganic materials 0.000 claims description 5
- 229910052716 thallium Inorganic materials 0.000 claims description 5
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 4
- 229910001508 alkali metal halide Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 229910052788 barium Inorganic materials 0.000 claims description 4
- 229910052791 calcium Inorganic materials 0.000 claims description 4
- 239000011575 calcium Substances 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 229910052718 tin Inorganic materials 0.000 claims description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052793 cadmium Inorganic materials 0.000 claims description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052792 caesium Inorganic materials 0.000 claims description 3
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 claims description 3
- 229910052744 lithium Inorganic materials 0.000 claims description 3
- 229910052756 noble gas Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 229910052712 strontium Inorganic materials 0.000 claims description 3
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052733 gallium Inorganic materials 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 229910052706 scandium Inorganic materials 0.000 claims description 2
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 claims description 2
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 82
- 235000009518 sodium iodide Nutrition 0.000 description 27
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 16
- 239000007789 gas Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- -1 Thallojodid Chemical compound 0.000 description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 6
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 239000000539 dimer Substances 0.000 description 4
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 150000004694 iodide salts Chemical class 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- RMUKCGUDVKEQPL-UHFFFAOYSA-K triiodoindigane Chemical compound I[In](I)I RMUKCGUDVKEQPL-UHFFFAOYSA-K 0.000 description 3
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 3
- 229910052721 tungsten Inorganic materials 0.000 description 3
- 239000010937 tungsten Substances 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 229910021617 Indium monochloride Inorganic materials 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- OKIIEJOIXGHUKX-UHFFFAOYSA-L cadmium iodide Chemical compound [Cd+2].[I-].[I-] OKIIEJOIXGHUKX-UHFFFAOYSA-L 0.000 description 2
- 239000007772 electrode material Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- APHGZSBLRQFRCA-UHFFFAOYSA-M indium(1+);chloride Chemical compound [In]Cl APHGZSBLRQFRCA-UHFFFAOYSA-M 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229940075417 cadmium iodide Drugs 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- ZYCMDWDFIQDPLP-UHFFFAOYSA-N hbr bromine Chemical compound Br.Br ZYCMDWDFIQDPLP-UHFFFAOYSA-N 0.000 description 1
- AJKLKFPOECCSOO-UHFFFAOYSA-N hydrochloride;hydroiodide Chemical compound Cl.I AJKLKFPOECCSOO-UHFFFAOYSA-N 0.000 description 1
- ILVUABTVETXVMV-UHFFFAOYSA-N hydron;bromide;iodide Chemical compound Br.I ILVUABTVETXVMV-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000000752 ionisation method Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Inorganic materials [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
Landscapes
- Discharge Lamp (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742422411 DE2422411A1 (de) | 1974-05-09 | 1974-05-09 | Hochdruckquecksilberdampfentladungslampe |
| IT2308275A IT1037912B (it) | 1974-05-09 | 1975-05-06 | Lampada a scarica a vapori di mercurio ad alta pressione |
| NL7505275A NL7505275A (nl) | 1974-05-09 | 1975-05-06 | Hogedrukkwikdampontladingslamp. |
| GB1916675A GB1498258A (en) | 1974-05-09 | 1975-05-07 | High pressure mercury vapour discharge lamp |
| FR7514333A FR2270673B1 (enrdf_load_stackoverflow) | 1974-05-09 | 1975-05-07 | |
| BE156147A BE828831A (fr) | 1974-05-09 | 1975-05-07 | Lampe a decharge dans la vapeur de mercure a haute pression |
| JP5535375A JPS50152578A (enrdf_load_stackoverflow) | 1974-05-09 | 1975-05-08 | |
| BR7503672A BR7502888A (pt) | 1974-05-09 | 1975-05-09 | Lampada de descarga a vapor de mercurio de alta pressao |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742422411 DE2422411A1 (de) | 1974-05-09 | 1974-05-09 | Hochdruckquecksilberdampfentladungslampe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2422411A1 true DE2422411A1 (de) | 1975-12-11 |
Family
ID=5915050
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742422411 Ceased DE2422411A1 (de) | 1974-05-09 | 1974-05-09 | Hochdruckquecksilberdampfentladungslampe |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS50152578A (enrdf_load_stackoverflow) |
| BE (1) | BE828831A (enrdf_load_stackoverflow) |
| BR (1) | BR7502888A (enrdf_load_stackoverflow) |
| DE (1) | DE2422411A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2270673B1 (enrdf_load_stackoverflow) |
| GB (1) | GB1498258A (enrdf_load_stackoverflow) |
| IT (1) | IT1037912B (enrdf_load_stackoverflow) |
| NL (1) | NL7505275A (enrdf_load_stackoverflow) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2655167A1 (de) * | 1976-12-06 | 1978-06-08 | Patra Patent Treuhand | Hochdruckentladungslampe mit metallhalogeniden |
| FR2393419A1 (fr) * | 1977-06-04 | 1978-12-29 | Philips Nv | Lampe a decharge dans la vapeur de mercure a haute pression |
| DE3242752A1 (de) * | 1982-01-19 | 1983-09-08 | Jenoptik Jena Gmbh, Ddr 6900 Jena | Elektrodenstabilisierte hochdruckentladungslampe mit leuchtzusaetzen |
| US4686419A (en) * | 1985-02-22 | 1987-08-11 | Patent Treuhand Gesellschaft Fur Elektrische Gluhlampen Mbh | Compact high-pressure discharge lamp with a fill including cadmium and lithium halide |
| US4801846A (en) * | 1986-12-19 | 1989-01-31 | Gte Laboratories Incorporated | Rare earth halide light source with enhanced red emission |
| US5451838A (en) * | 1994-03-03 | 1995-09-19 | Hamamatsu Photonics K.K. | Metal halide lamp |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5231583A (en) * | 1975-09-05 | 1977-03-10 | Toshiba Corp | Lamp discharging metallic fumes |
| US5013968A (en) * | 1989-03-10 | 1991-05-07 | General Electric Company | Reprographic metal halide lamps having long life and maintenance |
| JPH03152852A (ja) * | 1989-11-08 | 1991-06-28 | Matsushita Electric Works Ltd | 高輝度放電ランプ及び無電極放電灯装置 |
| US5256940A (en) * | 1989-11-08 | 1993-10-26 | Matsushita Electric Works, Ltd. | High intensity discharge lamp device |
| DE4132530A1 (de) * | 1991-09-30 | 1993-04-01 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe kleiner leistung |
| US5212424A (en) * | 1991-11-21 | 1993-05-18 | General Electric Company | Metal halide discharge lamp containing a sodium getter |
| EP0543169B2 (en) * | 1991-11-21 | 1998-08-19 | Ushiodenki Kabushiki Kaisha | Metallic vapour discharge lamp |
| DE19645959A1 (de) * | 1996-11-07 | 1998-05-14 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Metallhalogenid-Hochdruckentladungslampe |
| CA2274199A1 (en) * | 1998-11-10 | 2000-05-10 | Osram Sylvania Inc. | Arc discharge lamp containing barium having improved arc tube |
| US6731068B2 (en) * | 2001-12-03 | 2004-05-04 | General Electric Company | Ceramic metal halide lamp |
| JP2005534139A (ja) * | 2002-01-15 | 2005-11-10 | コーニンクレッカ フィリップス エレクトロニクス エヌ ヴィ | メタルハライドランプ |
| US7268495B2 (en) * | 2005-01-21 | 2007-09-11 | General Electric Company | Ceramic metal halide lamp |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1444023A (en) * | 1973-01-23 | 1976-07-28 | Thorn Electrical Ind Ltd | Electric discharge lamps |
-
1974
- 1974-05-09 DE DE19742422411 patent/DE2422411A1/de not_active Ceased
-
1975
- 1975-05-06 NL NL7505275A patent/NL7505275A/xx not_active Application Discontinuation
- 1975-05-06 IT IT2308275A patent/IT1037912B/it active
- 1975-05-07 BE BE156147A patent/BE828831A/xx unknown
- 1975-05-07 GB GB1916675A patent/GB1498258A/en not_active Expired
- 1975-05-07 FR FR7514333A patent/FR2270673B1/fr not_active Expired
- 1975-05-08 JP JP5535375A patent/JPS50152578A/ja active Pending
- 1975-05-09 BR BR7503672A patent/BR7502888A/pt unknown
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2655167A1 (de) * | 1976-12-06 | 1978-06-08 | Patra Patent Treuhand | Hochdruckentladungslampe mit metallhalogeniden |
| FR2393419A1 (fr) * | 1977-06-04 | 1978-12-29 | Philips Nv | Lampe a decharge dans la vapeur de mercure a haute pression |
| DE3242752A1 (de) * | 1982-01-19 | 1983-09-08 | Jenoptik Jena Gmbh, Ddr 6900 Jena | Elektrodenstabilisierte hochdruckentladungslampe mit leuchtzusaetzen |
| US4686419A (en) * | 1985-02-22 | 1987-08-11 | Patent Treuhand Gesellschaft Fur Elektrische Gluhlampen Mbh | Compact high-pressure discharge lamp with a fill including cadmium and lithium halide |
| EP0193086A3 (en) * | 1985-02-22 | 1988-11-02 | Patent-Treuhand-Gesellschaft Fur Elektrische Gluhlampen Mbh | Compact high pressure discharge lamp |
| US4801846A (en) * | 1986-12-19 | 1989-01-31 | Gte Laboratories Incorporated | Rare earth halide light source with enhanced red emission |
| US5451838A (en) * | 1994-03-03 | 1995-09-19 | Hamamatsu Photonics K.K. | Metal halide lamp |
Also Published As
| Publication number | Publication date |
|---|---|
| BE828831A (fr) | 1975-11-07 |
| FR2270673B1 (enrdf_load_stackoverflow) | 1979-04-06 |
| IT1037912B (it) | 1979-11-20 |
| JPS50152578A (enrdf_load_stackoverflow) | 1975-12-08 |
| GB1498258A (en) | 1978-01-18 |
| FR2270673A1 (enrdf_load_stackoverflow) | 1975-12-05 |
| NL7505275A (nl) | 1975-11-11 |
| BR7502888A (pt) | 1976-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2422411A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| EP0903770B1 (de) | Metallhalogenidlampe | |
| DE1464181B2 (de) | Elektrische hochdruck dampfentladungslampe | |
| EP0193086B1 (de) | Kompakte Hochdruckentladungslampe | |
| DE2455277C2 (de) | Hochdruck-Zinnhalogenidentladungslampe | |
| DE3813421A1 (de) | Hochdruck-quecksilberdampfentladungslampe | |
| EP0637056B1 (de) | Hochdruckentladungslampe | |
| EP0453893B1 (de) | Hochdruckentladungslampe | |
| DE2617915A1 (de) | Lichtbogen-entladungseinrichtung | |
| DE1940539B2 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden | |
| DE2519377A1 (de) | Quecksilberdampf-hochdruckentladungslampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2359138A1 (de) | Quecksilber-metallhalogenid-entladungslampen | |
| DE2725297A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2201831A1 (de) | Bogenentladungsvorrichtung | |
| DE2530076A1 (de) | Thoriumoxid-yttriumoxid-emissionsmischung fuer entladungslampen | |
| DE69327275T2 (de) | Metall iodid lampe | |
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE3733217C2 (enrdf_load_stackoverflow) | ||
| EP1187173A2 (de) | Niederdruckgasentladungslampe mit kupferhaltiger Gasfüllung | |
| DE2456757C2 (de) | Metallhalogenid-Hochdruckgasentladungslampe | |
| DE2114804B2 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination | ||
| 8180 | Miscellaneous part 1 |
Free format text: WIEDEREINSETZUNG IN DEN VORHERGEHENDEN STAND |
|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |