DE1073039B - Schaltungsanordnung zum Darstellen insbesondere einer negativen Impedanz mittels Transistoren - Google Patents
Schaltungsanordnung zum Darstellen insbesondere einer negativen Impedanz mittels TransistorenInfo
- Publication number
- DE1073039B DE1073039B DENDAT1073039D DE1073039DA DE1073039B DE 1073039 B DE1073039 B DE 1073039B DE NDAT1073039 D DENDAT1073039 D DE NDAT1073039D DE 1073039D A DE1073039D A DE 1073039DA DE 1073039 B DE1073039 B DE 1073039B
- Authority
- DE
- Germany
- Prior art keywords
- impedance
- impedances
- terminals
- group
- arrangement according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000003321 amplification Effects 0.000 claims description 3
- 238000003199 nucleic acid amplification method Methods 0.000 claims description 3
- 230000004048 modification Effects 0.000 claims 4
- 238000012986 modification Methods 0.000 claims 4
- 239000003990 capacitor Substances 0.000 description 9
- 238000004804 winding Methods 0.000 description 5
- PCLIRWBVOVZTOK-UHFFFAOYSA-M 2-(1-methylpyrrolidin-1-ium-1-yl)ethyl 2-hydroxy-2,2-diphenylacetate;iodide Chemical compound [I-].C=1C=CC=CC=1C(O)(C=1C=CC=CC=1)C(=O)OCC[N+]1(C)CCCC1 PCLIRWBVOVZTOK-UHFFFAOYSA-M 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 238000013016 damping Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 238000013459 approach Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 108010038132 serratiopeptidase Proteins 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04B—TRANSMISSION
- H04B3/00—Line transmission systems
- H04B3/02—Details
- H04B3/04—Control of transmission; Equalising
- H04B3/16—Control of transmission; Equalising characterised by the negative-impedance network used
- H04B3/18—Control of transmission; Equalising characterised by the negative-impedance network used wherein the network comprises semiconductor devices
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03H—IMPEDANCE NETWORKS, e.g. RESONANT CIRCUITS; RESONATORS
- H03H11/00—Networks using active elements
- H03H11/02—Multiple-port networks
- H03H11/40—Impedance converters
Landscapes
- Engineering & Computer Science (AREA)
- Computer Networks & Wireless Communication (AREA)
- Signal Processing (AREA)
- Amplifiers (AREA)
- Networks Using Active Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL353041X | 1955-10-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1073039B true DE1073039B (de) | 1960-01-14 |
Family
ID=19785113
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1073039D Pending DE1073039B (de) | 1955-10-14 | Schaltungsanordnung zum Darstellen insbesondere einer negativen Impedanz mittels Transistoren |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2904758A (enExample) |
| BE (1) | BE551746A (enExample) |
| CH (1) | CH353041A (enExample) |
| DE (1) | DE1073039B (enExample) |
| FR (1) | FR1160405A (enExample) |
| GB (1) | GB845281A (enExample) |
| NL (2) | NL201234A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1288158B (de) * | 1964-01-24 | 1969-01-30 | Int Standard Electric Corp | Haltestromkreis fuer in Reihe geschaltete elektrische Koppelelemente eines mehrstufigen endmarkierten Koppelnetzes in Fernmelde-, insbesondere Fernsprechvermittlungsanlagen |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL224544A (enExample) * | 1957-04-23 | |||
| US3025415A (en) * | 1958-03-24 | 1962-03-13 | Ibm | Bistable transistor circuit |
| US2957091A (en) * | 1958-04-09 | 1960-10-18 | Bell Telephone Labor Inc | Transistor ring counter with bistable stages |
| US3207962A (en) * | 1959-01-02 | 1965-09-21 | Transitron Electronic Corp | Semiconductor device having turn on and turn off gain |
| US3065360A (en) * | 1959-05-19 | 1962-11-20 | Lucio M Vallese | Transistor thyratron circuit employing grounded-emitter silicon controlled rectifieror equivalent |
| US3209205A (en) * | 1960-06-07 | 1965-09-28 | North Electric Co | Current supply apparatus |
| US3178662A (en) * | 1961-03-21 | 1965-04-13 | Hughes Aircraft Co | Large inductance element utilizing avalanche multiplication negative resistance which cancels equal positive resistance |
| US3144620A (en) * | 1961-04-07 | 1964-08-11 | Gen Electric | Transistorized negative resistance networks |
| US3185940A (en) * | 1961-07-06 | 1965-05-25 | Gen Electric | Complementary transistor negative resistance relaxation oscillator |
| FR1481739A (enExample) * | 1965-06-14 | 1967-08-21 | ||
| US3639858A (en) * | 1968-08-31 | 1972-02-01 | Mitsumi Electric Co Ltd | Transistor impedance converter and oscillator circuits |
| FR2177440B1 (enExample) * | 1971-12-17 | 1977-01-28 | Person Jean Michel |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1971919A (en) * | 1930-10-11 | 1934-08-28 | Rca Corp | Negative conductance circuits |
| US2662123A (en) * | 1951-02-24 | 1953-12-08 | Bell Telephone Labor Inc | Electrical transmission system including bilateral transistor amplifier |
| FR1079265A (fr) * | 1952-09-17 | 1954-11-29 | Western Electric Co | Convertisseur d'impédance négative à transistor |
| GB727765A (en) * | 1952-09-19 | 1955-04-06 | Jean Marie Moulon | Improvements in or relating to negative impedance devices |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB536583A (en) * | 1939-10-19 | 1941-05-20 | Marconi Wireless Telegraph Co | Improvements in stable band-pass amplifier circuits |
| US2769908A (en) * | 1952-11-22 | 1956-11-06 | Bell Telephone Labor Inc | Negative impedance transistor circuits |
-
0
- NL NL106412D patent/NL106412C/xx active
- NL NL201234D patent/NL201234A/xx unknown
- BE BE551746D patent/BE551746A/xx unknown
- DE DENDAT1073039D patent/DE1073039B/de active Pending
-
1956
- 1956-10-08 US US614657A patent/US2904758A/en not_active Expired - Lifetime
- 1956-10-11 GB GB31002/56A patent/GB845281A/en not_active Expired
- 1956-10-12 FR FR1160405D patent/FR1160405A/fr not_active Expired
- 1956-10-12 CH CH353041D patent/CH353041A/de unknown
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1971919A (en) * | 1930-10-11 | 1934-08-28 | Rca Corp | Negative conductance circuits |
| US2662123A (en) * | 1951-02-24 | 1953-12-08 | Bell Telephone Labor Inc | Electrical transmission system including bilateral transistor amplifier |
| FR1079265A (fr) * | 1952-09-17 | 1954-11-29 | Western Electric Co | Convertisseur d'impédance négative à transistor |
| GB727765A (en) * | 1952-09-19 | 1955-04-06 | Jean Marie Moulon | Improvements in or relating to negative impedance devices |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1288158B (de) * | 1964-01-24 | 1969-01-30 | Int Standard Electric Corp | Haltestromkreis fuer in Reihe geschaltete elektrische Koppelelemente eines mehrstufigen endmarkierten Koppelnetzes in Fernmelde-, insbesondere Fernsprechvermittlungsanlagen |
Also Published As
| Publication number | Publication date |
|---|---|
| NL106412C (enExample) | |
| BE551746A (enExample) | |
| CH353041A (de) | 1961-03-31 |
| NL201234A (enExample) | |
| GB845281A (en) | 1960-08-17 |
| US2904758A (en) | 1959-09-15 |
| FR1160405A (fr) | 1958-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE942748C (de) | Verstaerker mit einem Transistorpaar mit komplementaeren Kennlinien | |
| EP0579686B1 (de) | Wandlerschaltung | |
| DE1073039B (de) | Schaltungsanordnung zum Darstellen insbesondere einer negativen Impedanz mittels Transistoren | |
| CH646827A5 (de) | Speisebruecke fuer einen teilnehmerstromkreis. | |
| DE1909721C3 (de) | Schaltungsanordnung zur Gleichspannungsteilung | |
| DE2924171A1 (de) | Monolithisch integrierbarer transistorverstaerker | |
| DE2946952C2 (enExample) | ||
| DE3007715A1 (de) | Verstaerkerschaltung mit durch eine steuerspannung steuerbarer gesamtverstaerkung | |
| DE2041601C3 (de) | Transistorisierter Signaldämpfungskreis | |
| DE2819087A1 (de) | Verstaerkerschaltung mit zwei transistoren | |
| DE3145771C2 (enExample) | ||
| DE3017566C2 (de) | Verstärker, insbesondere für eine Teilnehmerschaltung | |
| DE2261853A1 (de) | Operationsverstaerker mit nachgeschalteter verstaerkerstufe | |
| DE2712680A1 (de) | Mehrstufiger transistorverstaerker fuer wechselspannungen | |
| DE3109375A1 (de) | Variabler gyrator mit einem einzigen verstaerker | |
| DE2213712A1 (de) | Matrix Schaltungsanordnung | |
| DE4243009A1 (de) | Schaltungsanordnung für einen integrierten Ausgangsverstärker | |
| DE2536386C3 (de) | Aktiver Modulator mit kombinierter Strom-Spannungsgegenkopplung | |
| DE2431485A1 (de) | Schaltungsanordnung zur abgabe einer symmetrischen ausgangsspannung | |
| DE2834641A1 (de) | Mehrstufiger transistorverstaerker | |
| DE1487485B2 (de) | Uebertragungsvierpol, bestehend aus einem differentialverstaerker hohen eingangswiderstandes | |
| DE1815203A1 (de) | Schaltungsanordnung zur UEbertragung von Signalen zwischen unterschiedlichen Gleichspannungspegeln | |
| DE1616411C3 (de) | Hinsichtlich der Resonanzfrequenz einstellbarer aktiver Vierpol | |
| DE1512749B2 (de) | Verstärker mit Gegentakteingang und Eintaktausgang | |
| DE1933120A1 (de) | Integrierbarer UEbertragungsvierpol |