DE2251649A1 - Starrer polyurethanharz-gegenstand - Google Patents
Starrer polyurethanharz-gegenstandInfo
- Publication number
- DE2251649A1 DE2251649A1 DE2251649A DE2251649A DE2251649A1 DE 2251649 A1 DE2251649 A1 DE 2251649A1 DE 2251649 A DE2251649 A DE 2251649A DE 2251649 A DE2251649 A DE 2251649A DE 2251649 A1 DE2251649 A1 DE 2251649A1
- Authority
- DE
- Germany
- Prior art keywords
- component
- weights
- sum
- propanol
- hydroxyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920005749 polyurethane resin Polymers 0.000 title claims description 4
- 239000000203 mixture Substances 0.000 claims description 47
- 239000003054 catalyst Substances 0.000 claims description 27
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 12
- 239000007788 liquid Substances 0.000 claims description 11
- 229920005862 polyol Polymers 0.000 claims description 11
- 150000003077 polyols Chemical class 0.000 claims description 11
- 239000007787 solid Substances 0.000 claims description 10
- 238000009835 boiling Methods 0.000 claims description 9
- 239000005056 polyisocyanate Substances 0.000 claims description 9
- 229920001228 polyisocyanate Polymers 0.000 claims description 9
- 239000012948 isocyanate Substances 0.000 claims description 8
- 150000002513 isocyanates Chemical class 0.000 claims description 8
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 claims description 7
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 5
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 5
- 229920000570 polyether Polymers 0.000 claims description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000002524 organometallic group Chemical group 0.000 claims description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- ZOKHGHDRKCYWTH-UHFFFAOYSA-N 1,1-dichloropropan-2-ol Chemical compound CC(O)C(Cl)Cl ZOKHGHDRKCYWTH-UHFFFAOYSA-N 0.000 claims description 2
- 229940051269 1,3-dichloro-2-propanol Drugs 0.000 claims description 2
- DEWLEGDTCGBNGU-UHFFFAOYSA-N 1,3-dichloropropan-2-ol Chemical compound ClCC(O)CCl DEWLEGDTCGBNGU-UHFFFAOYSA-N 0.000 claims description 2
- YYTSGNJTASLUOY-UHFFFAOYSA-N 1-chloropropan-2-ol Chemical compound CC(O)CCl YYTSGNJTASLUOY-UHFFFAOYSA-N 0.000 claims description 2
- RHQDFWAXVIIEBN-UHFFFAOYSA-N Trifluoroethanol Chemical compound OCC(F)(F)F RHQDFWAXVIIEBN-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052753 mercury Inorganic materials 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 150000002902 organometallic compounds Chemical class 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 230000001737 promoting effect Effects 0.000 claims 2
- JNOZGFXJZQXOSU-UHFFFAOYSA-N 1-chloro-2-methylpropan-2-ol Chemical compound CC(C)(O)CCl JNOZGFXJZQXOSU-UHFFFAOYSA-N 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 229960004592 isopropanol Drugs 0.000 claims 1
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 22
- -1 epiooodhydrin Chemical compound 0.000 description 16
- 239000007795 chemical reaction product Substances 0.000 description 9
- VQPKAMAVKYTPLB-UHFFFAOYSA-N lead;octanoic acid Chemical compound [Pb].CCCCCCCC(O)=O VQPKAMAVKYTPLB-UHFFFAOYSA-N 0.000 description 9
- 239000004698 Polyethylene Substances 0.000 description 8
- 238000005266 casting Methods 0.000 description 8
- 235000011187 glycerol Nutrition 0.000 description 8
- 229920000573 polyethylene Polymers 0.000 description 8
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 7
- 239000004814 polyurethane Substances 0.000 description 7
- 229920002635 polyurethane Polymers 0.000 description 7
- 150000007824 aliphatic compounds Chemical class 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 125000005442 diisocyanate group Chemical group 0.000 description 4
- 230000001788 irregular Effects 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000003999 initiator Substances 0.000 description 3
- 229910052745 lead Inorganic materials 0.000 description 3
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 3
- FKTHNVSLHLHISI-UHFFFAOYSA-N 1,2-bis(isocyanatomethyl)benzene Chemical compound O=C=NCC1=CC=CC=C1CN=C=O FKTHNVSLHLHISI-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000012975 dibutyltin dilaurate Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 2
- 125000005628 tolylene group Chemical group 0.000 description 2
- UJPMYEOUBPIPHQ-UHFFFAOYSA-N 1,1,1-trifluoroethane Chemical compound CC(F)(F)F UJPMYEOUBPIPHQ-UHFFFAOYSA-N 0.000 description 1
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 1
- ZXHZWRZAWJVPIC-UHFFFAOYSA-N 1,2-diisocyanatonaphthalene Chemical compound C1=CC=CC2=C(N=C=O)C(N=C=O)=CC=C21 ZXHZWRZAWJVPIC-UHFFFAOYSA-N 0.000 description 1
- ALQLPWJFHRMHIU-UHFFFAOYSA-N 1,4-diisocyanatobenzene Chemical compound O=C=NC1=CC=C(N=C=O)C=C1 ALQLPWJFHRMHIU-UHFFFAOYSA-N 0.000 description 1
- JIABEENURMZTTI-UHFFFAOYSA-N 1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene Chemical class O=C=NC1=CC=CC=C1CC1=CC=CC=C1N=C=O JIABEENURMZTTI-UHFFFAOYSA-N 0.000 description 1
- IDJOCJAIQSKSOP-UHFFFAOYSA-N 2,2-dichloroethanol Chemical compound OCC(Cl)Cl IDJOCJAIQSKSOP-UHFFFAOYSA-N 0.000 description 1
- PQXKWPLDPFFDJP-UHFFFAOYSA-N 2,3-dimethyloxirane Chemical compound CC1OC1C PQXKWPLDPFFDJP-UHFFFAOYSA-N 0.000 description 1
- XYFMKXAUKVXBTM-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl.OCCCl XYFMKXAUKVXBTM-UHFFFAOYSA-N 0.000 description 1
- GGDYAKVUZMZKRV-UHFFFAOYSA-N 2-fluoroethanol Chemical compound OCCF GGDYAKVUZMZKRV-UHFFFAOYSA-N 0.000 description 1
- QZWKEPYTBWZJJA-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine-4,4'-diisocyanate Chemical compound C1=C(N=C=O)C(OC)=CC(C=2C=C(OC)C(N=C=O)=CC=2)=C1 QZWKEPYTBWZJJA-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- 229920000538 Poly[(phenyl isocyanate)-co-formaldehyde] Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- JQZRVMZHTADUSY-UHFFFAOYSA-L di(octanoyloxy)tin Chemical compound [Sn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O JQZRVMZHTADUSY-UHFFFAOYSA-L 0.000 description 1
- KIQKWYUGPPFMBV-UHFFFAOYSA-N diisocyanatomethane Chemical compound O=C=NCN=C=O KIQKWYUGPPFMBV-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- AQBLLJNPHDIAPN-LNTINUHCSA-K iron(3+);(z)-4-oxopent-2-en-2-olate Chemical compound [Fe+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O AQBLLJNPHDIAPN-LNTINUHCSA-K 0.000 description 1
- LIKBJVNGSGBSGK-UHFFFAOYSA-N iron(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Fe+3].[Fe+3] LIKBJVNGSGBSGK-UHFFFAOYSA-N 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000004005 microsphere Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- 125000005474 octanoate group Chemical group 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- OOCYPIXCHKROMD-UHFFFAOYSA-M phenyl(propanoyloxy)mercury Chemical compound CCC(=O)O[Hg]C1=CC=CC=C1 OOCYPIXCHKROMD-UHFFFAOYSA-M 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000007712 rapid solidification Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/2805—Compounds having only one group containing active hydrogen
- C08G18/288—Compounds containing at least one heteroatom other than oxygen or nitrogen
- C08G18/2885—Compounds containing at least one heteroatom other than oxygen or nitrogen containing halogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyurethanes Or Polyureas (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US19134371A | 1971-10-21 | 1971-10-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2251649A1 true DE2251649A1 (de) | 1973-04-26 |
Family
ID=22705098
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2251649A Pending DE2251649A1 (de) | 1971-10-21 | 1972-10-20 | Starrer polyurethanharz-gegenstand |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3746692A (OSRAM) |
| JP (1) | JPS4851097A (OSRAM) |
| AR (1) | AR192258A1 (OSRAM) |
| AU (1) | AU476194B2 (OSRAM) |
| BE (1) | BE790396A (OSRAM) |
| BR (1) | BR7207343D0 (OSRAM) |
| CA (1) | CA978297A (OSRAM) |
| DE (1) | DE2251649A1 (OSRAM) |
| ES (1) | ES407802A1 (OSRAM) |
| FR (1) | FR2156841B1 (OSRAM) |
| GB (1) | GB1408920A (OSRAM) |
| IT (1) | IT966400B (OSRAM) |
| NL (1) | NL7214237A (OSRAM) |
| ZA (1) | ZA727166B (OSRAM) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4154716A (en) * | 1972-04-24 | 1979-05-15 | The Dow Chemical Company | Fluid rapid-setting urethane compositions |
| US3890265A (en) * | 1972-09-07 | 1975-06-17 | Enamel Varnish & Chemical Comp | Method and compositions for protecting surfaces |
| US4001166A (en) * | 1973-01-29 | 1977-01-04 | The Dow Chemical Company | Solid, rapid-setting, rigid polyurethanes |
| US4000105A (en) * | 1973-01-29 | 1976-12-28 | The Dow Chemical Company | Solid, rapid-setting, rigid polyurethanes |
| US3883484A (en) * | 1973-05-07 | 1975-05-13 | Dow Chemical Co | Rapid setting polyurethanes from diols and polyisocyanates in the presence of a hydroxyl-containing halogenated aliphatic compound |
| US3883465A (en) * | 1973-05-07 | 1975-05-13 | Dow Chemical Co | Rapid setting polyurethanes from diols and polyfunctional polyisocyanates prepared in the presence of carboxylic acid esters |
| US3886102A (en) * | 1973-05-07 | 1975-05-27 | Dow Chemical Co | Rapid setting polyurethanes from diols and polyisocyanates prepared in the presence of a mixture of liquid modifiers |
| US3897410A (en) * | 1973-06-04 | 1975-07-29 | Dow Chemical Co | Rapid setting non-elastomeric polyurethane compositions prepared in the presence of a mixture of liquid modifiers |
| US3965073A (en) * | 1973-06-04 | 1976-06-22 | The Dow Chemical Company | Preparation of rapid setting non-elastomeric polyurethane compositions in the presence of ester-modified polyoxyalkylene compounds |
| US3914198A (en) * | 1973-08-29 | 1975-10-21 | Dow Chemical Co | Rapid-setting polyurethanes |
| US4038238A (en) * | 1973-08-29 | 1977-07-26 | The Dow Chemical Company | Low density rapid-setting polyurethanes |
| US3983068A (en) * | 1973-10-10 | 1976-09-28 | The Dow Chemical Company | Solid, rapid-setting, rigid polyurethanes |
| US3983069A (en) * | 1973-10-10 | 1976-09-28 | The Dow Chemical Company | Solid, rapid-setting, rigid polyurethanes |
| US3989663A (en) * | 1973-10-10 | 1976-11-02 | The Dow Chemical Company | Solid, rapid-setting rigid polyurethanes |
| US3983064A (en) * | 1973-10-10 | 1976-09-28 | The Dow Chemical Company | Solid, rapid-setting, rigid polyurethanes |
| US3983065A (en) * | 1973-10-10 | 1976-09-28 | The Dow Chemical Company | Solid, rapid-setting, rigid polyurethanes |
| US3983066A (en) * | 1973-10-10 | 1976-09-28 | The Dow Chemical Company | Solid, rapid setting, rigid polyurethanes |
| US4008185A (en) * | 1974-03-29 | 1977-02-15 | The Dow Chemical Company | Process for preparing rapid-setting polyurethanes |
| US4075151A (en) * | 1975-05-05 | 1978-02-21 | The Dow Chemical Company | Solid, rapid-setting, rigid polyurethanes |
| US4071482A (en) * | 1976-10-27 | 1978-01-31 | General Latex And Chemical Corporation | Reduced-friability, highly cross-linked, flame-resistant, polyurethane foams |
| US4165414A (en) * | 1978-01-23 | 1979-08-21 | Basf Wyandotte Corporation | Urethane-modified isocyanurate foams having improved insulating and flame retardant properties |
| US4263411A (en) * | 1978-10-30 | 1981-04-21 | Mooney Chemicals, Inc. | Polyurethane compositions and process for preparing polyurethane emitting reduced amounts of toxic fumes on burning using a cobalt, copper, nickel or manganese salt |
| US4273913A (en) * | 1979-03-26 | 1981-06-16 | W. R. Grace & Co. | Isocyanate capped urethane-containing prepolymer prepared from polyols obtained from epihalohydrin |
| US4242490A (en) * | 1979-07-20 | 1980-12-30 | The General Tire & Rubber Company | Thermoset polyurethane prepared from a polypropylene ether triol obtained using a double metal cyanide complex catalyst, ethylene glycol and tolylene diisocyanate |
| DE3070380D1 (en) * | 1979-09-21 | 1985-05-02 | Basf Wyandotte Corp | Rigid, non-cellular urethane polymer composition modified with reaction product of an isocyanate and an alcohol and a process for producing it |
| US4297482A (en) * | 1979-12-13 | 1981-10-27 | W. R. Grace & Co. | Chain-extended polyol compositions and method |
| US4548919A (en) * | 1982-12-17 | 1985-10-22 | American Cyanamid Company | Catalyst compositions for polyaliphatic isocyanate-based polyurethanes |
| GB2191208A (en) * | 1986-06-05 | 1987-12-09 | Basf Corp | High resiliency molded polyurethane foams |
| EP2816066A1 (de) * | 2013-06-19 | 2014-12-24 | Basf Se | Emissionsarmes, stabilisiertes Polyurethan |
| CN111518251A (zh) * | 2020-04-08 | 2020-08-11 | 上海抚佳精细化工有限公司 | 一种聚氨酯硬质泡沫及其制备方法 |
| CN113736246B (zh) * | 2021-09-09 | 2022-03-29 | 上海鹤城高分子科技有限公司 | 一种健身器材用浇注型聚氨酯及其制备方法 |
-
0
- BE BE790396D patent/BE790396A/xx unknown
-
1971
- 1971-10-21 US US00191343A patent/US3746692A/en not_active Expired - Lifetime
-
1972
- 1972-10-04 CA CA153,249A patent/CA978297A/en not_active Expired
- 1972-10-06 ZA ZA727166A patent/ZA727166B/xx unknown
- 1972-10-11 AU AU47623/72A patent/AU476194B2/en not_active Expired
- 1972-10-17 GB GB4784672A patent/GB1408920A/en not_active Expired
- 1972-10-17 AR AR244666A patent/AR192258A1/es active
- 1972-10-19 IT IT53465/72A patent/IT966400B/it active
- 1972-10-19 JP JP47104037A patent/JPS4851097A/ja active Pending
- 1972-10-19 FR FR7237130A patent/FR2156841B1/fr not_active Expired
- 1972-10-19 BR BR007343/72A patent/BR7207343D0/pt unknown
- 1972-10-20 DE DE2251649A patent/DE2251649A1/de active Pending
- 1972-10-20 NL NL7214237A patent/NL7214237A/xx not_active Application Discontinuation
- 1972-10-20 ES ES407802A patent/ES407802A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2156841B1 (OSRAM) | 1975-01-03 |
| BE790396A (fr) | 1973-04-20 |
| GB1408920A (en) | 1975-10-08 |
| FR2156841A1 (OSRAM) | 1973-06-01 |
| AR192258A1 (es) | 1973-02-08 |
| NL7214237A (OSRAM) | 1973-04-25 |
| ES407802A1 (es) | 1976-02-16 |
| AU476194B2 (en) | 1976-09-16 |
| IT966400B (it) | 1974-02-11 |
| BR7207343D0 (pt) | 1973-08-30 |
| JPS4851097A (OSRAM) | 1973-07-18 |
| CA978297A (en) | 1975-11-18 |
| ZA727166B (en) | 1973-07-25 |
| US3746692A (en) | 1973-07-17 |
| AU4762372A (en) | 1974-04-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2251649A1 (de) | Starrer polyurethanharz-gegenstand | |
| DE2253194C2 (OSRAM) | ||
| EP0897402B1 (de) | Verfahren zur herstellung von elastischen polyurethan-formkörpern mit kompakter oberfläche und zelligem kern | |
| EP0542806B1 (de) | Verfahren zur herstellung polyolhaltiger dispersionen und deren verwendung | |
| DE2238109A1 (de) | Verfahren zum aufbereiten von polyurethanschaumstoffabfaellen zu polyolen | |
| EP0038463A2 (de) | Verfahren zur Herstellung von Polyurethan-Formkörpern | |
| DE1420778C3 (de) | Verfahren zur Herstellung von Kautschukmassen | |
| DE19521798A1 (de) | Polyurethanelastomere aus aliphatischen Polyisocyanaten und Polyesteretherpolyolen | |
| DE4337569A1 (de) | Verfahren zur FCKW-freien Herstellung von zelligen Polyurethanformkörpern | |
| EP0705871A1 (de) | Verwendung von Polyolderivaten als innere Trennmittel bei der Herstellung von Polyurethan-Formteilen | |
| EP0347691A2 (de) | Mit einer konturierten, mehrschichtigen Folie versehene Polyurethan-Formkörper, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1720843A1 (de) | Fuer Spritzguss geeignete Polyurethane und Verfahren zu ihrer Herstellung | |
| EP0003569B1 (de) | Verfahren zur Herstellung von Formschaumstoffen auf Polyisocyanat-Basis | |
| DE3703739A1 (de) | Verfahren zur herstellung von formkoerpern, hierzu geeignete gemische von gegenueber isocyanatgruppen reaktionsfaehigen verbindungen und die nach dem verfahren erhaltenen formkoerper | |
| DE1271977B (de) | Verfahren zum Herstellen elastomerer Polyurethane | |
| DE2843739B2 (de) | Verfahren zur Herstellung von im wesentlichen homogenen Polyurethan-Elastomeren | |
| DE68922305T2 (de) | Modifizierte silicatzusammensetzung und verfahren zur herstellung einer sandgiessform daraus. | |
| DE102004011348A1 (de) | Katalysatorkombination zur Beschleunigung des Aushärtevorganges bei Polyurethangiessharzsystemen | |
| EP0009111A1 (de) | Transparente, elastische Polyurethan-Harnstoff-Elastomere, Verfahren zu deren Herstellung und deren Verwendung zur Herstellung von Schuhsohlen | |
| DE1034850B (de) | Beschleunigung der Umsetzung von Polyoxy-Verbindungen mit Polyisocyanaten | |
| DE1520570C3 (de) | Verfahren zur Herstellung von Polyurethanelastomeren mit verbesserter Kältebeständigkeit | |
| DE2900031C2 (OSRAM) | ||
| DE60106730T2 (de) | Aromatische aminhärter und ihre verwendung | |
| DE1014740B (de) | Verfahren zur Herstellung von hochmolekularen vernetzten Kunststoffen | |
| EP0688815B1 (de) | Verfahren zur Herstellung von Hydroxylgruppen aufweisenden Verbindungen aus (Polyurethan) Polyharnstoffabfällen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |