DE2362648C2 - Verfahren zur Herstellung von o-Hydroxyhalogenbenzolsulfonaten - Google Patents
Verfahren zur Herstellung von o-HydroxyhalogenbenzolsulfonatenInfo
- Publication number
- DE2362648C2 DE2362648C2 DE2362648A DE2362648A DE2362648C2 DE 2362648 C2 DE2362648 C2 DE 2362648C2 DE 2362648 A DE2362648 A DE 2362648A DE 2362648 A DE2362648 A DE 2362648A DE 2362648 C2 DE2362648 C2 DE 2362648C2
- Authority
- DE
- Germany
- Prior art keywords
- sodium
- solvent
- reaction
- dielectric constant
- selectivity
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 6
- 239000002904 solvent Substances 0.000 claims description 28
- 238000007127 saponification reaction Methods 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 2
- 239000007791 liquid phase Substances 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 17
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 14
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 12
- 229910052708 sodium Inorganic materials 0.000 description 12
- 239000011734 sodium Substances 0.000 description 12
- 238000006467 substitution reaction Methods 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- -1 alkyl radical Chemical class 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 5
- OMVLAGBUFPUMGQ-UHFFFAOYSA-M sodium;2,4,5-trichlorobenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl OMVLAGBUFPUMGQ-UHFFFAOYSA-M 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000001804 chlorine Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- VGVRPFIJEJYOFN-UHFFFAOYSA-N 2,3,4,6-tetrachlorophenol Chemical class OC1=C(Cl)C=C(Cl)C(Cl)=C1Cl VGVRPFIJEJYOFN-UHFFFAOYSA-N 0.000 description 2
- BWRJIDMRILXEDW-UHFFFAOYSA-N 2,3,4-trichlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C(Cl)=C1Cl BWRJIDMRILXEDW-UHFFFAOYSA-N 0.000 description 2
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical compound [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 1
- XKEFYDZQGKAQCN-UHFFFAOYSA-N 1,3,5-trichlorobenzene Chemical compound ClC1=CC(Cl)=CC(Cl)=C1 XKEFYDZQGKAQCN-UHFFFAOYSA-N 0.000 description 1
- UXGBMFKPXSGANM-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl UXGBMFKPXSGANM-UHFFFAOYSA-N 0.000 description 1
- ZGZXYZZHXXTTJN-UHFFFAOYSA-N 2,3-dichlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(Cl)=C1Cl ZGZXYZZHXXTTJN-UHFFFAOYSA-N 0.000 description 1
- RYVQCRHDUUSHQX-UHFFFAOYSA-N 2-chloro-4-hydroxybenzenesulfonic acid Chemical class OC1=CC=C(S(O)(=O)=O)C(Cl)=C1 RYVQCRHDUUSHQX-UHFFFAOYSA-N 0.000 description 1
- IULJSGIJJZZUMF-UHFFFAOYSA-N 2-hydroxybenzenesulfonic acid Chemical compound OC1=CC=CC=C1S(O)(=O)=O IULJSGIJJZZUMF-UHFFFAOYSA-N 0.000 description 1
- WDNBURPWRNALGP-UHFFFAOYSA-N 3,4-Dichlorophenol Chemical compound OC1=CC=C(Cl)C(Cl)=C1 WDNBURPWRNALGP-UHFFFAOYSA-N 0.000 description 1
- BOUSMGITTRHFHS-UHFFFAOYSA-N 3,4-dichloro-2-hydroxybenzenesulfonic acid Chemical class OC1=C(Cl)C(Cl)=CC=C1S(O)(=O)=O BOUSMGITTRHFHS-UHFFFAOYSA-N 0.000 description 1
- FQEYHIPPYOSPLF-UHFFFAOYSA-N 4-bromo-3-chlorophenol Chemical compound OC1=CC=C(Br)C(Cl)=C1 FQEYHIPPYOSPLF-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical class CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 239000004435 Oxo alcohol Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 206010039509 Scab Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- XGZRAKBCYZIBKP-UHFFFAOYSA-L disodium;dihydroxide Chemical compound [OH-].[OH-].[Na+].[Na+] XGZRAKBCYZIBKP-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000005171 halobenzenes Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical class CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- VDGYMDVRXAWGJD-UHFFFAOYSA-M lithium;2,4,5-trichlorobenzenesulfonate Chemical compound [Li+].[O-]S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl VDGYMDVRXAWGJD-UHFFFAOYSA-M 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- JLSJYRCUMQYOKR-UHFFFAOYSA-M sodium;2,3,4,5-tetrachlorobenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl JLSJYRCUMQYOKR-UHFFFAOYSA-M 0.000 description 1
