DE2157607C3 - Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate - Google Patents
Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische PräparateInfo
- Publication number
- DE2157607C3 DE2157607C3 DE2157607A DE2157607A DE2157607C3 DE 2157607 C3 DE2157607 C3 DE 2157607C3 DE 2157607 A DE2157607 A DE 2157607A DE 2157607 A DE2157607 A DE 2157607A DE 2157607 C3 DE2157607 C3 DE 2157607C3
- Authority
- DE
- Germany
- Prior art keywords
- substituted
- urea
- ethyl
- methyl
- carbamic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000000825 pharmaceutical preparation Substances 0.000 title 1
- -1 cyclopentylethyl Chemical group 0.000 claims description 34
- 239000004202 carbamide Chemical class 0.000 claims description 20
- 229940100389 Sulfonylurea Drugs 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 14
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical class NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 9
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical compound OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 150000003672 ureas Chemical class 0.000 claims description 5
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical class NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 150000001447 alkali salts Chemical class 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- VNMLVHLVBFHHSN-UHFFFAOYSA-N thiophen-2-ylcarbamic acid Chemical class OC(=O)NC1=CC=CS1 VNMLVHLVBFHHSN-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 150000001714 carbamic acid halides Chemical class 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 229940124530 sulfonamide Drugs 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 claims description 2
- 230000010933 acylation Effects 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 150000001409 amidines Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 claims description 2
- 206010012601 diabetes mellitus Diseases 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 229960001330 hydroxycarbamide Drugs 0.000 claims description 2
- 239000012948 isocyanate Substances 0.000 claims description 2
- 150000002513 isocyanates Chemical class 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical class NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 claims description 2
- 150000007659 semicarbazones Chemical class 0.000 claims description 2
- 150000003454 sulfinic acid halides Chemical class 0.000 claims description 2
- 150000003455 sulfinic acids Chemical class 0.000 claims description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 2
- 150000003456 sulfonamides Chemical class 0.000 claims description 2
- 150000003461 sulfonyl halides Chemical class 0.000 claims description 2
- KWGFMMAPDMTJHX-UHFFFAOYSA-N sulfonylthiourea Chemical class SC(=N)N=S(=O)=O KWGFMMAPDMTJHX-UHFFFAOYSA-N 0.000 claims description 2
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical class O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 claims description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 2
- 210000002700 urine Anatomy 0.000 claims 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 69
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 235000013877 carbamide Nutrition 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- 239000008280 blood Substances 0.000 description 6
- 210000004369 blood Anatomy 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 3
- 241000283973 Oryctolagus cuniculus Species 0.000 description 3
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 3
