DE1945642A1 - Verfahren zur Herstellung supraleitender Draehte - Google Patents
Verfahren zur Herstellung supraleitender DraehteInfo
- Publication number
- DE1945642A1 DE1945642A1 DE19691945642 DE1945642A DE1945642A1 DE 1945642 A1 DE1945642 A1 DE 1945642A1 DE 19691945642 DE19691945642 DE 19691945642 DE 1945642 A DE1945642 A DE 1945642A DE 1945642 A1 DE1945642 A1 DE 1945642A1
- Authority
- DE
- Germany
- Prior art keywords
- elements
- added
- ppm
- ratios
- nickel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229910052751 metal Inorganic materials 0.000 claims abstract description 10
- 239000002184 metal Substances 0.000 claims abstract description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims abstract description 6
- 230000005294 ferromagnetic effect Effects 0.000 claims abstract description 6
- 229910052759 nickel Inorganic materials 0.000 claims abstract description 6
- 229910052732 germanium Inorganic materials 0.000 claims abstract description 5
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 4
- 230000005496 eutectics Effects 0.000 claims abstract description 4
- 229910052726 zirconium Inorganic materials 0.000 claims abstract description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims abstract description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims abstract description 3
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910001275 Niobium-titanium Inorganic materials 0.000 claims abstract description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims abstract description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims abstract description 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims abstract description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims abstract description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 3
- 229910052804 chromium Inorganic materials 0.000 claims abstract description 3
- 239000011651 chromium Substances 0.000 claims abstract description 3
- 239000010941 cobalt Substances 0.000 claims abstract description 3
- 229910017052 cobalt Inorganic materials 0.000 claims abstract description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052733 gallium Inorganic materials 0.000 claims abstract description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 3
- 239000001257 hydrogen Substances 0.000 claims abstract description 3
- 229910052742 iron Inorganic materials 0.000 claims abstract description 3
- RJSRQTFBFAJJIL-UHFFFAOYSA-N niobium titanium Chemical compound [Ti].[Nb] RJSRQTFBFAJJIL-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 3
- 239000001301 oxygen Substances 0.000 claims abstract description 3
- 229910052720 vanadium Inorganic materials 0.000 claims abstract description 3
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims abstract description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims abstract 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract 2
- 229910052802 copper Inorganic materials 0.000 claims abstract 2
- 239000010949 copper Substances 0.000 claims abstract 2
- 238000000034 method Methods 0.000 claims description 12
- 239000000463 material Substances 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 239000013078 crystal Substances 0.000 claims description 4
- 238000010586 diagram Methods 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- 229910052735 hafnium Inorganic materials 0.000 claims description 2
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 229910052710 silicon Inorganic materials 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 230000000087 stabilizing effect Effects 0.000 claims description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 2
- 230000000717 retained effect Effects 0.000 claims 3
- 239000010936 titanium Substances 0.000 abstract description 7
- 229910052719 titanium Inorganic materials 0.000 abstract description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 abstract description 5
- 239000002131 composite material Substances 0.000 abstract description 5
- -1 borium Chemical compound 0.000 abstract description 4
- 239000002994 raw material Substances 0.000 abstract description 3
- 239000002887 superconductor Substances 0.000 abstract description 3
- 229910001092 metal group alloy Inorganic materials 0.000 abstract description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 abstract 1
- 239000004411 aluminium Substances 0.000 abstract 1
- 239000004020 conductor Substances 0.000 abstract 1
- 229910052748 manganese Inorganic materials 0.000 abstract 1
- 239000011572 manganese Substances 0.000 abstract 1
- 150000002739 metals Chemical class 0.000 abstract 1
- 239000010955 niobium Substances 0.000 description 5
- 229910045601 alloy Inorganic materials 0.000 description 3
- 239000000956 alloy Substances 0.000 description 3
- 230000005291 magnetic effect Effects 0.000 description 3
- 229910052758 niobium Inorganic materials 0.000 description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- XAEWZDYWZHIUCT-UHFFFAOYSA-N desipramine hydrochloride Chemical compound [H+].[Cl-].C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 XAEWZDYWZHIUCT-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10N—ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10N60/00—Superconducting devices
- H10N60/01—Manufacture or treatment
- H10N60/0156—Manufacture or treatment of devices comprising Nb or an alloy of Nb with one or more of the elements of group IVB, e.g. titanium, zirconium or hafnium
Landscapes
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Superconductors And Manufacturing Methods Therefor (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR34933A FR1460032A (fr) | 1965-10-14 | 1965-10-14 | Perfectionnements aux fils supraconducteurs |
| FR54043A FR90029E (fr) | 1965-10-14 | 1966-03-18 | Perfectionnements aux fils supraconducteurs |
| FR166890A FR95612E (fr) | 1965-10-14 | 1968-09-20 | Perfectionnements aux fils supraconducteurs. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1945642A1 true DE1945642A1 (de) | 1970-09-10 |
Family
ID=8654757
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691945642 Pending DE1945642A1 (de) | 1965-10-14 | 1969-09-09 | Verfahren zur Herstellung supraleitender Draehte |
Country Status (4)
| Country | Link |
|---|---|
| BE (1) | BE738952A (enrdf_load_html_response) |
| DE (1) | DE1945642A1 (enrdf_load_html_response) |
| FR (1) | FR95612E (enrdf_load_html_response) |
| NL (1) | NL6913303A (enrdf_load_html_response) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0032691B1 (de) * | 1980-01-22 | 1983-07-20 | Siemens Aktiengesellschaft | Verfahren zur Herstellung eines Supraleiters mit einer intermetallischen Verbindung |
-
1968
- 1968-09-20 FR FR166890A patent/FR95612E/fr not_active Expired
-
1969
- 1969-09-01 NL NL6913303A patent/NL6913303A/xx not_active Application Discontinuation
- 1969-09-09 DE DE19691945642 patent/DE1945642A1/de active Pending
- 1969-09-17 BE BE738952D patent/BE738952A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0032691B1 (de) * | 1980-01-22 | 1983-07-20 | Siemens Aktiengesellschaft | Verfahren zur Herstellung eines Supraleiters mit einer intermetallischen Verbindung |
Also Published As
| Publication number | Publication date |
|---|---|
| FR95612E (fr) | 1971-03-26 |
| NL6913303A (enrdf_load_html_response) | 1970-03-24 |
| BE738952A (enrdf_load_html_response) | 1970-03-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3531769C2 (enrdf_load_html_response) | ||
| DE3531770C2 (enrdf_load_html_response) | ||
| DE69202515T2 (de) | Verfahren zur Herstellung von zweiphasigen Dauermagneten auf der Basis von Seltenen Erden. | |
| DE2412573A1 (de) | Verfahren zur herstellung eines unterteilten supraleitenden drahtes | |
| DE2915737A1 (de) | Amorphe metallegierung und baender daraus | |
| DE3019980C2 (de) | Verfahren zur Herstellung von Supraleiterdrähten aus mit Kupfer oder Kupferlegierung umgebenen, Niob und Aluminium enthaltenden Multifilamenten | |
| DE2928060A1 (de) | Verfahren zur behandlung einer fe-cr-co-magnetlegierung | |
| DE2507105C2 (de) | Verfahren zur Herstellung von permanentmagnetischem Material, enthaltend Samarium, Kobalt, Kupfer und gegebenenfalls Eisen | |
| DE69108829T2 (de) | Permanent magnetisierbares Puder vom R-Fe-B Typ und Verbundmagnet daraus. | |
| EP0048313B1 (de) | Supraleitende Drähte auf der Basis von Bronze-Nb3Sn und Verfahren zu deren Herstellung | |
| US4419145A (en) | Process for producing Nb3 Sn superconductor | |
| DE3014699A1 (en) | Magnetically anisotropic alloys by deformation processing | |
| DE69008855T2 (de) | Amorphe legierungen auf eisenbasis mit hoher sättigungsinduktion und ausgezeichneten weichferromagnetischen eigenschaften. | |
| DE2910044A1 (de) | Legierung | |
| DE1945642A1 (de) | Verfahren zur Herstellung supraleitender Draehte | |
| DE3144869C2 (enrdf_load_html_response) | ||
| DE69421197T2 (de) | Verfahren zur Herstellung eines Nb3X supraleitenden Drahtes | |
| DE2453636A1 (de) | Verfahren zur herstellung eines halbharten magnetischen materials | |
| US3303065A (en) | Superocnductive alloy members | |
| DE2320107A1 (de) | Supraleitende legierung | |
| DE2011581A1 (enrdf_load_html_response) | ||
| DE2144747C3 (de) | Supraleitende Materialien vom A tief 3 B-Typ mit hoher Sprungtemperatur | |
| DE2557840C3 (de) | Verfahren zur Herstellung von duktilen supraleitenden Vielkernleitern | |
| DE68920392T2 (de) | Verfahren zur Herstellung eines oxidischen supraleitenden Drahts. | |
| AT255143B (de) | Verfahren zur Herstellung eines Gegenstandes, der zumindest auf einem Teil seiner Oberfläche eine ununterbrochene Schicht aus Nb3Sn aufweist |