DE1190027B - Farbfernsehkamera - Google Patents
FarbfernsehkameraInfo
- Publication number
- DE1190027B DE1190027B DER32952A DER0032952A DE1190027B DE 1190027 B DE1190027 B DE 1190027B DE R32952 A DER32952 A DE R32952A DE R0032952 A DER0032952 A DE R0032952A DE 1190027 B DE1190027 B DE 1190027B
- Authority
- DE
- Germany
- Prior art keywords
- color
- luminance signal
- tube
- gamma
- television camera
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000012937 correction Methods 0.000 claims description 21
- 230000003595 spectral effect Effects 0.000 claims description 6
- 230000001953 sensory effect Effects 0.000 claims 1
- 239000003086 colorant Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 4
- 230000005540 biological transmission Effects 0.000 description 3
- 125000001475 halogen functional group Chemical group 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 239000000969 carrier Substances 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000003446 memory effect Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000010363 phase shift Effects 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- VVNRQZDDMYBBJY-UHFFFAOYSA-M sodium 1-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalen-2-olate Chemical compound [Na+].C1=CC=CC2=C(S([O-])(=O)=O)C(N=NC3=C4C=CC=CC4=CC=C3O)=CC=C21 VVNRQZDDMYBBJY-UHFFFAOYSA-M 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 230000004304 visual acuity Effects 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N23/00—Cameras or camera modules comprising electronic image sensors; Control thereof
- H04N23/10—Cameras or camera modules comprising electronic image sensors; Control thereof for generating image signals from different wavelengths
- H04N23/13—Cameras or camera modules comprising electronic image sensors; Control thereof for generating image signals from different wavelengths with multiple sensors
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Processing Of Color Television Signals (AREA)
- Color Television Image Signal Generators (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US119871A US3196205A (en) | 1961-06-27 | 1961-06-27 | Color television camera system |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1190027B true DE1190027B (de) | 1965-04-01 |
Family
ID=22386898
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DER32952A Pending DE1190027B (de) | 1961-06-27 | 1962-06-19 | Farbfernsehkamera |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3196205A (enExample) |
| DE (1) | DE1190027B (enExample) |
| GB (1) | GB974140A (enExample) |
| NL (1) | NL280164A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2522342A1 (de) * | 1975-05-20 | 1976-12-02 | Siemens Ag | Farbfernsehkamera |
| DE2847858A1 (de) * | 1977-11-04 | 1979-05-10 | Ampex | Hybrid-farbfernsehkamera |
| DE202007019236U1 (de) | 2007-11-02 | 2011-11-09 | Valentina Anzupowa | Farbteiler-Bildwandler-Gruppe mit teildurchlässigen Spiegeln und Mosaikfarbfiltern |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1290178B (de) * | 1961-09-28 | 1969-03-06 | Aga Ab | Farbfernseh-Aufnahmeeinrichtung zur Erzielung eines moeglichst wenig sichtbaren Rauschens |
| US3272916A (en) * | 1962-05-16 | 1966-09-13 | Emi Ltd | Color television systems utilizing a true luminance signal |
| US3284566A (en) * | 1962-07-16 | 1966-11-08 | Emi Ltd | Colour television camera arrangements |
| NL295794A (enExample) * | 1962-07-25 | |||
| GB1057253A (en) * | 1962-11-09 | 1967-02-01 | Emi Ltd | Improvements relating to television camera arrangements |
| US3281528A (en) * | 1962-11-09 | 1966-10-25 | Emi Ltd | Colour television system including means for separately deriving the luminance component |
| US3283067A (en) * | 1964-04-03 | 1966-11-01 | Rca Corp | Signal processing apparatus for color systems utilizing separate luminance signal pickup |
| US3381084A (en) * | 1964-06-01 | 1968-04-30 | Mannie Feigenbaum | Color television camera optical system |
| GB1170452A (en) * | 1966-02-04 | 1969-11-12 | Electrical & Musical Ind Ltd | Improvements relating to Camera Television Systems |
| NL6812375A (enExample) * | 1967-08-31 | 1969-03-04 | ||
| US3573353A (en) * | 1967-12-18 | 1971-04-06 | Technical Operations Inc | Optical detection system and method with spatial filtering |
| US3585281A (en) * | 1967-12-22 | 1971-06-15 | Printing Dev Inc | Apparatus for optically resolving the light derived from the scanning of a tonal image into color components |
| US3729580A (en) * | 1972-04-18 | 1973-04-24 | Fernseh Gmbh | Television camera system |
| US3787610A (en) * | 1972-07-10 | 1974-01-22 | Gte Sylvania Inc | Signal transducer incorporating a multi-channel photomultiplier tube |
| US4499494A (en) * | 1982-09-27 | 1985-02-12 | Rca Corporation | Television gamma corrector with symmetrical response about black-level |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2641643A (en) * | 1950-12-01 | 1953-06-09 | Rca Corp | Color television camera |
| US2750439A (en) * | 1950-06-30 | 1956-06-12 | Rca Corp | Color television transmitter |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2672072A (en) * | 1951-03-15 | 1954-03-16 | Rca Corp | Color television optical system |
| US2858362A (en) * | 1952-03-12 | 1958-10-28 | Alda V Bedford | Color television signal generating apparatus |
-
0
- NL NL280164D patent/NL280164A/xx unknown
-
1961
- 1961-06-27 US US119871A patent/US3196205A/en not_active Expired - Lifetime
-
1962
- 1962-06-07 GB GB22119/62A patent/GB974140A/en not_active Expired
- 1962-06-19 DE DER32952A patent/DE1190027B/de active Pending
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2750439A (en) * | 1950-06-30 | 1956-06-12 | Rca Corp | Color television transmitter |
| US2641643A (en) * | 1950-12-01 | 1953-06-09 | Rca Corp | Color television camera |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2522342A1 (de) * | 1975-05-20 | 1976-12-02 | Siemens Ag | Farbfernsehkamera |
| DE2847858A1 (de) * | 1977-11-04 | 1979-05-10 | Ampex | Hybrid-farbfernsehkamera |
| DE202007019236U1 (de) | 2007-11-02 | 2011-11-09 | Valentina Anzupowa | Farbteiler-Bildwandler-Gruppe mit teildurchlässigen Spiegeln und Mosaikfarbfiltern |
Also Published As
| Publication number | Publication date |
|---|---|
| US3196205A (en) | 1965-07-20 |
| NL280164A (enExample) | |
| GB974140A (en) | 1964-11-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3629403C2 (de) | Verfahren zur Korrektur der Farbsättigung bei der elektronischen Bildverarbeitung | |
| DE1190027B (de) | Farbfernsehkamera | |
| DE1916690C3 (de) | Farbcodiermatrix | |
| DE2847858A1 (de) | Hybrid-farbfernsehkamera | |
| DE1269157B (de) | Faksimile-Verfahren zur Herstellung eines Wiedergabebildes eines Halbtonoriginals | |
| DE2419804C3 (de) | Farbwertreglerschaltung für einen Farbfernsehempfänger | |
| DE844921C (de) | Anordnung zur farbigen Fernsehuebertragung | |
| DE1597771C3 (de) | Verfahren zur Herstellung von korrigierten Farbauszugssignalen und Farbauszügen | |
| DE2018149A1 (de) | Farbfernsehkamerasystem | |
| DE2237784A1 (de) | Schaltungsanordnung zur veraenderung der farbart | |
| DE3220933C2 (de) | Farbfernsehwiedergabeanordnung mit einer Anzahl Bildwiedergaberöhren | |
| DE2248621A1 (de) | Verfahren und vorrichtung zur aenderung der farbtemperatur | |
| DE1268182B (de) | Faksimile-Verfahren zur Herstellung einer vielfarbigen Wiedergabe eines Halbtonoriginals | |
| EP0019735B1 (de) | Verfahren und Schaltung zur Kontrastkorrektur von Farbfernsehsignalen | |
| DE964065C (de) | Verfahren zur UEbertragung und Wiedergabe farbiger Fernsehbilder | |
| DE947082C (de) | Farbfernsehempfaenger | |
| DE1462784A1 (de) | Farbfernsehsystem | |
| DE2703552B2 (de) | Schaltungsanordnung zur Verbesserung der Bildgüte in Farbfernsehempfängern | |
| DE3149476A1 (de) | Bildanzeigeanordnung und diese verwendende bildanzeigesysteme | |
| DE1254182B (de) | Farbfernsehkamera | |
| DE1267705B (de) | Vorrichtung zur Gamma-Korrektion fuer Dreifarben-Fernsehen | |
| DE2122701C3 (de) | Matrix-Schaltung für einen Farbfernsehempfänger | |
| DE2515479C3 (de) | Verfahren zur T-Korrektur von Videosignalen | |
| DE3224131C2 (enExample) | ||
| DE2415173C3 (de) | Verfahren und Einrichtung zur farbigen Miedergabe von Schwarz-Wett-Bildern fiber Farbfernsehbildröhren |