DE1768909A1 - Verfahren zur Herstellung von ungesaettigten Acylhalogeniden - Google Patents
Verfahren zur Herstellung von ungesaettigten AcylhalogenidenInfo
- Publication number
- DE1768909A1 DE1768909A1 DE19681768909 DE1768909A DE1768909A1 DE 1768909 A1 DE1768909 A1 DE 1768909A1 DE 19681768909 DE19681768909 DE 19681768909 DE 1768909 A DE1768909 A DE 1768909A DE 1768909 A1 DE1768909 A1 DE 1768909A1
- Authority
- DE
- Germany
- Prior art keywords
- chloride
- palladium
- vinyl
- reaction
- group viii
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 33
- 150000001266 acyl halides Chemical class 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 39
- -1 vinyl halide Chemical class 0.000 claims description 29
- 239000003054 catalyst Substances 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 24
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 20
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 18
- 229910052763 palladium Inorganic materials 0.000 claims description 18
- 229920002554 vinyl polymer Polymers 0.000 claims description 18
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 16
- 229910052751 metal Inorganic materials 0.000 claims description 12
- 239000002184 metal Substances 0.000 claims description 12
- 229910000510 noble metal Inorganic materials 0.000 claims description 12
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 11
- 239000000047 product Substances 0.000 claims description 10
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 claims description 9
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052737 gold Inorganic materials 0.000 claims description 7
- 239000010931 gold Substances 0.000 claims description 7
- 239000007795 chemical reaction product Substances 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- 229910052697 platinum Inorganic materials 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 4
- 229910052703 rhodium Inorganic materials 0.000 claims description 4
- 239000010948 rhodium Substances 0.000 claims description 4
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 4
- UOORRWUZONOOLO-UHFFFAOYSA-N 1,3-dichloropropene Chemical group ClCC=CCl UOORRWUZONOOLO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- 229910052707 ruthenium Inorganic materials 0.000 claims description 3
- 229910052741 iridium Inorganic materials 0.000 claims description 2
- 229910052762 osmium Inorganic materials 0.000 claims description 2
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 claims description 2
- 239000012808 vapor phase Substances 0.000 claims description 2
- 208000003251 Pruritus Diseases 0.000 claims 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims 1
- 238000005810 carbonylation reaction Methods 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 230000006315 carbonylation Effects 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 238000004817 gas chromatography Methods 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001336 alkenes Chemical class 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 3
- 230000009257 reactivity Effects 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- FALCMQXTWHPRIH-UHFFFAOYSA-N 2,3-dichloroprop-1-ene Chemical compound ClCC(Cl)=C FALCMQXTWHPRIH-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000005309 metal halides Chemical class 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- OWXJKYNZGFSVRC-NSCUHMNNSA-N (e)-1-chloroprop-1-ene Chemical compound C\C=C\Cl OWXJKYNZGFSVRC-NSCUHMNNSA-N 0.000 description 1
- OWXJKYNZGFSVRC-UHFFFAOYSA-N 1-chloroprop-1-ene Chemical compound CC=CCl OWXJKYNZGFSVRC-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- YVVZMSBDWZBPCS-UHFFFAOYSA-N 2-chloroethenylcyclohexane Chemical group ClC=CC1CCCCC1 YVVZMSBDWZBPCS-UHFFFAOYSA-N 0.000 description 1
- PNLQPWWBHXMFCA-UHFFFAOYSA-N 2-chloroprop-1-ene Chemical compound CC(Cl)=C PNLQPWWBHXMFCA-UHFFFAOYSA-N 0.000 description 1
- HFPLCFMATPQWMD-UHFFFAOYSA-N 3,3-dichloro-propionic acid Chemical compound OC(=O)CC(Cl)Cl HFPLCFMATPQWMD-UHFFFAOYSA-N 0.000 description 1
- AWSSTZZQBPIWKZ-UHFFFAOYSA-N 3-chloro-2-methylpropanoic acid Chemical compound ClCC(C)C(O)=O AWSSTZZQBPIWKZ-UHFFFAOYSA-N 0.000 description 1
- OAAGDVLVOKMRCQ-UHFFFAOYSA-N 5-piperidin-4-yl-3-pyridin-4-yl-1,2,4-oxadiazole Chemical compound C1CNCCC1C1=NC(C=2C=CN=CC=2)=NO1 OAAGDVLVOKMRCQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 235000010893 Bischofia javanica Nutrition 0.000 description 1
- 240000005220 Bischofia javanica Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- YMOONIIMQBGTDU-VOTSOKGWSA-N [(e)-2-bromoethenyl]benzene Chemical compound Br\C=C\C1=CC=CC=C1 YMOONIIMQBGTDU-VOTSOKGWSA-N 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- PVEOYINWKBTPIZ-UHFFFAOYSA-N but-3-enoic acid Chemical compound OC(=O)CC=C PVEOYINWKBTPIZ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000003426 co-catalyst Substances 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- OBNCKNCVKJNDBV-UHFFFAOYSA-N ethyl butyrate Chemical compound CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- CHTWJLYZRAJEKG-UHFFFAOYSA-N methyl 3-chloro-2-methylpropanoate Chemical compound COC(=O)C(C)CCl CHTWJLYZRAJEKG-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- MHMUCYJKZUZMNJ-OWOJBTEDSA-N trans-3-chloroacrylic acid Chemical compound OC(=O)\C=C\Cl MHMUCYJKZUZMNJ-OWOJBTEDSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/58—Preparation of carboxylic acid halides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65334967A | 1967-07-14 | 1967-07-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1768909A1 true DE1768909A1 (de) | 1971-12-30 |
Family
ID=24620488
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681768909 Pending DE1768909A1 (de) | 1967-07-14 | 1968-07-12 | Verfahren zur Herstellung von ungesaettigten Acylhalogeniden |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3626005A (en:Method) |
| BE (1) | BE718054A (en:Method) |
| DE (1) | DE1768909A1 (en:Method) |
| FR (1) | FR1589074A (en:Method) |
| GB (1) | GB1174747A (en:Method) |
| NL (1) | NL6809923A (en:Method) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4039572A (en) * | 1974-03-19 | 1977-08-02 | Teijin Limited | Process for preparing diesters of carboxylic acids by catalytic oxidative carbonylation |
| US3988358A (en) * | 1974-05-10 | 1976-10-26 | The University Of Delaware | Process for the preparation of carboxylic acid esters from organic halides |
| IT1060551B (it) * | 1974-06-10 | 1982-08-20 | Lorenzini Sas Inst Biochim | Ammidi sostituite dell acido 3 metil 4 penil 3 butenoico aventi elevata azione ipolipemizzante |
| US4447640A (en) * | 1982-05-17 | 1984-05-08 | The Dow Chemical Company | Preparation of α-unsaturated carboxylic esters and amides from 1,2-dihaloalkanes by carbonylation |
| US4480121A (en) * | 1982-08-26 | 1984-10-30 | The Dow Chemical Company | Preparation of 2-halo-1-alkenes and acrylate esters from hydrocarbon streams |
| US4451667A (en) * | 1982-08-26 | 1984-05-29 | The Dow Chemical Company | Preparation of acrylate esters from vinyl halides and organic carbonates |
| US4743705A (en) * | 1984-07-30 | 1988-05-10 | The Dow Chemical Company | Preparation of acrylate esters |
| US4640831A (en) * | 1984-12-18 | 1987-02-03 | The Dow Chemical Company | Method for recovering protic acids using reversible bases |
| US4582929A (en) * | 1984-12-24 | 1986-04-15 | The Dow Chemical Company | Method of recovering halide values from carbonylation reaction mixtures |
| US5004568A (en) * | 1985-10-03 | 1991-04-02 | National Distillers And Chemical Corporation | Carbonylation of allylic ethers to esters |
| US4767574A (en) * | 1985-10-03 | 1988-08-30 | National Distillers And Chemical Corporation | Carbonylation of allylic ethers to esters |
| US5300675A (en) * | 1993-06-29 | 1994-04-05 | Hoechst Celanese Corp. | Process for synthesizing substituted cinnamic acid derivatives |
| US5399753A (en) * | 1994-05-04 | 1995-03-21 | Dsm, N. V. | Catalyst recovery in the carbonylation of chlorobutenes to pentenoyl chloride |
| US6337418B1 (en) * | 1999-04-09 | 2002-01-08 | Eastman Chemical Co. | Preparation of C1-C5 alkyl esters of nitro or thioether substituted aromatic carboxylic acids |
| US6509293B1 (en) * | 2000-05-22 | 2003-01-21 | Eastman Chemical Company | Gold based heterogeneous carbonylation catalysts |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA747415A (en) * | 1966-11-29 | Sennewald Kurt | Process for the manufacture of vinyl acetate | |
| US3040090A (en) * | 1959-04-14 | 1962-06-19 | Du Pont | Processes of making oxygenated organic compounds |
| US3013066A (en) * | 1961-03-23 | 1961-12-12 | Du Pont | Dimerization of alpha olefins with a group viii noble metal salt |
| US3338961A (en) * | 1964-01-30 | 1967-08-29 | Ethyl Corp | Promoted catalytic carbonylation of allylic halides |
| US3349119A (en) * | 1965-02-19 | 1967-10-24 | Union Oil Co | Oxidative carbonylation of olefins in the presence of inorganic acid anhydrides |
| US3381030A (en) * | 1964-06-01 | 1968-04-30 | Union Oil Co | Aliphatic carboxylic acid esters and unsaturated carboxylic acids by oxidative carbonylation of olefins |
| US3457299A (en) * | 1968-03-28 | 1969-07-22 | Ethyl Corp | Process for preparing carboxylates from olefin halides and carbon monoxide |
-
1967
- 1967-07-14 US US653349A patent/US3626005A/en not_active Expired - Lifetime
-
1968
- 1968-07-12 NL NL6809923A patent/NL6809923A/xx unknown
- 1968-07-12 BE BE718054D patent/BE718054A/xx unknown
- 1968-07-12 DE DE19681768909 patent/DE1768909A1/de active Pending
- 1968-07-12 FR FR1589074D patent/FR1589074A/fr not_active Expired
- 1968-07-15 GB GB33686/68A patent/GB1174747A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1174747A (en) | 1969-12-17 |
| BE718054A (en:Method) | 1968-12-16 |
| FR1589074A (en:Method) | 1970-03-23 |
| NL6809923A (en:Method) | 1969-01-16 |
| US3626005A (en) | 1971-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1768909A1 (de) | Verfahren zur Herstellung von ungesaettigten Acylhalogeniden | |
| DE3205464C2 (de) | Verfahren zur Herstellung von n-Octanol | |
| DE2364039A1 (de) | Verfahren zur herstellung von aldehyden oder n-acyl-alpha-aminosaeuren | |
| DE2630268C2 (de) | Verfahren zur Herstellung von Methacrylsäure oder niedermolekularen Methacrylsäurealkylestern | |
| DE68914956T2 (de) | Methode zur Herstellung von Dialkyl- und Diallyldicarbonaten. | |
| DE69405518T2 (de) | Gleichzeitige Herstellung von Ditertiärbutylperoxid und Tertiärbutylalkohol aus Tertiärbutylhydroperoxid | |
| DE2716000C2 (de) | Verfahren zur Herstellung von 1,4- Diacyloxybuten-(2) | |
| DE2443743A1 (de) | Substituierte 8-hydroxychinoline, verfahren zu ihrer herstellung und ihre verwendung | |
| DE3335595C2 (en:Method) | ||
| DE2303271B2 (de) | Verfahren zur Herstellung von Essigsäure oder deren Gemisch mit Methylacetat | |
| DE2134115A1 (de) | Verfahren zur katalytischen Isomerisierung von Carbonsäureallylestern | |
| DE2240398C3 (de) | Verfahren zur Herstellung von Arylessigsäurealkylestern | |
| DE2616979A1 (de) | Verfahren zur herstellung von carbonsaeureestern durch katalytische oxidation von alkoholen | |
| DE2443142C2 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäurenitril | |
| DE2554403A1 (de) | Verfahren zur katalytischen kupplung von allylverbindungen an substituierte olefine | |
| EP0535518B1 (de) | Verfahren zur Herstellung von 2-Aminomethylpiperidin | |
| DE2646733C3 (de) | Verfahren zur Herstellung von Acrylamid | |
| DE60313317T2 (de) | Kontinuierliches verfahren zur cyanierung von hydrierten beta-ketoestern | |
| DE2416584C2 (de) | Verfahren zur Herstellung von Squalan | |
| EP0226942A2 (de) | Verfahren zur Herstellung von ungesättigten aliphatischen Carbonsäureanhydriden | |
| EP0056615B1 (de) | Verfahren zur Herstellung von Carnitinamid | |
| DE3335594A1 (de) | Verfahren zur herstellung von carbonsaeureanhydriden | |
| DE2503926A1 (de) | Verfahren zur herstellung von vinylestern von carbonsaeuren | |
| DE60119188T2 (de) | Verfahren zur Herstellung einer Epoxycyclododecan-Verbindung | |
| DE69403831T2 (de) | Verfahren zur Carbonylierung der Allylbutenole und ihrer Ester |