DE2235686A1 - Antriebsanordnung beim turbinenspinnen - Google Patents
Antriebsanordnung beim turbinenspinnenInfo
- Publication number
- DE2235686A1 DE2235686A1 DE19722235686 DE2235686A DE2235686A1 DE 2235686 A1 DE2235686 A1 DE 2235686A1 DE 19722235686 DE19722235686 DE 19722235686 DE 2235686 A DE2235686 A DE 2235686A DE 2235686 A1 DE2235686 A1 DE 2235686A1
- Authority
- DE
- Germany
- Prior art keywords
- spinning
- turbine
- individual
- drive arrangement
- drives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000009987 spinning Methods 0.000 title claims description 32
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
- 238000000605 extraction Methods 0.000 claims description 7
- 230000003068 static effect Effects 0.000 claims description 4
- 230000001105 regulatory effect Effects 0.000 claims 2
- 241000196324 Embryophyta Species 0.000 description 6
- 230000001360 synchronised effect Effects 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 244000025221 Humulus lupulus Species 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000007383 open-end spinning Methods 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01H—SPINNING OR TWISTING
- D01H4/00—Open-end spinning machines or arrangements for imparting twist to independently moving fibres separated from slivers; Piecing arrangements therefor; Covering endless core threads with fibres by open-end spinning techniques
- D01H4/42—Control of driving or stopping
- D01H4/44—Control of driving or stopping in rotor spinning
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Textile Engineering (AREA)
- Spinning Or Twisting Of Yarns (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722235686 DE2235686A1 (de) | 1972-07-20 | 1972-07-20 | Antriebsanordnung beim turbinenspinnen |
| CS508473A CS177136B2 (https=) | 1972-07-20 | 1973-07-16 | |
| IT2670673A IT992640B (it) | 1972-07-20 | 1973-07-18 | Disposizione dei motori per la filatura a turbina |
| CH1052973A CH559255A5 (https=) | 1972-07-20 | 1973-07-18 | |
| AT633273A AT332257B (de) | 1972-07-20 | 1973-07-18 | Antriebsanordnung beim turbinenspinnen |
| FR7326579A FR2193891B1 (https=) | 1972-07-20 | 1973-07-19 | |
| BE133646A BE802546A (fr) | 1972-07-20 | 1973-07-19 | Dispositif d'entrainement pour le filage centrifuge sur turbine |
| JP8258873A JPS4942933A (https=) | 1972-07-20 | 1973-07-19 | |
| GB3485473A GB1418155A (en) | 1972-07-20 | 1973-07-20 | Spinning machines |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722235686 DE2235686A1 (de) | 1972-07-20 | 1972-07-20 | Antriebsanordnung beim turbinenspinnen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2235686A1 true DE2235686A1 (de) | 1974-01-31 |
Family
ID=5851198
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722235686 Pending DE2235686A1 (de) | 1972-07-20 | 1972-07-20 | Antriebsanordnung beim turbinenspinnen |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS4942933A (https=) |
| AT (1) | AT332257B (https=) |
| BE (1) | BE802546A (https=) |
| CH (1) | CH559255A5 (https=) |
| CS (1) | CS177136B2 (https=) |
| DE (1) | DE2235686A1 (https=) |
| FR (1) | FR2193891B1 (https=) |
| GB (1) | GB1418155A (https=) |
| IT (1) | IT992640B (https=) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2911378A1 (de) * | 1979-03-23 | 1980-10-02 | Zinser Textilmaschinen Gmbh | Ringspinn- oder ringzwirnmaschine |
| DE3113909A1 (de) * | 1981-03-20 | 1982-09-30 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach | Textilmaschine |
| DE3309789A1 (de) * | 1983-03-18 | 1984-09-20 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach | Spinnereimaschine zum aufwinden von faeden |
| DE3619647A1 (de) * | 1986-06-11 | 1987-12-17 | Zinser Textilmaschinen Gmbh | Verfahren und vorrichtung zum einzelmotorischen antrieb einer spindel bei einer spinnmaschine |
| DE3822420A1 (de) * | 1988-07-02 | 1990-01-04 | Skf Textilmasch Komponenten | Ringspinn-/oder ringzwirnmaschine |
| DE3838418A1 (de) * | 1988-11-12 | 1990-05-17 | Zinser Textilmaschinen Gmbh | Spinnereimaschine, mit mehreren ueber die laenge der maschine verteilten elektromotoren |
| DE4411293A1 (de) * | 1994-03-31 | 1995-10-05 | Palitex Project Co Gmbh | Einzelmotorischer Antrieb für einen OE-Spinnrotor |
| DE10062096B4 (de) * | 1999-12-29 | 2012-06-14 | Rieter Ingolstadt Gmbh | Spinnmaschine mit mehrere Einzelantriebe aufweisenden Spinnstellen |
| EP1422323B1 (de) * | 2002-11-20 | 2017-04-12 | Maschinenfabrik Rieter Ag | Modulare Luftspinnmaschine |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5512866A (en) * | 1978-07-11 | 1980-01-29 | Towa Kogyo Kk | Method of driving pneumatic clearer in spinning machine |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3780513A (en) * | 1970-04-08 | 1973-12-25 | Toyoda Automatic Loom Works | Method and apparatus for driving open-end spinning frame |
