DE1235304B - Verfahren zur Herstellung neuer Phenylcyclohexylalkylamine bzw. ihrer Salze - Google Patents
Verfahren zur Herstellung neuer Phenylcyclohexylalkylamine bzw. ihrer SalzeInfo
- Publication number
- DE1235304B DE1235304B DEB70885A DEB0070885A DE1235304B DE 1235304 B DE1235304 B DE 1235304B DE B70885 A DEB70885 A DE B70885A DE B0070885 A DEB0070885 A DE B0070885A DE 1235304 B DE1235304 B DE 1235304B
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- hydrogen
- amines
- phenylcyclohexane
- ether
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 150000003839 salts Chemical class 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- -1 methylenedioxy Chemical group 0.000 claims description 40
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 19
- 150000001412 amines Chemical class 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 239000012279 sodium borohydride Substances 0.000 claims description 8
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 239000012433 hydrogen halide Substances 0.000 claims description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 4
- 229910052987 metal hydride Inorganic materials 0.000 claims description 4
- 150000004681 metal hydrides Chemical class 0.000 claims description 4
- QCCDLTOVEPVEJK-UHFFFAOYSA-N phenylacetone Chemical class CC(=O)CC1=CC=CC=C1 QCCDLTOVEPVEJK-UHFFFAOYSA-N 0.000 claims description 4
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 claims description 3
- 150000003857 carboxamides Chemical class 0.000 claims description 3
- 150000002440 hydroxy compounds Chemical class 0.000 claims description 3
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 claims description 3
- 229910001023 sodium amalgam Inorganic materials 0.000 claims description 3
- 241000251730 Chondrichthyes Species 0.000 claims description 2
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 72
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 16
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 16
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 16
- 239000002585 base Substances 0.000 description 15
- IFFPICMESYHZPQ-UHFFFAOYSA-N Prenylamine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)CCNC(C)CC1=CC=CC=C1 IFFPICMESYHZPQ-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000000155 melt Substances 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 8
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 239000011976 maleic acid Substances 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- UMYZWICEDUEWIM-UHFFFAOYSA-N 1-(3,4-dimethoxyphenyl)propan-2-one Chemical compound COC1=CC=C(CC(C)=O)C=C1OC UMYZWICEDUEWIM-UHFFFAOYSA-N 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 4
- 125000001033 ether group Chemical group 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003218 coronary vasodilator agent Substances 0.000 description 3
- BLEBFDYUDVZRFG-UHFFFAOYSA-N dichloromethane;propan-2-ol Chemical compound ClCCl.CC(C)O BLEBFDYUDVZRFG-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- NNFOTEQKNPUXGR-UHFFFAOYSA-N 1-(4-phenylmethoxyphenyl)propan-2-one Chemical compound C1=CC(CC(=O)C)=CC=C1OCC1=CC=CC=C1 NNFOTEQKNPUXGR-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000021736 acetylation Effects 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 210000003141 lower extremity Anatomy 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 229940124549 vasodilator Drugs 0.000 description 2
- 239000003071 vasodilator agent Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- GRDPPSMNRDZCGL-ODZAUARKSA-N (z)-but-2-enedioic acid;propan-2-ol Chemical compound CC(C)O.OC(=O)\C=C/C(O)=O GRDPPSMNRDZCGL-ODZAUARKSA-N 0.000 description 1
- NVYOCAOZCSNIHR-UHFFFAOYSA-N 2-bromopropylbenzene Chemical compound CC(Br)CC1=CC=CC=C1 NVYOCAOZCSNIHR-UHFFFAOYSA-N 0.000 description 1
- XIYKRJLTYKUWAM-UHFFFAOYSA-N 3,4-methylenedioxyphenylpropan-2-one Chemical compound CC(=O)CC1=CC=C2OCOC2=C1 XIYKRJLTYKUWAM-UHFFFAOYSA-N 0.000 description 1
- PIZQYPJBCGDOKL-UHFFFAOYSA-N 3-(1-phenylcyclohexyl)propanamide Chemical compound C=1C=CC=CC=1C1(CCC(=O)N)CCCCC1 PIZQYPJBCGDOKL-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- IGARGHRYKHJQSM-UHFFFAOYSA-N cyclohexylbenzene Chemical compound C1CCCCC1C1=CC=CC=C1 IGARGHRYKHJQSM-UHFFFAOYSA-N 0.000 description 1
- ZWWCURLKEXEFQT-UHFFFAOYSA-N dinitrogen pentoxide Inorganic materials [O-][N+](=O)O[N+]([O-])=O ZWWCURLKEXEFQT-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- TYCLZWSARRVFGY-UHFFFAOYSA-N n-propan-2-yl-1,3-benzodioxol-5-amine Chemical compound CC(C)NC1=CC=C2OCOC2=C1 TYCLZWSARRVFGY-UHFFFAOYSA-N 0.000 description 1
- FRCFWPVMFJMNDP-UHFFFAOYSA-N n-propan-2-ylaniline Chemical compound CC(C)NC1=CC=CC=C1 FRCFWPVMFJMNDP-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL129621D NL129621C (enEXAMPLES) | 1963-02-26 | ||
| DEB70885A DE1235304B (de) | 1963-02-26 | 1963-02-26 | Verfahren zur Herstellung neuer Phenylcyclohexylalkylamine bzw. ihrer Salze |
| DK93765A DK108857C (da) | 1963-02-26 | 1964-02-12 | Fremgangsmåde til fremstilling af phenylcyclohexylalkylaminer eller syreadditionssalte deraf. |
| DK93665A DK108856C (da) | 1963-02-26 | 1964-02-12 | Fremgangsmåde til fremstilling af phenylcyclohexylalkylaminer eller syreadditionssalte deraf. |
| DK68264A DK119309B (da) | 1963-02-26 | 1964-02-12 | Analogifremgangsmåde til fremstilling af phenylcyclohexylalkylaminer eller syreadditionssalte deraf. |
| CH1453966A CH455757A (de) | 1963-02-26 | 1964-02-24 | Verfahren zur Herstellung neuer Phenyl-cyclohexylalkylamine |
| CH217864A CH443277A (de) | 1963-02-26 | 1964-02-24 | Verfahren zur Herstellung neuer Phenylcyclohexylalkamine |
| LU45512A LU45512A1 (enEXAMPLES) | 1963-02-26 | 1964-02-24 | |
| AT330965A AT246126B (de) | 1963-02-26 | 1964-02-25 | Verfahren zur Herstellung neuer Phenyl-cyclohexylalkylamine und ihrer Salze |
| AT330865A AT246125B (de) | 1963-02-26 | 1964-02-25 | Verfahren zur Herstellung neuer Phenyl-cyclohexylalkylamine und ihrer Salze |
| AT162164A AT245563B (de) | 1963-02-26 | 1964-02-25 | Verfahren zur Herstellung neuer Phenyl-cyclohexylalkylamine und ihrer Salze |
| GB780964A GB1004659A (en) | 1963-02-26 | 1964-02-25 | New phenyl-cyclohexyl-alkylamines |
| NL6401755A NL6401755A (enEXAMPLES) | 1963-02-26 | 1964-02-25 | |
| BE644354D BE644354A (enEXAMPLES) | 1963-02-26 | 1964-02-26 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB70885A DE1235304B (de) | 1963-02-26 | 1963-02-26 | Verfahren zur Herstellung neuer Phenylcyclohexylalkylamine bzw. ihrer Salze |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1235304B true DE1235304B (de) | 1967-03-02 |
Family
ID=6976817
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB70885A Pending DE1235304B (de) | 1963-02-26 | 1963-02-26 | Verfahren zur Herstellung neuer Phenylcyclohexylalkylamine bzw. ihrer Salze |
Country Status (8)
| Country | Link |
|---|---|
| AT (3) | AT245563B (enEXAMPLES) |
| BE (1) | BE644354A (enEXAMPLES) |
| CH (2) | CH443277A (enEXAMPLES) |
| DE (1) | DE1235304B (enEXAMPLES) |
| DK (3) | DK119309B (enEXAMPLES) |
| GB (1) | GB1004659A (enEXAMPLES) |
| LU (1) | LU45512A1 (enEXAMPLES) |
| NL (2) | NL6401755A (enEXAMPLES) |
-
0
- NL NL129621D patent/NL129621C/xx active
-
1963
- 1963-02-26 DE DEB70885A patent/DE1235304B/de active Pending
-
1964
- 1964-02-12 DK DK68264A patent/DK119309B/da unknown
- 1964-02-12 DK DK93765A patent/DK108857C/da active
- 1964-02-12 DK DK93665A patent/DK108856C/da active
- 1964-02-24 CH CH217864A patent/CH443277A/de unknown
- 1964-02-24 LU LU45512A patent/LU45512A1/xx unknown
- 1964-02-24 CH CH1453966A patent/CH455757A/de unknown
