DE1443853B - - Google Patents
Info
- Publication number
- DE1443853B DE1443853B DE1443853B DE 1443853 B DE1443853 B DE 1443853B DE 1443853 B DE1443853 B DE 1443853B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- hydrogen peroxide
- reaction
- water
- percarboxylic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 113
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 78
- 239000002253 acid Substances 0.000 claims description 56
- 238000006243 chemical reaction Methods 0.000 claims description 54
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 53
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 51
- 238000000034 method Methods 0.000 claims description 35
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 26
- 238000004821 distillation Methods 0.000 claims description 25
- 230000008569 process Effects 0.000 claims description 24
- 150000007513 acids Chemical class 0.000 claims description 13
- 229920006395 saturated elastomer Polymers 0.000 claims description 7
- 150000001735 carboxylic acids Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 2
- 229960002163 hydrogen peroxide Drugs 0.000 description 55
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 42
- 229960000583 acetic acid Drugs 0.000 description 27
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 22
- 239000000047 product Substances 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 18
- 239000000243 solution Substances 0.000 description 15
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 14
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 13
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- 239000001301 oxygen Substances 0.000 description 11
- 150000002978 peroxides Chemical class 0.000 description 11
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 10
- 125000001931 aliphatic group Chemical group 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 9
- 239000002360 explosive Substances 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 238000010924 continuous production Methods 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- 235000019260 propionic acid Nutrition 0.000 description 7
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 6
- -1 aliphatic acid Chemical class 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 238000005755 formation reaction Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 235000011007 phosphoric acid Nutrition 0.000 description 4
- CZPZWMPYEINMCF-UHFFFAOYSA-N propaneperoxoic acid Chemical compound CCC(=O)OO CZPZWMPYEINMCF-UHFFFAOYSA-N 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 238000010923 batch production Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000006735 epoxidation reaction Methods 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 150000004965 peroxy acids Chemical class 0.000 description 3
- RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000033444 hydroxylation Effects 0.000 description 2
- 238000005805 hydroxylation reaction Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000000052 vinegar Substances 0.000 description 2
- 235000021419 vinegar Nutrition 0.000 description 2
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical compound OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- KZPGKZWAVAXZQU-UHFFFAOYSA-N acetic acid;ethaneperoxoic acid Chemical compound CC(O)=O.CC(=O)OO KZPGKZWAVAXZQU-UHFFFAOYSA-N 0.000 description 1
- FVTRDWMTAVVDCU-UHFFFAOYSA-N acetic acid;hydrogen peroxide Chemical compound OO.CC(O)=O FVTRDWMTAVVDCU-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229940023913 cation exchange resins Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- IGNDVJNROAXRKE-UHFFFAOYSA-N ethaneperoxoic acid;hydrate Chemical compound O.CC(=O)OO IGNDVJNROAXRKE-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- ICYJJTNLBFMCOZ-UHFFFAOYSA-J molybdenum(4+);disulfate Chemical compound [Mo+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ICYJJTNLBFMCOZ-UHFFFAOYSA-J 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
Family
ID=
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2519299A1 (de) * | 1975-04-30 | 1976-11-11 | Bayer Ag | Verfahren zur herstellung von perpropionsaeureloesungen |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2519299A1 (de) * | 1975-04-30 | 1976-11-11 | Bayer Ag | Verfahren zur herstellung von perpropionsaeureloesungen |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69108600T2 (de) | Verfahren zur Herstellung von e-Caprolacton. | |
| DE3017518C2 (de) | Verfahren zur Herstellung von N-Phosphonomethyl-Glycin | |
| DD232483A5 (de) | Verfahren zur reinigung von ethylenglykol | |
| EP2791125B1 (de) | HERSTELLUNG VON 5-HYDROXYMETHYLFURFURAL (HMF) AUS SACCHARIDLÖSUNGEN IN GEGENWART EINES LÖSEMITTELS MIT EINEM SIEDEPUNKT GRÖßER 60°C UND KLEINER 200°C (BEI NORMALDRUCK, KURZ LEICHTSIEDER GENANNT) | |
| DE2131753A1 (de) | Verfahren zum Umwandeln der Carboxylgruppen von Carbonsaeuren in Hydroxymethylgruppen durch Hydrogenolyse | |
| DE3442937C2 (de) | Verfahren zur kontinuierlichen Herstellung von 1,2-Pentandiol | |
| EP0443392B1 (de) | Verfahren zur Herstellung von Tetrahydrofuran und alpha-Butyrolacton | |
| DE3041673C2 (de) | Verfahren zur Herstellung von 1,4-Anhydrotetriten, 1,4-Anhydropentiten oder 1,4;3,6-Dianhydrohexiten | |
| DE1443853A1 (de) | Verfahren zur Herstellung von Persaeuren | |
| DE2461503C3 (de) | Verfahren zur Herstellung von Pinakolin | |
| DE1443853B (enExample) | ||
| DE1043316B (de) | Verfahren zur Herstellung von weitgehend reinen Loesungen von Peressig- oder Perpropionsaeure in organischen Loesungsmitteln | |
| DE3784040T2 (de) | Verfahren zur reinigung von isopropylalkohol. | |
| DE2813755C3 (de) | Verfahren zur Reinigung der Orthophosphorsäure | |
| DE2603269C3 (de) | Verfahren zur Herstellung von Cyclohexanon und methylsubstituiertem oder unsubstituiertem Phenol | |
| DE2141156A1 (de) | Verfahren zur herstellung organischer percarbonsaeureloesungen | |
| DE2013469A1 (de) | Verfahren zur Herstellung von Perestern | |
| DE3720562C2 (enExample) | ||
| DE1643158C3 (enExample) | ||
| DE2721766C2 (enExample) | ||
| DE2935910C2 (de) | Verfahren zur kontinuierlichen Herstellung von Butandiolen und/oder Butendiolen | |
| DE1064054B (de) | Verfahren zur Herstellung von Sorbinsaeure durch Umsetzung von Keten mit Crotonaldehyd | |
| EP0061057B1 (de) | Verfahren zur Herstellung von Formaldehyd | |
| EP0468320A1 (de) | Verfahren zur Herstellung von Glykolen aus Formaldehyd | |
| DE1917032A1 (de) | Verfahren zur Herstellung von Percarbonsaeureloesungen |