DE1643313A1 - Neue herbicid wirksame Verbindungen und Zusammensetzungen - Google Patents
Neue herbicid wirksame Verbindungen und ZusammensetzungenInfo
- Publication number
- DE1643313A1 DE1643313A1 DE19511643313 DE1643313A DE1643313A1 DE 1643313 A1 DE1643313 A1 DE 1643313A1 DE 19511643313 DE19511643313 DE 19511643313 DE 1643313 A DE1643313 A DE 1643313A DE 1643313 A1 DE1643313 A1 DE 1643313A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- propyl
- dinitro
- hydrogen
- compositions
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 title claims description 20
- 239000000203 mixture Substances 0.000 title claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 13
- 230000002363 herbicidal effect Effects 0.000 claims description 8
- -1 pyrrolidino, piperidino Chemical group 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229940124530 sulfonamide Drugs 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000004009 herbicide Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 240000008853 Datura stramonium Species 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 240000001592 Amaranthus caudatus Species 0.000 description 3
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 3
- 244000025254 Cannabis sativa Species 0.000 description 3
- 244000281762 Chenopodium ambrosioides Species 0.000 description 3
- 241000209504 Poaceae Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- PEDHCXVSNZZLSR-UHFFFAOYSA-N 4-amino-n-propylbenzenesulfonamide Chemical compound CCCNS(=O)(=O)C1=CC=C(N)C=C1 PEDHCXVSNZZLSR-UHFFFAOYSA-N 0.000 description 2
- 240000006995 Abutilon theophrasti Species 0.000 description 2
- 235000005474 African couch grass Nutrition 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 235000000509 Chenopodium ambrosioides Nutrition 0.000 description 2
- 235000005490 Chenopodium botrys Nutrition 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 241001520106 Eustachys Species 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 244000045561 useful plants Species 0.000 description 2
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 235000003129 Ambrosia artemisiifolia var elatior Nutrition 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 101100260565 Dictyostelium discoideum thyA gene Proteins 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 1
- 240000003176 Digitaria ciliaris Species 0.000 description 1
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 1
- 235000005476 Digitaria cruciata Nutrition 0.000 description 1
- 235000006830 Digitaria didactyla Nutrition 0.000 description 1
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 235000016623 Fragaria vesca Nutrition 0.000 description 1
- 240000009088 Fragaria x ananassa Species 0.000 description 1
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 1
- 244000299507 Gossypium hirsutum Species 0.000 description 1
- 241001075721 Hibiscus trionum Species 0.000 description 1
- 235000001047 Hibiscus trionum Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001327265 Ischaemum Species 0.000 description 1
- 235000003403 Limnocharis flava Nutrition 0.000 description 1
- 240000000982 Malva neglecta Species 0.000 description 1
- 235000000060 Malva neglecta Nutrition 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- 244000010062 Setaria pumila Species 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 235000003484 annual ragweed Nutrition 0.000 description 1
- 210000000709 aorta Anatomy 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 235000006263 bur ragweed Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 235000003488 common ragweed Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- CDZOGLJOFWFVOZ-UHFFFAOYSA-N n-propylaniline Chemical compound CCCNC1=CC=CC=C1 CDZOGLJOFWFVOZ-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 235000009736 ragweed Nutrition 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 101150068774 thyX gene Proteins 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/22—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
- C07D203/24—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL132336D NL132336C (instruction) | 1951-01-28 | ||
| DE19511643313 DE1643313A1 (de) | 1951-01-28 | 1951-01-28 | Neue herbicid wirksame Verbindungen und Zusammensetzungen |
