DE2301971A1 - 1-alkylidenaminouracile, verfahren zu ihrer herstellung und ihre verwendung als herbizide - Google Patents
1-alkylidenaminouracile, verfahren zu ihrer herstellung und ihre verwendung als herbizideInfo
- Publication number
- DE2301971A1 DE2301971A1 DE2301971A DE2301971A DE2301971A1 DE 2301971 A1 DE2301971 A1 DE 2301971A1 DE 2301971 A DE2301971 A DE 2301971A DE 2301971 A DE2301971 A DE 2301971A DE 2301971 A1 DE2301971 A1 DE 2301971A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- optionally
- amino
- carbon atoms
- optionally substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 16
- 239000004009 herbicide Substances 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 26
- 239000002904 solvent Substances 0.000 claims description 13
- 150000002576 ketones Chemical class 0.000 claims description 11
- 150000001299 aldehydes Chemical class 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- 239000004606 Fillers/Extenders Substances 0.000 claims description 4
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 4
- 239000002798 polar solvent Substances 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 3
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 230000008635 plant growth Effects 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 2
- 125000005347 halocycloalkyl group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 23
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- -1 o-methylcyclohexyl-5-bromo-6-methyl-uracil Chemical compound 0.000 description 14
- 241000196324 Embryophyta Species 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000003995 emulsifying agent Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 229940035893 uracil Drugs 0.000 description 7
- 244000075850 Avena orientalis Species 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 6
- 240000008042 Zea mays Species 0.000 description 6
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 6
- 230000002363 herbicidal effect Effects 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 210000002268 wool Anatomy 0.000 description 6
- 101100310622 Mus musculus Soga1 gene Proteins 0.000 description 5
- 241000209140 Triticum Species 0.000 description 5
- 235000021307 Triticum Nutrition 0.000 description 5
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 5
- 235000005822 corn Nutrition 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- IILMINFWXULDNN-UHFFFAOYSA-N 1-aminopyrimidine-2,4-dione Chemical compound NN1C=CC(=O)NC1=O IILMINFWXULDNN-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 241001049165 Caria Species 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 244000000626 Daucus carota Species 0.000 description 3
- 235000002767 Daucus carota Nutrition 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241001310793 Podium Species 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 241000219422 Urtica Species 0.000 description 3
- 125000002877 alkyl aryl group Chemical group 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- YGHRJJRRZDOVPD-UHFFFAOYSA-N 3-methylbutanal Chemical compound CC(C)CC=O YGHRJJRRZDOVPD-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 235000007351 Eleusine Nutrition 0.000 description 2
- 241000209215 Eleusine Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000234642 Festuca Species 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- 244000042664 Matricaria chamomilla Species 0.000 description 2
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- PWAXUOGZOSVGBO-UHFFFAOYSA-N adipoyl chloride Chemical compound ClC(=O)CCCCC(Cl)=O PWAXUOGZOSVGBO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- ZTMKADLOSYKWCA-UHFFFAOYSA-N lenacil Chemical compound O=C1NC=2CCCC=2C(=O)N1C1CCCCC1 ZTMKADLOSYKWCA-UHFFFAOYSA-N 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N pentanal Chemical compound CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- GUMZPHOQHLZJOY-UHFFFAOYSA-N 1,3-oxazine-2,4-dione Chemical class O=C1C=COC(=O)N1 GUMZPHOQHLZJOY-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- ZWUSBSHBFFPRNE-UHFFFAOYSA-N 3,4-dichlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1Cl ZWUSBSHBFFPRNE-UHFFFAOYSA-N 0.000 description 1
- NLXFKDHULKLENC-UHFFFAOYSA-N 3,4-dihydro-2h-1,3-oxazine Chemical compound C1NCC=CO1 NLXFKDHULKLENC-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- WGDIMRGOISXBSS-UHFFFAOYSA-N 5-bromo-1-butyl-6-methylpyrimidine-2,4-dione Chemical compound CCCCN1C(C)=C(Br)C(=O)NC1=O WGDIMRGOISXBSS-UHFFFAOYSA-N 0.000 description 1
- SLOVSIZPYAVFEK-UHFFFAOYSA-N 5-bromo-3-cyclohexyl-1-[(3,4-dichlorophenyl)methylideneamino]-6-methylpyrimidine-2,4-dione Chemical compound ClC=1C=C(C=NN2C(=O)N(C(=O)C(=C2C)Br)C2CCCCC2)C=CC1Cl SLOVSIZPYAVFEK-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 240000002245 Acer pensylvanicum Species 0.000 description 1
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 1
- 235000003130 Arctium lappa Nutrition 0.000 description 1
- 244000294263 Arctium minus Species 0.000 description 1
- 235000008078 Arctium minus Nutrition 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 206010053759 Growth retardation Diseases 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 244000211187 Lepidium sativum Species 0.000 description 1
- 235000007849 Lepidium sativum Nutrition 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 244000152045 Themeda triandra Species 0.000 description 1
- 244000274883 Urtica dioica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 244000230030 foxtail bristlegrass Species 0.000 description 1
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 208000037824 growth disorder Diseases 0.000 description 1
- 231100000001 growth retardation Toxicity 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- DUDXQIXWPJMPRQ-UHFFFAOYSA-N isocyanatomethylcyclohexane Chemical compound O=C=NCC1CCCCC1 DUDXQIXWPJMPRQ-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- PLQCPDHNBLXOEO-UHFFFAOYSA-N oxazine-3,4-dione Chemical class O=C1C=CONC1=O PLQCPDHNBLXOEO-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- PJGSXYOJTGTZAV-UHFFFAOYSA-N pinacolone Chemical compound CC(=O)C(C)(C)C PJGSXYOJTGTZAV-UHFFFAOYSA-N 0.000 description 1
- 150000007519 polyprotic acids Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- YZHUMGUJCQRKBT-UHFFFAOYSA-M sodium chlorate Chemical compound [Na+].[O-]Cl(=O)=O YZHUMGUJCQRKBT-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000036435 stunted growth Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000012749 thinning agent Substances 0.000 description 1
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/553—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms with halogen atoms or nitro radicals directly attached to ring carbon atoms, e.g. fluorouracil
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (27)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| RO7300077210A RO63028A (fr) | 1973-01-16 | 1973-01-16 | Procede pour la preparation des 1-alkylydenaminouracyles |
| DE2301971A DE2301971A1 (de) | 1973-01-16 | 1973-01-16 | 1-alkylidenaminouracile, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| AU64398/74A AU475434B2 (en) | 1973-01-16 | 1974-01-10 | 1-alkylideneaminouracils, process for their preparation and their use as herbicides |
| BR215/74A BR7400215D0 (pt) | 1973-01-16 | 1974-01-14 | Processo para a preparacao de 1-alquilidenaminouracilos, e composicoes herbicidas a base destes |
| IT19388/74A IT1044792B (it) | 1973-01-16 | 1974-01-14 | I.alcohiliden.amino.uracili procedimento per la loro preparazione e loro impiego come erbicidi |
| DD175988A DD114209A5 (enExample) | 1973-01-16 | 1974-01-14 | |
| PL1974168085A PL88496B1 (enExample) | 1973-01-16 | 1974-01-14 | |
| LU69154A LU69154A1 (enExample) | 1973-01-16 | 1974-01-14 | |
| SU1992877A SU542446A3 (ru) | 1973-01-16 | 1974-01-14 | Способ борьбы с нежелательной растительностью |
| CH48174A CH604514A5 (enExample) | 1973-01-16 | 1974-01-14 | |
| IL44000A IL44000A (en) | 1973-01-16 | 1974-01-14 | 1-alkylideneaminouracils their preparation and their use as herbicides |
| US05/433,165 US4006008A (en) | 1973-01-16 | 1974-01-14 | 1-Alkylideneaminouracil compounds and herbicidal compositions |
| NL7400539A NL7400539A (enExample) | 1973-01-16 | 1974-01-15 | |
| ES422303A ES422303A1 (es) | 1973-01-16 | 1974-01-15 | Procedimiento para la obtencion de 1-alquilidenaminouraci- los. |
