DE1468117C - - Google Patents
Info
- Publication number
- DE1468117C DE1468117C DE1468117C DE 1468117 C DE1468117 C DE 1468117C DE 1468117 C DE1468117 C DE 1468117C
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- percent
- oxide
- copper
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000003054 catalyst Substances 0.000 claims description 35
- XLOMVQKBTHCTTD-UHFFFAOYSA-N zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 18
- -1 keto alcohols Chemical class 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 11
- 239000011787 zinc oxide Substances 0.000 claims description 10
- 239000010949 copper Substances 0.000 claims description 9
- 238000006356 dehydrogenation reaction Methods 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 230000001603 reducing Effects 0.000 claims description 8
- 230000003197 catalytic Effects 0.000 claims description 6
- 229910000423 chromium oxide Inorganic materials 0.000 claims description 6
- 229910052802 copper Inorganic materials 0.000 claims description 6
- QPLDLSVMHZLSFG-UHFFFAOYSA-N copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims description 6
- 229910000431 copper oxide Inorganic materials 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- WGLPBDUCMAPZCE-UHFFFAOYSA-N trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 claims description 6
- 239000005751 Copper oxide Substances 0.000 claims description 5
- 238000006297 dehydration reaction Methods 0.000 claims description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 4
- YXSIKEMDQWEQTO-UHFFFAOYSA-N [O-2].[Zn+2].[Cr+3].[Cu+2] Chemical compound [O-2].[Zn+2].[Cr+3].[Cu+2] YXSIKEMDQWEQTO-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atoms Chemical group C* 0.000 claims description 3
- 150000002334 glycols Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 27
- XLSMFKSTNGKWQX-UHFFFAOYSA-N hydroxyacetone Chemical compound CC(=O)CO XLSMFKSTNGKWQX-UHFFFAOYSA-N 0.000 description 11
- 239000007789 gas Substances 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000011701 zinc Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- BMRWNKZVCUKKSR-UHFFFAOYSA-N 1,2-Butanediol Chemical compound CCC(O)CO BMRWNKZVCUKKSR-UHFFFAOYSA-N 0.000 description 3
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 3
- 230000000875 corresponding Effects 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229910052709 silver Inorganic materials 0.000 description 3
- BERDEBHAJNAUOM-UHFFFAOYSA-N Copper(I) oxide Chemical compound [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000001590 oxidative Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- GFAZHVHNLUBROE-UHFFFAOYSA-N 1-hydroxybutan-2-one Chemical compound CCC(=O)CO GFAZHVHNLUBROE-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N AI2O3 Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- YCIMNLLNPGFGHC-UHFFFAOYSA-N Catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N Trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229940112669 cuprous oxide Drugs 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- ZITKDVFRMRXIJQ-UHFFFAOYSA-N dodecane-1,2-diol Chemical compound CCCCCCCCCCC(O)CO ZITKDVFRMRXIJQ-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004858 feed analysis Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2180947B1 (de) | Hydrierkatalysator und verfahren zur herstellung von alkoholen durch hydrierung von carbonylverbindungen | |
| DE3244313C2 (de) | Zink-Chrom-Kupfer-Katalysator und dessen Verwendung für die Alkoholsynthese | |
| EP1749572B1 (de) | Verfahren zur hydrierung von oxo-aldehyden mit hohen estergehalten | |
| DE2757788C3 (de) | Verfahren zur Herstellung von Dimethyläther | |
| DE3403491A1 (de) | Katalysator zur synthese von methanol und hoehere alkohole enthaltenden alkoholgemischen | |
| WO2001087809A1 (de) | Verfahren zur herstellung von gesättigten c3-c20-alkoholen | |
| EP0394842B1 (de) | Katalysator für die Hydrierung aliphatischer ungesättigter Verbindungen | |
| DE1568542B2 (de) | Verfahren zur katalytischen Umwandlung von Butadien- und n-Buten-1 -haltigen C tief 4 - Kohlenwasserstoffen | |
| DE3524317C2 (sv) | ||
| CH636277A5 (de) | Nickel und/oder kobalt und zinkoxid enthaltender katalysator, verfahren zu dessen herstellung und seine verwendung. | |
| DE1241429B (de) | Verfahren zur Herstellung von Methanol | |
| DE2928434A1 (de) | Verfahren zur herstellung von methanol | |
| DE3007139C2 (de) | Kupferchromit-Katalysator, Verfahren zu seiner Herstellung und seine Verwendung zur Herstellung von Alkoholen aus ungesättigten Aldehyden | |
| DE1468117C (sv) | ||
| EP0482445A2 (de) | Verfahren zur Hydrierung von Acetylenalkoholen | |
| DE1468117A1 (de) | Verfahren zur Herstellung von Ketoalkoholen | |
| DE2235992C3 (de) | Verfahren zur Herstellung gesättigter aliphatischer Amine | |
| DE1144703B (de) | Verfahren zur Herstellung von Alkoholen durch katalytische Hydrierung von Estern | |
| DE19510629A1 (de) | Verfahren zur Herstellung eines Alkohols und für dieses Verfahren geeigneter Katalysatorvorläufer | |
| DE19636066A1 (de) | Verfahren zur Dehydrierung von 1,4-Butandiol zu gamma-Butyrolacton | |
| DE3913839A1 (de) | Verfahren zur hydrierung von acetylenalkoholen | |
| DE1925965C3 (de) | Verfahren zur Herstellung von Acrylsäure durch Oxydation von Propylen | |
| DE19500479A1 (de) | Hydrierung von Acetylenverbindungen | |
| DE1468117B (de) | Verfahren zur Herstellung von Ketoalkoholen | |
| DE2738269C3 (de) | Verfahren zur Herstellung von Aceton aus Isobutyraldehyd |