DE2348957A1 - Verfahren zur hydroxylierung aromatischer verbindungen - Google Patents
Verfahren zur hydroxylierung aromatischer verbindungenInfo
- Publication number
- DE2348957A1 DE2348957A1 DE19732348957 DE2348957A DE2348957A1 DE 2348957 A1 DE2348957 A1 DE 2348957A1 DE 19732348957 DE19732348957 DE 19732348957 DE 2348957 A DE2348957 A DE 2348957A DE 2348957 A1 DE2348957 A1 DE 2348957A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen peroxide
- hydroxylation
- works
- reaction
- aromatic compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 23
- 150000001491 aromatic compounds Chemical class 0.000 title claims description 14
- 230000033444 hydroxylation Effects 0.000 title claims description 11
- 238000005805 hydroxylation reaction Methods 0.000 title claims description 11
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 32
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 12
- 229910052752 metalloid Inorganic materials 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 150000002738 metalloids Chemical class 0.000 claims description 8
- 235000011007 phosphoric acid Nutrition 0.000 claims description 8
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 239000008139 complexing agent Substances 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 5
- 239000011669 selenium Substances 0.000 claims description 5
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 4
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 4
- 229910021645 metal ion Inorganic materials 0.000 claims description 4
- 229910052698 phosphorus Inorganic materials 0.000 claims description 4
- 239000011574 phosphorus Substances 0.000 claims description 4
- 229910052711 selenium Inorganic materials 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000012429 reaction media Substances 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 229910052785 arsenic Inorganic materials 0.000 claims description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 229910052714 tellurium Inorganic materials 0.000 claims description 2
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052723 transition metal Inorganic materials 0.000 claims description 2
- 150000003624 transition metals Chemical class 0.000 claims description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 10
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 8
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 229940005657 pyrophosphoric acid Drugs 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- -1 aliphatic peracid Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 235000011180 diphosphates Nutrition 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000004967 organic peroxy acids Chemical class 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 229940048084 pyrophosphate Drugs 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- KKUKTXOBAWVSHC-UHFFFAOYSA-N Dimethylphosphate Chemical compound COP(O)(=O)OC KKUKTXOBAWVSHC-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical compound OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- RUZMUTWCUZLWQU-UHFFFAOYSA-N [ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OP(O)(=O)OCC RUZMUTWCUZLWQU-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000002925 chemical effect Effects 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- YQHVEGTZGGQQMV-UHFFFAOYSA-N dicyclohexyl hydrogen phosphate Chemical class C1CCCCC1OP(=O)(O)OC1CCCCC1 YQHVEGTZGGQQMV-UHFFFAOYSA-N 0.000 description 1
- UCQFCFPECQILOL-UHFFFAOYSA-N diethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCC UCQFCFPECQILOL-UHFFFAOYSA-N 0.000 description 1
