DE1669128C - - Google Patents
Info
- Publication number
- DE1669128C DE1669128C DE1669128C DE 1669128 C DE1669128 C DE 1669128C DE 1669128 C DE1669128 C DE 1669128C
- Authority
- DE
- Germany
- Prior art keywords
- weight
- percent
- polishing agent
- silane
- viscosity
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000005498 polishing Methods 0.000 claims description 32
- 239000003795 chemical substances by application Substances 0.000 claims description 31
- -1 polysiloxanes Polymers 0.000 claims description 21
- 239000007795 chemical reaction product Substances 0.000 claims description 14
- 239000001993 wax Substances 0.000 claims description 14
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims description 10
- 229910000077 silane Inorganic materials 0.000 claims description 10
- 235000013870 dimethyl polysiloxane Nutrition 0.000 claims description 9
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 claims description 9
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 claims description 8
- 229920001296 polysiloxane Polymers 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 150000004756 silanes Chemical class 0.000 claims description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 239000004205 dimethyl polysiloxane Substances 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000003599 detergent Substances 0.000 description 19
- 239000002904 solvent Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 239000004203 carnauba wax Substances 0.000 description 2
- 235000013869 carnauba wax Nutrition 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000003350 kerosene Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- WERKSKAQRVDLDW-ANOHMWSOSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO WERKSKAQRVDLDW-ANOHMWSOSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1669128A1 (de) | Waschmittelbestaendige Autopoliermittel | |
| DE2936678C2 (de) | Poliermittel | |
| DE2404138C3 (de) | Zusatz für Poliermittel | |
| EP0166122B1 (de) | Betaingruppen enthaltende Siloxane, deren Herstellung und Verwendung in kosmetischen Zubereitungen | |
| DE3924911C2 (de) | Wäßrige Organosiloxanzusammensetzung, Verfahren zu deren Herstellung und ihre Verwendung zur Behandlung von Textilien | |
| DE69232533T2 (de) | Verfahren zur Herstellung von Mikroemulsionen aus Amingruppen enthaltenden Polysiloxanen | |
| EP0164668B1 (de) | Betaingruppen enthaltende Siloxane, deren Herstellung und Verwendung in Haarpflegemitteln | |
| DE3705121A1 (de) | Polyquaternaere polysiloxan-polymere, deren herstellung und verwendung in kosmetischen zubereitungen | |
| DE2838325A1 (de) | Verbesserte moebelpolituremulsion | |
| DE2905257A1 (de) | Haarbehandlungsmittel | |
| DE2448755A1 (de) | Waessriges spuel- und ueberzugsmittel fuer harte oberflaechen | |
| DE4324648A1 (de) | Oberflächenschutzstoffzusammensetzung | |
| DE2101388A1 (de) | Poliermasse | |
| EP0002506B1 (de) | Verwendung von Mitteln zur Kur sowie zum Waschen von Haaren | |
| DE2300245A1 (de) | Oberflaechenpflegemittel auf basis von organopolysiloxanen und wachs | |
| DE1669128C (enExample) | ||
| EP1008616A2 (de) | W/O-Emulsionen, enthaltend aminofunktionelle Organopolysiloxane | |
| DE1949463C3 (de) | Aminomethylsubstituierte Polysiloxane enthaltendes Mittel und dessen Verwendung zur Herstellung wasserabweisender und glanzgebender Überzüge | |
| DE1669128B (de) | Autopoliermittel | |
| DE3034231C2 (de) | Polydiorganosiloxane enthaltende Seifen | |
| DE2364153A1 (de) | Poliermittel | |
| DE19923477C2 (de) | Pflegemittel, enthaltend Aminoorganopolysiloxane mit Fluorgruppen | |
| DE928118C (de) | Impraegnierungsmittel, insbesondere fuer Leder | |
| DE1812709C3 (de) | Politur, enthaltend ein Wachs, ein durch Aminokohlenwasserstoffgruppen substituiertes Polydiorganosiloxan, ein Lösungsmittel und übliche Zusätze | |
| DE602004009406T2 (de) | Waschmittel |