DE1951061C - - Google Patents
Info
- Publication number
- DE1951061C DE1951061C DE19691951061 DE1951061A DE1951061C DE 1951061 C DE1951061 C DE 1951061C DE 19691951061 DE19691951061 DE 19691951061 DE 1951061 A DE1951061 A DE 1951061A DE 1951061 C DE1951061 C DE 1951061C
- Authority
- DE
- Germany
- Prior art keywords
- trans
- carboxylic acid
- aminomethylcyclohexane
- pharmacologically acceptable
- acceptable salts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 amino, nitro, sulfamoyl Chemical group 0.000 claims description 58
- GYDJEQRTZSCIOI-UHFFFAOYSA-N AMCHA Chemical compound NCC1CCC(C(O)=O)CC1 GYDJEQRTZSCIOI-UHFFFAOYSA-N 0.000 claims description 50
- 239000011780 sodium chloride Substances 0.000 claims description 29
- 150000002148 esters Chemical class 0.000 claims description 26
- 150000003839 salts Chemical class 0.000 claims description 22
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N Cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 57
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 38
- 239000000203 mixture Substances 0.000 description 29
- 238000002844 melting Methods 0.000 description 27
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 26
- 238000000921 elemental analysis Methods 0.000 description 23
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 23
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 23
- 230000000694 effects Effects 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 19
- 150000007860 aryl ester derivatives Chemical class 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- CPELXLSAUQHCOX-UHFFFAOYSA-N hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 13
- 239000002253 acid Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 230000002401 inhibitory effect Effects 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- 239000003208 petroleum Substances 0.000 description 11
- 238000001816 cooling Methods 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 238000000354 decomposition reaction Methods 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- FYSNRJHAOHDILO-UHFFFAOYSA-N Thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 150000004820 halides Chemical class 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- 239000006188 syrup Substances 0.000 description 8
- 235000020357 syrup Nutrition 0.000 description 8
- 229960000583 Acetic Acid Drugs 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 238000007792 addition Methods 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 6
- 230000001681 protective Effects 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- SESFRYSPDFLNCH-UHFFFAOYSA-N Benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 5
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 229950003499 FIBRIN Drugs 0.000 description 4
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 4
- 102000009123 Fibrin Human genes 0.000 description 4
- 108010073385 Fibrin Proteins 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N Perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 4
- 239000004019 antithrombin Substances 0.000 description 4
- 230000000963 caseinolytic Effects 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 239000008363 phosphate buffer Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- NKCXQMYPWXSLIZ-PSRDDEIFSA-N (2S)-2-[[(2S)-1-[(2S)-5-amino-2-[[2-[[(2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]propanoyl]amino]-4-oxobutanoyl]amino]-3-m Chemical compound O=C([C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](N)[C@@H](C)O)[C@@H](C)O)C(C)C)N1CCC[C@H]1C(=O)N[C@@H](CO)C(O)=O NKCXQMYPWXSLIZ-PSRDDEIFSA-N 0.000 description 3
- XRZWVSXEDRYQGC-UHFFFAOYSA-N 4-cyclohexylpyrrolidin-1-ium-2-carboxylate Chemical compound C1NC(C(=O)O)CC1C1CCCCC1 XRZWVSXEDRYQGC-UHFFFAOYSA-N 0.000 description 3
- QCTBMLYLENLHLA-UHFFFAOYSA-N Aminomethylbenzoic acid Chemical compound NCC1=CC=C(C(O)=O)C=C1 QCTBMLYLENLHLA-UHFFFAOYSA-N 0.000 description 3
- 229940012957 Plasmin Drugs 0.000 description 3
- 229960005202 Streptokinase Drugs 0.000 description 3
- 108010023197 Streptokinase Proteins 0.000 description 3
- 108090000190 Thrombin Proteins 0.000 description 3
- MNZMECMQTYGSOI-UHFFFAOYSA-N acetic acid;hydron;bromide Chemical compound Br.CC(O)=O MNZMECMQTYGSOI-UHFFFAOYSA-N 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000001567 anti-fibrinolytic Effects 0.000 description 3
- 239000005018 casein Substances 0.000 description 3
- 235000021240 caseins Nutrition 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000003480 fibrinolytic Effects 0.000 description 3
- 239000003527 fibrinolytic agent Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000000896 plasminic Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229960004072 thrombin Drugs 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-Hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- 108060001001 BRK1 Proteins 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N Benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- 210000004369 Blood Anatomy 0.000 description 2
- QXZGBUJJYSLZLT-FDISYFBBSA-N Bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N Carbon tetrachloride Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 108010049003 Fibrinogen Proteins 0.000 description 2
- 229940012952 Fibrinogen Drugs 0.000 description 2
- 102000008946 Fibrinogen Human genes 0.000 description 2
- 229940019698 Fibrinogen containing hemostatics Drugs 0.000 description 2
- 102100011311 KNG1 Human genes 0.000 description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 2
- SZTXWQMDCVOAKJ-LJGSYFOKSA-N NC[C@H]1CC[C@H](C(Cl)=O)CC1 Chemical compound NC[C@H]1CC[C@H](C(Cl)=O)CC1 SZTXWQMDCVOAKJ-LJGSYFOKSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N P-Toluenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 241000030360 Peromyscus truei Species 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N Phosphoryl chloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 102000003827 Plasma kallikrein Human genes 0.000 description 2
- 108090000113 Plasma kallikrein Proteins 0.000 description 2
- 102000013566 Plasminogen Human genes 0.000 description 2
- 108010051456 Plasminogen Proteins 0.000 description 2
- 101710009148 SERPINA1 Proteins 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 108090000631 Trypsin Proteins 0.000 description 2
- 102000004142 Trypsin Human genes 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 230000001475 anti-trypsic Effects 0.000 description 2
- RGZZCZQQPNJCPO-UHFFFAOYSA-N benzyl 3-(4-hydroxyphenyl)prop-2-enoate Chemical compound C1=CC(O)=CC=C1C=CC(=O)OCC1=CC=CC=C1 RGZZCZQQPNJCPO-UHFFFAOYSA-N 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 230000000875 corresponding Effects 0.000 description 2
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- YOQDYZUWIQVZSF-UHFFFAOYSA-N sodium borohydride Substances [BH4-].[Na+] YOQDYZUWIQVZSF-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- ODGROJYWQXFQOZ-UHFFFAOYSA-N sodium;boron(1-) Chemical compound [B-].[Na+] ODGROJYWQXFQOZ-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229960001322 trypsin Drugs 0.000 description 2
- 239000012588 trypsin Substances 0.000 description 2
- 239000002753 trypsin inhibitor Substances 0.000 description 2
- GYDJEQRTZSCIOI-LJGSYFOKSA-N (1r,4r)-4-(aminomethyl)cyclohexane-1-carboxylic acid Chemical compound NC[C@H]1CC[C@H](C(O)=O)CC1 GYDJEQRTZSCIOI-LJGSYFOKSA-N 0.000 description 1
- WORJRXHJTUTINR-UHFFFAOYSA-M 1,4-dioxane;chloride Chemical compound [Cl-].C1COCCO1 WORJRXHJTUTINR-UHFFFAOYSA-M 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- XQXPVVBIMDBYFF-UHFFFAOYSA-N 4-Hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=C(O)C=C1 XQXPVVBIMDBYFF-UHFFFAOYSA-N 0.000 description 1
- 229940090052 4-aminomethylbenzoic acid Drugs 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N Benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- MOZDKDIOPSPTBH-UHFFFAOYSA-N Benzyl parahydroxybenzoate Chemical compound C1=CC(O)=CC=C1C(=O)OCC1=CC=CC=C1 MOZDKDIOPSPTBH-UHFFFAOYSA-N 0.000 description 1
- 241000219430 Betula pendula Species 0.000 description 1
- 210000001772 Blood Platelets Anatomy 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- HFFLGKNGCAIQMO-UHFFFAOYSA-N Chloral Chemical group ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 1
- IQBVTUVKXKPUSX-GJTSMBTKSA-N Cl.NC[C@@H]1CC[C@H](CC1)C(=O)OC1=CC=CC=C1 Chemical compound Cl.NC[C@@H]1CC[C@H](CC1)C(=O)OC1=CC=CC=C1 IQBVTUVKXKPUSX-GJTSMBTKSA-N 0.000 description 1
- 229940088598 Enzyme Drugs 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 206010018987 Haemorrhage Diseases 0.000 description 1
- 108060005987 Kallikreins Proteins 0.000 description 1
- 102000001399 Kallikreins Human genes 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N Phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N Phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N Phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 241001481796 Rattus exulans Species 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 210000004291 Uterus Anatomy 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K [O-]P([O-])([O-])=O Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- WJGAPUXHSQQWQF-UHFFFAOYSA-N acetic acid;hydrochloride Chemical compound Cl.CC(O)=O WJGAPUXHSQQWQF-UHFFFAOYSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000001154 acute Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229960003375 aminomethylbenzoic acid Drugs 0.000 description 1
- 230000000288 anti-kallikrein Effects 0.000 description 1
- IUGQFMIATSVYLK-UHFFFAOYSA-N benzyl 2-(4-hydroxyphenyl)acetate Chemical compound C1=CC(O)=CC=C1CC(=O)OCC1=CC=CC=C1 IUGQFMIATSVYLK-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000740 bleeding Effects 0.000 description 1
- 231100000319 bleeding Toxicity 0.000 description 1
- 230000023555 blood coagulation Effects 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-M chloride;hydrochloride Chemical compound Cl.[Cl-] IXCSERBJSXMMFS-UHFFFAOYSA-M 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 125000000853 cresyl group Chemical class C1(=CC=C(C=C1)C)* 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- KPBIBQOKODBTMS-UHFFFAOYSA-N dibenzyl 4-hydroxybenzene-1,3-dicarboxylate Chemical compound OC1=CC=C(C(=O)OCC=2C=CC=CC=2)C=C1C(=O)OCC1=CC=CC=C1 KPBIBQOKODBTMS-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 230000000058 esterolytic Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- UCVODTZQZHMTPN-UHFFFAOYSA-N heptanoyl chloride Chemical compound CCCCCCC(Cl)=O UCVODTZQZHMTPN-UHFFFAOYSA-N 0.000 description 1
- 230000003284 homeostatic Effects 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 125000004401 m-toluyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C(*)=O 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 1
- GNCWCTBHZCBXGL-UHFFFAOYSA-N methyl 4-hydroxy-3-nitrobenzoate Chemical compound COC(=O)C1=CC=C(O)C([N+]([O-])=O)=C1 GNCWCTBHZCBXGL-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000005441 o-toluyl group Chemical group [H]C1=C([H])C(C(*)=O)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000003056 p-(2-carboxyethyl)phenyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 230000003389 potentiating Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 231100000486 side effect Toxicity 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001187 sodium carbonate Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing Effects 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-L tyrosinate(2-) Chemical compound [O-]C(=O)C(N)CC1=CC=C([O-])C=C1 OUYCCCASQSFEME-UHFFFAOYSA-L 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7422068 | 1968-10-14 | ||
| JP7422068 | 1968-10-14 | ||
| JP9056468 | 1968-12-12 | ||
| JP9056468 | 1968-12-12 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1951061A1 DE1951061A1 (de) | 1970-06-25 |
| DE1951061C true DE1951061C (ja) | 1973-02-08 |
Family
ID=26415343
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691951061 Granted DE1951061A1 (de) | 1968-10-14 | 1969-10-10 | Neue Ester |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3699149A (ja) |
| AT (1) | AT291976B (ja) |
| BE (1) | BE740202A (ja) |
| CA (1) | CA929942A (ja) |
| CH (1) | CH523222A (ja) |
| DE (1) | DE1951061A1 (ja) |
| DK (1) | DK122954B (ja) |
| ES (1) | ES372360A1 (ja) |
| FI (1) | FI52076C (ja) |
| FR (1) | FR2020646B1 (ja) |
| GB (1) | GB1277227A (ja) |
| IE (1) | IE33596B1 (ja) |
| IL (1) | IL33104A (ja) |
| NL (1) | NL146790B (ja) |
| NO (1) | NO130583C (ja) |
| PH (1) | PH9762A (ja) |
| PL (1) | PL80293B1 (ja) |
| RO (1) | RO57232A (ja) |
| SE (1) | SE365506B (ja) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4069240A (en) * | 1975-09-04 | 1978-01-17 | Uniroyal, Inc. | Nuclear hydrogenation of n-aryl carbamates |
| US4147876A (en) * | 1978-05-01 | 1979-04-03 | Daiichi Seiyaku Co., Ltd. | Easily hydrolyzable esters of 4-(2-carboxyethyl)phenyl trans-4-aminomethylcyclohexanecarboxylate and process of use |
| FR2424902A1 (fr) * | 1978-05-03 | 1979-11-30 | Daiichi Seiyaku Co | Procede pour la preparation de trans-4-aminomethylcyclohexanecarboxylate de 4'-(2-carboxyethyl)phenyle ou de ses sels d'addition d'acides et intermediaires utiles dans cette preparation |
| DE2819462A1 (de) * | 1978-05-03 | 1979-11-08 | Daiichi Seiyaku Co | Verfahren zur herstellung von 4'-(2-carboxyaethyl)phenyl-trans-4-aminomethylcyclohexan-carboxylat oder seiner saeureadditionssalze und neue zwischenprodukte zur herstellung dieser verbindung |
| US4313435A (en) | 1980-04-18 | 1982-02-02 | Gulf & Western Corporation | Apparatus and method of producing a succession of die cut tobacco blanks |
| US4465851A (en) * | 1981-01-22 | 1984-08-14 | Nippon Chemiphar Co., Ltd. | Guanidinocyclohexanecarboxylic acid derivatives |
| ATE12224T1 (de) * | 1981-11-17 | 1985-04-15 | Kabivitrum Ab | Verbindungen mit antifibrinolytischer wirksamkeit. |
| AU3620099A (en) * | 1998-04-24 | 1999-11-16 | Proteus Molecular Design Limited | Aminomethyl-benzoic ester derivatives as tryptase inhibitors |
| US7226951B2 (en) * | 2003-12-17 | 2007-06-05 | Allergan, Inc. | Compounds having selective cytochrome P450RAI-1 or selective cytochrome P450RAI-2 inhibitory activity and methods of obtaining the same |
| CA2613875C (en) * | 2005-07-04 | 2018-09-25 | Ramu Krishnan | Improved drug or pharmaceutical compounds and a preparation thereof |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD48209A (ja) * |
-
1969
- 1969-09-30 US US862512A patent/US3699149A/en not_active Expired - Lifetime
- 1969-09-30 CA CA063735A patent/CA929942A/en not_active Expired
- 1969-10-01 IL IL33104A patent/IL33104A/en unknown
- 1969-10-03 GB GB48814/69A patent/GB1277227A/en not_active Expired
- 1969-10-08 IE IE1393/69A patent/IE33596B1/xx unknown
- 1969-10-08 SE SE13844/69A patent/SE365506B/xx unknown
- 1969-10-09 ES ES372360A patent/ES372360A1/es not_active Expired
- 1969-10-10 DE DE19691951061 patent/DE1951061A1/de active Granted
- 1969-10-10 CH CH1525769A patent/CH523222A/de not_active IP Right Cessation
- 1969-10-10 PL PL1969136290A patent/PL80293B1/pl unknown
- 1969-10-10 PH PH10787A patent/PH9762A/en unknown
- 1969-10-13 FR FR6935019A patent/FR2020646B1/fr not_active Expired
- 1969-10-13 BE BE740202D patent/BE740202A/xx not_active IP Right Cessation
- 1969-10-13 DK DK542769AA patent/DK122954B/da not_active IP Right Cessation
- 1969-10-14 RO RO61267A patent/RO57232A/ro unknown
- 1969-10-14 NL NL696915495A patent/NL146790B/xx not_active IP Right Cessation
- 1969-10-14 AT AT09657/69A patent/AT291976B/de active
- 1969-10-14 NO NO4087/69A patent/NO130583C/no unknown
- 1969-10-14 FI FI692959A patent/FI52076C/fi active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2054380B1 (de) | Trypsinartige serinprotease-hemmstoffe, ihre herstellung und verwendung | |
| DE69316370T2 (de) | Pharmazeutisch wiksame diketopiperazinen | |
| US4634783A (en) | Novel amidine compound | |
| DE69620161T2 (de) | Thrombininhibitoren | |
| DE69920888T2 (de) | Disubstituierte pyrazoline und triazoline als faktor xa inhibitoren | |
| DE69919397T2 (de) | Thrombin-inhibitoren | |
| DE3207033C2 (de) | Amidinverbindungen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Mittel | |
| DE2548886C2 (de) | p-(p'-Guanidinobenzoyloxy)-phenylcarbonsäureester, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE1951061C (ja) | ||
| EP1114024B1 (de) | Urokinase-inhibitoren | |
| DE3005580C2 (ja) | ||
| DE69818510T2 (de) | Neue verbindungen | |
| EP1311473A2 (de) | NEUE VERBINDUNGEN, DIE FAKTOR Xa-AKTIVITÄT INHIBIEREN | |
| DE2846251C2 (ja) | ||
| DE3031791C2 (ja) | ||
| DE2840636C2 (ja) | ||
| DE1951061A1 (de) | Neue Ester | |
| EP1664089B1 (de) | Basisch-substituierte benzylaminanaloga als inhibitoren des gerinnungsfaktors xa, ihre herstellung und verwendung | |
| DE10210590A1 (de) | Hemmstoffe des Gerinnungsfaktors Xa, ihre Herstellung und Verwendung | |
| DE2801478C2 (ja) | ||
| CH689611A5 (de) | Urokinase-Inhibitoren. | |
| DE2550088A1 (de) | N hoch 2 -naphtalinsulfonyl-l-argininester und -amide | |
| DE3207023C2 (de) | Amidinverbindungen, Verfahren zu ihrer Herstellung und pharmazeutische Mittel, die diese Verbindungen enthalten | |
| DE1966174C3 (de) | Arylester der 4-Aminomethyl-benzoesäure, deren pharmazeutisch anwendbare Salze, Verfahren zur herstellung dieser Verbindungen und diese Verbindungen enthaltende pharmazeutische Präparate | |
| DE1951061B (de) | Neue Ester der trans 4 Aminomethyl cyclohexan 1 carbonsaure und deren phar makologisch vertragliche Salze |