| JPS5034649B1 (https=) * | 1970-04-18 | 1975-11-10 |
-
1972
- 1972-07-20 DE DE19722235686 patent/DE2235686A1/de active Pending
-
1973
- 1973-07-16 CS CS508473A patent/CS177136B2/cs unknown
- 1973-07-18 IT IT2670673A patent/IT992640B/it active
- 1973-07-18 CH CH1052973A patent/CH559255A5/xx not_active IP Right Cessation
- 1973-07-18 AT AT633273A patent/AT332257B/de not_active IP Right Cessation
- 1973-07-19 FR FR7326579A patent/FR2193891B1/fr not_active Expired
- 1973-07-19 BE BE133646A patent/BE802546A/xx unknown
- 1973-07-19 JP JP8258873A patent/JPS4942933A/ja active Pending
- 1973-07-20 GB GB3485473A patent/GB1418155A/en not_active Expired
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2911378A1 (de) * | 1979-03-23 | 1980-10-02 | Zinser Textilmaschinen Gmbh | Ringspinn- oder ringzwirnmaschine |
| DE3113909A1 (de) * | 1981-03-20 | 1982-09-30 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach | Textilmaschine |
| DE3309789A1 (de) * | 1983-03-18 | 1984-09-20 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach | Spinnereimaschine zum aufwinden von faeden |
| DE3619647A1 (de) * | 1986-06-11 | 1987-12-17 | Zinser Textilmaschinen Gmbh | Verfahren und vorrichtung zum einzelmotorischen antrieb einer spindel bei einer spinnmaschine |
| DE3822420A1 (de) * | 1988-07-02 | 1990-01-04 | Skf Textilmasch Komponenten | Ringspinn-/oder ringzwirnmaschine |
| US4947634A (en) * | 1988-07-02 | 1990-08-14 | Skf Textilmaschinen-Komponenten Gmbh | Ring spinning or ring twisting machine |
| DE3838418A1 (de) * | 1988-11-12 | 1990-05-17 | Zinser Textilmaschinen Gmbh | Spinnereimaschine, mit mehreren ueber die laenge der maschine verteilten elektromotoren |
| DE4411293A1 (de) * | 1994-03-31 | 1995-10-05 | Palitex Project Co Gmbh | Einzelmotorischer Antrieb für einen OE-Spinnrotor |
| DE10062096B4 (de) * | 1999-12-29 | 2012-06-14 | Rieter Ingolstadt Gmbh | Spinnmaschine mit mehrere Einzelantriebe aufweisenden Spinnstellen |
| EP1422323B1 (de) * | 2002-11-20 | 2017-04-12 | Maschinenfabrik Rieter Ag | Modulare Luftspinnmaschine |
Also Published As
| Publication number | Publication date |
|---|---|
| BE802546A (fr) | 1973-11-16 |
| AT332257B (de) | 1976-09-27 |
| IT992640B (it) | 1975-09-30 |
| GB1418155A (en) | 1975-12-17 |
| JPS4942933A (https=) | 1974-04-23 |
| FR2193891B1 (https=) | 1976-05-07 |
| FR2193891A1 (https=) | 1974-02-22 |
| CH559255A5 (https=) | 1975-02-28 |
| ATA633273A (de) | 1975-12-15 |
| CS177136B2 (https=) | 1977-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0654550B1 (de) | Streckwerk | |
| DE2116953B2 (de) | Antrieb einer offenendspinnmaschine | |
| DE2911379A1 (de) | Lange spinnmaschine | |
| DE2911378A1 (de) | Ringspinn- oder ringzwirnmaschine | |
| DE2753924C2 (de) | Antriebseinrichtung für Arbeitsorgane einer Spinnerei- oder Zwirnereimaschine | |
| DE2235686A1 (de) | Antriebsanordnung beim turbinenspinnen | |
| DE10062096B4 (de) | Spinnmaschine mit mehrere Einzelantriebe aufweisenden Spinnstellen | |
| CH678434A5 (https=) | ||
| EP0440025B1 (de) | Antriebseinrichtung einer OE-Spinnmaschine | |
| DE3641569C1 (en) | Circuit arrangement for spinning or twisting machines | |
| EP2140049B1 (de) | Antriebsvorrichtung für die spindeln einer ringspinnmaschine | |
| DE2165666C3 (de) | Schaltungsanordnung zur Sollwerteinste lung | |
| DE2325888C3 (de) | Spinn- oder Zwirnmaschine | |
| EP1521870A1 (de) | Vorrichtung zum f hren, behandeln oder f rdern von zumi ndest einem faden | |
| EP0202253B1 (de) | Tangentialriemenantrieb für eine spinn-oder zwirnmaschine | |
| EP0718422A1 (de) | Maschine zum Herstellen von Wattewickeln aus Faserbändern | |
| CH672326A5 (https=) | ||
| EP0411379B2 (de) | Streckwerk mit geregelten Antriebsgruppen | |
| EP1807560A1 (de) | Elektromotor und textilmaschine mit wenigstens einem elektromotor | |
| EP0671355B1 (de) | Bandablage | |
| DE1271815C2 (de) | Einrichtung zum Steuern und Speisen der Motoren einer Spinnmaschine zur Herstellung von synthetischen Fasern | |
| DE3436505C2 (https=) | ||
| DE1660331C3 (de) | Vorrichtung zum kontinuierlichen Verstrecken und/oder Schrumpfen von synthetischen Fäden | |
| DE2359330C3 (de) | Anordnung zur Spannungsversorgung der Drehfeldmotoren einer Produktionsmaschine in der Faserindustrie, insbesondere in der Chemiefaserindustrie | |
| DE2430178A1 (de) | Mehrmotorenantrieb |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |