DE1793440C - - Google Patents
Info
- Publication number
- DE1793440C DE1793440C DE1793440C DE 1793440 C DE1793440 C DE 1793440C DE 1793440 C DE1793440 C DE 1793440C
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- chlorine
- catalyst
- sulfoxide
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000460 chlorine Substances 0.000 claims description 28
- 229910052801 chlorine Inorganic materials 0.000 claims description 28
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 26
- 239000003054 catalyst Substances 0.000 claims description 24
- 150000001336 alkenes Chemical class 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 8
- 150000003462 sulfoxides Chemical class 0.000 claims description 8
- 239000005977 Ethylene Substances 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 6
- 238000004821 distillation Methods 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 4
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- 239000000047 product Substances 0.000 claims description 4
- 238000007792 addition Methods 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 238000006555 catalytic reaction Methods 0.000 claims description 3
- 238000005755 formation reaction Methods 0.000 claims description 3
- HRYZWHHZPQKTII-UHFFFAOYSA-N Chloroethane Chemical group CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 claims description 2
- 239000012043 crude product Substances 0.000 claims description 2
- 125000003963 dichloro group Chemical group Cl* 0.000 claims description 2
- 229960003750 ethyl chloride Drugs 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 239000010802 sludge Substances 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 230000001629 suppression Effects 0.000 claims description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K Iron(III) chloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims 6
- 230000003197 catalytic Effects 0.000 claims 4
- 125000004432 carbon atoms Chemical group C* 0.000 claims 3
- 238000000034 method Methods 0.000 claims 3
- 238000006467 substitution reaction Methods 0.000 claims 3
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-Trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 claims 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 239000001257 hydrogen Substances 0.000 claims 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 2
- LOWMYOWHQMKBTM-UHFFFAOYSA-N 1-butylsulfinylbutane Chemical compound CCCCS(=O)CCCC LOWMYOWHQMKBTM-UHFFFAOYSA-N 0.000 claims 1
- VTRRCXRVEQTTOE-UHFFFAOYSA-N 1-methylsulfinylethane Chemical compound CCS(C)=O VTRRCXRVEQTTOE-UHFFFAOYSA-N 0.000 claims 1
- BQCCJWMQESHLIT-UHFFFAOYSA-N 1-propylsulfinylpropane Chemical compound CCCS(=O)CCC BQCCJWMQESHLIT-UHFFFAOYSA-N 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L Iron(II) chloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 claims 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 claims 1
- 241000282941 Rangifer tarandus Species 0.000 claims 1
- 230000002378 acidificating Effects 0.000 claims 1
- 150000001335 aliphatic alkanes Chemical class 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 239000000956 alloy Substances 0.000 claims 1
- 229910045601 alloy Inorganic materials 0.000 claims 1
- 150000001408 amides Chemical class 0.000 claims 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims 1
- 239000006227 byproduct Substances 0.000 claims 1
- 150000001721 carbon Chemical class 0.000 claims 1
- -1 carbon atoms amide Chemical class 0.000 claims 1
- 150000001805 chlorine compounds Chemical class 0.000 claims 1
- 230000036461 convulsion Effects 0.000 claims 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- VTLYFUHAOXGGBS-UHFFFAOYSA-N fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- 150000002430 hydrocarbons Chemical class 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 230000000737 periodic Effects 0.000 claims 1
- 239000012063 pure reaction product Substances 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- 230000035945 sensitivity Effects 0.000 claims 1
- 239000011780 sodium chloride Substances 0.000 claims 1
- 239000000725 suspension Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 3
- WIHMGGWNMISDNJ-UHFFFAOYSA-N 1,1-dichloropropane Chemical compound CCC(Cl)Cl WIHMGGWNMISDNJ-UHFFFAOYSA-N 0.000 description 2
- 150000001348 alkyl chlorides Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- AVGQTJUPLKNPQP-UHFFFAOYSA-N 1,1,1-trichloropropane Chemical compound CCC(Cl)(Cl)Cl AVGQTJUPLKNPQP-UHFFFAOYSA-N 0.000 description 1
- LGXVIGDEPROXKC-UHFFFAOYSA-N 1,1-Dichloroethene Chemical compound ClC(Cl)=C LGXVIGDEPROXKC-UHFFFAOYSA-N 0.000 description 1
- UAZUEJTXWAXSMA-UHFFFAOYSA-N 1,1-dichlorobut-1-ene Chemical class CCC=C(Cl)Cl UAZUEJTXWAXSMA-UHFFFAOYSA-N 0.000 description 1
- PQBOTZNYFQWRHU-UHFFFAOYSA-N 1,2-dichlorobutane Chemical compound CCC(Cl)CCl PQBOTZNYFQWRHU-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- 241001026509 Kata Species 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N N-Propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- BNIXVQGCZULYKV-UHFFFAOYSA-N Pentachloroethane Chemical compound ClC(Cl)C(Cl)(Cl)Cl BNIXVQGCZULYKV-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- IAQRGUVFOMOMEM-ONEGZZNKSA-N trans-but-2-ene Chemical compound C\C=C\C IAQRGUVFOMOMEM-ONEGZZNKSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N triclene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1518502C3 (de) | Verfahren zur Herstellung von alpha,beta olefinisch ungesättigten aliphatischen Mononitnlen | |
| DE4326952A1 (de) | Verfahren zur Herstellung von Triphenylphosphin | |
| DE60004186T2 (de) | Verfahren zur herstellung von 1,1,1,3,3-pentafluorpropen und 1,1,1,3,3-pentafluorpropan | |
| DE1793440C (ja) | ||
| DE68902658T2 (de) | Verfahren zur herstellung von fluoroaromatischen verbindungen. | |
| EP0297238B1 (de) | Verfahren zur Herstellung von Methallylchlorid | |
| DE69801180T2 (de) | Verfahren zur Herstellung von 3,3-dichlor-1,1,1-trifluoraceton | |
| DE60011118T2 (de) | Verfahren zur herstellung von halogenierten kohlenwasserstoffen | |
| DE10238811B4 (de) | Oxichlorierung von Olefinen und Aromaten unter Verwendung eines neuartigen Wirbelschicht-Reaktorkonzeptes | |
| DE1793440B1 (de) | Verfahren zur Herstellung von Dichloralkanen | |
| DE2754891C3 (de) | Verfahren zur Reinigung von nichtumgesetztem 1.2-Dichloräthan aus der Vinylchloridherstellung | |
| DE2924962A1 (de) | Verfahren zur herstellung von sauerstoffhaltigen kohlenstoffverbindungen und olefinen aus synthesegas | |
| DE2540291C3 (de) | Verfahren zur kontinuierlichen Herstellung von 1,2-Dichloräthan und Katalysatorbehälter als Bestandteil einer Vorrichtung zur Durchführung des genannten Verfahrens | |
| AT392066B (de) | Verfahren zur herstellung von isobutyrylfluorid durch carbonylierung von propen mit kohlenmonoxid in wasserfreiem fluorwasserstoff | |
| DE69224492T2 (de) | Verfahren zur Alpha-Chlorierung von Phenylacetonitrilen | |
| DE1264428B (de) | Verfahren zur Herstellung von 1-Chlor-1-fluoraethan und 1, 1-Difluoraethan | |
| EP0111203B1 (de) | Verfahren zur Herstellung von 1,2-Dichlorethan | |
| EP0146882B1 (de) | Verfahren zur Herstellung von 1,2-Dichlorethan | |
| DE1224301B (de) | Verfahren zur Herstellung von Allylchlorid und seinen Monomethylsubstitutionsprodukten | |
| EP0120273B1 (de) | Verfahren zur kontinuierlichen Herstellung von Pentachlorpyridin | |
| DE660642C (de) | Verfahren zum Herstellen chlor- oder bromhaltiger aliphatischer Kohlenwasserstoffe durch Addition von Chlor oder Brom an ungesaettigte Kohlenwasserstoffe | |
| DE2920678A1 (de) | Verfahren zur herstellung von carbonylverbindungen durch oxidation von alkoholen mit molekularem sauerstoff | |
| EP0082342A2 (de) | Katalysatorgemisch und Verfahren zur Herstellung von 1,2-Dichlorethan | |
| EP0003358B1 (de) | Verfahren zur kontinuierlichen Chlorierung von Olefinen in flüssiger Phase sowie Messanordnung zur Chlorkonzentrationsbestimmung und -regelung als Bestandteile einer Vorrichtung zur Durchführung des Verfahrens | |
| DE1232129B (de) | Verfahren zur kontinuierlichen Herstellung von Monochloressigsaeure |