| TR17624A TR17624A (tr) | 1973-01-16 | 1974-01-15 | 1-alkilidenaminourasiller,bunlarin hazirlanmasina mahsus usul ve bunlarin herbisid olarak kullanilmasi |
| CA190,205A CA1050980A (en) | 1973-01-16 | 1974-01-15 | 1-alkylideneaminouracils, process for their preparation and their use as herbicides |
| ZA740254A ZA74254B (en) | 1973-01-16 | 1974-01-15 | 1-alkylideneaminouracils,process for their preparation and their use as herbicides |
| IE87/74A IE38745B1 (en) | 1973-01-16 | 1974-01-15 | 1-alkylideneaminouracils process for their preparation and their use as herbicides |
| GB186574A GB1405401A (en) | 1973-01-16 | 1974-01-15 | 1-alkylidene-aminouracils process for their preparation and their use as herbicides |
| EG14/74A EG11022A (en) | 1973-01-16 | 1974-01-15 | 1-alkylideneaminouracils process for their preparation and their use as herbicides |
| JP49007175A JPS49108083A (enExample) | 1973-01-16 | 1974-01-16 | |
| BE139873A BE809818A (fr) | 1973-01-16 | 1974-01-16 | Nouveaux 1-alkylidene-aminouraciles |
| FR7401489A FR2213940B1 (enExample) | 1973-01-16 | 1974-01-16 | |
| CS7400000271A CS179437B2 (en) | 1973-01-16 | 1974-01-16 | Herbicidal agent and method of production of active substances |
| HUBA3015A HU168587B (enExample) | 1973-01-16 | 1974-01-16 | |
| JP49007176A JPS49108245A (enExample) | 1973-01-16 | 1974-01-16 | |
| AT33474*#A AT328791B (de) | 1973-01-16 | 1974-01-16 | Herbizides mittel |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2301971A DE2301971A1 (de) | 1973-01-16 | 1973-01-16 | 1-alkylidenaminouracile, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2301971A1 true DE2301971A1 (de) | 1974-07-25 |
Family
ID=5869110
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2301971A Pending DE2301971A1 (de) | 1973-01-16 | 1973-01-16 | 1-alkylidenaminouracile, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US4006008A (enExample) |
| JP (2) | JPS49108083A (enExample) |
| AT (1) | AT328791B (enExample) |
| AU (1) | AU475434B2 (enExample) |
| BE (1) | BE809818A (enExample) |
| BR (1) | BR7400215D0 (enExample) |
| CA (1) | CA1050980A (enExample) |
| CH (1) | CH604514A5 (enExample) |
| CS (1) | CS179437B2 (enExample) |
| DD (1) | DD114209A5 (enExample) |
| DE (1) | DE2301971A1 (enExample) |
| EG (1) | EG11022A (enExample) |
| ES (1) | ES422303A1 (enExample) |
| FR (1) | FR2213940B1 (enExample) |
| GB (1) | GB1405401A (enExample) |
| HU (1) | HU168587B (enExample) |
| IE (1) | IE38745B1 (enExample) |
| IL (1) | IL44000A (enExample) |
| IT (1) | IT1044792B (enExample) |
| LU (1) | LU69154A1 (enExample) |
| NL (1) | NL7400539A (enExample) |
| PL (1) | PL88496B1 (enExample) |
| RO (1) | RO63028A (enExample) |
| SU (1) | SU542446A3 (enExample) |
| TR (1) | TR17624A (enExample) |
| ZA (1) | ZA74254B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4448961A (en) * | 1980-09-14 | 1984-05-15 | Zoecon Corporation | Substituted anilino pyrimidines |
| DE69204909T2 (de) * | 1991-06-07 | 1996-02-08 | Sumitomo Chemical Co | Amino-Urazilderivate, deren Herstellung und Verwendung. |
| KR20170004695A (ko) | 2015-07-03 | 2017-01-11 | 엘지전자 주식회사 | 와치 타입 단말기 |
-
1973
- 1973-01-16 DE DE2301971A patent/DE2301971A1/de active Pending
- 1973-01-16 RO RO7300077210A patent/RO63028A/ro unknown
-
1974
- 1974-01-10 AU AU64398/74A patent/AU475434B2/en not_active Expired
- 1974-01-14 PL PL1974168085A patent/PL88496B1/pl unknown
- 1974-01-14 BR BR215/74A patent/BR7400215D0/pt unknown
- 1974-01-14 US US05/433,165 patent/US4006008A/en not_active Expired - Lifetime
- 1974-01-14 DD DD175988A patent/DD114209A5/xx unknown
- 1974-01-14 IL IL44000A patent/IL44000A/en unknown
- 1974-01-14 LU LU69154A patent/LU69154A1/xx unknown
- 1974-01-14 IT IT19388/74A patent/IT1044792B/it active
- 1974-01-14 CH CH48174A patent/CH604514A5/xx not_active IP Right Cessation
- 1974-01-14 SU SU1992877A patent/SU542446A3/ru active
- 1974-01-15 ES ES422303A patent/ES422303A1/es not_active Expired
- 1974-01-15 ZA ZA740254A patent/ZA74254B/xx unknown
- 1974-01-15 GB GB186574A patent/GB1405401A/en not_active Expired
- 1974-01-15 IE IE87/74A patent/IE38745B1/xx unknown
- 1974-01-15 NL NL7400539A patent/NL7400539A/xx not_active Application Discontinuation
- 1974-01-15 TR TR17624A patent/TR17624A/xx unknown
- 1974-01-15 EG EG14/74A patent/EG11022A/xx active
- 1974-01-15 CA CA190,205A patent/CA1050980A/en not_active Expired
- 1974-01-16 JP JP49007175A patent/JPS49108083A/ja active Pending
- 1974-01-16 BE BE139873A patent/BE809818A/xx unknown
- 1974-01-16 JP JP49007176A patent/JPS49108245A/ja active Pending
- 1974-01-16 FR FR7401489A patent/FR2213940B1/fr not_active Expired
- 1974-01-16 HU HUBA3015A patent/HU168587B/hu unknown
- 1974-01-16 CS CS7400000271A patent/CS179437B2/cs unknown
- 1974-01-16 AT AT33474*#A patent/AT328791B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS49108083A (enExample) | 1974-10-14 |
| US4006008A (en) | 1977-02-01 |
| ZA74254B (en) | 1974-12-24 |
| CA1050980A (en) | 1979-03-20 |
| BR7400215D0 (pt) | 1974-08-22 |
| FR2213940B1 (enExample) | 1977-06-10 |
| LU69154A1 (enExample) | 1974-08-19 |
| JPS49108245A (enExample) | 1974-10-15 |
| AU6439874A (en) | 1975-07-10 |
| EG11022A (en) | 1977-01-31 |
| PL88496B1 (enExample) | 1976-09-30 |
| RO63028A (fr) | 1978-08-15 |
| IT1044792B (it) | 1980-04-21 |
| DD114209A5 (enExample) | 1975-07-20 |
| CH604514A5 (enExample) | 1978-09-15 |
| ES422303A1 (es) | 1976-07-01 |
| HU168587B (enExample) | 1976-06-28 |
| IL44000A (en) | 1977-05-31 |
| IL44000A0 (en) | 1974-05-16 |
| BE809818A (fr) | 1974-07-16 |
| ATA33474A (de) | 1975-06-15 |
| CS179437B2 (en) | 1977-10-31 |
| AT328791B (de) | 1976-04-12 |
| TR17624A (tr) | 1975-07-23 |
| GB1405401A (en) | 1975-09-10 |
| FR2213940A1 (enExample) | 1974-08-09 |
| IE38745B1 (en) | 1978-05-24 |
| NL7400539A (enExample) | 1974-07-18 |
| IE38745L (en) | 1974-07-16 |
| AU475434B2 (en) | 1976-08-19 |
| SU542446A3 (ru) | 1977-01-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| WO1989002891A1 (fr) | Composes heterocycliques | |
| DE2013406A1 (de) | 1(13 4 Thiadiazol 2 yl) lmidazohdi non (2) Derivate, Verfahren zu ihrer Her stellung und ihre Verwendung als herbizide | |
| DE2207549B2 (de) | 1-Aminouracile und deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2107757C3 (de) | 4-Amino-1,2,4-triazin-5-one, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2138031C3 (de) | Verfahren zur Herstellung von 1.2.4-Triazin-5-onen | |
| DE2141468C3 (de) | H2-Benzothiazolyl)-l-äthyl-3methyl-harnstoff, Verfahren zu seiner Herstellung sowie seine Verwendung als Herbizid | |
| DE2013407A1 (de) | 1 (1,3,4 Thiadiazol 2 yl) lmidazohdi non (2) Derivate, Verfahren zu ihrer Her stellung und ihre Verwendung als herbizide | |
| DE1768244A1 (de) | N-(2,2,4,4-Tetrafluor-1,3-benz-dioxanyl)-harnstoffe und Verfahren zu ihrer Herstellung | |
| DD209718A5 (de) | Schaedlingsbekaempfungsmittel | |
| DE2238206C2 (de) | Azomethine von 4-Amino-5-H-1,2,4-triazin-5-onen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| EP0037495A1 (de) | Pyrimidyl-chinazoline, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate | |
| DE2301971A1 (de) | 1-alkylidenaminouracile, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE2417511A1 (de) | 6-sec.-butyl-1,2,4-triazin-5(4h)-one, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE2346936C2 (de) | Verfahren zur Herstellung von neuen 3,4-Dihydro-1,2,4-triazinen sowie drei Verbindungen dieses Typs und deren Verwendung | |
| DE2114018C3 (de) | 3-(2-Tetrahydropyranyl)-l,23,4tetrahydropyrimidin-2,4-dione, Verfahren zu ihrer Herstellung und pesticide Zusammensetzungen | |
| EP0031086A1 (de) | Halogenierte Imidazol-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE2236339A1 (de) | Verfahren zur herstellung von alphacyan-hydrazonen | |
| DE1817119A1 (de) | Imidazolidinon-Derivate und ihre Verwendung als Herbizide | |
| DE2058346A1 (de) | Verfahren zur Herstellung von 1-(1,3,4-Thiadiazol-2-yl)-imidazolidinon-(2)-Derivaten | |
| DE2340570A1 (de) | Acylierte harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE2441156A1 (de) | 1-furfurylamino-uracile, ein verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| EP0013905B1 (de) | 4,5-Dichlorimidazol-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE1953357A1 (de) | Cyclopropan-carbonsaeure-benzthiazylamide,Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE2514992A1 (de) | Fungizide mittel | |
| DE1670925C3 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OHN | Withdrawal |