DE1758467A1 - Gesinterte Hartmetallegierung und Verfahren zu ihrer Herstellung - Google Patents
Gesinterte Hartmetallegierung und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE1758467A1 DE1758467A1 DE19681758467 DE1758467A DE1758467A1 DE 1758467 A1 DE1758467 A1 DE 1758467A1 DE 19681758467 DE19681758467 DE 19681758467 DE 1758467 A DE1758467 A DE 1758467A DE 1758467 A1 DE1758467 A1 DE 1758467A1
- Authority
- DE
- Germany
- Prior art keywords
- carbide
- hard metal
- sintered hard
- nbc
- metal alloys
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229910001092 metal group alloy Inorganic materials 0.000 title claims description 12
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 238000000034 method Methods 0.000 title claims description 4
- 229910003468 tantalcarbide Inorganic materials 0.000 claims description 27
- 229910052751 metal Inorganic materials 0.000 claims description 12
- 239000002184 metal Substances 0.000 claims description 12
- 239000013078 crystal Substances 0.000 claims description 11
- 229910045601 alloy Inorganic materials 0.000 claims description 10
- 239000000956 alloy Substances 0.000 claims description 10
- 150000001247 metal acetylides Chemical class 0.000 claims description 10
- WHJFNYXPKGDKBB-UHFFFAOYSA-N hafnium;methane Chemical compound C.[Hf] WHJFNYXPKGDKBB-UHFFFAOYSA-N 0.000 claims description 6
- UNASZPQZIFZUSI-UHFFFAOYSA-N methylidyneniobium Chemical compound [Nb]#C UNASZPQZIFZUSI-UHFFFAOYSA-N 0.000 claims description 6
- 229910052715 tantalum Inorganic materials 0.000 claims description 6
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 5
- INZDTEICWPZYJM-UHFFFAOYSA-N 1-(chloromethyl)-4-[4-(chloromethyl)phenyl]benzene Chemical compound C1=CC(CCl)=CC=C1C1=CC=C(CCl)C=C1 INZDTEICWPZYJM-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- NFFIWVVINABMKP-UHFFFAOYSA-N methylidynetantalum Chemical compound [Ta]#C NFFIWVVINABMKP-UHFFFAOYSA-N 0.000 claims description 4
- 239000010955 niobium Substances 0.000 claims description 4
- MTPVUVINMAGMJL-UHFFFAOYSA-N trimethyl(1,1,2,2,2-pentafluoroethyl)silane Chemical compound C[Si](C)(C)C(F)(F)C(F)(F)F MTPVUVINMAGMJL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052735 hafnium Inorganic materials 0.000 claims description 3
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 229910052758 niobium Inorganic materials 0.000 claims description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 3
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 1
- 150000002739 metals Chemical class 0.000 description 5
- 229910000531 Co alloy Inorganic materials 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- 238000005520 cutting process Methods 0.000 description 2
- 238000003754 machining Methods 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 241000220479 Acacia Species 0.000 description 1
- 229910001208 Crucible steel Inorganic materials 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 244000078856 Prunus padus Species 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C29/00—Alloys based on carbides, oxides, nitrides, borides, or silicides, e.g. cermets, or other metal compounds, e.g. oxynitrides, sulfides
- C22C29/02—Alloys based on carbides, oxides, nitrides, borides, or silicides, e.g. cermets, or other metal compounds, e.g. oxynitrides, sulfides based on carbides or carbonitrides
- C22C29/06—Alloys based on carbides, oxides, nitrides, borides, or silicides, e.g. cermets, or other metal compounds, e.g. oxynitrides, sulfides based on carbides or carbonitrides based on carbides, but not containing other metal compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Powder Metallurgy (AREA)
- Carbon And Carbon Compounds (AREA)
- Ceramic Products (AREA)
- Cutting Tools, Boring Holders, And Turrets (AREA)
- Manufacture Of Alloys Or Alloy Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT575067A AT276792B (de) | 1967-06-20 | 1967-06-20 | Gesinterte Hartmetall-Legierung und Verfahren zu ihrer Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1758467A1 true DE1758467A1 (de) | 1972-07-27 |
Family
ID=3579242
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681758467 Pending DE1758467A1 (de) | 1967-06-20 | 1968-06-07 | Gesinterte Hartmetallegierung und Verfahren zu ihrer Herstellung |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3463621A (enExample) |
| AT (1) | AT276792B (enExample) |
| BE (1) | BE715585A (enExample) |
| CH (1) | CH505905A (enExample) |
| DE (1) | DE1758467A1 (enExample) |
| DK (1) | DK136317B (enExample) |
| ES (1) | ES354907A1 (enExample) |
| FI (1) | FI49188C (enExample) |
| FR (1) | FR1593539A (enExample) |
| GB (1) | GB1235708A (enExample) |
| LU (1) | LU56288A1 (enExample) |
| NL (1) | NL6808598A (enExample) |
| NO (1) | NO122771B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3525999A (en) * | 1968-12-24 | 1970-08-25 | Ugine Carbone | Carbide alloys |
| US4195049A (en) * | 1978-07-13 | 1980-03-25 | Ford Motor Company | Method of increasing the strength of a beta silicon carbide article |
| JPH0617531B2 (ja) * | 1986-02-20 | 1994-03-09 | 日立金属株式会社 | 強靭性サ−メツト |
| SE456428B (sv) * | 1986-05-12 | 1988-10-03 | Santrade Ltd | Hardmetallkropp for bergborrning med bindefasgradient och sett att framstella densamma |
| CN105586523A (zh) * | 2016-01-20 | 2016-05-18 | 刘岗 | 环保节能水刀除膜机 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2198343A (en) * | 1937-01-16 | 1940-04-23 | American Cutting Alloys Inc | Hard metal composition |
| US2188983A (en) * | 1938-05-05 | 1940-02-06 | Sirian Wire And Contact Compan | Hard metal alloys and process of making the same |
| CH365543A (de) * | 1956-04-13 | 1962-11-15 | Sandvikens Jernverks Ab | Gesinterte Hartmetallegierung |
| US2899739A (en) * | 1956-06-19 | 1959-08-18 | Sintered hard metal alloy | |
| SE301725B (enExample) * | 1963-07-01 | 1968-06-17 | Sandvikens Jernverks Ab |
-
1967
- 1967-06-20 AT AT575067A patent/AT276792B/de not_active IP Right Cessation
-
1968
- 1968-05-24 BE BE715585D patent/BE715585A/xx not_active IP Right Cessation
- 1968-06-07 DE DE19681758467 patent/DE1758467A1/de active Pending
- 1968-06-07 FR FR1593539D patent/FR1593539A/fr not_active Expired
- 1968-06-11 ES ES354907A patent/ES354907A1/es not_active Expired
- 1968-06-13 DK DK276268AA patent/DK136317B/da not_active IP Right Cessation
- 1968-06-18 LU LU56288D patent/LU56288A1/xx unknown
- 1968-06-18 GB GB29034/68A patent/GB1235708A/en not_active Expired
- 1968-06-19 NL NL6808598A patent/NL6808598A/xx unknown
- 1968-06-19 US US738137A patent/US3463621A/en not_active Expired - Lifetime
- 1968-06-19 CH CH910568A patent/CH505905A/fr not_active IP Right Cessation
- 1968-06-20 NO NO2434/68A patent/NO122771B/no unknown
- 1968-06-20 FI FI681741A patent/FI49188C/fi active
Also Published As
| Publication number | Publication date |
|---|---|
| NL6808598A (enExample) | 1968-12-23 |
| FR1593539A (enExample) | 1970-06-01 |
| NO122771B (enExample) | 1971-08-09 |
| DK136317C (enExample) | 1978-02-27 |
| US3463621A (en) | 1969-08-26 |
| DK136317B (da) | 1977-09-26 |
| BE715585A (enExample) | 1968-10-16 |
| LU56288A1 (enExample) | 1968-09-30 |
| FI49188C (fi) | 1975-04-10 |
| CH505905A (fr) | 1971-04-15 |
| FI49188B (enExample) | 1974-12-31 |
| AT276792B (de) | 1969-12-10 |
| ES354907A1 (es) | 1970-03-01 |
| GB1235708A (en) | 1971-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69015712T2 (de) | Gesinterte Carbonitridlegierung. | |
| DE68909898T3 (de) | Hochfester, Stickstoff enthaltender Cermet und Verfahren zu seiner Herstellung. | |
| DE68910081T2 (de) | Schneidkörperblatt und Verfahren zu dessen Herstellung. | |
| DE2429075A1 (de) | Karbonitridlegierungen fuer schneidwerkzeuge und verschleissteile | |
| DE3781773T2 (de) | Legierung aus verformungsbestaendigem, metallisch verbundenem karbonitrid. | |
| DE2830010A1 (de) | Metall-keramik-werkstoff auf der basis von titancarbid | |
| DE69323145T2 (de) | Carbonitridlegierung auf Titanbasis mit gesteuerter Struktur | |
| DE3903682A1 (de) | Durch stickstoff verfestigte fe-ni-cr-legierung | |
| DE2420768A1 (de) | Karbonitridlegierungen fuer schneidwerkzeuge und verschleissteile | |
| DE1758467A1 (de) | Gesinterte Hartmetallegierung und Verfahren zu ihrer Herstellung | |
| DE69513086T2 (de) | Stickstoffenthaltende hartgesinterte Legierung | |
| DE1288791B (de) | Verwendung einer Sinterhartmetallegierung zum Zerspannen von Gusseisen und Stahl | |
| DE3309237C2 (de) | Verfahren zum Herstellen hochverschleißfester Sinterhartmetalle auf Titannitridbasis | |
| DE69807559T2 (de) | Legierung auf Titanbasis | |
| DE2303756C3 (de) | Verfahren zur Erzeugung einer Mischkarbidschicht aus Vanadium und Chrom auf kohlenstoffhaltigen Eisenwerkstoffen | |
| DE69209885T2 (de) | Gesinterte Karbonitridlegierung mit verbesserter Verschleissbeständigkeit | |
| DE667071C (de) | Hartmetallegierung | |
| DE69125181T2 (de) | Verfahren zur herstellung einer gesinterten karbonitridlegierung zum feinfräsen | |
| DE69313543T2 (de) | Verbundkörper | |
| AT160276B (de) | Hartmetallegierung. | |
| DE659534C (de) | Schneidwerkzeuge aus einer Hartlegierung mit besonders grosser Zaehigkeit | |
| DE918050C (de) | Hartmetallegierung | |
| DE762288C (de) | Hartmetallegierung | |
| DE69125626T2 (de) | Verfahren zur herstellung einer gesinterten karbonitridlegierung zur intermittierenden bearbeitung schwer bearbeitbarer materialien | |
| DE3228692C2 (de) | Hartmetall |