- 1964-02-25 AT AT162164A patent/AT245563B/de active
- 1964-02-25 AT AT330865A patent/AT246125B/de active
- 1964-02-25 NL NL6401755A patent/NL6401755A/xx unknown
- 1964-02-25 AT AT330965A patent/AT246126B/de active
- 1964-02-25 GB GB780964A patent/GB1004659A/en not_active Expired
- 1964-02-26 BE BE644354D patent/BE644354A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| BE644354A (enEXAMPLES) | 1964-08-26 |
| AT246126B (de) | 1966-04-12 |
| NL6401755A (enEXAMPLES) | 1964-08-27 |
| DK108856C (da) | 1968-02-19 |
| AT245563B (de) | 1966-03-10 |
| GB1004659A (en) | 1965-09-15 |
| DK108857C (da) | 1968-02-19 |
| CH443277A (de) | 1967-09-15 |
| CH455757A (de) | 1968-05-15 |
| AT246125B (de) | 1966-04-12 |
| NL129621C (enEXAMPLES) | |
| DK119309B (da) | 1970-12-14 |
| LU45512A1 (enEXAMPLES) | 1964-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0110372B1 (de) | 1-Phenylisochinolinderivate und Verfahren zu ihrer Herstellung, diese Verbindung enthaltende pharmazeutische Präparate und deren Anwendung | |
| EP0253327B1 (de) | Neue Diphenylpropylamin-Derivate, ihre Herstellung sowie ihre pharmazeutische Verwendung | |
| DE2411382A1 (de) | Neue 2-tetrahydrofurfuryl-6,7-benzomorphane, deren saeureadditionssalze, ihre verwendung als arzneimittel und verfahren zu deren herstellung | |
| DE2060816C3 (de) | 4-Phenylpiperidinderivate Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen enthaltend diese Verbindungen | |
| DE2413102C3 (de) | Verfahren zur Herstellung von l-(3,5-Dihydroxyphenyl)-t-hydroxy-2- eckige Klammer auf 1-methyl-2-(4-hydroxyphenyl)- äthyl] -aminoäthan | |
| DE2115926B2 (de) | 1-(4-hydroxy-3-dimethylaminosulfamidophenyl)-2-aminoaethanderivate, verfahren zu ihrer herstellung und diese enthaltende mittel | |
| CH644580A5 (de) | Cyclohexen-derivate. | |
| DE1793383C3 (de) | 4-Cyan-4-phenyl-aminocyclohexane und deren wasserlösliche Salze, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE1545714A1 (de) | Neue N-Aralkyl-piperidyl-1,3-dioxolane und Verfahren zur Herstellung derselben | |
| DE2724478C2 (de) | 5,11-Dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-on-derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| CH638184A5 (de) | Verfahren zur herstellung neuer phenylazacycloalkane. | |
| CH624104A5 (enEXAMPLES) | ||
| DE1235304B (de) | Verfahren zur Herstellung neuer Phenylcyclohexylalkylamine bzw. ihrer Salze | |
| DE2061864B2 (de) | Acylderivate von substituierten Bis-Arylalkylaminen | |
| DE2810482C2 (de) | 1-Phenyl-2- eckige Klammer auf (N-alkyl)-amino eckige Klammer zu -propan-1,3-diole, Verfahren zur Herstellung derselben und solche enthaltende Arzneimittel | |
| DE1177633B (de) | Verfahren zur Herstellung aminoalkylierter 9,10-Dihydroanthracene | |
| DE1110160B (de) | Verfahren zur Herstellung analeptisch wirksamer N-substituierter Aminonorcamphanderivate bzw. von deren Saeureadditionssalzen und quaternaeren Ammoniumverbindungen | |
| DE2304414A1 (de) | Aminopropanderivate und verfahren zu ihrer herstellung | |
| DE2150977C3 (de) | Thienyl-aryl-propyl(3)-1 -phenyl-1 hydroxy-propyl(2)-amine, Verfahren zu ihrer Herstellung und deren Verwendung bei der Bekämpfung von Durchblutungsstörungen | |
| DE2639291A1 (de) | Neue aryl-alkylamine | |
| DE1133395B (de) | Verfahren zur Herstellung von herz- und kreislaufwirksamen Phenylalkylaminen | |
| EP0082266A1 (de) | Substituierte 1,5-Diaminopentane, ihre Herstellung und diese enthaltende Arzneimittel | |
| DE1243181B (de) | Verfahren zur Herstellung neuer Phenylcyclohexylalkylamine bzw. ihrer Salze | |
| AT359501B (de) | Verfahren zur herstellung von neuen phenyl- aethylaminen und ihren physiologisch ver- traeglichen saeureadditionssalzen | |
| DE1493522C (de) | Verfahren zur Herstellung von Diphenyl propylaminderivaten |