DE102014211916B4 - Tonerprozess für hyperpigmentierte Toner - Google Patents
Tonerprozess für hyperpigmentierte Toner Download PDFInfo
- Publication number
- DE102014211916B4 DE102014211916B4 DE102014211916.2A DE102014211916A DE102014211916B4 DE 102014211916 B4 DE102014211916 B4 DE 102014211916B4 DE 102014211916 A DE102014211916 A DE 102014211916A DE 102014211916 B4 DE102014211916 B4 DE 102014211916B4
- Authority
- DE
- Germany
- Prior art keywords
- mixture
- weight
- toner
- poly
- toner particles
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000000034 method Methods 0.000 title claims abstract description 47
- 239000002245 particle Substances 0.000 claims abstract description 94
- 239000000203 mixture Substances 0.000 claims abstract description 82
- 229920005989 resin Polymers 0.000 claims abstract description 32
- 239000011347 resin Substances 0.000 claims abstract description 32
- 239000004816 latex Substances 0.000 claims abstract description 30
- 229920000126 latex Polymers 0.000 claims abstract description 30
- 239000003086 colorant Substances 0.000 claims abstract description 17
- 230000004931 aggregating effect Effects 0.000 claims abstract description 15
- 239000001993 wax Substances 0.000 claims abstract description 15
- 239000007787 solid Substances 0.000 claims abstract description 13
- 239000007788 liquid Substances 0.000 claims abstract description 8
- 238000007865 diluting Methods 0.000 claims abstract description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- 239000000049 pigment Substances 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 11
- 239000000975 dye Substances 0.000 claims description 7
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical class CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 2
- 150000001252 acrylic acid derivatives Chemical class 0.000 claims description 2
- 150000001253 acrylic acids Chemical class 0.000 claims description 2
- 150000008360 acrylonitriles Chemical class 0.000 claims description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N butadiene group Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 claims description 2
- 125000005395 methacrylic acid group Chemical class 0.000 claims description 2
- 150000003440 styrenes Chemical class 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims 1
- -1 transition metal salts Chemical class 0.000 description 38
- 238000004581 coalescence Methods 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 238000004220 aggregation Methods 0.000 description 20
- 230000002776 aggregation Effects 0.000 description 20
- 239000000725 suspension Substances 0.000 description 15
- 239000000654 additive Substances 0.000 description 11
- 239000000839 emulsion Substances 0.000 description 11
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 9
- 239000003999 initiator Substances 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- 239000004094 surface-active agent Substances 0.000 description 9
- 229920006127 amorphous resin Polymers 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 7
- 239000000178 monomer Substances 0.000 description 7
- 229920001225 polyester resin Polymers 0.000 description 7
- 239000004645 polyester resin Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000004971 Cross linker Substances 0.000 description 6
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 230000009477 glass transition Effects 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- FFJCNSLCJOQHKM-CLFAGFIQSA-N (z)-1-[(z)-octadec-9-enoxy]octadec-9-ene Chemical compound CCCCCCCC\C=C/CCCCCCCCOCCCCCCCC\C=C/CCCCCCCC FFJCNSLCJOQHKM-CLFAGFIQSA-N 0.000 description 5
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 5
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 5
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 5
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000003945 anionic surfactant Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- TUZBYYLVVXPEMA-UHFFFAOYSA-N butyl prop-2-enoate;styrene Chemical compound C=CC1=CC=CC=C1.CCCCOC(=O)C=C TUZBYYLVVXPEMA-UHFFFAOYSA-N 0.000 description 4
- 239000008367 deionised water Substances 0.000 description 4
- 229910021641 deionized water Inorganic materials 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- 239000002736 nonionic surfactant Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical class C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 235000010980 cellulose Nutrition 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000002563 ionic surfactant Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- QYZFTMMPKCOTAN-UHFFFAOYSA-N n-[2-(2-hydroxyethylamino)ethyl]-2-[[1-[2-(2-hydroxyethylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide Chemical compound OCCNCCNC(=O)C(C)(C)N=NC(C)(C)C(=O)NCCNCCO QYZFTMMPKCOTAN-UHFFFAOYSA-N 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 150000001451 organic peroxides Chemical class 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229920003048 styrene butadiene rubber Polymers 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- WYGWHHGCAGTUCH-UHFFFAOYSA-N 2-[(2-cyano-4-methylpentan-2-yl)diazenyl]-2,4-dimethylpentanenitrile Chemical compound CC(C)CC(C)(C#N)N=NC(C)(C#N)CC(C)C WYGWHHGCAGTUCH-UHFFFAOYSA-N 0.000 description 2