- AXDCOWAMLFDLEP-UHFFFAOYSA-N dimethoxyphosphoryl dimethyl phosphate Chemical compound COP(=O)(OC)OP(=O)(OC)OC AXDCOWAMLFDLEP-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 230000000640 hydroxylating effect Effects 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 150000008379 phenol ethers Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/60—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by oxidation reactions introducing directly hydroxy groups on a =CH-group belonging to a six-membered aromatic ring with the aid of other oxidants than molecular oxygen or their mixtures with molecular oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7234358A FR2201279B1 (enExample) | 1972-09-28 | 1972-09-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2348957A1 true DE2348957A1 (de) | 1974-04-11 |
Family
ID=9104904
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732348957 Pending DE2348957A1 (de) | 1972-09-28 | 1973-09-28 | Verfahren zur hydroxylierung aromatischer verbindungen |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3943179A (enExample) |
| JP (1) | JPS4970933A (enExample) |
| AT (1) | AT326632B (enExample) |
| BE (1) | BE805415A (enExample) |
| BR (1) | BR7307453D0 (enExample) |
| DD (1) | DD108732A5 (enExample) |
| DE (1) | DE2348957A1 (enExample) |
| FR (1) | FR2201279B1 (enExample) |
| GB (1) | GB1433545A (enExample) |
| IT (1) | IT995532B (enExample) |
| LU (1) | LU68525A1 (enExample) |
| NL (1) | NL7312990A (enExample) |
| PL (1) | PL86971B1 (enExample) |
| RO (1) | RO70440A (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0121671A3 (en) * | 1983-03-11 | 1985-12-27 | Degussa Aktiengesellschaft | Process for the preparation of dihydroxybenzenes |
| EP0122374A3 (en) * | 1983-03-11 | 1986-01-02 | Degussa Aktiengesellschaft | Process for the preparation of dihydroxybenzenes |
| EP0121693A3 (en) * | 1983-03-11 | 1986-01-08 | Degussa Aktiengesellschaft | Process for the selective preparation of dihydroxybenzenes |
| EP0230625A1 (de) * | 1986-01-25 | 1987-08-05 | Degussa Aktiengesellschaft | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon |
| EP0275400A1 (de) * | 1986-12-18 | 1988-07-27 | Degussa Aktiengesellschaft | Verfahren zur Herstellung von substituierten Dihydroxybenzolen |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2942366A1 (de) * | 1979-10-19 | 1981-04-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung mehrwertiger phenole |
| DE3308737C2 (de) * | 1983-03-11 | 1985-01-24 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Brenzcatechin und Hydrochinon |
| US4588845A (en) * | 1983-07-18 | 1986-05-13 | Fmc Corporation | Oxidation of unsaturated organic compounds with hydrogen peroxide |
| FR2611711B1 (fr) * | 1987-03-06 | 1989-06-09 | Interox Sa | Procede pour la fabrication d'une 2,3-dihydroxyquinoxaline et 2,3-dihydroxyquinoxalines ainsi obtenues |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2437648A (en) * | 1943-09-15 | 1948-03-09 | Research Corp | Catalytic oxidation of unsaturated organic compounds |
| US2792430A (en) * | 1955-11-28 | 1957-05-14 | Shell Dev | Production of phenolic compounds |
| US2903480A (en) * | 1956-03-16 | 1959-09-08 | California Research Corp | Oxidation process with sulfur and water |
| FR2038575A5 (en) * | 1969-03-19 | 1971-01-08 | Air Liquide | Ooxidation of organic compounds using a per- - oxide and oxygen donor |
| US3652597A (en) * | 1970-03-02 | 1972-03-28 | Polaroid Corp | Production of di-hydroxy products |
-
1972
- 1972-09-28 FR FR7234358A patent/FR2201279B1/fr not_active Expired
-
1973
- 1973-09-07 RO RO7376014A patent/RO70440A/ro unknown
- 1973-09-11 PL PL1973165151A patent/PL86971B1/pl unknown
- 1973-09-20 NL NL7312990A patent/NL7312990A/xx unknown
- 1973-09-25 BR BR7453/73A patent/BR7307453D0/pt unknown
- 1973-09-26 JP JP48107648A patent/JPS4970933A/ja active Pending
- 1973-09-26 DD DD173688A patent/DD108732A5/xx unknown
- 1973-09-27 BE BE136131A patent/BE805415A/xx unknown
- 1973-09-27 GB GB4533573A patent/GB1433545A/en not_active Expired
- 1973-09-27 LU LU68525A patent/LU68525A1/xx unknown
- 1973-09-27 US US05/401,172 patent/US3943179A/en not_active Expired - Lifetime
- 1973-09-28 DE DE19732348957 patent/DE2348957A1/de active Pending
- 1973-09-28 AT AT836373A patent/AT326632B/de not_active IP Right Cessation
- 1973-09-28 IT IT29569/73A patent/IT995532B/it active
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0121671A3 (en) * | 1983-03-11 | 1985-12-27 | Degussa Aktiengesellschaft | Process for the preparation of dihydroxybenzenes |
| EP0122374A3 (en) * | 1983-03-11 | 1986-01-02 | Degussa Aktiengesellschaft | Process for the preparation of dihydroxybenzenes |
| EP0121693A3 (en) * | 1983-03-11 | 1986-01-08 | Degussa Aktiengesellschaft | Process for the selective preparation of dihydroxybenzenes |
| EP0230625A1 (de) * | 1986-01-25 | 1987-08-05 | Degussa Aktiengesellschaft | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon |
| EP0275400A1 (de) * | 1986-12-18 | 1988-07-27 | Degussa Aktiengesellschaft | Verfahren zur Herstellung von substituierten Dihydroxybenzolen |
Also Published As
| Publication number | Publication date |
|---|---|
| IT995532B (it) | 1975-11-20 |
| DD108732A5 (enExample) | 1974-10-05 |
| BR7307453D0 (pt) | 1974-08-29 |
| BE805415A (fr) | 1974-03-27 |
| ATA836373A (de) | 1975-03-15 |
| LU68525A1 (enExample) | 1974-04-02 |
| GB1433545A (en) | 1976-04-28 |
| AT326632B (de) | 1975-12-29 |
| FR2201279A1 (enExample) | 1974-04-26 |
| JPS4970933A (enExample) | 1974-07-09 |
| RO70440A (ro) | 1980-06-15 |
| FR2201279B1 (enExample) | 1975-03-14 |
| PL86971B1 (enExample) | 1976-06-30 |
| NL7312990A (enExample) | 1974-04-01 |
| US3943179A (en) | 1976-03-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2733516A1 (de) | Verfahren zum telomerisieren von dienen | |
| DE2627354A1 (de) | Verfahren zur herstellung von aldehyden | |
| DE1643347A1 (de) | Verfahren zur Herstellung von aromatischen Lactonen | |
| DE2410758C3 (de) | Verfahren zur Herstellung von mehrwertigen substituierten Phenolen bzw. Monoäthern mehrwertiger Phenole durch Kernhydroxylierung von Phenolen oder Phenoläthern | |
| DE2514742C3 (de) | Verfahren zur Herstellung von zweiwertigen Phenolderivaten | |
| DE2633302C2 (de) | Verfahren zur Herstellung von Phenolen durch Hydroxylierung von aromatischen Verbindungen | |
| DE2348957A1 (de) | Verfahren zur hydroxylierung aromatischer verbindungen | |
| DE1418577B1 (de) | Verfahren zur Herstellung von kernsubstituierten o-(alpha-Alkylol)-phenolen | |
| DE2355690C2 (de) | Verfahren zur Herstellung von Phenol oder substituierten Phenolen | |
| DE1244780B (de) | Verfahren zur Herstellung von tertiaeren Phosphinoxyden | |
| EP0025519A1 (de) | Verfahren zur Herstellung von 2-Alkyl- bzw. 2-Arylthiomethylphenol | |
| EP0091011A2 (de) | Verfahren zur Herstellung von Phenyläthern | |
| DE2332747A1 (de) | Verfahren zur hydroxylierung aromatischer verbindungen | |
| DE2322290A1 (de) | Verfahren zur hydroxylierung aromatischer verbindungen | |
| DE3308763A1 (de) | Verfahren zur selektiven herstellung von dihydroxybenzolen | |
| DE2638559C2 (de) | Verfahren zur Herstellung von zweiwertigen Phenolen oder deren Monoethern | |
| DE2922688C2 (de) | Verfahren zur Nitrosierung von Phenolen zu Benzochinonoximen | |
| EP0373420A1 (de) | Verfahren zur Abtrennung von Kupfer aus basisch reagierenden, wässrigen Lösungen | |
| DE1187017B (de) | Verfahren zur Herstellung von Polyaethern durch Polykondensation von Thiodiglykol | |
| EP0027593B1 (de) | Verfahren zur Herstellung mehrwertiger Phenole | |
| EP0130439B1 (de) | Verfahren zur Herstellung von Derivaten der Vinylphosphon-, oder Vinylpyrophosphonsäure | |
| DE1173081C2 (de) | Verfahren zur herstellung hochkonzentrierter loesungen von metallseifen epoxydierter fettsaeuren in alkylphenolen | |
| DE1668966B1 (de) | Verfahren zur gleichzeitigen Herstellung von 2,6-Dimethyl-phenol und 4-tert.-Butylphenol | |
| DE1195327B (de) | Verfahren zur Herstellung von symmetrischen Trihydroxybenzolen | |
| DE2514743B2 (de) | Verfahren zur Herstellung von zweiwertigen Phenolderivaten |