- KMFXMUYBJLJRGA-UHFFFAOYSA-M sodium;2,3,4-trichlorobenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=C(Cl)C(Cl)=C1Cl KMFXMUYBJLJRGA-UHFFFAOYSA-M 0.000 description 1
- RZKOSNKZEJZCKB-UHFFFAOYSA-M sodium;2,5-dichloro-4-hydroxybenzenesulfonate Chemical compound [Na+].OC1=CC(Cl)=C(S([O-])(=O)=O)C=C1Cl RZKOSNKZEJZCKB-UHFFFAOYSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C39/00—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a six-membered aromatic ring
- C07C39/24—Halogenated derivatives
- C07C39/26—Halogenated derivatives monocyclic monohydroxylic containing halogen bound to ring carbon atoms
- C07C39/27—Halogenated derivatives monocyclic monohydroxylic containing halogen bound to ring carbon atoms all halogen atoms being bound to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7247213A FR2212827A5 (enExample) | 1972-12-29 | 1972-12-29 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2362648A1 DE2362648A1 (de) | 1974-07-11 |
| DE2362648C2 true DE2362648C2 (de) | 1983-03-17 |
Family
ID=9109632
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2362648A Expired DE2362648C2 (de) | 1972-12-29 | 1973-12-17 | Verfahren zur Herstellung von o-Hydroxyhalogenbenzolsulfonaten |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3965158A (enExample) |
| JP (1) | JPS569502B2 (enExample) |
| BE (1) | BE809291A (enExample) |
| BR (1) | BR7310179D0 (enExample) |
| CA (1) | CA998689A (enExample) |
| DE (1) | DE2362648C2 (enExample) |
| FR (1) | FR2212827A5 (enExample) |
| GB (1) | GB1410848A (enExample) |
| IT (1) | IT1000224B (enExample) |
| NL (1) | NL7317318A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5232469A (en) * | 1975-09-09 | 1977-03-11 | Toyota Motor Corp | Train preventing mechanism of disk brake |
| JPS6216391Y2 (enExample) * | 1980-10-15 | 1987-04-24 | ||
| US4547597A (en) * | 1983-05-17 | 1985-10-15 | The Dow Chemical Company | Preparation of halogenated phenols |
| DE3408806A1 (de) * | 1984-03-10 | 1985-10-10 | Richard Dr. 6507 Ingelheim Sehring | Verfahren zur herstellung von 2,5-dichlorphenol |
| JPS6380700U (enExample) * | 1986-11-12 | 1988-05-27 | ||
| JPH0348281U (enExample) * | 1989-09-19 | 1991-05-08 | ||
| JPH0642733A (ja) * | 1992-04-17 | 1994-02-18 | Nippon Kankyo Asesumento Center:Kk | 排煙処理装置 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2835707A (en) * | 1956-04-23 | 1958-05-20 | Dow Chemical Co | Process for making meta-chlorophenol |
| NL295899A (enExample) * | 1962-07-30 | |||
| US3584052A (en) * | 1968-04-02 | 1971-06-08 | Hoffmann La Roche | Process for preparing alkali metal dichlorophenol sulfonates |
| US3755470A (en) * | 1968-07-31 | 1973-08-28 | E Michaels | Process for preparing polyhalo phenols |
| US3666819A (en) * | 1968-07-31 | 1972-05-30 | Edwin B Michaels | Process for preparing polyhalo phenols |
-
1972
- 1972-12-29 FR FR7247213A patent/FR2212827A5/fr not_active Expired
-
1973
- 1973-11-22 GB GB5427173A patent/GB1410848A/en not_active Expired
- 1973-12-07 IT IT54147/73A patent/IT1000224B/it active
- 1973-12-17 DE DE2362648A patent/DE2362648C2/de not_active Expired
- 1973-12-17 JP JP14174373A patent/JPS569502B2/ja not_active Expired
- 1973-12-18 NL NL7317318A patent/NL7317318A/xx not_active Application Discontinuation
- 1973-12-27 BR BR10179/73A patent/BR7310179D0/pt unknown
- 1973-12-27 US US05/428,828 patent/US3965158A/en not_active Expired - Lifetime
- 1973-12-28 CA CA189,063A patent/CA998689A/fr not_active Expired
- 1973-12-28 BE BE139432A patent/BE809291A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR7310179D0 (pt) | 1974-08-15 |
| BE809291A (fr) | 1974-06-28 |
| IT1000224B (it) | 1976-03-30 |
| FR2212827A5 (enExample) | 1974-07-26 |
| US3965158A (en) | 1976-06-22 |
| NL7317318A (enExample) | 1974-07-02 |
| GB1410848A (en) | 1975-10-22 |
| DE2362648A1 (de) | 1974-07-11 |
| JPS569502B2 (enExample) | 1981-03-02 |
| JPS505353A (enExample) | 1975-01-21 |
| CA998689A (fr) | 1976-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2212278B1 (de) | Verfahren zur herstellung von acylglycinaten | |
| DE1954173C3 (de) | Verfahren zur Herstellung von Bromnitroalkoholen | |
| DE1218434B (de) | Verfahren zur Herstellung von Gemischen oberflaechenaktiver Verbindungen | |
| DE2362648C2 (de) | Verfahren zur Herstellung von o-Hydroxyhalogenbenzolsulfonaten | |
| EP0000493B1 (de) | Verfahren zur Herstellung von 1-Amino-8-naphthol-3,6-disulfonsäure (H-Säure). | |
| EP0302326B1 (de) | Verfahren zur Herstellung von mit Fluor und gegebenenfalls zusätzlich Chlor substituierten Benzotrifluoriden und neue Benzotrifluoride | |
| DE1493433B2 (de) | Verfahren zur herstellung von sekundaeren aminoparaffinen mit primaerer aminogruppe | |
| DE3435299A1 (de) | Verfahren zur herstellung von 1,1,1,3,3,3-hexafluorpropan-2-ol durch hydrogenolyse von hexafluoracetonhydrat | |
| DE2416722C3 (de) | Verfahren zur Herstellung von 2-Nitrohalogenophenolen | |
| EP0812821B1 (de) | Kohlensäureesterbetaine und deren Herstellung und Verwendung | |
| DE3016571A1 (de) | Verfahren zur herstellung von perfluoralkyl-alkanolen | |
| EP0000495A1 (de) | Verfahren zur Herstellung von 1-Amino-8-naphthol-3,6-disulfonsäure (H-Säure). | |
| EP0124084B1 (de) | Verfahren zur Herstellung von 6-Chlor-2,4-dinitrophenol | |
| DE60027210T2 (de) | Verfahren zur herstellung von 1,1-bis-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexan | |
| DE2123989A1 (de) | Verfahren zur Herstellung von C tief 1bis C tief 10-Alkylestern der Chrysanthemsäure | |
| DE2613003B2 (enExample) | ||
| DE650380C (de) | Verfahren zur Darstellung von Morpholin bzw. 2, 6-Dimethylmorpholin | |
| DE2006205A1 (de) | Verfahren zur Herstellung von Nitrophenol und Salzen desselben | |
| EP0173201A1 (de) | Verfahren zur Herstellung aromatischer Bromverbindungen | |
| DE3029368A1 (de) | Verfahren zur halogenierung von gegebenenfalls substituierten 4-tert.-butyltoluolen sowie die daraus erhaltenen gemische aus gegebenenfalls substituierten 4-tert.-butylbenzalhalogeniden, und 4-tert.-butylbenzotrihalogeniden | |
| DE601822C (de) | Verfahren zur Darstellung von AEthern der Acetylenreihe | |
| DE2353330C2 (de) | Verfahren zur Gewinnung von reinem 1,1,2- Trifluor-2-chlorethyldifluormethyläther | |
| DE69600519T2 (de) | Verfahren zur Herstellung von tertiär Butyl-Hydrozin-Halogenid | |
| EP0033775A1 (de) | Verfahren zur Abtrennung von Sulfonsäuren aus dem bei der Umsetzung von Paraffinen mit Schwefeldioxid, Sauerstoff und Wasser in Gegenwart von UV-Licht erhaltenem Reaktionsprodukt | |
| DE169746C (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |