DE1279019B - Verfahren zur Herstellung von Organohalogensiliciumverbindungen - Google Patents
Verfahren zur Herstellung von OrganohalogensiliciumverbindungenInfo
- Publication number
- DE1279019B DE1279019B DEW43112A DEW0043112A DE1279019B DE 1279019 B DE1279019 B DE 1279019B DE W43112 A DEW43112 A DE W43112A DE W0043112 A DEW0043112 A DE W0043112A DE 1279019 B DE1279019 B DE 1279019B
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- catalysts
- organohalosilicon
- hours
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- 150000001875 compounds Chemical class 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 3
- 239000003054 catalyst Substances 0.000 claims description 29
- -1 phosphonitrile chlorides Chemical class 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000005375 organosiloxane group Chemical group 0.000 claims description 6
- 229910052698 phosphorus Inorganic materials 0.000 claims description 5
- 239000011574 phosphorus Substances 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 150000003961 organosilicon compounds Chemical class 0.000 claims description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- 150000001412 amines Chemical class 0.000 description 9
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 239000005051 trimethylchlorosilane Substances 0.000 description 7
- 238000004821 distillation Methods 0.000 description 6
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 235000013162 Cocos nucifera Nutrition 0.000 description 4
- 244000060011 Cocos nucifera Species 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 150000003377 silicon compounds Chemical class 0.000 description 4
- 150000003512 tertiary amines Chemical class 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- BGBCSHOMEDPNEI-UHFFFAOYSA-N trichloro(trimethylsilyloxy)silane Chemical compound C[Si](C)(C)O[Si](Cl)(Cl)Cl BGBCSHOMEDPNEI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- RQNKWGZXLCSXAQ-UHFFFAOYSA-N chloro-ethenyl-methyl-trimethylsilyloxysilane Chemical compound C[Si](C)(C)O[Si](C)(Cl)C=C RQNKWGZXLCSXAQ-UHFFFAOYSA-N 0.000 description 1
- RTCGUJFWSLMVSH-UHFFFAOYSA-N chloroform;silicon Chemical compound [Si].ClC(Cl)Cl RTCGUJFWSLMVSH-UHFFFAOYSA-N 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- JJRDHFIVAPVZJN-UHFFFAOYSA-N cyclotrisiloxane Chemical class O1[SiH2]O[SiH2]O[SiH2]1 JJRDHFIVAPVZJN-UHFFFAOYSA-N 0.000 description 1
- KTQYJQFGNYHXMB-UHFFFAOYSA-N dichloro(methyl)silicon Chemical compound C[Si](Cl)Cl KTQYJQFGNYHXMB-UHFFFAOYSA-N 0.000 description 1
- YLJJAVFOBDSYAN-UHFFFAOYSA-N dichloro-ethenyl-methylsilane Chemical compound C[Si](Cl)(Cl)C=C YLJJAVFOBDSYAN-UHFFFAOYSA-N 0.000 description 1
- QWRDZADJOIJTGA-UHFFFAOYSA-N dichloro-ethenyl-trimethylsilyloxysilane Chemical compound C[Si](C)(C)O[Si](Cl)(Cl)C=C QWRDZADJOIJTGA-UHFFFAOYSA-N 0.000 description 1
- FWPHTMLJYGTNJA-UHFFFAOYSA-N dichlorosilyloxy(trimethyl)silane Chemical compound C[Si](C)(C)O[SiH](Cl)Cl FWPHTMLJYGTNJA-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000005055 methyl trichlorosilane Substances 0.000 description 1
- 239000005048 methyldichlorosilane Substances 0.000 description 1
- JLUFWMXJHAVVNN-UHFFFAOYSA-N methyltrichlorosilane Chemical compound C[Si](Cl)(Cl)Cl JLUFWMXJHAVVNN-UHFFFAOYSA-N 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- GQIUQDDJKHLHTB-UHFFFAOYSA-N trichloro(ethenyl)silane Chemical compound Cl[Si](Cl)(Cl)C=C GQIUQDDJKHLHTB-UHFFFAOYSA-N 0.000 description 1
- UHUUYVZLXJHWDV-UHFFFAOYSA-N trimethyl(methylsilyloxy)silane Chemical compound C[SiH2]O[Si](C)(C)C UHUUYVZLXJHWDV-UHFFFAOYSA-N 0.000 description 1
- 239000005050 vinyl trichlorosilane Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/12—Organo silicon halides
- C07F7/121—Preparation or treatment not provided for in C07F7/14, C07F7/16 or C07F7/20
- C07F7/125—Preparation or treatment not provided for in C07F7/14, C07F7/16 or C07F7/20 by reactions involving both Si-C and Si-halogen linkages, the Si-C and Si-halogen linkages can be to the same or to different Si atoms, e.g. redistribution reactions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Catalysts (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEW43112A DE1279019B (de) | 1967-01-04 | 1967-01-04 | Verfahren zur Herstellung von Organohalogensiliciumverbindungen |
| AT1162367A AT275554B (de) | 1967-01-04 | 1967-12-22 | Verfahren zur Herstellung von Organohalogensilicium-Verbindungen |
| BE708800D BE708800A (enExample) | 1967-01-04 | 1967-12-29 | |
| NL6717832A NL6717832A (enExample) | 1967-01-04 | 1967-12-29 | |
| GB50/68A GB1195761A (en) | 1967-01-04 | 1968-01-01 | Process for the Manufacture of Organohalogenosilicon Compounds |
| US694826A US3549680A (en) | 1967-01-04 | 1968-01-02 | Method of preparing organo-halogenosilicon compounds |
| FR1567146D FR1567146A (enExample) | 1967-01-04 | 1968-01-03 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEW43112A DE1279019B (de) | 1967-01-04 | 1967-01-04 | Verfahren zur Herstellung von Organohalogensiliciumverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1279019B true DE1279019B (de) | 1968-10-03 |
Family
ID=7603526
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEW43112A Pending DE1279019B (de) | 1967-01-04 | 1967-01-04 | Verfahren zur Herstellung von Organohalogensiliciumverbindungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3549680A (enExample) |
| AT (1) | AT275554B (enExample) |
| BE (1) | BE708800A (enExample) |
| DE (1) | DE1279019B (enExample) |
| FR (1) | FR1567146A (enExample) |
| GB (1) | GB1195761A (enExample) |
| NL (1) | NL6717832A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4323185C1 (de) * | 1993-07-10 | 1995-01-19 | Nuenchritz Chemie Gmbh | Verfahren zur Herstellung von Polyorganosiloxanen |
| DE4446515C1 (de) * | 1994-12-24 | 1996-05-02 | Huels Silicone Gmbh | Durch Chlorphosphazene substituierte Phosphate, Silylphosphate bzw. deren Polyphosphate, deren Herstellung sowie ihre Verwendung |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2119143A5 (enExample) * | 1970-12-22 | 1972-08-04 | Rhone Poulenc Sa | |
| DE3306295A1 (de) * | 1983-02-23 | 1984-08-23 | Wacker-Chemie GmbH, 8000 München | Verfahren zum stabilisieren von organopolysiloxanen |
| DE3742068A1 (de) * | 1987-12-11 | 1989-06-22 | Wacker Chemie Gmbh | Verfahren zur herstellung von in den endstaendigen einheiten je eine si-gebundene hydroxylgruppe aufweisenden diorganopolysiloxanen |
| DE3742069A1 (de) * | 1987-12-11 | 1989-06-22 | Wacker Chemie Gmbh | Verfahren zur herstellung von diorganopolysiloxanen mit triorganosiloxygruppen als endstaendigen einheiten |
| US4782172A (en) * | 1987-12-28 | 1988-11-01 | Dow Corning Corporation | Removal of polyfunctional silanes from organosilanes |
| DE3918337A1 (de) * | 1989-06-05 | 1990-12-06 | Wacker Chemie Gmbh | Verfahren zur herstellung von organosiloxanen |
| JP2851131B2 (ja) * | 1990-06-13 | 1999-01-27 | 信越化学工業株式会社 | モノハロゲノシランの製造方法 |
| US5068383A (en) * | 1990-11-09 | 1991-11-26 | Dow Corning Corporation | Catalyzed redistribution of polyorganosiloxanes |
| GB9103666D0 (en) * | 1991-02-21 | 1991-04-10 | Dow Corning Sa | Method of making organopolysiloxanes |
| GB9103656D0 (en) * | 1991-02-21 | 1991-04-10 | Dow Corning Sa | Catalyst for polymerisation |
| GB9727136D0 (en) * | 1997-12-24 | 1998-02-25 | Dow Corning | Catalyst composition |
| GB9827069D0 (en) | 1998-12-09 | 1999-02-03 | Dow Corning | Polymerisation catalyst |
| JP3915881B2 (ja) * | 2001-03-14 | 2007-05-16 | 信越化学工業株式会社 | 分岐状低分子シロキサンの製造方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL124484C (enExample) * | 1964-05-20 | |||
| US3296197A (en) * | 1964-12-28 | 1967-01-03 | Gen Electric | Organopolysiloxane compositions |
| US3466314A (en) * | 1966-01-03 | 1969-09-09 | Monsanto Co | Silicon compounds |
| US3432488A (en) * | 1966-09-09 | 1969-03-11 | Gen Electric | Soluble silylated cellulose and method of preparing same |
| US3452072A (en) * | 1966-12-29 | 1969-06-24 | Gen Electric | Bicyclic organosilicon compounds with alkylene linkage |
-
1967
- 1967-01-04 DE DEW43112A patent/DE1279019B/de active Pending
- 1967-12-22 AT AT1162367A patent/AT275554B/de active
- 1967-12-29 NL NL6717832A patent/NL6717832A/xx unknown
- 1967-12-29 BE BE708800D patent/BE708800A/xx unknown
-
1968
- 1968-01-01 GB GB50/68A patent/GB1195761A/en not_active Expired
- 1968-01-02 US US694826A patent/US3549680A/en not_active Expired - Lifetime
- 1968-01-03 FR FR1567146D patent/FR1567146A/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4323185C1 (de) * | 1993-07-10 | 1995-01-19 | Nuenchritz Chemie Gmbh | Verfahren zur Herstellung von Polyorganosiloxanen |
| DE4446515C1 (de) * | 1994-12-24 | 1996-05-02 | Huels Silicone Gmbh | Durch Chlorphosphazene substituierte Phosphate, Silylphosphate bzw. deren Polyphosphate, deren Herstellung sowie ihre Verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1567146A (enExample) | 1969-05-16 |
| AT275554B (de) | 1969-10-27 |
| GB1195761A (en) | 1970-06-24 |
| BE708800A (enExample) | 1968-07-01 |
| US3549680A (en) | 1970-12-22 |
| NL6717832A (enExample) | 1968-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1279019B (de) | Verfahren zur Herstellung von Organohalogensiliciumverbindungen | |
| EP0011714B1 (de) | Verfahren zum Anlagern von Si-H-Verbindungen an aliphatische Mehrfachbindung | |
| EP0208285B1 (de) | Verfahren zur Herstellung von linearen Organopolysiloxanen mit Triorganosiloxygruppen als endständige Einheiten | |
| DE3742069A1 (de) | Verfahren zur herstellung von diorganopolysiloxanen mit triorganosiloxygruppen als endstaendigen einheiten | |
| DE2849092A1 (de) | Silylphosphate und verfahren zu deren herstellung | |
| DE3428581A1 (de) | Verfahren zum stabilisieren von organopolysiloxanen | |
| EP0626414B1 (de) | Organosiliciumreste aufweisende Phosphazene, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2524041A1 (de) | Verfahren zum stabilisieren von organopolysiloxanen | |
| EP0305737A2 (de) | Verfahren zum Kondensieren und/oder Äquilibrieren von Organo-(poly)siloxanen | |
| DE2643467C3 (de) | Verfahren zur Erhöhung des Molekulargewichts eines Organosiloxane mit an Silicium gebundenen Hydroxylgruppen | |
| DE1203773B (de) | Verfahren zur Herstellung von tertiaeren Phosphinen | |
| DE3303707C2 (enExample) | ||
| DE2263819A1 (de) | Alpha-alkoxy-omega-siloxanole und verfahren zu irer herstellung | |
| DE1193504B (de) | Verfahren zur Herstellung von Polysiloxanen mit endstaendigen Diketongruppen | |
| EP0005787B1 (de) | Verfahren zur Herstellung von SiC-gebundene Vinylgruppen enthaltenden Organopolysiloxanharzen | |
| DE3742068A1 (de) | Verfahren zur herstellung von in den endstaendigen einheiten je eine si-gebundene hydroxylgruppe aufweisenden diorganopolysiloxanen | |
| DE1668605A1 (de) | Verfahren zur Herstellung von siliciumhaltigen Alkoholen | |
| DE1595239B2 (de) | Verfahren zur herstellung von linearen organopolysiloxanen | |
| DE1645651A1 (de) | Verfahren zur Herstellung von Polysilarylensiloxanen | |
| DE3504185A1 (de) | Verfahren zur erhoehung des molekulargewichts von diorgano(poly)-siloxan | |
| DE1720684A1 (de) | Verfahren zur Herstellung von sekundaeren Aminoalkoholen abgeleiteter Aminoalkoxypolysiloxane | |
| DE1620933A1 (de) | Verfahren zur Herstellung von mit Trimethylsilylgruppen endblockierten Methylphenylsilikonoelen | |
| DE1056836B (de) | Verfahren zur Herstellung von fluorhaltigen Organopolysiloxanen | |
| DE954877C (de) | Verfahren zur Herstellung von Organosiliciumestern | |
| DE2135674A1 (de) | Verfahren zur herstellung von tris(trimethylsiloxy)-phenylsilan |