- XGEGHDBEHXKFPX-NJFSPNSNSA-N methylurea Chemical compound [14CH3]NC(N)=O XGEGHDBEHXKFPX-NJFSPNSNSA-N 0.000 description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- VYDWIUVHDLOEIF-UHFFFAOYSA-N (2-ethylcyclopentyl)methylurea Chemical compound CCC1CCCC1CNC(N)=O VYDWIUVHDLOEIF-UHFFFAOYSA-N 0.000 description 2
- VFMPCBSRNCHHKO-UHFFFAOYSA-N 2-ethylcyclopentan-1-amine Chemical compound CCC1CCCC1N VFMPCBSRNCHHKO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- UBLYEVLMRSPMOG-UHFFFAOYSA-N cyclopentylmethanamine Chemical compound NCC1CCCC1 UBLYEVLMRSPMOG-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- KYMXBBBWJVWQSX-UHFFFAOYSA-N n,3-dimethylcyclopentan-1-amine Chemical compound CNC1CCC(C)C1 KYMXBBBWJVWQSX-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- UQHLFZVUHJUWGD-UHFFFAOYSA-N 1-cyclopentyl-3-methylurea Chemical compound CNC(=O)NC1CCCC1 UQHLFZVUHJUWGD-UHFFFAOYSA-N 0.000 description 1
- UKPLRVAKKXWITN-UHFFFAOYSA-N 2-cyclopentylethanamine Chemical compound NCCC1CCCC1 UKPLRVAKKXWITN-UHFFFAOYSA-N 0.000 description 1
- PXFQOVSAJSZQQY-UHFFFAOYSA-N 5-(cyclopentylmethyl)-1h-imidazole-2-carboxamide Chemical compound N1C(C(=O)N)=NC(CC2CCCC2)=C1 PXFQOVSAJSZQQY-UHFFFAOYSA-N 0.000 description 1
- JVLUMHRASWENRU-UHFFFAOYSA-N 5-chloro-2-methoxybenzoyl chloride Chemical compound COC1=CC=C(Cl)C=C1C(Cl)=O JVLUMHRASWENRU-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- HICCEVOALWQVIS-UHFFFAOYSA-N N-sulfonyl-1H-imidazole-2-carboxamide Chemical class S(=O)(=O)=NC(=O)C=1NC=CN=1 HICCEVOALWQVIS-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- CXILIZHOBKFGHS-UHFFFAOYSA-N cyclopentylmethylurea Chemical compound NC(=O)NCC1CCCC1 CXILIZHOBKFGHS-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229940127017 oral antidiabetic Drugs 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- WZHRJGWXUCLILI-UHFFFAOYSA-N sulfonylcarbamic acid Chemical class OC(=O)N=S(=O)=O WZHRJGWXUCLILI-UHFFFAOYSA-N 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Quinoline Compounds (AREA)
Priority Applications (22)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE791638D BE791638A (fr) | 1971-11-20 | Sulfonyl-urees, leur procede de preparation et leurs applications | |
| DE2157607A DE2157607C3 (de) | 1971-11-20 | 1971-11-20 | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate |
| NL7215460A NL7215460A (enExample) | 1971-11-20 | 1972-11-15 | |
| CH1667472A CH589616A5 (enExample) | 1971-11-20 | 1972-11-16 | |
| AU48931/72A AU444450B2 (en) | 1971-11-20 | 1972-11-16 | Sulfonylureas and process for preparing them |
| CA156,783A CA991188A (en) | 1971-11-20 | 1972-11-17 | Sulfonyl ureas and process for preparing them |
| SE7214966A SE400075B (sv) | 1971-11-20 | 1972-11-17 | Forfarande for framstellning av substituerade sulfonylkarbamider med blodsockersenkande egenskaper |
| ZA728159A ZA728159B (en) | 1971-11-20 | 1972-11-17 | Sulfonyl ureas and process for preparing them |
| AT981372A AT332880B (de) | 1971-11-20 | 1972-11-17 | Verfahren zur herstellung von neuen sulfonylharnstoffen und deren salzen |
| JP11650972A JPS5438093B2 (enExample) | 1971-11-20 | 1972-11-20 | |
| US308002A US3927088A (en) | 1971-11-20 | 1972-11-20 | Sulfonyl ureas and process for preparing them |
| GB5351272A GB1414514A (en) | 1971-11-20 | 1972-11-20 | Sulphonyl ureas and process for preparing them |
| FR7241131A FR2160669B1 (enExample) | 1971-11-20 | 1972-11-20 | |
| US05/581,764 US3984416A (en) | 1971-11-20 | 1975-05-29 | Substituted quinoline-8-carboxamido ethyl benzene-sulfonyl N-cyclopentylmethyl urea |
| AT436675A AT342070B (de) | 1971-11-20 | 1975-06-09 | Verfahren zur herstellung von neuen sulfonylharnstoffen |
| AT436575A AT336632B (de) | 1971-11-20 | 1975-06-09 | Verfahren zur herstellung von neuen acylaminoalkylbenzolsulfonylharnstoffen |
| CH352377A CH599932A5 (enExample) | 1971-11-20 | 1977-03-12 | |
| CH352177A CH599930A5 (enExample) | 1971-11-20 | 1977-03-12 | |
| CH352277A CH599931A5 (enExample) | 1971-11-20 | 1977-03-12 | |
| CH352577A CH599934A5 (enExample) | 1971-11-20 | 1977-03-12 | |
| CH352477A CH599933A5 (enExample) | 1971-11-20 | 1977-03-12 | |
| CH352077A CH601212A5 (enExample) | 1971-11-20 | 1977-03-12 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2157607A DE2157607C3 (de) | 1971-11-20 | 1971-11-20 | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2157607A1 DE2157607A1 (de) | 1973-05-24 |
| DE2157607B2 DE2157607B2 (de) | 1979-07-19 |
| DE2157607C3 true DE2157607C3 (de) | 1980-03-20 |
Family
ID=5825640
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2157607A Expired DE2157607C3 (de) | 1971-11-20 | 1971-11-20 | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3927088A (enExample) |
| JP (1) | JPS5438093B2 (enExample) |
| AT (1) | AT332880B (enExample) |
| BE (1) | BE791638A (enExample) |
| CA (1) | CA991188A (enExample) |
| CH (7) | CH589616A5 (enExample) |
| DE (1) | DE2157607C3 (enExample) |
| FR (1) | FR2160669B1 (enExample) |
| GB (1) | GB1414514A (enExample) |
| NL (1) | NL7215460A (enExample) |
| SE (1) | SE400075B (enExample) |
| ZA (1) | ZA728159B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4282239A (en) | 1978-06-27 | 1981-08-04 | Hoechst Aktiengesellschaft | Sulfonyl ureas and pharmaceutical preparations thereof |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU2001267878A1 (en) * | 2000-07-05 | 2002-01-14 | Ajinomoto Co. Inc. | Hypoglycemics |
| JP6762249B2 (ja) | 2017-03-15 | 2020-09-30 | 日本金銭機械株式会社 | 紙葉類処理装置 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1185180B (de) * | 1963-10-19 | 1965-01-14 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| US3454635A (en) * | 1965-07-27 | 1969-07-08 | Hoechst Ag | Benzenesulfonyl-ureas and process for their manufacture |
| DE1294957B (de) * | 1966-07-02 | 1969-05-14 | Boehringer & Soehne Gmbh | Verfahren zur Herstellung von Hydrindensulfonylharnstoffen und -sulfonylsemicarbaziden |
| US3631205A (en) * | 1966-12-15 | 1971-12-28 | Sandoz Ag | Sulfonyl urea derivatives |
| DE1568648C3 (de) * | 1966-12-19 | 1975-03-27 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate |
| LU56488A1 (enExample) * | 1967-08-10 | 1970-01-15 | ||
| BE754454A (fr) * | 1969-08-06 | 1971-02-05 | Bayer Ag | Nouveaux composes hypoglycemiques du type d'arylsulfonylurees et d'arylsulfonylsemicarbazides contenant des groupes carbonamide |
-
0
- BE BE791638D patent/BE791638A/xx unknown
-
1971
- 1971-11-20 DE DE2157607A patent/DE2157607C3/de not_active Expired
-
1972
- 1972-11-15 NL NL7215460A patent/NL7215460A/xx not_active Application Discontinuation
- 1972-11-16 CH CH1667472A patent/CH589616A5/xx not_active IP Right Cessation
- 1972-11-17 CA CA156,783A patent/CA991188A/en not_active Expired
- 1972-11-17 ZA ZA728159A patent/ZA728159B/xx unknown
- 1972-11-17 AT AT981372A patent/AT332880B/de active
- 1972-11-17 SE SE7214966A patent/SE400075B/xx unknown
- 1972-11-20 US US308002A patent/US3927088A/en not_active Expired - Lifetime
- 1972-11-20 FR FR7241131A patent/FR2160669B1/fr not_active Expired
- 1972-11-20 GB GB5351272A patent/GB1414514A/en not_active Expired
- 1972-11-20 JP JP11650972A patent/JPS5438093B2/ja not_active Expired
-
1977
- 1977-03-12 CH CH352477A patent/CH599933A5/xx not_active IP Right Cessation
- 1977-03-12 CH CH352177A patent/CH599930A5/xx not_active IP Right Cessation
- 1977-03-12 CH CH352577A patent/CH599934A5/xx not_active IP Right Cessation
- 1977-03-12 CH CH352077A patent/CH601212A5/xx not_active IP Right Cessation
- 1977-03-12 CH CH352277A patent/CH599931A5/xx not_active IP Right Cessation
- 1977-03-12 CH CH352377A patent/CH599932A5/xx not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4282239A (en) | 1978-06-27 | 1981-08-04 | Hoechst Aktiengesellschaft | Sulfonyl ureas and pharmaceutical preparations thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| CA991188A (en) | 1976-06-15 |
| DE2157607A1 (de) | 1973-05-24 |
| CH589616A5 (enExample) | 1977-07-15 |
| NL7215460A (enExample) | 1973-05-22 |
| CH601212A5 (enExample) | 1978-06-30 |
| CH599931A5 (enExample) | 1978-06-15 |
| US3927088A (en) | 1975-12-16 |
| CH599933A5 (enExample) | 1978-06-15 |
| ATA981372A (de) | 1976-02-15 |
| AU4893172A (en) | 1974-01-24 |
| CH599934A5 (enExample) | 1978-06-15 |
| FR2160669B1 (enExample) | 1976-12-03 |
| BE791638A (fr) | 1973-05-21 |
| DE2157607B2 (de) | 1979-07-19 |
| AT332880B (de) | 1976-10-25 |
| ZA728159B (en) | 1973-07-25 |
| CH599930A5 (enExample) | 1978-06-15 |
| CH599932A5 (enExample) | 1978-06-15 |
| GB1414514A (en) | 1975-11-19 |
| SE400075B (sv) | 1978-03-13 |
| FR2160669A1 (enExample) | 1973-06-29 |
| JPS5438093B2 (enExample) | 1979-11-19 |
| JPS4861455A (enExample) | 1973-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0031058B1 (de) | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und pharmazeutische Präparate enthaltend diese Verbindungen | |
| DE1543564C3 (de) | Benzolsulfonylharnstoffe, Verfahren zur ihrer Herstellung und diese enthaltende phyrmazeutische Präparate | |
| CH628887A5 (de) | Verfahren zur herstellung von benzolsulfonylharnstoffen. | |
| DE2238870C3 (de) | Benzolsulfonylharnstoffe | |
| DE2157607C3 (de) | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| EP0073507B1 (de) | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen und ihre Verwendung | |
| DE2413514C3 (de) | N-Acylaminoathylbenzolsulfonyl-N'-methylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE1443905C3 (de) | benzolsulfonyl] -N'-cyclohexylharnstoff, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE1568648C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| EP0089597A2 (de) | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen und ihre Verwendung | |
| DE2720926A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| DE1909272A1 (de) | N-[4-(ss<2-Methoxy-5-chlor-benzamido>-aethyl)-benzolsulfonyl]-N'-cyclopentylharnstoff und Verfahren zu seiner Herstellung | |
| DE2230543A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| EP0031088A1 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen sowie ihre Verwendung | |
| DE1568626B2 (de) | BenzolsuHonyl-harnstoffe, ihre Salze, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| EP0006587B1 (de) | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung sowie pharmazeutische Präparate auf Basis dieser Verbindungen | |
| DE1518895C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung | |
| EP0047496A1 (de) | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen und ihre Verwendung | |
| DE2027950A1 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE2948522A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| DE2948472A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| AT366670B (de) | Verfahren zur herstellung von neuen acylaminoalkylbenzolsulfonylharnstoffen und von deren salzen | |
| DE1793111C3 (de) | Acylaminoäthylbenzolsulfonyl-delta hoch 2-cyclohexenyl-harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1443890C (de) | Benzolsulfonyl Harnstoffe und Verfahren zu ihrer Herstellung | |
| DE2846330A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |