DE1068023B - - Google Patents
Info
- Publication number
- DE1068023B DE1068023B DENDAT1068023D DE1068023DA DE1068023B DE 1068023 B DE1068023 B DE 1068023B DE NDAT1068023 D DENDAT1068023 D DE NDAT1068023D DE 1068023D A DE1068023D A DE 1068023DA DE 1068023 B DE1068023 B DE 1068023B
- Authority
- DE
- Germany
- Prior art keywords
- chromium
- nickel
- iron
- boron
- alloy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229910045601 alloy Inorganic materials 0.000 claims description 33
- 239000000956 alloy Substances 0.000 claims description 33
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 32
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 28
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 20
- 229910052796 boron Inorganic materials 0.000 claims description 20
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 16
- 229910052804 chromium Inorganic materials 0.000 claims description 16
- 239000011651 chromium Substances 0.000 claims description 16
- 229910052759 nickel Inorganic materials 0.000 claims description 16
- 229910052742 iron Inorganic materials 0.000 claims description 14
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 13
- 150000002910 rare earth metals Chemical class 0.000 claims description 11
- 229910052710 silicon Inorganic materials 0.000 claims description 7
- 239000010703 silicon Substances 0.000 claims description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 5
- 229910052782 aluminium Inorganic materials 0.000 claims description 5
- 229910052791 calcium Inorganic materials 0.000 claims description 5
- 239000011575 calcium Substances 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 150000002739 metals Chemical class 0.000 claims description 5
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 4
- 229910052726 zirconium Inorganic materials 0.000 claims description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 229910000623 nickel–chromium alloy Inorganic materials 0.000 claims description 2
- 229910052758 niobium Inorganic materials 0.000 claims description 2
- 239000010955 niobium Substances 0.000 claims description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052715 tantalum Inorganic materials 0.000 claims description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- 239000010936 titanium Substances 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 1
- 238000007792 addition Methods 0.000 description 12
- 230000003647 oxidation Effects 0.000 description 10
- 238000007254 oxidation reaction Methods 0.000 description 10
- 239000000463 material Substances 0.000 description 8
- 229910018487 Ni—Cr Inorganic materials 0.000 description 6
- VNNRSPGTAMTISX-UHFFFAOYSA-N chromium nickel Chemical compound [Cr].[Ni] VNNRSPGTAMTISX-UHFFFAOYSA-N 0.000 description 6
- 229910052684 Cerium Inorganic materials 0.000 description 4
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 239000012535 impurity Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910001122 Mischmetal Inorganic materials 0.000 description 1
- 229910052779 Neodymium Inorganic materials 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000788 chromium alloy Substances 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 description 1
- 229910001404 rare earth metal oxide Inorganic materials 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- -1 yanadine Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C19/00—Alloys based on nickel or cobalt
- C22C19/03—Alloys based on nickel or cobalt based on nickel
- C22C19/05—Alloys based on nickel or cobalt based on nickel with chromium
- C22C19/058—Alloys based on nickel or cobalt based on nickel with chromium without Mo and W
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Hard Magnetic Materials (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1068023B true DE1068023B (enExample) | 1959-10-29 |
Family
ID=593420
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1068023D Pending DE1068023B (enExample) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1068023B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0246939A3 (en) * | 1986-04-21 | 1988-10-12 | Kawasaki Steel Corporation | Fe-cr-al stainless steel having high oxidation resistance and spalling resistance and fe-cr-al steel foil for catalyst substrate of catalytic converter |
Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH191890A (de) * | 1935-05-09 | 1937-07-15 | Mond Nickel Co Ltd | Verfahren zur Herstellung eines Gegenstandes, welcher bestimmt ist, beim Gebrauche wiederholter hoher Erhitzung unterworfen zu werden. |
| US2104835A (en) * | 1935-03-07 | 1938-01-11 | Firm Heraeus Vacuumschmelze Ag | Heat-resisting implement |
| US2104836A (en) * | 1935-03-07 | 1938-01-11 | Firm Heracus Vacuumschmelze Ag | Heat-resisting implement |
| US2289641A (en) * | 1939-05-13 | 1942-07-14 | Driver Co Wilbur B | Alloy |
| US2289640A (en) * | 1939-05-13 | 1942-07-14 | Driver Co Wilbur B | Alloy |
| FR932273A (fr) * | 1943-06-30 | 1948-03-17 | Rolls Royce | Alliage à base de nickel |
| FR55100E (fr) * | 1946-11-25 | 1951-06-06 | Rolls Royce | Alliage à base de nickel |
-
0
- DE DENDAT1068023D patent/DE1068023B/de active Pending
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2104835A (en) * | 1935-03-07 | 1938-01-11 | Firm Heraeus Vacuumschmelze Ag | Heat-resisting implement |
| US2104836A (en) * | 1935-03-07 | 1938-01-11 | Firm Heracus Vacuumschmelze Ag | Heat-resisting implement |
| CH191890A (de) * | 1935-05-09 | 1937-07-15 | Mond Nickel Co Ltd | Verfahren zur Herstellung eines Gegenstandes, welcher bestimmt ist, beim Gebrauche wiederholter hoher Erhitzung unterworfen zu werden. |
| US2289641A (en) * | 1939-05-13 | 1942-07-14 | Driver Co Wilbur B | Alloy |
| US2289640A (en) * | 1939-05-13 | 1942-07-14 | Driver Co Wilbur B | Alloy |
| FR932273A (fr) * | 1943-06-30 | 1948-03-17 | Rolls Royce | Alliage à base de nickel |
| FR55100E (fr) * | 1946-11-25 | 1951-06-06 | Rolls Royce | Alliage à base de nickel |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0246939A3 (en) * | 1986-04-21 | 1988-10-12 | Kawasaki Steel Corporation | Fe-cr-al stainless steel having high oxidation resistance and spalling resistance and fe-cr-al steel foil for catalyst substrate of catalytic converter |
| US4904540A (en) * | 1986-04-21 | 1990-02-27 | Kawasaki Steel Corp. | Fe-Cr-Al stainless steel having high oxidation resistance and spalling resistance and Fe-Cr-Al steel for catalyst substrate of catalytic converter |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1952877A1 (de) | Gusslegierung auf Nickelbasis | |
| DE2620311C2 (enExample) | ||
| DE1258110B (de) | Verwendung einer oxydationsbestaendigen, nicht sproeden Eisenlegierung als Werkstoff fuer Bauteile in Heissdampfsystemen | |
| DE2910653C2 (enExample) | ||
| DE2910581A1 (de) | Alterungshaertbare eisen-nickel-chrom- legierung | |
| DE2311998A1 (de) | Verwendung einer nickellegierung fuer bauteile mit hoher zeitstandfestigkeit | |
| DE2534786A1 (de) | Nickel-chrom-wolfram-legierungen | |
| DE2316891A1 (de) | Verfahren zur verbesserung der kriecheigenschaften von titanlegierungen | |
| DE1921359B2 (de) | Verfahren zur Erhöhung der Duktilität bei hohen Temperaturen von Gußlegierungen auf Nickelbasis | |
| DE2010055B2 (de) | Verfahren zum Herstellen eines Werkstoffs mit hoher Zeitstandfestigkeit und Zähigkeit | |
| DE2045816A1 (de) | Legierungen auf Titan Basis | |
| DE1953025C3 (de) | Oxydationsbeständige Kobaltlegierung und ihre Verwendung | |
| AT203734B (de) | Nickel-Chrom-Legierung | |
| DE1068023B (enExample) | ||
| EP0119501A1 (de) | Verwendung einer aushärtbaren Kupfer-Nickel-Mangan-Legierung als Werkstoff zur Herstellung von Brillenteilen | |
| DE1758778B1 (de) | Verwendung einer aushaertbaren titanlegierung fuer gegen staende mit hoher festigkeit und guter verformbarkeit bei raumtemperatur und erhoehten temperaturen sowie hoher dauerstandfestigkeit | |
| DE69205032T2 (de) | Zirkonium-Gallium-Legierung und daraus hergestellte Bauteile für Kernreaktoren. | |
| DE915987C (de) | Verfahren zur Herstellung von Hartmetallen erhoehter Zaehigkeit | |
| DE1458354A1 (de) | Titanlegierung | |
| DE2713755C3 (de) | Verwendung einer Legierung für mit Porzellan zu verblendende Kronen oder Brücken | |
| AT257959B (de) | Molybdänlegierung und Verfahren zu ihrer Behandlung | |
| DE1121099B (de) | Die Verwendung einer Eisenlegierung als Werkstoff fuer hochhitzebestaendige Gegenstaende, die gegen reduzierende stickstoffhaltige Gase bestaendig sein muessen | |
| DE1533210B1 (de) | Zirkoniumlegierung | |
| DE2258523C3 (de) | Titanlegierung | |
| DE2362062C3 (de) | Nickellegierung für Präzisionswiderstände |