DE1668500B2 - Verfahren zur herstellung von epoxiden - Google Patents
Verfahren zur herstellung von epoxidenInfo
- Publication number
- DE1668500B2 DE1668500B2 DE19671668500 DE1668500A DE1668500B2 DE 1668500 B2 DE1668500 B2 DE 1668500B2 DE 19671668500 DE19671668500 DE 19671668500 DE 1668500 A DE1668500 A DE 1668500A DE 1668500 B2 DE1668500 B2 DE 1668500B2
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen peroxide
- reaction
- compound
- isopropanol
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 14
- 238000004519 manufacturing process Methods 0.000 title description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 66
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 18
- 239000003960 organic solvent Substances 0.000 claims description 5
- 229910052723 transition metal Inorganic materials 0.000 claims description 5
- 150000003624 transition metals Chemical class 0.000 claims description 5
- -1 organic nitrogen compound Transition metal compound Chemical class 0.000 claims description 4
- 150000003512 tertiary amines Chemical class 0.000 claims description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 4
- 229910052721 tungsten Inorganic materials 0.000 claims description 4
- 239000010937 tungsten Substances 0.000 claims description 4
- 229910052720 vanadium Inorganic materials 0.000 claims description 4
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 4
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 3
- 229910052770 Uranium Inorganic materials 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 239000011733 molybdenum Substances 0.000 claims description 3
- 229910052758 niobium Inorganic materials 0.000 claims description 3
- 239000010955 niobium Substances 0.000 claims description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 3
- 229910052702 rhenium Inorganic materials 0.000 claims description 3
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 3
- DNYWZCXLKNTFFI-UHFFFAOYSA-N uranium Chemical compound [U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U] DNYWZCXLKNTFFI-UHFFFAOYSA-N 0.000 claims description 3
- 239000000908 ammonium hydroxide Substances 0.000 claims description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 2
- 150000002118 epoxides Chemical class 0.000 claims 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 14
- 150000002924 oxiranes Chemical class 0.000 description 14
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 8
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 7
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 6
- 150000002334 glycols Chemical class 0.000 description 6
- LFMTUFVYMCDPGY-UHFFFAOYSA-N n,n-diethylethanamine oxide Chemical compound CC[N+]([O-])(CC)CC LFMTUFVYMCDPGY-UHFFFAOYSA-N 0.000 description 5
- 239000012429 reaction media Substances 0.000 description 5
- 239000003708 ampul Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- 239000004593 Epoxy Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 238000006735 epoxidation reaction Methods 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 3
- 229910017464 nitrogen compound Inorganic materials 0.000 description 3
- 150000002830 nitrogen compounds Chemical class 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 150000003623 transition metal compounds Chemical class 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- OZECDDHOAMNMQI-UHFFFAOYSA-H cerium(3+);trisulfate Chemical compound [Ce+3].[Ce+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O OZECDDHOAMNMQI-UHFFFAOYSA-H 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 150000002897 organic nitrogen compounds Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- ZWAJLVLEBYIOTI-OLQVQODUSA-N (1s,6r)-7-oxabicyclo[4.1.0]heptane Chemical compound C1CCC[C@@H]2O[C@@H]21 ZWAJLVLEBYIOTI-OLQVQODUSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- WHNBDXQTMPYBAT-UHFFFAOYSA-N 2-butyloxirane Chemical compound CCCCC1CO1 WHNBDXQTMPYBAT-UHFFFAOYSA-N 0.000 description 1
- OURXRFYZEOUCRM-UHFFFAOYSA-N 4-hydroxymorpholine Chemical compound ON1CCOCC1 OURXRFYZEOUCRM-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N N,N-Diethylethanamine Substances CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 125000005595 acetylacetonate group Chemical group 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 150000001925 cycloalkenes Chemical class 0.000 description 1
- OWOKCNWPTSZEGO-UHFFFAOYSA-N cyclohexanol;methyl acetate Chemical compound COC(C)=O.OC1CCCCC1 OWOKCNWPTSZEGO-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- JVQOASIPRRGMOS-UHFFFAOYSA-M dodecyl(trimethyl)azanium;hydroxide Chemical compound [OH-].CCCCCCCCCCCC[N+](C)(C)C JVQOASIPRRGMOS-UHFFFAOYSA-M 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- QOSATHPSBFQAML-UHFFFAOYSA-N hydrogen peroxide;hydrate Chemical compound O.OO QOSATHPSBFQAML-UHFFFAOYSA-N 0.000 description 1
- 230000033444 hydroxylation Effects 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 150000004966 inorganic peroxy acids Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000005078 molybdenum compound Substances 0.000 description 1
- 150000002752 molybdenum compounds Chemical class 0.000 description 1
- LKPFBGKZCCBZDK-UHFFFAOYSA-N n-hydroxypiperidine Chemical compound ON1CCCCC1 LKPFBGKZCCBZDK-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D301/00—Preparation of oxiranes
- C07D301/32—Separation; Purification
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D301/00—Preparation of oxiranes
- C07D301/02—Synthesis of the oxirane ring
- C07D301/03—Synthesis of the oxirane ring by oxidation of unsaturated compounds, or of mixtures of unsaturated and saturated compounds
- C07D301/12—Synthesis of the oxirane ring by oxidation of unsaturated compounds, or of mixtures of unsaturated and saturated compounds with hydrogen peroxide or inorganic peroxides or peracids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Epoxy Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR82232A FR1506459A (fr) | 1966-11-02 | 1966-11-02 | Procédé de préparation d'époxydes et produits préparés selon ce procédé |
| US9595670A | 1970-12-07 | 1970-12-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1668500A1 DE1668500A1 (de) | 1972-04-06 |
| DE1668500B2 true DE1668500B2 (de) | 1973-04-12 |
| DE1668500C3 DE1668500C3 (enExample) | 1973-11-08 |
Family
ID=26174032
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671668500 Granted DE1668500B2 (de) | 1966-11-02 | 1967-10-30 | Verfahren zur herstellung von epoxiden |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3778451A (enExample) |
| BE (1) | BE705867A (enExample) |
| DE (1) | DE1668500B2 (enExample) |
| ES (1) | ES346620A1 (enExample) |
| FR (1) | FR1506459A (enExample) |
| LU (1) | LU54772A1 (enExample) |
| NL (1) | NL159098B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2752626A1 (de) * | 1976-11-26 | 1978-06-01 | Ugine Kuhlmann | Verfahren zur epoxydation von olefinen durch wasserstoffperoxid |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4046783A (en) * | 1973-07-26 | 1977-09-06 | Texaco Development Corporation | Method of olefin epoxidation |
| FR2245582B1 (enExample) * | 1973-10-02 | 1976-05-14 | Ugine Kuhlmann | |
| US4024165A (en) * | 1976-06-29 | 1977-05-17 | Shell Oil Company | Process for the epoxidation of olefins |
| US4157346A (en) * | 1976-10-21 | 1979-06-05 | Olin Corporation | Catalytic epoxidation of alkylene compounds |
| FR2508451A1 (fr) * | 1981-06-26 | 1982-12-31 | Interox | Procede pour la fabrication d'epoxydes |
| US4558026A (en) * | 1982-09-28 | 1985-12-10 | The Halcon Sd Group, Inc. | Catalyst comprising tellurium chemically bound to aromatic polymer |
| US4480113A (en) * | 1982-09-28 | 1984-10-30 | The Halcon Sd Group, Inc. | Epoxidation catalyst and process |
| IT1205277B (it) * | 1982-11-10 | 1989-03-15 | Montedison Spa | Nuovo composizioni perossidiche a base di tungsteno e fosforo o arsenico |
| US4579982A (en) * | 1984-03-28 | 1986-04-01 | Union Carbide Corporation | Preparation of monoalkylene glycols using two liquid phase reaction menstruum |
| US4822925A (en) * | 1984-03-28 | 1989-04-18 | Union Carbide Corporation | Organosalts of metalate anions and process for the production of alkylene glycols therewith |
| US4667045A (en) * | 1984-03-28 | 1987-05-19 | Union Carbide Corporation | Organosalts of metalate anions and process for the production of alkylene glycols therewith |
| DE3731690C1 (de) * | 1987-09-21 | 1989-01-19 | Degussa | Verfahren zur katalytischen Epoxidation von Olefinen mit Wasserstoffperoxid |
| DE3731689A1 (de) * | 1987-09-21 | 1989-03-30 | Degussa | Rhenium-oxo-porphyrin-komplexe |
| US5344946A (en) * | 1991-04-09 | 1994-09-06 | Solvay Interox Gmbh | Process for the preparation of vicinal diols and/or epoxides |
| US5103027A (en) * | 1991-07-23 | 1992-04-07 | Arco Chemical Technology, L.P. | Olefin expoxidation using an oxorhenium porphyrin complex catalyst and an organic hydroperoxide |
| US5118822A (en) * | 1991-09-30 | 1992-06-02 | Arco Chemical Technology, L.P. | Olefin epoxidation using a perrhenate catalyst and an organic hydroperoxide |
| US5166372A (en) * | 1992-02-07 | 1992-11-24 | Arco Chemical Technology, L.P. | Epoxidation process |
| CA2137310C (en) * | 1993-12-20 | 2004-02-17 | John C. Jubin Jr. | Catalytic converter and method for highly exothermic reactions |
| US6414168B1 (en) | 1998-12-28 | 2002-07-02 | Caschem, Inc. | Epoxidation of ricinic compounds using a phase-transfer catalyst |
| US6051725A (en) * | 1998-12-28 | 2000-04-18 | Caschem, Inc. | Epoxidation of ricinic compounds using a phase-transfer catalyst |
-
1966
- 1966-11-02 FR FR82232A patent/FR1506459A/fr not_active Expired
-
1967
- 1967-10-30 DE DE19671668500 patent/DE1668500B2/de active Granted
- 1967-10-30 BE BE705867D patent/BE705867A/xx not_active IP Right Cessation
- 1967-10-31 LU LU54772D patent/LU54772A1/xx unknown
- 1967-10-31 ES ES346620A patent/ES346620A1/es not_active Expired
- 1967-11-01 NL NL6714844.A patent/NL159098B/xx not_active IP Right Cessation
-
1970
- 1970-12-07 US US00095956A patent/US3778451A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2752626A1 (de) * | 1976-11-26 | 1978-06-01 | Ugine Kuhlmann | Verfahren zur epoxydation von olefinen durch wasserstoffperoxid |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1506459A (fr) | 1967-12-22 |
| ES346620A1 (es) | 1969-04-16 |
| DE1668500A1 (de) | 1972-04-06 |
| BE705867A (fr) | 1968-04-30 |
| LU54772A1 (enExample) | 1968-05-08 |
| US3778451A (en) | 1973-12-11 |
| NL6714844A (enExample) | 1968-05-03 |
| DE1668500C3 (enExample) | 1973-11-08 |
| NL159098B (nl) | 1979-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1668500C3 (enExample) | ||
| DE1520725A1 (de) | Verfahren zur Herstellung von Alkydharzen | |
| DE2616934C3 (de) | Verfahren zur Epoxidierung von Olefinen | |
| EP0286937B1 (de) | Verfahren zur Herstellung epoxidierter Fettalkohole | |
| DE2239681B2 (de) | Verfahren zur Epoxidierung von olefinisch ungesättigten Verbindungen mit Wasserstoffperoxid | |
| DE2446830A1 (de) | Verfahren zur epoxydation von olefinen | |
| DE3528004C2 (enExample) | ||
| DE2718057A1 (de) | Verfahren zur herstellung von epoxiden | |
| DE1914572B2 (de) | Verfahren zur Herstellung von Dodecandisäure -1,12 | |
| DE1618861A1 (enExample) | ||
| DE1543018C3 (enExample) | ||
| DE69606108T2 (de) | Verfahren zur Propylenepoxidation | |
| DE3205648A1 (de) | Verfahren zur herstellung von c(pfeil abwaerts)3(pfeil abwaerts)-c(pfeil abwaerts)1(pfeil abwaerts)(pfeil abwaerts)0(pfeil abwaerts)-epoxiden | |
| DE3528003C2 (enExample) | ||
| DE1518997C3 (de) | Verfahren zur Herstellung von Epoxiden | |
| DE2835884A1 (de) | Verfahren zur herstellung von 7-oxabicyclo(4.1.0)heptan-3,4-dicarbonsaeure-diglycidylester | |
| DE1568790C3 (de) | Verfahren zur katalytischen Herstellung von furanverbindungen | |
| DE1161881B (de) | Verfahren zur Herstellung von 1, 2-Epoxycyclododecadien-(5, 9) | |
| DE1939891C2 (de) | Verfahren zur Herstellung von Glyzerin | |
| DE2225450C3 (de) | Verfahren zur gleichzeitigen Herstellung von Propylenoxid und Essigsäure | |
| EP0034206A1 (de) | Verfahren zur Epoxydierung von Cyclododecen oder Tricyclodecen-3 | |
| DE1518521C3 (de) | Verfahren zur Herstellung von Epoxyden | |
| DE1568001C3 (de) | Verfahren zur Herstellung von Epoxyden | |
| DE1150675B (de) | Verfahren zur Herstellung von Cyclododecen mit ueberwiegendem Gehalt an cis-Cyclododecen | |
| DE1468025B2 (de) | Verfahren zur herstellung von epoxyverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: CHLOE CHIMIE, 92800 PUTEAUX, FR |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: WUESTHOFF, F., DR.-ING. FRHR. VON PECHMANN, E., DIPL.-CHEM. DR.RER.NAT. BEHRENS, D., DR.-ING. GOETZ, R., DIPL.-ING. DIPL.-WIRTSCH.-ING., PAT.-ANW., 8000 MUENCHEN |