- ROGIWVXWXZRRMZ-UHFFFAOYSA-N 2-methylbuta-1,3-diene;styrene Chemical compound CC(=C)C=C.C=CC1=CC=CC=C1 ROGIWVXWXZRRMZ-UHFFFAOYSA-N 0.000 description 2
- JYCQQPHGFMYQCF-UHFFFAOYSA-N 4-tert-Octylphenol monoethoxylate Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 JYCQQPHGFMYQCF-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 239000002174 Styrene-butadiene Substances 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- 229960000686 benzalkonium chloride Drugs 0.000 description 2
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- IYCOKCJDXXJIIM-UHFFFAOYSA-N butyl prop-2-enoate;prop-2-enoic acid;styrene Chemical compound OC(=O)C=C.C=CC1=CC=CC=C1.CCCCOC(=O)C=C IYCOKCJDXXJIIM-UHFFFAOYSA-N 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000002826 coolant Substances 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 229920002114 octoxynol-9 Polymers 0.000 description 2
- 239000003002 pH adjusting agent Substances 0.000 description 2
- 229920001983 poloxamer Polymers 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 239000011115 styrene butadiene Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- VNDYJBBGRKZCSX-UHFFFAOYSA-L zinc bromide Chemical compound Br[Zn]Br VNDYJBBGRKZCSX-UHFFFAOYSA-L 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- FVQMJJQUGGVLEP-UHFFFAOYSA-N (2-methylpropan-2-yl)oxy 2-ethylhexaneperoxoate Chemical compound CCCCC(CC)C(=O)OOOC(C)(C)C FVQMJJQUGGVLEP-UHFFFAOYSA-N 0.000 description 1
- QEQBMZQFDDDTPN-UHFFFAOYSA-N (2-methylpropan-2-yl)oxy benzenecarboperoxoate Chemical compound CC(C)(C)OOOC(=O)C1=CC=CC=C1 QEQBMZQFDDDTPN-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- RIPYNJLMMFGZSX-UHFFFAOYSA-N (5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate Chemical compound C=1C=CC=CC=1C(=O)OOC(C)(C)CCC(C)(C)OOC(=O)C1=CC=CC=C1 RIPYNJLMMFGZSX-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- IMYCVFRTNVMHAD-UHFFFAOYSA-N 1,1-bis(2-methylbutan-2-ylperoxy)cyclohexane Chemical compound CCC(C)(C)OOC1(OOC(C)(C)CC)CCCCC1 IMYCVFRTNVMHAD-UHFFFAOYSA-N 0.000 description 1
- NALFRYPTRXKZPN-UHFFFAOYSA-N 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane Chemical compound CC1CC(C)(C)CC(OOC(C)(C)C)(OOC(C)(C)C)C1 NALFRYPTRXKZPN-UHFFFAOYSA-N 0.000 description 1
- HSLFISVKRDQEBY-UHFFFAOYSA-N 1,1-bis(tert-butylperoxy)cyclohexane Chemical compound CC(C)(C)OOC1(OOC(C)(C)C)CCCCC1 HSLFISVKRDQEBY-UHFFFAOYSA-N 0.000 description 1
- UICXTANXZJJIBC-UHFFFAOYSA-N 1-(1-hydroperoxycyclohexyl)peroxycyclohexan-1-ol Chemical compound C1CCCCC1(O)OOC1(OO)CCCCC1 UICXTANXZJJIBC-UHFFFAOYSA-N 0.000 description 1
- HQOVXPHOJANJBR-UHFFFAOYSA-N 2,2-bis(tert-butylperoxy)butane Chemical compound CC(C)(C)OOC(C)(CC)OOC(C)(C)C HQOVXPHOJANJBR-UHFFFAOYSA-N 0.000 description 1
- DMWVYCCGCQPJEA-UHFFFAOYSA-N 2,5-bis(tert-butylperoxy)-2,5-dimethylhexane Chemical compound CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)C DMWVYCCGCQPJEA-UHFFFAOYSA-N 0.000 description 1
- JGBAASVQPMTVHO-UHFFFAOYSA-N 2,5-dihydroperoxy-2,5-dimethylhexane Chemical compound OOC(C)(C)CCC(C)(C)OO JGBAASVQPMTVHO-UHFFFAOYSA-N 0.000 description 1
- LCPVQAHEFVXVKT-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)pyridin-3-amine Chemical compound NC1=CC=CN=C1OC1=CC=C(F)C=C1F LCPVQAHEFVXVKT-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- MYECVPCGFLCGQX-UHFFFAOYSA-N 2-[(1-amino-2-methyl-1-phenyliminopropan-2-yl)diazenyl]-2-methyl-n'-phenylpropanimidamide;dihydrochloride Chemical compound Cl.Cl.C=1C=CC=CC=1NC(=N)C(C)(C)N=NC(C)(C)C(=N)NC1=CC=CC=C1 MYECVPCGFLCGQX-UHFFFAOYSA-N 0.000 description 1
- QRGNGVOBMOHGED-UHFFFAOYSA-N 2-[2-[2-(5-hydroxy-1,4,5,6-tetrahydropyrimidin-2-yl)propan-2-yldiazenyl]propan-2-yl]-1,4,5,6-tetrahydropyrimidin-5-ol;dihydrochloride Chemical compound Cl.Cl.N=1CC(O)CNC=1C(C)(C)N=NC(C)(C)C1=NCC(O)CN1 QRGNGVOBMOHGED-UHFFFAOYSA-N 0.000 description 1
- AEZBIUBWOJAYOA-UHFFFAOYSA-N 2-[2-[2-[2-[1-(2-hydroxyethyl)-4,5-dihydroimidazol-2-yl]propan-2-yldiazenyl]propan-2-yl]-4,5-dihydroimidazol-1-yl]ethanol Chemical compound N=1CCN(CCO)C=1C(C)(C)N=NC(C)(C)C1=NCCN1CCO AEZBIUBWOJAYOA-UHFFFAOYSA-N 0.000 description 1
- VEBJYBIQIYFEFN-UHFFFAOYSA-N 2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol Chemical compound CCCCCCCCC1=CC=C(OCCOCCOCCOCCOCCO)C=C1 VEBJYBIQIYFEFN-UHFFFAOYSA-N 0.000 description 1
- RXXPAEGIPXPLPB-UHFFFAOYSA-N 2-[2-[4-(7-methyloctyl)phenoxy]ethoxy]ethanol Chemical compound CC(C)CCCCCCC1=CC=C(OCCOCCO)C=C1 RXXPAEGIPXPLPB-UHFFFAOYSA-N 0.000 description 1
- DKESBEUCKHTHLQ-UHFFFAOYSA-N 2-[[1-amino-1-(2-hydroxyethylimino)-2-methylpropan-2-yl]diazenyl]-n'-(2-hydroxyethyl)-2-methylpropanimidamide;dihydrochloride Chemical compound Cl.Cl.OCCNC(=N)C(C)(C)N=NC(C)(C)C(=N)NCCO DKESBEUCKHTHLQ-UHFFFAOYSA-N 0.000 description 1
- XDMWMLIKOQYJQM-UHFFFAOYSA-N 2-[[1-amino-1-(4-aminophenyl)imino-2-methylpropan-2-yl]diazenyl]-n'-(4-aminophenyl)-2-methylpropanimidamide;tetrahydrochloride Chemical compound Cl.Cl.Cl.Cl.C=1C=C(N)C=CC=1NC(=N)C(C)(C)N=NC(C)(C)C(=N)NC1=CC=C(N)C=C1 XDMWMLIKOQYJQM-UHFFFAOYSA-N 0.000 description 1
- BMROYLZOZRHCAI-UHFFFAOYSA-N 2-[[1-amino-1-(4-chlorophenyl)imino-2-methylpropan-2-yl]diazenyl]-n'-(4-chlorophenyl)-2-methylpropanimidamide;dihydrochloride Chemical compound Cl.Cl.C=1C=C(Cl)C=CC=1NC(=N)C(C)(C)N=NC(C)(C)C(=N)NC1=CC=C(Cl)C=C1 BMROYLZOZRHCAI-UHFFFAOYSA-N 0.000 description 1
- QRYPVXBEPZJBRR-UHFFFAOYSA-N 2-[[1-amino-1-(4-hydroxyphenyl)imino-2-methylpropan-2-yl]diazenyl]-n'-(4-hydroxyphenyl)-2-methylpropanimidamide;dihydrochloride Chemical compound Cl.Cl.C=1C=C(O)C=CC=1NC(=N)C(C)(C)N=NC(C)(C)C(=N)NC1=CC=C(O)C=C1 QRYPVXBEPZJBRR-UHFFFAOYSA-N 0.000 description 1
- XRXANEMIFVRKLN-UHFFFAOYSA-N 2-hydroperoxy-2-methylbutane Chemical compound CCC(C)(C)OO XRXANEMIFVRKLN-UHFFFAOYSA-N 0.000 description 1
- LONCJFPVKZBTLG-UHFFFAOYSA-N 2-methylbuta-1,3-diene prop-1-enylbenzene Chemical compound CC(=C)C=C.CC=CC1=CC=CC=C1 LONCJFPVKZBTLG-UHFFFAOYSA-N 0.000 description 1
- KLWOORLBKQYYQC-UHFFFAOYSA-N 2-methylbuta-1,3-diene propyl prop-2-enoate Chemical compound CC(=C)C=C.CCCOC(=O)C=C KLWOORLBKQYYQC-UHFFFAOYSA-N 0.000 description 1
- NRDDLSFHZLETFD-UHFFFAOYSA-N 2-methylbuta-1,3-diene;methyl 2-methylprop-2-enoate Chemical compound CC(=C)C=C.COC(=O)C(C)=C NRDDLSFHZLETFD-UHFFFAOYSA-N 0.000 description 1
- HNJKLOSHGNUTBM-UHFFFAOYSA-N 2-methylbuta-1,3-diene;methyl prop-2-enoate Chemical compound CC(=C)C=C.COC(=O)C=C HNJKLOSHGNUTBM-UHFFFAOYSA-N 0.000 description 1
- XXEJNJYARCWPGC-UHFFFAOYSA-N 2-methylbuta-1,3-diene;propyl 2-methylprop-2-enoate Chemical compound CC(=C)C=C.CCCOC(=O)C(C)=C XXEJNJYARCWPGC-UHFFFAOYSA-N 0.000 description 1
- IFXDUNDBQDXPQZ-UHFFFAOYSA-N 2-methylbutan-2-yl 2-ethylhexaneperoxoate Chemical compound CCCCC(CC)C(=O)OOC(C)(C)CC IFXDUNDBQDXPQZ-UHFFFAOYSA-N 0.000 description 1
- RFSCGDQQLKVJEJ-UHFFFAOYSA-N 2-methylbutan-2-yl benzenecarboperoxoate Chemical compound CCC(C)(C)OOC(=O)C1=CC=CC=C1 RFSCGDQQLKVJEJ-UHFFFAOYSA-N 0.000 description 1
- FSGAMPVWQZPGJF-UHFFFAOYSA-N 2-methylbutan-2-yl ethaneperoxoate Chemical compound CCC(C)(C)OOC(C)=O FSGAMPVWQZPGJF-UHFFFAOYSA-N 0.000 description 1
- RCEJCSULJQNRQQ-UHFFFAOYSA-N 2-methylbutanenitrile Chemical compound CCC(C)C#N RCEJCSULJQNRQQ-UHFFFAOYSA-N 0.000 description 1
- CVEPFOUZABPRMK-UHFFFAOYSA-N 2-methylprop-2-enoic acid;styrene Chemical class CC(=C)C(O)=O.C=CC1=CC=CC=C1 CVEPFOUZABPRMK-UHFFFAOYSA-N 0.000 description 1
- BIISIZOQPWZPPS-UHFFFAOYSA-N 2-tert-butylperoxypropan-2-ylbenzene Chemical compound CC(C)(C)OOC(C)(C)C1=CC=CC=C1 BIISIZOQPWZPPS-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 1
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical class [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ISCIUIIRLMFIQC-UHFFFAOYSA-N C=CC=C.C=CC#N.OC(=O)C=C.C=CC1=CC=CC=C1 Chemical compound C=CC=C.C=CC#N.OC(=O)C=C.C=CC1=CC=CC=C1 ISCIUIIRLMFIQC-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- JUIBLDFFVYKUAC-UHFFFAOYSA-N [5-(2-ethylhexanoylperoxy)-2,5-dimethylhexan-2-yl] 2-ethylhexaneperoxoate Chemical compound CCCCC(CC)C(=O)OOC(C)(C)CCC(C)(C)OOC(=O)C(CC)CCCC JUIBLDFFVYKUAC-UHFFFAOYSA-N 0.000 description 1
- KYIKRXIYLAGAKQ-UHFFFAOYSA-N abcn Chemical compound C1CCCCC1(C#N)N=NC1(C#N)CCCCC1 KYIKRXIYLAGAKQ-UHFFFAOYSA-N 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000006177 alkyl benzyl group Chemical group 0.000 description 1
- 229920005603 alternating copolymer Polymers 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- QLJCFNUYUJEXET-UHFFFAOYSA-K aluminum;trinitrite Chemical compound [Al+3].[O-]N=O.[O-]N=O.[O-]N=O QLJCFNUYUJEXET-UHFFFAOYSA-K 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- NBXSIUSZCHNKCZ-UHFFFAOYSA-N bis[2-(1,4,5,6-tetrahydropyrimidin-2-yl)propan-2-yl]diazene;dihydrochloride Chemical compound Cl.Cl.N=1CCCNC=1C(C)(C)N=NC(C)(C)C1=NCCCN1 NBXSIUSZCHNKCZ-UHFFFAOYSA-N 0.000 description 1
- GSZJXKXRHCJVCI-UHFFFAOYSA-N bis[2-(4,5,6,7-tetrahydro-1h-1,3-diazepin-2-yl)propan-2-yl]diazene;dihydrochloride Chemical compound Cl.Cl.N=1CCCCNC=1C(C)(C)N=NC(C)(C)C1=NCCCCN1 GSZJXKXRHCJVCI-UHFFFAOYSA-N 0.000 description 1
- LBSPZZSGTIBOFG-UHFFFAOYSA-N bis[2-(4,5-dihydro-1h-imidazol-2-yl)propan-2-yl]diazene;dihydrochloride Chemical compound Cl.Cl.N=1CCNC=1C(C)(C)N=NC(C)(C)C1=NCCN1 LBSPZZSGTIBOFG-UHFFFAOYSA-N 0.000 description 1
- PZXSLFQJOZPCJG-UHFFFAOYSA-N bis[2-(5-methyl-4,5-dihydro-1h-imidazol-2-yl)propan-2-yl]diazene;dihydrochloride Chemical compound Cl.Cl.N1C(C)CN=C1C(C)(C)N=NC(C)(C)C1=NCC(C)N1 PZXSLFQJOZPCJG-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- VMMVQEIZBCZSNG-UHFFFAOYSA-N buta-1,3-diene prop-1-enylbenzene Chemical compound C=CC=C.CC=CC1=CC=CC=C1 VMMVQEIZBCZSNG-UHFFFAOYSA-N 0.000 description 1
- LKAVYBZHOYOUSX-UHFFFAOYSA-N buta-1,3-diene;2-methylprop-2-enoic acid;styrene Chemical compound C=CC=C.CC(=C)C(O)=O.C=CC1=CC=CC=C1 LKAVYBZHOYOUSX-UHFFFAOYSA-N 0.000 description 1
- WOYXYXOSUAZDIA-UHFFFAOYSA-N buta-1,3-diene;butyl 2-methylprop-2-enoate Chemical compound C=CC=C.CCCCOC(=O)C(C)=C WOYXYXOSUAZDIA-UHFFFAOYSA-N 0.000 description 1
- YIEXROAWVNRRMJ-UHFFFAOYSA-N buta-1,3-diene;butyl prop-2-enoate Chemical compound C=CC=C.CCCCOC(=O)C=C YIEXROAWVNRRMJ-UHFFFAOYSA-N 0.000 description 1
- UWWYTVDAXIVRAJ-UHFFFAOYSA-N buta-1,3-diene;ethyl 2-methylprop-2-enoate Chemical compound C=CC=C.CCOC(=O)C(C)=C UWWYTVDAXIVRAJ-UHFFFAOYSA-N 0.000 description 1
- UCPLVEOTDDIMJD-UHFFFAOYSA-N buta-1,3-diene;ethyl prop-2-enoate Chemical compound C=CC=C.CCOC(=O)C=C UCPLVEOTDDIMJD-UHFFFAOYSA-N 0.000 description 1
- KLIYQWXIWMRMGR-UHFFFAOYSA-N buta-1,3-diene;methyl 2-methylprop-2-enoate Chemical compound C=CC=C.COC(=O)C(C)=C KLIYQWXIWMRMGR-UHFFFAOYSA-N 0.000 description 1
- LRTQWXGNPCHTFW-UHFFFAOYSA-N buta-1,3-diene;methyl prop-2-enoate Chemical compound C=CC=C.COC(=O)C=C LRTQWXGNPCHTFW-UHFFFAOYSA-N 0.000 description 1
- PLOYJEGLPVCRAJ-UHFFFAOYSA-N buta-1,3-diene;prop-2-enoic acid;styrene Chemical compound C=CC=C.OC(=O)C=C.C=CC1=CC=CC=C1 PLOYJEGLPVCRAJ-UHFFFAOYSA-N 0.000 description 1
- NACNINIZJRIDPK-UHFFFAOYSA-N buta-1,3-diene;propyl 2-methylprop-2-enoate Chemical compound C=CC=C.CCCOC(=O)C(C)=C NACNINIZJRIDPK-UHFFFAOYSA-N 0.000 description 1
- XPRLOFXIQNKWMK-UHFFFAOYSA-N buta-1,3-diene;propyl prop-2-enoate Chemical compound C=CC=C.CCCOC(=O)C=C XPRLOFXIQNKWMK-UHFFFAOYSA-N 0.000 description 1
- QQIMXPLXJVRMNX-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene Chemical compound CC(=C)C=C.CCCCOC(=O)C(C)=C QQIMXPLXJVRMNX-UHFFFAOYSA-N 0.000 description 1
- VMRHCZNACCBXEJ-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;butyl prop-2-enoate Chemical compound CCCCOC(=O)C=C.CCCCOC(=O)C(C)=C VMRHCZNACCBXEJ-UHFFFAOYSA-N 0.000 description 1
- KGVITRZHZPHLOI-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;prop-2-enoic acid Chemical compound OC(=O)C=C.CCCCOC(=O)C(C)=C KGVITRZHZPHLOI-UHFFFAOYSA-N 0.000 description 1
- PSJCFABZBPCBNQ-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;prop-2-enoic acid;styrene Chemical compound OC(=O)C=C.C=CC1=CC=CC=C1.CCCCOC(=O)C(C)=C PSJCFABZBPCBNQ-UHFFFAOYSA-N 0.000 description 1
- DFYKHEXCUQCPEB-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;styrene Chemical compound C=CC1=CC=CC=C1.CCCCOC(=O)C(C)=C DFYKHEXCUQCPEB-UHFFFAOYSA-N 0.000 description 1
- BXIQXYOPGBXIEM-UHFFFAOYSA-N butyl 4,4-bis(tert-butylperoxy)pentanoate Chemical compound CCCCOC(=O)CCC(C)(OOC(C)(C)C)OOC(C)(C)C BXIQXYOPGBXIEM-UHFFFAOYSA-N 0.000 description 1
- HOIWWOKSBHULCU-UHFFFAOYSA-N butyl prop-2-enoate;2-methylbuta-1,3-diene Chemical compound CC(=C)C=C.CCCCOC(=O)C=C HOIWWOKSBHULCU-UHFFFAOYSA-N 0.000 description 1
- JDWNLYTUXXATMM-UHFFFAOYSA-N butyl prop-2-enoate;3-prop-2-enoyloxypropanoic acid;styrene Chemical compound C=CC1=CC=CC=C1.CCCCOC(=O)C=C.OC(=O)CCOC(=O)C=C JDWNLYTUXXATMM-UHFFFAOYSA-N 0.000 description 1
- QMRMTRCBDHFTIV-UHFFFAOYSA-N butyl prop-2-enoate;prop-2-enenitrile;prop-2-enoic acid Chemical compound C=CC#N.OC(=O)C=C.CCCCOC(=O)C=C QMRMTRCBDHFTIV-UHFFFAOYSA-N 0.000 description 1
- UPMATSCYHGMGSE-UHFFFAOYSA-N butyl prop-2-enoate;prop-2-enenitrile;prop-2-enoic acid;styrene Chemical compound C=CC#N.OC(=O)C=C.C=CC1=CC=CC=C1.CCCCOC(=O)C=C UPMATSCYHGMGSE-UHFFFAOYSA-N 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229910000420 cerium oxide Inorganic materials 0.000 description 1
- DRVWBEJJZZTIGJ-UHFFFAOYSA-N cerium(3+);oxygen(2-) Chemical class [O-2].[O-2].[O-2].[Ce+3].[Ce+3] DRVWBEJJZZTIGJ-UHFFFAOYSA-N 0.000 description 1
- 229960004830 cetylpyridinium Drugs 0.000 description 1
- NEUSVAOJNUQRTM-UHFFFAOYSA-N cetylpyridinium Chemical compound CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 NEUSVAOJNUQRTM-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000701 coagulant Substances 0.000 description 1
- 239000011362 coarse particle Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- XJOBOFWTZOKMOH-UHFFFAOYSA-N decanoyl decaneperoxoate Chemical compound CCCCCCCCCC(=O)OOC(=O)CCCCCCCCC XJOBOFWTZOKMOH-UHFFFAOYSA-N 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 239000012933 diacyl peroxide Substances 0.000 description 1
- BUACSMWVFUNQET-UHFFFAOYSA-H dialuminum;trisulfate;hydrate Chemical compound O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O BUACSMWVFUNQET-UHFFFAOYSA-H 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- FPDLLPXYRWELCU-UHFFFAOYSA-M dimethyl(dioctadecyl)azanium;methyl sulfate Chemical compound COS([O-])(=O)=O.CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC FPDLLPXYRWELCU-UHFFFAOYSA-M 0.000 description 1
- SIYLLGKDQZGJHK-UHFFFAOYSA-N dimethyl-(phenylmethyl)-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]ammonium Chemical compound C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 SIYLLGKDQZGJHK-UHFFFAOYSA-N 0.000 description 1
- SMQZZQFYHUDLSJ-UHFFFAOYSA-L disodium;1-dodecylnaphthalene;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.C1=CC=C2C(CCCCCCCCCCCC)=CC=CC2=C1 SMQZZQFYHUDLSJ-UHFFFAOYSA-L 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- RXQXUXZUWNFWJV-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene Chemical compound CC(=C)C=C.CCOC(=O)C(C)=C RXQXUXZUWNFWJV-UHFFFAOYSA-N 0.000 description 1
- NICWAKGKDIAMOD-UHFFFAOYSA-N ethyl 3,3-bis(2-methylbutan-2-ylperoxy)butanoate Chemical compound CCOC(=O)CC(C)(OOC(C)(C)CC)OOC(C)(C)CC NICWAKGKDIAMOD-UHFFFAOYSA-N 0.000 description 1
- HARQWLDROVMFJE-UHFFFAOYSA-N ethyl 3,3-bis(tert-butylperoxy)butanoate Chemical compound CCOC(=O)CC(C)(OOC(C)(C)C)OOC(C)(C)C HARQWLDROVMFJE-UHFFFAOYSA-N 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- REYZQLSIADJXGD-UHFFFAOYSA-N ethyl prop-2-enoate;2-methylbuta-1,3-diene Chemical compound CC(=C)C=C.CCOC(=O)C=C REYZQLSIADJXGD-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- MVFCKEFYUDZOCX-UHFFFAOYSA-N iron(2+);dinitrate Chemical compound [Fe+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MVFCKEFYUDZOCX-UHFFFAOYSA-N 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- KZCOBXFFBQJQHH-UHFFFAOYSA-N octane-1-thiol Chemical compound CCCCCCCCS KZCOBXFFBQJQHH-UHFFFAOYSA-N 0.000 description 1
- 150000004028 organic sulfates Chemical class 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000259 polyoxyethylene lauryl ether Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- KUKFKAPJCRZILJ-UHFFFAOYSA-N prop-2-enenitrile;prop-2-enoic acid Chemical compound C=CC#N.OC(=O)C=C KUKFKAPJCRZILJ-UHFFFAOYSA-N 0.000 description 1
- HXHCOXPZCUFAJI-UHFFFAOYSA-N prop-2-enoic acid;styrene Chemical class OC(=O)C=C.C=CC1=CC=CC=C1 HXHCOXPZCUFAJI-UHFFFAOYSA-N 0.000 description 1
- OIMDJNFWDDTLOZ-UHFFFAOYSA-N propyl prop-2-enoate;styrene Chemical compound CCCOC(=O)C=C.C=CC1=CC=CC=C1 OIMDJNFWDDTLOZ-UHFFFAOYSA-N 0.000 description 1
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229920005604 random copolymer Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- NMOALOSNPWTWRH-UHFFFAOYSA-N tert-butyl 7,7-dimethyloctaneperoxoate Chemical compound CC(C)(C)CCCCCC(=O)OOC(C)(C)C NMOALOSNPWTWRH-UHFFFAOYSA-N 0.000 description 1
- SWAXTRYEYUTSAP-UHFFFAOYSA-N tert-butyl ethaneperoxoate Chemical compound CC(=O)OOC(C)(C)C SWAXTRYEYUTSAP-UHFFFAOYSA-N 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 238000011179 visual inspection Methods 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
- 229940102001 zinc bromide Drugs 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 229960001939 zinc chloride Drugs 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
- 229910000368 zinc sulfate Inorganic materials 0.000 description 1
- 229960001763 zinc sulfate Drugs 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/0802—Preparation methods
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/0819—Developers with toner particles characterised by the dimensions of the particles
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/0802—Preparation methods
- G03G9/0804—Preparation methods whereby the components are brought together in a liquid dispersing medium
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/0827—Developers with toner particles characterised by their shape, e.g. degree of sphericity
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Developing Agents For Electrophotography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13/930,326 US9023574B2 (en) | 2013-06-28 | 2013-06-28 | Toner processes for hyper-pigmented toners |
| US13/930,326 | 2013-06-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE102014211916A1 DE102014211916A1 (de) | 2014-12-31 |
| DE102014211916B4 true DE102014211916B4 (de) | 2021-07-22 |
Family
ID=52017580
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE102014211916.2A Active DE102014211916B4 (de) | 2013-06-28 | 2014-06-20 | Tonerprozess für hyperpigmentierte Toner |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US9023574B2 (enExample) |
| JP (1) | JP2015011346A (enExample) |
| BR (1) | BR102014014482A2 (enExample) |
| CA (1) | CA2852402C (enExample) |
| DE (1) | DE102014211916B4 (enExample) |
| MX (1) | MX352061B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US10025587B2 (en) * | 2016-08-17 | 2018-07-17 | American Megatrends Inc. | Method of bootup and installation, and computer system thereof |
Citations (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3590000A (en) | 1967-06-05 | 1971-06-29 | Xerox Corp | Solid developer for latent electrostatic images |
| US3800588A (en) | 1971-04-30 | 1974-04-02 | Mts System Corp | Multiple axis control system for vibration test apparatus |
| US4298672A (en) | 1978-06-01 | 1981-11-03 | Xerox Corporation | Toners containing alkyl pyridinium compounds and their hydrates |
| US4338390A (en) | 1980-12-04 | 1982-07-06 | Xerox Corporation | Quarternary ammonium sulfate or sulfonate charge control agents for electrophotographic developers compatible with viton fuser |
| US5227460A (en) | 1991-12-30 | 1993-07-13 | Xerox Corporation | Cross-linked toner resins |
| US5278020A (en) | 1992-08-28 | 1994-01-11 | Xerox Corporation | Toner composition and processes thereof |
| US5290654A (en) | 1992-07-29 | 1994-03-01 | Xerox Corporation | Microsuspension processes for toner compositions |
| US5308734A (en) | 1992-12-14 | 1994-05-03 | Xerox Corporation | Toner processes |
| US5344738A (en) | 1993-06-25 | 1994-09-06 | Xerox Corporation | Process of making toner compositions |
| US5346797A (en) | 1993-02-25 | 1994-09-13 | Xerox Corporation | Toner processes |
| US5348832A (en) | 1993-06-01 | 1994-09-20 | Xerox Corporation | Toner compositions |
| US5364729A (en) | 1993-06-25 | 1994-11-15 | Xerox Corporation | Toner aggregation processes |
| US5366841A (en) | 1993-09-30 | 1994-11-22 | Xerox Corporation | Toner aggregation processes |
| US5370963A (en) | 1993-06-25 | 1994-12-06 | Xerox Corporation | Toner emulsion aggregation processes |
| US5403693A (en) | 1993-06-25 | 1995-04-04 | Xerox Corporation | Toner aggregation and coalescence processes |
| US5405728A (en) | 1993-06-25 | 1995-04-11 | Xerox Corporation | Toner aggregation processes |
| US5418108A (en) | 1993-06-25 | 1995-05-23 | Xerox Corporation | Toner emulsion aggregation process |
| US5496676A (en) | 1995-03-27 | 1996-03-05 | Xerox Corporation | Toner aggregation processes |
| US5501935A (en) | 1995-01-17 | 1996-03-26 | Xerox Corporation | Toner aggregation processes |
| US5527658A (en) | 1995-03-13 | 1996-06-18 | Xerox Corporation | Toner aggregation processes using water insoluble transition metal containing powder |
| US5585215A (en) | 1996-06-13 | 1996-12-17 | Xerox Corporation | Toner compositions |
| US5650255A (en) | 1996-09-03 | 1997-07-22 | Xerox Corporation | Low shear toner aggregation processes |
| US5650256A (en) | 1996-10-02 | 1997-07-22 | Xerox Corporation | Toner processes |
| US5723253A (en) | 1994-12-05 | 1998-03-03 | Konica Corporation | Light-sensitive composition and light-sensitive lithographic printing plate containing o-quinonediazide compound, novolak resin, polymer and enclosure compound |
| US5744520A (en) | 1995-07-03 | 1998-04-28 | Xerox Corporation | Aggregation processes |
| US5747215A (en) | 1997-03-28 | 1998-05-05 | Xerox Corporation | Toner compositions and processes |
| US5766818A (en) | 1997-10-29 | 1998-06-16 | Xerox Corporation | Toner processes with hydrolyzable surfactant |
| US5804349A (en) | 1996-10-02 | 1998-09-08 | Xerox Corporation | Acrylonitrile-modified toner compositions and processes |
| US5827633A (en) | 1997-07-31 | 1998-10-27 | Xerox Corporation | Toner processes |
| US5840462A (en) | 1998-01-13 | 1998-11-24 | Xerox Corporation | Toner processes |
| US5853944A (en) | 1998-01-13 | 1998-12-29 | Xerox Corporation | Toner processes |
| US5863698A (en) | 1998-04-13 | 1999-01-26 | Xerox Corporation | Toner processes |
| US5869215A (en) | 1998-01-13 | 1999-02-09 | Xerox Corporation | Toner compositions and processes thereof |
| US5910387A (en) | 1998-01-13 | 1999-06-08 | Xerox Corporation | Toner compositions with acrylonitrile and processes |
| US5916725A (en) | 1998-01-13 | 1999-06-29 | Xerox Corporation | Surfactant free toner processes |
| US5919595A (en) | 1998-01-13 | 1999-07-06 | Xerox Corporation | Toner process with cationic salts |
| US5925488A (en) | 1996-09-03 | 1999-07-20 | Xerox Corporation | Toner processes using in-situ tricalcium phospate |
| US5977210A (en) | 1995-01-30 | 1999-11-02 | Xerox Corporation | Modified emulsion aggregation processes |
| US6214507B1 (en) | 1998-08-11 | 2001-04-10 | Xerox Corporation | Toner compositions |
| US6730450B1 (en) | 2000-11-28 | 2004-05-04 | Xerox Corporation | Toner compositions comprising polyester resin and poly (3,4-ethylenedioxythiophene) |
| US6743559B2 (en) | 2000-11-28 | 2004-06-01 | Xerox Corporation | Toner compositions comprising polyester resin and polypyrrole |
| US6756176B2 (en) | 2002-09-27 | 2004-06-29 | Xerox Corporation | Toner processes |
| US6780500B2 (en) | 2000-11-16 | 2004-08-24 | Catherine Dumouchel | Part made of recycled thermoplastic material, a corresponding method of manufacture, and a pallet comprising at least one bar of this type |
| US20040202952A1 (en) | 2003-04-14 | 2004-10-14 | Xerox Corporation | Toner processes |
| US6830860B2 (en) | 2003-01-22 | 2004-12-14 | Xerox Corporation | Toner compositions and processes thereof |
| US7029817B2 (en) | 2004-02-13 | 2006-04-18 | Xerox Corporation | Toner processes |
| DE112010004799T5 (de) | 2009-12-14 | 2012-11-15 | Kao Corporation | Verfahren zur Tonerherstellung |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6593049B1 (en) | 2001-03-26 | 2003-07-15 | Xerox Corporation | Toner and developer compositions |
| US6749980B2 (en) | 2002-05-20 | 2004-06-15 | Xerox Corporation | Toner processes |
| JP4631787B2 (ja) | 2006-04-18 | 2011-02-16 | 富士ゼロックス株式会社 | 静電荷像現像用トナー、静電荷像現像剤、画像形成方法、画像形成装置、及び、印刷物 |
| US8211607B2 (en) | 2008-08-27 | 2012-07-03 | Xerox Corporation | Toner compositions |
| US8431318B2 (en) | 2010-04-09 | 2013-04-30 | Xerox Corporation | Toner compositions and processes |
| US9581926B2 (en) * | 2010-04-13 | 2017-02-28 | Xerox Corporation | Imaging processes |
| US8221953B2 (en) | 2010-05-21 | 2012-07-17 | Xerox Corporation | Emulsion aggregation process |
| JP2012083639A (ja) * | 2010-10-14 | 2012-04-26 | Konica Minolta Business Technologies Inc | トナーの製造方法 |
| JP5736265B2 (ja) * | 2011-07-21 | 2015-06-17 | 花王株式会社 | 電子写真用トナーの製造方法 |
-
2013
- 2013-06-28 US US13/930,326 patent/US9023574B2/en active Active
-
2014
- 2014-05-21 CA CA2852402A patent/CA2852402C/en not_active Expired - Fee Related
- 2014-06-13 BR BRBR102014014482-0A patent/BR102014014482A2/pt not_active Application Discontinuation
- 2014-06-16 JP JP2014123638A patent/JP2015011346A/ja active Pending
- 2014-06-20 DE DE102014211916.2A patent/DE102014211916B4/de active Active
- 2014-06-27 MX MX2014007982A patent/MX352061B/es active IP Right Grant
Patent Citations (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3590000A (en) | 1967-06-05 | 1971-06-29 | Xerox Corp | Solid developer for latent electrostatic images |
| US3800588A (en) | 1971-04-30 | 1974-04-02 | Mts System Corp | Multiple axis control system for vibration test apparatus |
| US4298672A (en) | 1978-06-01 | 1981-11-03 | Xerox Corporation | Toners containing alkyl pyridinium compounds and their hydrates |
| US4338390A (en) | 1980-12-04 | 1982-07-06 | Xerox Corporation | Quarternary ammonium sulfate or sulfonate charge control agents for electrophotographic developers compatible with viton fuser |
| US5227460A (en) | 1991-12-30 | 1993-07-13 | Xerox Corporation | Cross-linked toner resins |
| US5290654A (en) | 1992-07-29 | 1994-03-01 | Xerox Corporation | Microsuspension processes for toner compositions |
| US5278020A (en) | 1992-08-28 | 1994-01-11 | Xerox Corporation | Toner composition and processes thereof |
| US5308734A (en) | 1992-12-14 | 1994-05-03 | Xerox Corporation | Toner processes |
| US5346797A (en) | 1993-02-25 | 1994-09-13 | Xerox Corporation | Toner processes |
| US5348832A (en) | 1993-06-01 | 1994-09-20 | Xerox Corporation | Toner compositions |
| US5364729A (en) | 1993-06-25 | 1994-11-15 | Xerox Corporation | Toner aggregation processes |
| US5370963A (en) | 1993-06-25 | 1994-12-06 | Xerox Corporation | Toner emulsion aggregation processes |
| US5403693A (en) | 1993-06-25 | 1995-04-04 | Xerox Corporation | Toner aggregation and coalescence processes |
| US5405728A (en) | 1993-06-25 | 1995-04-11 | Xerox Corporation | Toner aggregation processes |
| US5418108A (en) | 1993-06-25 | 1995-05-23 | Xerox Corporation | Toner emulsion aggregation process |
| US5344738A (en) | 1993-06-25 | 1994-09-06 | Xerox Corporation | Process of making toner compositions |
| US5366841A (en) | 1993-09-30 | 1994-11-22 | Xerox Corporation | Toner aggregation processes |
| US5723253A (en) | 1994-12-05 | 1998-03-03 | Konica Corporation | Light-sensitive composition and light-sensitive lithographic printing plate containing o-quinonediazide compound, novolak resin, polymer and enclosure compound |
| US5501935A (en) | 1995-01-17 | 1996-03-26 | Xerox Corporation | Toner aggregation processes |
| US5977210A (en) | 1995-01-30 | 1999-11-02 | Xerox Corporation | Modified emulsion aggregation processes |
| US5527658A (en) | 1995-03-13 | 1996-06-18 | Xerox Corporation | Toner aggregation processes using water insoluble transition metal containing powder |
| US5496676A (en) | 1995-03-27 | 1996-03-05 | Xerox Corporation | Toner aggregation processes |
| US5744520A (en) | 1995-07-03 | 1998-04-28 | Xerox Corporation | Aggregation processes |
| US5585215A (en) | 1996-06-13 | 1996-12-17 | Xerox Corporation | Toner compositions |
| US5650255A (en) | 1996-09-03 | 1997-07-22 | Xerox Corporation | Low shear toner aggregation processes |
| US5925488A (en) | 1996-09-03 | 1999-07-20 | Xerox Corporation | Toner processes using in-situ tricalcium phospate |
| US5804349A (en) | 1996-10-02 | 1998-09-08 | Xerox Corporation | Acrylonitrile-modified toner compositions and processes |
| US5650256A (en) | 1996-10-02 | 1997-07-22 | Xerox Corporation | Toner processes |
| US5747215A (en) | 1997-03-28 | 1998-05-05 | Xerox Corporation | Toner compositions and processes |
| US5763133A (en) | 1997-03-28 | 1998-06-09 | Xerox Corporation | Toner compositions and processes |
| US5902710A (en) | 1997-07-31 | 1999-05-11 | Xerox Corporation | Toner processes |
| US5827633A (en) | 1997-07-31 | 1998-10-27 | Xerox Corporation | Toner processes |
| US5766818A (en) | 1997-10-29 | 1998-06-16 | Xerox Corporation | Toner processes with hydrolyzable surfactant |
| US5910387A (en) | 1998-01-13 | 1999-06-08 | Xerox Corporation | Toner compositions with acrylonitrile and processes |
| US5869215A (en) | 1998-01-13 | 1999-02-09 | Xerox Corporation | Toner compositions and processes thereof |
| US5916725A (en) | 1998-01-13 | 1999-06-29 | Xerox Corporation | Surfactant free toner processes |
| US5919595A (en) | 1998-01-13 | 1999-07-06 | Xerox Corporation | Toner process with cationic salts |
| US5853944A (en) | 1998-01-13 | 1998-12-29 | Xerox Corporation | Toner processes |
| US5840462A (en) | 1998-01-13 | 1998-11-24 | Xerox Corporation | Toner processes |
| US5863698A (en) | 1998-04-13 | 1999-01-26 | Xerox Corporation | Toner processes |
| US6214507B1 (en) | 1998-08-11 | 2001-04-10 | Xerox Corporation | Toner compositions |
| US6780500B2 (en) | 2000-11-16 | 2004-08-24 | Catherine Dumouchel | Part made of recycled thermoplastic material, a corresponding method of manufacture, and a pallet comprising at least one bar of this type |
| US6730450B1 (en) | 2000-11-28 | 2004-05-04 | Xerox Corporation | Toner compositions comprising polyester resin and poly (3,4-ethylenedioxythiophene) |
| US6743559B2 (en) | 2000-11-28 | 2004-06-01 | Xerox Corporation | Toner compositions comprising polyester resin and polypyrrole |
| US6756176B2 (en) | 2002-09-27 | 2004-06-29 | Xerox Corporation | Toner processes |
| US6830860B2 (en) | 2003-01-22 | 2004-12-14 | Xerox Corporation | Toner compositions and processes thereof |
| US20040202952A1 (en) | 2003-04-14 | 2004-10-14 | Xerox Corporation | Toner processes |
| US7029817B2 (en) | 2004-02-13 | 2006-04-18 | Xerox Corporation | Toner processes |
| DE112010004799T5 (de) | 2009-12-14 | 2012-11-15 | Kao Corporation | Verfahren zur Tonerherstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| MX352061B (es) | 2017-11-08 |
| CA2852402A1 (en) | 2014-12-28 |
| MX2014007982A (es) | 2015-05-06 |
| BR102014014482A2 (pt) | 2015-06-30 |
| JP2015011346A (ja) | 2015-01-19 |
| CA2852402C (en) | 2017-01-17 |
| US20150004542A1 (en) | 2015-01-01 |
| DE102014211916A1 (de) | 2014-12-31 |
| US9023574B2 (en) | 2015-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5853943A (en) | Toner processes | |
| DE69833080T2 (de) | Verfahren zur Tonerherstellung | |
| US6503680B1 (en) | Latex processes | |
| US6447974B1 (en) | Polymerization processes | |
| DE69407875T2 (de) | Toneraggregationsverfahren | |
| US6673505B2 (en) | Toner coagulant processes | |
| DE102020112771B4 (de) | Toner und tonerherstellungsverfahren | |
| DE69916904T2 (de) | Tonerherstellungsverfahren | |
| DE60010192T2 (de) | Tensidefreies Emulsionspolymerisationsverfahren | |
| CA2746193C (en) | Continuous process for producing toner using an oscillatory flow continuous reactor | |
| DE102016204628A1 (de) | Tonerpartikel, umfassend sowohl Polyester- als auch Acrylatpolymere mit einer Polyesterhülle | |
| US7307111B2 (en) | Polymer particles containing a cross-linked polymer core and a linear non-cross-linked polymer shell, and toner formed therefrom | |
| US7291437B2 (en) | Toner processes | |
| DE102014208961A1 (de) | Tonerzusammensetzung | |
| DE102013221780B4 (de) | Tonerpartikel | |
| DE102014211916B4 (de) | Tonerprozess für hyperpigmentierte Toner | |
| DE60035819T2 (de) | Verfahren zur Tonerherstellung | |
| JP5109240B2 (ja) | 重合トナーの製造方法 | |
| DE102016221244A1 (de) | Styrol-/acrylat- und polyesterharzpartikel | |
| US10208186B2 (en) | Latex comprising colorant and methods of making the same | |
| DE102014209709A1 (de) | Kern-/hüllen-charge-kontroll-latex für ea-partikel | |
| JP2745227B2 (ja) | トナーの製造方法 | |
| DE102014203831A1 (de) | Emulsionsaggregationstoner mit verbesserter Partikelgrössenverteilung | |
| US20140370430A1 (en) | Low cost, low melt emulsion aggregation high gloss toners with low melt waxes | |
| JP2005171062A (ja) | ラテックスポリマーの調製法及び静電荷像現像用トナーの製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| R082 | Change of representative |
Representative=s name: GRUENECKER, KINKELDEY, STOCKMAIR & SCHWANHAEUS, DE Representative=s name: GRUENECKER PATENT- UND RECHTSANWAELTE PARTG MB, DE |
|
| R012 | Request for examination validly filed | ||
| R016 | Response to examination communication | ||
| R018 | Grant decision by examination section/examining division | ||
| R020 | Patent grant now final |