DE2102112C3 - Hochdruck-Entladungslampe - Google Patents
Hochdruck-EntladungslampeInfo
- Publication number
- DE2102112C3 DE2102112C3 DE19712102112 DE2102112A DE2102112C3 DE 2102112 C3 DE2102112 C3 DE 2102112C3 DE 19712102112 DE19712102112 DE 19712102112 DE 2102112 A DE2102112 A DE 2102112A DE 2102112 C3 DE2102112 C3 DE 2102112C3
- Authority
- DE
- Germany
- Prior art keywords
- discharge tube
- electrode
- temperature
- lamp
- discharge lamp
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000576 coating method Methods 0.000 claims description 15
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 15
- 229910001507 metal halide Inorganic materials 0.000 claims description 14
- 150000005309 metal halides Chemical class 0.000 claims description 14
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 10
- 229910052753 mercury Inorganic materials 0.000 claims description 10
- 239000011248 coating agent Substances 0.000 claims description 9
- 238000010276 construction Methods 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 235000009518 sodium iodide Nutrition 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 4
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- RMUKCGUDVKEQPL-UHFFFAOYSA-K triiodoindigane Chemical compound I[In](I)I RMUKCGUDVKEQPL-UHFFFAOYSA-K 0.000 claims description 2
- 238000009826 distribution Methods 0.000 description 11
- 238000005204 segregation Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 4
- 239000010453 quartz Substances 0.000 description 4
- 238000009877 rendering Methods 0.000 description 4
- 239000002585 base Substances 0.000 description 3
- 235000013601 eggs Nutrition 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 3
- 229910001928 zirconium oxide Inorganic materials 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 238000010891 electric arc Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- PCLIRWBVOVZTOK-UHFFFAOYSA-M 2-(1-methylpyrrolidin-1-ium-1-yl)ethyl 2-hydroxy-2,2-diphenylacetate;iodide Chemical compound [I-].C=1C=CC=CC=1C(O)(C=1C=CC=CC=1)C(=O)OCC[N+]1(C)CCCC1 PCLIRWBVOVZTOK-UHFFFAOYSA-M 0.000 description 1
- 235000000434 Melocanna baccifera Nutrition 0.000 description 1
- 241001497770 Melocanna baccifera Species 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 1
- 229910001338 liquidmetal Inorganic materials 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- ZQESQBVNDBLWAM-WMZHIEFXSA-N n-[(3s,4r)-1-[2-(4-isothiocyanatophenyl)ethyl]-3-methylpiperidin-4-yl]-n-phenylpropanamide Chemical compound C([C@H]([C@H](C1)C)N(C(=O)CC)C=2C=CC=CC=2)CN1CCC1=CC=C(N=C=S)C=C1 ZQESQBVNDBLWAM-WMZHIEFXSA-N 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/125—Selection of substances for gas fillings; Specified operating pressure or temperature having an halogenide as principal component
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/82—Lamps with high-pressure unconstricted discharge having a cold pressure > 400 Torr
- H01J61/827—Metal halide arc lamps
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US575970A | 1970-01-26 | 1970-01-26 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2102112A1 DE2102112A1 (de) | 1971-09-16 |
| DE2102112B2 DE2102112B2 (de) | 1974-08-15 |
| DE2102112C3 true DE2102112C3 (de) | 1975-05-15 |
Family
ID=21717596
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712102112 Expired DE2102112C3 (de) | 1970-01-26 | 1971-01-18 | Hochdruck-Entladungslampe |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE761971A (https=) |
| DE (1) | DE2102112C3 (https=) |
| FR (1) | FR2077012A5 (https=) |
| GB (1) | GB1337134A (https=) |
| NL (1) | NL165000C (https=) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19714009A1 (de) * | 1997-04-04 | 1998-10-08 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Gleichstrombogenlampe |
| DE19714008A1 (de) * | 1997-04-04 | 1998-10-08 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Gleichstrombogenlampe |
| DE10101508A1 (de) * | 2001-01-12 | 2002-08-01 | Philips Corp Intellectual Pty | Hochdruckentladungslampe |
| AU2002356378A1 (en) * | 2002-01-16 | 2003-07-30 | Koninklijke Philips Electronics N.V. | Gas discharge lamp |
| JP4553736B2 (ja) * | 2002-12-20 | 2010-09-29 | コーニンクレッカ フィリップス エレクトロニクス エヌ ヴィ | 高圧ガス放電ランプ及び高圧ガス放電ランプを備えた照明ユニット |
| WO2005038858A2 (en) * | 2003-10-17 | 2005-04-28 | Philips Intellectual Property & Standards Gmbh | Crevice-minimized metal halide burner with ceramic discharge vessel |
| US20050179388A1 (en) * | 2004-02-17 | 2005-08-18 | Strok Jack M. | Discharge lamp and method of forming same |
| WO2006043191A1 (en) * | 2004-10-20 | 2006-04-27 | Philips Intellectual Property & Standards Gmbh | High intensity discharge lamp |
-
1971
- 1971-01-01 GB GB17971A patent/GB1337134A/en not_active Expired
- 1971-01-11 NL NL7100341A patent/NL165000C/xx active
- 1971-01-18 DE DE19712102112 patent/DE2102112C3/de not_active Expired
- 1971-01-25 BE BE761971A patent/BE761971A/xx not_active IP Right Cessation
- 1971-01-26 FR FR7102557A patent/FR2077012A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL165000B (nl) | 1980-09-15 |
| DE2102112A1 (de) | 1971-09-16 |
| BE761971A (fr) | 1971-07-26 |
| NL165000C (nl) | 1981-02-16 |
| NL7100341A (https=) | 1971-07-28 |
| DE2102112B2 (de) | 1974-08-15 |
| GB1337134A (en) | 1973-11-14 |
| FR2077012A5 (https=) | 1971-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69805390T2 (de) | Metalldampfentladungslampe | |
| DE7011414U (de) | Bogenentladungslampe. | |
| DE2951966A1 (de) | Eektrode mit ueberwicklung fuer miniatur-dampflampe | |
| DE3038993C2 (de) | Metalldampfentladungslampe | |
| DE2102112C3 (de) | Hochdruck-Entladungslampe | |
| DE2935981A1 (de) | Miniatur-hochdruck-metallhalogenidlampe | |
| DE3135874A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE2840771C2 (https=) | ||
| DE2726946A1 (de) | Elektrische gluehlampe | |
| DE2513616A1 (de) | Hochdruck-natriumdampflampen mit niedriger leistung | |
| DE4008367A1 (de) | Einseitig gequetschte halogengluehlampe | |
| DE69109101T2 (de) | Metallhalogenidentladungslampe mit bestimmtem schaftlastfaktor. | |
| DE3327940A1 (de) | Hochleistungs-caesiumlampensystem fuer das laserpumpen | |
| DE1489445B1 (de) | Elektrode fuer eine Quecksilberdampfhochdrucklampe mit Halogenidfuellung | |
| DE3510156A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE1949946C3 (de) | Hohlraumelektrode für eine Hochdruck-Metalldampflampe | |
| DE2660352C2 (de) | Hochdruck-Entladungslampe | |
| DE69020465T3 (de) | Einseitig gequetschte elektrische Metalldampfentladungslampe. | |
| DE3346130A1 (de) | Entladungslampe hoher intensitaet mit gesteuerter radialer verteilung | |
| DE2513332A1 (de) | Leuchtstoffroehre mit amalgam bildendem material | |
| DE3733217A1 (de) | Metallhalogenid-lampe mit einer halogenidzusammensetzung zur steuerung der leistungsfaehigkeit | |
| DE1047313B (de) | Elektrode fuer Gasentladungslampen | |
| DE3327302A1 (de) | Niederdruck-quecksilberdampf-entladungslampe | |
| DE3044121A1 (de) | Natriumhochdrucklampe | |
| DE2943813A1 (de) | Bogenentladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |