DE1492274C - - Google Patents
Info
- Publication number
- DE1492274C DE1492274C DE19641492274 DE1492274A DE1492274C DE 1492274 C DE1492274 C DE 1492274C DE 19641492274 DE19641492274 DE 19641492274 DE 1492274 A DE1492274 A DE 1492274A DE 1492274 C DE1492274 C DE 1492274C
- Authority
- DE
- Germany
- Prior art keywords
- group
- protective
- substances
- πΐμ
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000126 substance Substances 0.000 claims description 63
- 150000001875 compounds Chemical class 0.000 claims description 17
- 239000002537 cosmetic Substances 0.000 claims description 15
- 239000000969 carrier Substances 0.000 claims description 7
- 239000011814 protection agent Substances 0.000 claims 1
- 230000001681 protective Effects 0.000 description 51
- -1 methoxypropyl Chemical group 0.000 description 22
- 238000002360 preparation method Methods 0.000 description 21
- 239000000203 mixture Substances 0.000 description 18
- 125000000217 alkyl group Chemical group 0.000 description 13
- 239000006210 lotion Substances 0.000 description 12
- 238000010521 absorption reaction Methods 0.000 description 11
- 239000007795 chemical reaction product Substances 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- BZKBCQXYZZXSCO-UHFFFAOYSA-N sodium hydride Chemical compound [H-].[Na+] BZKBCQXYZZXSCO-UHFFFAOYSA-N 0.000 description 9
- QIQXTHQIDYTFRH-UHFFFAOYSA-N Stearic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 125000004432 carbon atoms Chemical group C* 0.000 description 7
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- OFOBLEOULBTSOW-UHFFFAOYSA-N malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 7
- 210000003491 Skin Anatomy 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 6
- 125000002091 cationic group Chemical group 0.000 description 6
- 239000006071 cream Substances 0.000 description 6
- 229960000583 Acetic Acid Drugs 0.000 description 5
- 239000004166 Lanolin Substances 0.000 description 5
- 229940039717 Lanolin Drugs 0.000 description 5
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Tris Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 235000019388 lanolin Nutrition 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000002480 mineral oil Substances 0.000 description 5
- NQRYJNQNLNOLGT-UHFFFAOYSA-N piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- FXWFZIRWWNPPOV-UHFFFAOYSA-N 2-aminobenzaldehyde Chemical class NC1=CC=CC=C1C=O FXWFZIRWWNPPOV-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 235000021355 Stearic acid Nutrition 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 150000001851 cinnamic acid derivatives Chemical class 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 239000004611 light stabiliser Substances 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000008117 stearic acid Substances 0.000 description 4
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 3
- BXWNKGSJHAJOGX-UHFFFAOYSA-N Cetyl alcohol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 3
- BGNGWHSBYQYVRX-UHFFFAOYSA-N Para-Dimethylaminobenzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 239000003899 bactericide agent Substances 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 229960000541 cetyl alcohol Drugs 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229930016911 cinnamic acid Natural products 0.000 description 3
- 235000013985 cinnamic acid Nutrition 0.000 description 3
- 230000014509 gene expression Effects 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 description 3
- 230000031700 light absorption Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 230000000475 sunscreen Effects 0.000 description 3
- 239000000516 sunscreening agent Substances 0.000 description 3
- DGPBVJWCIDNDPN-UHFFFAOYSA-N 2-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=CC=C1C=O DGPBVJWCIDNDPN-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- TUNFSRHWOTWDNC-UHFFFAOYSA-N Myristic acid Natural products CCCCCCCCCCCCCC(O)=O TUNFSRHWOTWDNC-UHFFFAOYSA-N 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N Palmitic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 235000020127 ayran Nutrition 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- BEYLVANPYLXGSR-UHFFFAOYSA-N diethyl 2-[[4-(dimethylamino)phenyl]methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=C(N(C)C)C=C1 BEYLVANPYLXGSR-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- FGKJLKRYENPLQH-UHFFFAOYSA-M isocaproate Chemical compound CC(C)CCC([O-])=O FGKJLKRYENPLQH-UHFFFAOYSA-M 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 238000005191 phase separation Methods 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-L propanedioate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 2
- 230000002633 protecting Effects 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- JOLPMPPNHIACPD-ZZXKWVIFSA-N (E)-3-(4-aminophenyl)prop-2-enoic acid Chemical compound NC1=CC=C(\C=C\C(O)=O)C=C1 JOLPMPPNHIACPD-ZZXKWVIFSA-N 0.000 description 1
- UWNADWZGEHDQAB-UHFFFAOYSA-N 2,5-Dimethylhexane Chemical group CC(C)CCC(C)C UWNADWZGEHDQAB-UHFFFAOYSA-N 0.000 description 1
- SNUJAOPSQUVSPM-UHFFFAOYSA-N 2-[[4-(dimethylamino)phenyl]methylidene]propanedioic acid Chemical compound CN(C)C1=CC=C(C=C(C(O)=O)C(O)=O)C=C1 SNUJAOPSQUVSPM-UHFFFAOYSA-N 0.000 description 1
- KXTAOXNYQGASTA-UHFFFAOYSA-L 2-benzylidenepropanedioate Chemical compound [O-]C(=O)C(C([O-])=O)=CC1=CC=CC=C1 KXTAOXNYQGASTA-UHFFFAOYSA-L 0.000 description 1
- KWNYRTDLTSGITQ-UHFFFAOYSA-N 2-methylpropyl 2-(dimethylamino)benzoate Chemical compound CC(C)COC(=O)C1=CC=CC=C1N(C)C KWNYRTDLTSGITQ-UHFFFAOYSA-N 0.000 description 1
- AFDXODALSZRGIH-UHFFFAOYSA-N 4-methoxycinnamic acid Chemical compound COC1=CC=C(C=CC(O)=O)C=C1 AFDXODALSZRGIH-UHFFFAOYSA-N 0.000 description 1
- AXISYYRBXTVTFY-UHFFFAOYSA-N Isopropyl myristate Chemical compound CCCCCCCCCCCCCC(=O)OC(C)C AXISYYRBXTVTFY-UHFFFAOYSA-N 0.000 description 1
- 229960004665 MENTHYL SALICYLATE Drugs 0.000 description 1
- 229940105132 Myristate Drugs 0.000 description 1
- 235000021360 Myristic acid Nutrition 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N Oleyl alcohol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- 206010034960 Photophobia Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- SJOXEWUZWQYCGL-DVOMOZLQSA-N [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-hydroxybenzoate Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C1=CC=CC=C1O SJOXEWUZWQYCGL-DVOMOZLQSA-N 0.000 description 1
- 230000037374 absorbed through the skin Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001476 alcoholic Effects 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000000844 anti-bacterial Effects 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- SWBJZPDGKVYSLT-UHFFFAOYSA-N bis(2-methylpropyl) propanedioate Chemical compound CC(C)COC(=O)CC(=O)OCC(C)C SWBJZPDGKVYSLT-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000000490 cosmetic additive Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 201000004624 dermatitis Diseases 0.000 description 1
- 231100000406 dermatitis Toxicity 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 230000001627 detrimental Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N ethanone Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- CDEIESVXIPSGGU-UHFFFAOYSA-N ethyl 3-(4-acetamidophenyl)prop-2-enoate Chemical compound CCOC(=O)C=CC1=CC=C(NC(C)=O)C=C1 CDEIESVXIPSGGU-UHFFFAOYSA-N 0.000 description 1
- UKFXDFUAPNAMPJ-UHFFFAOYSA-N ethylmalonic acid Chemical compound CCC(C(O)=O)C(O)=O UKFXDFUAPNAMPJ-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000002349 favourable Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 125000005842 heteroatoms Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N iso-propanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229940074928 isopropyl myristate Drugs 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000012184 mineral wax Substances 0.000 description 1
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 229940113083 morpholine Drugs 0.000 description 1
- TUNFSRHWOTWDNC-UHFFFAOYSA-M myristate Chemical compound CCCCCCCCCCCCCC([O-])=O TUNFSRHWOTWDNC-UHFFFAOYSA-M 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003472 neutralizing Effects 0.000 description 1
- 230000003000 nontoxic Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- VBICKXHEKHSIBG-UHFFFAOYSA-N rac-1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000037307 sensitive skin Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N silicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 230000037380 skin damage Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB1312463 | 1963-04-03 | ||
GB13124/63A GB1064116A (en) | 1963-04-03 | 1963-04-03 | Ultra-violet absorbing compositions |
DEA0045618 | 1964-03-28 |
Publications (2)
Publication Number | Publication Date |
---|---|
DE1492274A1 DE1492274A1 (de) | 1969-11-06 |
DE1492274C true DE1492274C (ja) | 1973-03-29 |
Family
ID=10017265
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19641492274 Granted DE1492274A1 (de) | 1963-04-03 | 1964-03-28 | Kosmetische Cremes und Lotions fuer lokale Anwendung und Verfahren zur Herstellung von neuen,als Schutzstoffe gegen ultraviolette Strahlen verwendbaren Verbindungen |
Country Status (5)
Country | Link |
---|---|
US (1) | US3390051A (ja) |
CH (1) | CH430056A (ja) |
DE (1) | DE1492274A1 (ja) |
DK (1) | DK114645B (ja) |
GB (1) | GB1064116A (ja) |
Families Citing this family (12)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3692819A (en) * | 1969-09-29 | 1972-09-19 | Ciba Geigy Corp | Tertiary aminoacids |
DE2155495A1 (de) * | 1971-11-09 | 1973-05-10 | Bayer Ag | Verfahren zur herstellung von benzylidenverbindungen |
LU65622A1 (ja) * | 1972-06-29 | 1974-01-04 | ||
DE2652034A1 (de) * | 1976-11-15 | 1978-05-24 | Basf Ag | Lichtschutzmittel |
EP0100651A1 (en) * | 1982-08-03 | 1984-02-15 | VAN DYK & COMPANY, INC. | Dialkyl malonates as organic suncreen adjuvants |
FR2540380B1 (fr) * | 1983-02-03 | 1986-02-07 | Oreal | Composition cosmetique pour la protection contre le rayonnement ultraviolet et son utilisation a cet effet |
GB8403836D0 (en) * | 1984-02-14 | 1984-03-21 | Graesser Lab | Ultra-violet absorbing compounds |
US5237089A (en) * | 1986-02-07 | 1993-08-17 | Basf Aktiengesellschaft | Nitro or amino substituted phenylalkyl or phenylalkenyl carboxylic acid derivatives |
NZ221849A (en) * | 1986-09-26 | 1990-09-26 | Ici Australia Operations | Sunscreen compositions containing tetrahydropyridines |
WO1988002251A1 (en) * | 1986-09-26 | 1988-04-07 | Ici Australia Operations Proprietary Limited | Sunscreen compositions and compounds for use therein |
FR2744721B1 (fr) | 1996-02-12 | 1999-06-18 | Oreal | Nouveaux derives insolubles de s-triazine, leur procede de preparation, compositions les contenant et leurs utilisations |
JP6861819B2 (ja) * | 2017-07-26 | 2021-04-21 | 三井化学株式会社 | 光学材料用重合性組成物、光学材料およびその用途 |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2798881A (en) * | 1954-11-12 | 1957-07-09 | Du Pont | 4-(aminoaryl)-1, 3-butadiene-2-carbonitriles and their preparation |
-
1963
- 1963-04-03 GB GB13124/63A patent/GB1064116A/en not_active Expired
-
1964
- 1964-03-28 DE DE19641492274 patent/DE1492274A1/de active Granted
- 1964-03-31 US US356159A patent/US3390051A/en not_active Expired - Lifetime
- 1964-04-03 DK DK166464AA patent/DK114645B/da unknown
- 1964-04-03 CH CH427564A patent/CH430056A/fr unknown
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP0087098B1 (de) | s-Triazinderivate und ihre Verwendung als Lichtschutzmittel | |
DE2544180C2 (de) | Lichtschutzmittel für kosmetische Zwecke | |
AT391687B (de) | Verfahren zum herstellen von neuen 3-benzyliden- campher-verbindungen | |
DE3218973C2 (ja) | ||
EP0005182B1 (de) | Lichtschutzmittel | |
DE2722725C2 (ja) | ||
DE2543099C2 (de) | 2-Phenylbenzofurane enthaltende kosmetische Sonnenschutzmittel, Verfahren zur Herstellung von 2-Phenylbenzofuranen und 2-Phenylbenzofurane als solche | |
DE1492274C (ja) | ||
DE3644633A1 (de) | Neue 3-benzyliden-kampferderivate mit einem benzimidazol-, benzoxazol- oder benzothiazolrest, verfahren zu deren herstellung und deren anwendung in der kosmetik zum schutz gegen uv-strahlen | |
DE2929101A1 (de) | Sonnenschutzzubereitungen und ihre verwendung | |
CH634986A5 (en) | Cosmetic light-stabilising agent for the UV-A region | |
CH626803A5 (ja) | ||
DE3633453A1 (de) | Zusammensetzungen auf der basis von lysin- und argininsalzen | |
DE1492274A1 (de) | Kosmetische Cremes und Lotions fuer lokale Anwendung und Verfahren zur Herstellung von neuen,als Schutzstoffe gegen ultraviolette Strahlen verwendbaren Verbindungen | |
DE2347928A1 (de) | Schutzmittel gegen aktinische strahlen und dieses enthaltende mittel | |
DE19508608A1 (de) | Lichtbeständiges kosmetisches Mittel | |
CH634987A5 (en) | Cosmetic light-stabilising agent for the UV-A region | |
DE3543496A1 (de) | 4-methoxy-2'-carboxydibenzoylmethan und dessen salze | |
DE3002304C2 (ja) | ||
EP0044975A1 (de) | Polyalkoxycarbinolzimtsäureester, Verfahren zu ihrer Herstellung und diese enthaltende Lichtschutzmittel | |
EP0207287A2 (de) | Indolinderivate, Verfahren zu ihrer Herstellung und diese Indolinderivate enthaltende kosmetische Lichtschutzmittel | |
DE2514878B2 (de) | Allantoin-ascorbinsaeure-komplexe | |
DE3028417A1 (de) | Neue veraetherte p-hydroxyzimtsaeureester, ihre herstellung und diese enthaltende zubereitungen als lichtschutzmittel | |
DE1492274B (ja) | ||
DE2925818C2 (de) | Allantoin-Urocansäure-Komplexe und deren Ammonium-Natrium- und Kaliumsalze sowie diese enthaltende kosmetische Mittel |