DE1932421B - - Google Patents
Info
- Publication number
- DE1932421B DE1932421B DE1932421B DE 1932421 B DE1932421 B DE 1932421B DE 1932421 B DE1932421 B DE 1932421B
- Authority
- DE
- Germany
- Prior art keywords
- acid dinitrile
- chlorination
- catalyst
- dinitrile
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003054 catalyst Substances 0.000 claims description 8
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 238000005660 chlorination reaction Methods 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- XQZYPMVTSDWCCE-UHFFFAOYSA-N phthalonitrile Chemical compound N#CC1=CC=CC=C1C#N XQZYPMVTSDWCCE-UHFFFAOYSA-N 0.000 claims description 4
- WZHHYIOUKQNLQM-UHFFFAOYSA-N 3,4,5,6-tetrachlorophthalic acid Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C(O)=O WZHHYIOUKQNLQM-UHFFFAOYSA-N 0.000 claims description 3
- BHXFKXOIODIUJO-UHFFFAOYSA-N benzene-1,4-dicarbonitrile Chemical compound N#CC1=CC=C(C#N)C=C1 BHXFKXOIODIUJO-UHFFFAOYSA-N 0.000 claims description 3
- 238000010924 continuous production Methods 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 2
- 239000002006 petroleum coke Substances 0.000 claims description 2
- 150000003021 phthalic acid derivatives Chemical class 0.000 claims description 2
- 239000000741 silica gel Substances 0.000 claims description 2
- 229910002027 silica gel Inorganic materials 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KZCBXHSWMMIEQU-UHFFFAOYSA-N Chlorthal Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(C(O)=O)C(Cl)=C1Cl KZCBXHSWMMIEQU-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- UVGODUOYFYEIGZ-UHFFFAOYSA-N 2,4,5,6-tetrachlorobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(Cl)C(C(O)=O)=C1Cl UVGODUOYFYEIGZ-UHFFFAOYSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69413986T2 (de) | Chlorierungsverfahren | |
| DE69018051T2 (de) | Verfahren zur Umlagerung von geminalen allylischen Dihalogenverbindungen. | |
| EP0638580A1 (de) | Verfahren zur Herstellung von Triphenylphosphin | |
| DE4004494A1 (de) | Verfahren zur herstellung von gesaettigten, fluorhaltigen und chlorfreien kohlenwasserstoffen | |
| DE4005945A1 (de) | Verfahren zur herstellung von aethanderivaten | |
| DE1932421B (enrdf_load_stackoverflow) | ||
| DE1932421C3 (de) | Verfahren zur kontinuierlichen Herstellung von Tetrachlorphthalsäuredinitrilen | |
| CH622759A5 (enrdf_load_stackoverflow) | ||
| CH633244A5 (de) | M-brom-benzotrifluoride. | |
| DE3315147A1 (de) | Verfahren zur herstellung von aromatischen verbindungen, die ueber ein heteroatom gebundene perfluorierte seitenketten enthalten | |
| DE60011118T2 (de) | Verfahren zur herstellung von halogenierten kohlenwasserstoffen | |
| EP0407990B1 (de) | Verfahren zur Herstellung von 1,1,1-Trifluor-2,2-dichlorethan unter erhöhtem Druck | |
| DE69704836T2 (de) | Verfahren zur Herstellung von Benzoylchloriden | |
| EP0548682B1 (de) | Verfahren zur Herstellung von tertiären Phosphinen | |
| DE3104259A1 (de) | Verfahren zur herstellung von polychlorbenzoylchloriden | |
| DE4005944A1 (de) | Verfahren zur herstellung von 1.1.1.-trifluor-2.2.-dichlorethan | |
| DE3709415A1 (de) | Verfahren zur entfernung von m-chlortoluol aus chlortoluolgemischen | |
| EP0136566A2 (de) | Verfahren zur Herstellung von 3,4-Dichlorbenzotrihalogeniden | |
| DE69214450T2 (de) | Verfahren zur herstellung von 5-(3-butyryl-2,4,6-trimethyl)-2-(1-(ethoxyimino)propyl)-3-hydroxycyclohex-2-en-1-on | |
| EP0022185B1 (de) | Verfahren zur Herstellung von Chloracetylchlorid | |
| EP0234503A2 (de) | Verfahren zur Herstellung von 1,1,3-Trichloraceton | |
| DE1108676B (de) | Verfahren zur Herstellung von 2-Brom-2-chlor-1, 1, 1-trifluoraethan | |
| DE2121251A1 (de) | Verfahren zur Herstellung von Dichloracetoxypropan | |
| EP0474074A1 (de) | Verfahren zur Herstellung von Dichlorbenzol mit erhöhtem p-Anteil | |
| DE2416261A1 (de) | Bromhaltige telomere von tetrafluoraethylen und verfahren zur herstellung derselben |