DE1669368C - - Google Patents
Info
- Publication number
- DE1669368C DE1669368C DE1669368C DE 1669368 C DE1669368 C DE 1669368C DE 1669368 C DE1669368 C DE 1669368C
- Authority
- DE
- Germany
- Prior art keywords
- fibers
- caprolactam
- fiber
- poly
- crimps
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000835 fiber Substances 0.000 claims description 112
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 claims description 29
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 17
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 10
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 8
- 239000004952 Polyamide Substances 0.000 claims description 5
- 229920002647 polyamide Polymers 0.000 claims description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims 1
- 239000011707 mineral Substances 0.000 claims 1
- 239000002131 composite material Substances 0.000 description 25
- 229920000642 polymer Polymers 0.000 description 18
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 229920001577 copolymer Polymers 0.000 description 14
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 10
- 238000000034 method Methods 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 238000009987 spinning Methods 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 6
- 230000002441 reversible effect Effects 0.000 description 6
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 6
- 229920006240 drawn fiber Polymers 0.000 description 5
- 238000007669 thermal treatment Methods 0.000 description 5
- 239000004408 titanium dioxide Substances 0.000 description 5
- BDJRBEYXGGNYIS-UHFFFAOYSA-N Nonanedioid acid Natural products OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000002788 crimping Methods 0.000 description 4
- 238000001125 extrusion Methods 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 150000003951 lactams Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- 229920002302 Nylon 6,6 Polymers 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 125000003010 ionic group Chemical group 0.000 description 2
- 150000002500 ions Chemical group 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- CDJITXZSZYGOEE-UHFFFAOYSA-N 2-methylidenehexanediamide Chemical class NC(=O)CCCC(=C)C(N)=O CDJITXZSZYGOEE-UHFFFAOYSA-N 0.000 description 1
- PGGROMGHWHXWJL-UHFFFAOYSA-N 4-(azepane-1-carbonyl)benzamide Chemical compound C1=CC(C(=O)N)=CC=C1C(=O)N1CCCCCC1 PGGROMGHWHXWJL-UHFFFAOYSA-N 0.000 description 1
- CSVBIURHUGXNCS-UHFFFAOYSA-N 6-azaniumylhexylazanium;terephthalate Chemical compound NCCCCCCN.OC(=O)C1=CC=C(C(O)=O)C=C1 CSVBIURHUGXNCS-UHFFFAOYSA-N 0.000 description 1
- 229920000571 Nylon 11 Polymers 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920000305 Nylon 6,10 Polymers 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- LBVWYGNGGJURHQ-UHFFFAOYSA-N dicarbon Chemical compound [C-]#[C+] LBVWYGNGGJURHQ-UHFFFAOYSA-N 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 229920006017 homo-polyamide Polymers 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000009940 knitting Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000009941 weaving Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1660425B2 (de) | Spinnverfahren zur herabsetzung der ablenkung von aus einer spinnduese austretenden verbundfaeden | |
| DE2341156C3 (de) | Verfahren zum Herstellen von Florteppichen | |
| DE1807144A1 (de) | Fibrillierter Faden | |
| DE1660428A1 (de) | Schrumpffaehige Polyamidfasern und Verfahren zur Herstellung derselben | |
| DE1435527B1 (de) | Verfahren zur Herstellung kraeuselbarer Verbundfaeden | |
| DE2414637B2 (de) | Gekräuseltes synthetisches Garn und Verfahren zu dessen Herstellung | |
| DE1669477A1 (de) | Verfahren zur Herstellung von nicht klebenden Mischpolyamidfaeden | |
| DE1669368C (enExample) | ||
| DE2338286A1 (de) | Kraeuselfaehige verbundfaser | |
| DE1669485A1 (de) | Verfahren zur Herstellung eines Bikomponentenfadens mit latenter,hochelastischer und sehr gut wiederherstellbarer Kraeuselung | |
| DE1669372B1 (de) | Verfahren zum Herstellen von gekraeuselten Verbundfaeden | |
| DE2454119C2 (de) | Verfahren zur Herstellung eines hydrophilen Blockcopolymeren | |
| DE1660383B2 (de) | Verfahren zur Herstellung eines bauschigen Mehrfadengarns | |
| DE1669368A1 (de) | Kraeuselbare Verbundfasern | |
| DE1669368B (de) | Polyamid Zweikomponentenfasern | |
| DE1719235C3 (de) | Schmelzformungsmassen aus Polyester und Polyäther-Polyamid-Blockcopolymeren | |
| DE1669485C (de) | Verfahren zur Herstellung eines kräuselbaren Bikomponentenfadens | |
| DE1669484C (de) | Verfahren zur Herstellung eines Polyamidverbundfadens mit hoher Kräuselbarkeit | |
| DE2325139C3 (de) | Verfahren zur Herstellung von vollaromatischen Polyamidfasern | |
| DE1669372C (de) | Verfahren zum Herstellen von gekrau selten Verbundfaden | |
| DE1914399C (de) | Zusammengesetzter Polyamid/Polyester Faden mit einer elastischen Kräuselung | |
| DE1669383A1 (de) | Verfahren zur Herstellung von Bi-Komponenten-Faeden | |
| DE1669479C (de) | Zusammengesetzte Polyolefin/Polyamid Faden | |
| DE1669436C3 (de) | Verbundfaden aus zwei verschieden stark schrumpfenden Polymeren | |
| DE1669545C (de) | Verfahren zur Herstellung von gekräuselten bzw. kräuselfähigen Zweikomponentenfäden |