| US573829A US3367949A (en) | 1951-01-28 | 1966-08-22 | Sulfanilamides |
| FR123269A FR1538947A (fr) | 1951-01-28 | 1967-10-04 | Nouveaux sulfanilamides substitués et compositions herbicides les contenant |
| GB45898/67A GB1149139A (en) | 1951-01-28 | 1967-10-06 | New herbicidal compounds and compositions |
| NL6713615A NL6713615A (instruction) | 1951-01-28 | 1967-10-06 | |
| OA53088A OA02524A (fr) | 1951-01-28 | 1967-10-25 | Nouveaux sulfamides substituées et compositions herbicides les contenant. |
| CY51770A CY517A (en) | 1951-01-28 | 1970-01-14 | New herbicidal compounds and compositions |
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19511643313 DE1643313A1 (de) | 1951-01-28 | 1951-01-28 | Neue herbicid wirksame Verbindungen und Zusammensetzungen |
| US573829A US3367949A (en) | 1951-01-28 | 1966-08-22 | Sulfanilamides |
| FR123269A FR1538947A (fr) | 1951-01-28 | 1967-10-04 | Nouveaux sulfanilamides substitués et compositions herbicides les contenant |
| GB45898/67A GB1149139A (en) | 1951-01-28 | 1967-10-06 | New herbicidal compounds and compositions |
| NL6713615A NL6713615A (instruction) | 1951-01-28 | 1967-10-06 | |
| DEE0034909 | 1967-10-06 | ||
| OA53088A OA02524A (fr) | 1951-01-28 | 1967-10-25 | Nouveaux sulfamides substituées et compositions herbicides les contenant. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1643313A1 true DE1643313A1 (de) | 1972-03-09 |
| DE1643313B2 DE1643313B2 (instruction) | 1974-05-30 |
| DE1643313C3 DE1643313C3 (instruction) | 1975-01-30 |
Family
ID=27561257
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19511643313 Granted DE1643313A1 (de) | 1951-01-28 | 1951-01-28 | Neue herbicid wirksame Verbindungen und Zusammensetzungen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3367949A (instruction) |
| DE (1) | DE1643313A1 (instruction) |
| FR (1) | FR1538947A (instruction) |
| GB (1) | GB1149139A (instruction) |
| NL (2) | NL6713615A (instruction) |
| OA (1) | OA02524A (instruction) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3709674A (en) * | 1967-07-26 | 1973-01-09 | Misui Ioatsu Chem Inc | Method and composition for suppressing the nitrification of ammonium nitrogen in soil |
| US3549349A (en) * | 1969-06-30 | 1970-12-22 | Lilly Co Eli | Herbicidal combinations |
| US3637366A (en) * | 1969-09-04 | 1972-01-25 | Scott & Sons Co O M | Method and composition therefor |
| US3725479A (en) * | 1970-04-20 | 1973-04-03 | Lilly Co Eli | Bis(4-amino-or 4-substituted amino-3,5-dinitrophenyl) disulfide |
| US3681406A (en) * | 1970-11-03 | 1972-08-01 | Lilly Co Eli | N-alkoxyalkylidenesulfonamide compounds |
| US3692805A (en) * | 1971-01-25 | 1972-09-19 | Shell Oil Co | Aromatic sulfonyl azides |
| US3880644A (en) * | 1971-06-28 | 1975-04-29 | Lilly Co Eli | Sulfanilamide herbicides |
| US3909235A (en) * | 1971-09-24 | 1975-09-30 | Lilly Co Eli | Substituted sulfanilyl sulfilimine compounds as herbicides |
| US4074059A (en) * | 1972-01-19 | 1978-02-14 | American Cyanamid Company | Substituted-1-phenol-4-sulfonamides |
| US3979203A (en) * | 1972-01-19 | 1976-09-07 | American Cyanamid Company | Sulfonamido herbicidal compositions and plant control methods using the same |
| US3875192A (en) * | 1972-11-13 | 1975-04-01 | Lilly Co Eli | N{40 -alkoxy sulfanilamides |
| US3971650A (en) * | 1973-06-29 | 1976-07-27 | Chevron Research Company | Herbicidal N1 -methoxycarbonyl-N1 -alkyl-3,5-dinitro-N4 -N4 -dialkylsulfanilamide |
| CA1072359A (en) * | 1974-10-08 | 1980-02-26 | Hiroyuki Konishi | Method for controlling the growth of plants |
| US3979453A (en) * | 1975-06-23 | 1976-09-07 | Eli Lilly And Company | 3-Cyanamino-2,6-dinitroanilines |
| US4041159A (en) * | 1976-02-12 | 1977-08-09 | Chevron Research Company | Nematocidal 4-amino-N-thio-substituted 3,5-dinitrobenzenesulfonamides |
| US4091096A (en) * | 1976-03-19 | 1978-05-23 | Eli Lilly And Company | Dinitroanilines for the control of phytopathogens |
| US4054603A (en) * | 1976-08-31 | 1977-10-18 | Eli Lilly And Company | 4-Amino-3,5-dinitrobenzenesulfenamides and sulfinamides |
| US4104054A (en) * | 1976-12-09 | 1978-08-01 | Eli Lilly And Company | N1 -chloro-3,5-dinitrosulfanilamides |
| US4259347A (en) * | 1978-02-16 | 1981-03-31 | Eli Lilly And Company | Control of phytopathogens using dinitroaniline compounds |
| ZA899861B (en) * | 1988-12-27 | 1990-12-28 | Monsanto Co | Compositions containing a mixture of herbicides |
| EP2052612A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037629A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2169971A (en) * | 1936-04-18 | 1939-08-15 | Winthrop Chem Co Inc | Sulphonic acid amide compounds |
| US2231021A (en) * | 1938-11-02 | 1941-02-11 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2261175A (en) * | 1939-07-01 | 1941-11-04 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2358465A (en) * | 1941-07-11 | 1944-09-19 | Eastman Kodak Co | Sulphonamide compounds |
-
0
- NL NL132336D patent/NL132336C/xx active
-
1951
- 1951-01-28 DE DE19511643313 patent/DE1643313A1/de active Granted
-
1966
- 1966-08-22 US US573829A patent/US3367949A/en not_active Expired - Lifetime
-
1967
- 1967-10-04 FR FR123269A patent/FR1538947A/fr not_active Expired
- 1967-10-06 GB GB45898/67A patent/GB1149139A/en not_active Expired
- 1967-10-06 NL NL6713615A patent/NL6713615A/xx unknown
- 1967-10-25 OA OA53088A patent/OA02524A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3367949A (en) | 1968-02-06 |
| FR1538947A (fr) | 1968-09-06 |
| DE1643313C3 (instruction) | 1975-01-30 |
| NL6713615A (instruction) | 1969-04-09 |
| OA02524A (fr) | 1970-05-05 |
| GB1149139A (en) | 1969-04-16 |
| NL132336C (instruction) | |
| DE1643313B2 (instruction) | 1974-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1643313A1 (de) | Neue herbicid wirksame Verbindungen und Zusammensetzungen | |
| EP0103537B1 (de) | N-Arylsulfonyl-N'-triazolylharnstoffe | |
| EP0036390B1 (de) | Diphenyläther-Harnstoffe mit herbizider Wirkung | |
| CH628017A5 (de) | Verfahren zur herstellung der neuen verbindung n-(4-benzyloxyphenyl)-n'-methyl-n'-methoxyharnstoff. | |
| EP0035972B1 (de) | Cyanoalkyl-Phenylharnstoffe mit selektiver herbizider Wirkung, deren Herstellung und sie enthaltende Mittel | |
| EP0071572B1 (de) | Derivate der 2-Nitro-4- oder 5-Pyridyloxy-phenylphosphonsäure, Verfahren zu ihrer Herstellung, ihre Verwendung als Herbizide und/oder Pflanzenwachstumsregulatoren und/oder Mikrobizide, sowie zur Herstellung der Derivate verwendete Zwischenprodukte, Verfahren zu deren Herstellung und deren Verwendung als Herbizide | |
| DE1909108A1 (de) | Neue Phosphorsaeure- und Thiophosphorsaeureesteramide und ihre Verwendung als selektive Herbizide | |
| DE2210540C2 (de) | Cyanphenylcarbonate, Verfahren zu deren Herstellung sowie diese enthaltende herbizide Mittel | |
| CH631721A5 (de) | Pflanzenschutzmittel. | |
| EP0022750B1 (de) | 1,3,4-Thiadiazolyloxy-phenylharnstoffe, deren Herstellung und sie enthaltende herbizide Mittel | |
| CA1111062A (en) | Diphenyl ether derivatives, process for preparing the same and herbicidal compositions containing the same | |
| DD262992A5 (de) | Nematizide und insektizide zusammensetzung | |
| DE2163381A1 (de) | Herbizide Komposition | |
| DE2850902A1 (de) | Neue phenoxy-phenoxi-propionsaeureamide und ihre verwendung als herbizide | |
| DE1955892C3 (de) | Verwendung eines Benzylthiolcarbamates als Herbizid | |
| EP0016731B1 (de) | Meta-Cyanoalkoxy-Phenylharnstoffe mit herbizider Wirkung, deren Herstellung und sie enthaltende Mittel | |
| DE2147873A1 (de) | Organophosphor-Herbizide | |
| EP0007471B1 (de) | Herbizid aktive 3,4-Dinitro-diphenyläther, ihre Herstellung, herbizide Mittel und ihre Verwendung | |
| DE2451418A1 (de) | N-alkoxy-(oder n-alkenyloxy-)-n'(alpha, alpha-dimethylbenzyl)-n-phenylharnstoffe, diese verbindungen enthaltende herbicide masse sowie deren anwendung zur bekaempfung von unkrautwachstum | |
| AT261313B (de) | Verfahren zur Bekämpfung von phytopathogenen Pilzen oder erdbewohnenden Nematoden | |
| DE3019259A1 (de) | Salze von herbiziden 1,2,4-thiadiazolyl-5-harnstoffderivaten und deren verwendung | |
| DE2152947A1 (en) | Selective herbicide for paddy fields - contg a 1-phenyl -3, 3-dimethyl-urea and a thiocarbamate | |
| CH645353A5 (de) | Carbostyrilderivate. | |
| DE2047717A1 (de) | Herbizide Mittel | |
| DE2105933A1 (instruction) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |