DD156209A1 - Elektrische entladungslampe mit keramikentladungsrohr - Google Patents
Elektrische entladungslampe mit keramikentladungsrohr Download PDFInfo
- Publication number
- DD156209A1 DD156209A1 DD81227451A DD22745181A DD156209A1 DD 156209 A1 DD156209 A1 DD 156209A1 DD 81227451 A DD81227451 A DD 81227451A DD 22745181 A DD22745181 A DD 22745181A DD 156209 A1 DD156209 A1 DD 156209A1
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- filaments
- power supply
- ceramic
- discharge lamp
- electric discharge
- Prior art date
Links
- 239000000919 ceramic Substances 0.000 title claims abstract description 38
- 239000000463 material Substances 0.000 claims abstract description 5
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 18
- 229910052758 niobium Inorganic materials 0.000 claims description 10
- 239000010955 niobium Substances 0.000 claims description 10
- 239000004020 conductor Substances 0.000 abstract description 18
- 238000010304 firing Methods 0.000 abstract 1
- 230000000694 effects Effects 0.000 description 6
- 230000035939 shock Effects 0.000 description 6
- 239000011521 glass Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 238000005476 soldering Methods 0.000 description 4
- 230000001627 detrimental effect Effects 0.000 description 3
- 229910000679 solder Inorganic materials 0.000 description 3
- 210000000056 organ Anatomy 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/36—Seals between parts of vessels; Seals for leading-in conductors; Leading-in conductors
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU8080304A HU178836B (en) | 1980-02-11 | 1980-02-11 | Electric discharge lamp of ceramic bulb |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD156209A1 true DD156209A1 (de) | 1982-08-04 |
Family
ID=10949005
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD81227451A DD156209A1 (de) | 1980-02-11 | 1981-02-05 | Elektrische entladungslampe mit keramikentladungsrohr |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4376905A (enExample) |
| EP (1) | EP0034113B1 (enExample) |
| JP (1) | JPS56128561A (enExample) |
| AR (1) | AR223093A1 (enExample) |
| BR (1) | BR8100689A (enExample) |
| DD (1) | DD156209A1 (enExample) |
| DE (1) | DE3167525D1 (enExample) |
| ES (1) | ES8202185A1 (enExample) |
| HU (1) | HU178836B (enExample) |
| IN (1) | IN154885B (enExample) |
| SU (1) | SU1138057A3 (enExample) |
| ZA (1) | ZA81274B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU181782B (en) * | 1981-01-09 | 1983-11-28 | Egyesuelt Izzolampa | Discharge vessel for high-pressure sodium-vapour discharge lamps |
| HU182834B (en) * | 1982-02-25 | 1984-03-28 | Egyesuelt Izzolampa | Electric current lead-in, preferably for discharge vessel of high-pressure gas-discharge light-sources |
| US4742269A (en) * | 1984-11-09 | 1988-05-03 | Ngk Insulators, Ltd. | Ceramic envelope device for high-pressure discharge lamp |
| DE9112690U1 (de) * | 1991-10-11 | 1991-12-05 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe |
| DE9207816U1 (de) * | 1992-06-10 | 1992-08-20 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe |
| DE4242122A1 (de) * | 1992-12-14 | 1994-06-16 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Verfahren zur Herstellung einer vakuumdichten Abdichtung zwischen einem keramischen und einem metallischen Partner, insbesondere zur Anwendung bei der Herstellung eines Entladungsgefäßes für eine Lampe, sowie damit hergestellte Entladungsgefäße und Lampen |
| DE4242123A1 (de) * | 1992-12-14 | 1994-06-16 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe mit einem keramischen Entladungsgefäß |
| US7521870B2 (en) | 2004-06-08 | 2009-04-21 | Ngk Insulators, Ltd. | Luminous containers and those for high pressure discharge lamps |
| US7288303B2 (en) | 2004-06-08 | 2007-10-30 | Ngk Insulators, Ltd. | Structures of brittle materials and metals |
| WO2005122214A1 (ja) * | 2004-06-08 | 2005-12-22 | Ngk Insulators, Ltd. | 発光容器および高圧放電灯用発光容器 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2329118A (en) * | 1941-07-12 | 1943-09-07 | Gen Electric | Electrode for electrical discharge devices |
| US2452626A (en) * | 1945-03-03 | 1948-11-02 | Gen Electric X Ray Corp | Electron emitter |
| US3992642A (en) * | 1975-12-15 | 1976-11-16 | Mcvey Charles I | Ceramic envelope plug and lead wire and seal |
| NL183613B (nl) * | 1978-03-15 | 1988-07-01 | Philips Nv | Elektrische lamp. |
| US4295075A (en) * | 1979-12-14 | 1981-10-13 | Gte Products Corporation | Arc discharge lamp having ceramic arc tube |
-
1980
- 1980-02-11 HU HU8080304A patent/HU178836B/hu unknown
-
1981
- 1981-01-15 ZA ZA00810274A patent/ZA81274B/xx unknown
- 1981-01-23 EP EP81730009A patent/EP0034113B1/de not_active Expired
- 1981-01-23 DE DE8181730009T patent/DE3167525D1/de not_active Expired
- 1981-01-28 JP JP1148181A patent/JPS56128561A/ja active Granted
- 1981-02-02 IN IN117/CAL/81A patent/IN154885B/en unknown
- 1981-02-03 SU SU813238728A patent/SU1138057A3/ru active
- 1981-02-04 US US06/231,237 patent/US4376905A/en not_active Expired - Fee Related
- 1981-02-05 DD DD81227451A patent/DD156209A1/de unknown
- 1981-02-05 BR BR8100689A patent/BR8100689A/pt unknown
- 1981-02-10 ES ES499273A patent/ES8202185A1/es not_active Expired
- 1981-02-10 AR AR284260A patent/AR223093A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0255905B2 (enExample) | 1990-11-28 |
| ES499273A0 (es) | 1982-01-16 |
| BR8100689A (pt) | 1981-08-18 |
| ES8202185A1 (es) | 1982-01-16 |
| ZA81274B (en) | 1982-04-28 |
| HU178836B (en) | 1982-07-28 |
| EP0034113A1 (de) | 1981-08-19 |
| JPS56128561A (en) | 1981-10-08 |
| IN154885B (enExample) | 1984-12-22 |
| AR223093A1 (es) | 1981-07-15 |
| SU1138057A3 (ru) | 1985-01-30 |
| EP0034113B1 (de) | 1984-12-05 |
| US4376905A (en) | 1983-03-15 |
| DE3167525D1 (en) | 1985-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69600960T2 (de) | Hochdruckentladungslampe | |
| EP0239006B1 (de) | Halogenglühlampe und Verfahren zu ihrer Herstellung | |
| DD156209A1 (de) | Elektrische entladungslampe mit keramikentladungsrohr | |
| DE8908561U1 (de) | Hochdruckentladungslampe | |
| EP0446460A2 (de) | Einseitig gequetschte Halogenglühlampe | |
| DE69405181T2 (de) | Hochdruck-Entladungslampe | |
| DE1291419B (de) | Rueckwaertswellenroehre mit einer wendelfoermigen Verzoegerungsleitung | |
| EP0479088B1 (de) | Hochdruckentladungslampe und Verfahren zur Herstellung der Lampe | |
| DE1067930B (enExample) | ||
| DE1054575B (de) | Einschmelzung und Halterung fuer Hochdruckentladungslampen | |
| DE896686C (de) | Elektronen-Entladungsroehre | |
| EP0588201A2 (de) | Hochdruckentladungslampe und Herstellungsverfahren für eine Hochdruckentladungslampe | |
| DE10312720A1 (de) | Dielektrische Barriere-Entladungslampe mit Quetschdichtung | |
| DE2909259A1 (de) | Wolfram-halogen-lampe fuer einen monoblock-scheinwerfer sowie methode zu ihrer herstellung | |
| DE3245167C2 (enExample) | ||
| DE327634C (de) | Elektrische Schwingungsroehre | |
| DE9202638U1 (de) | Niederdruckentladungslampe | |
| DE1539527C (de) | Quecksilberhochdrucklampe kleiner Leistung und kleiner Abmessung | |
| DE2356661C3 (de) | Glühlampe, insbesondere Halogenlampe | |
| DE965882C (de) | Gasentladungsroehre mit kalter Kathode | |
| DE102018201068B4 (de) | Glühlampe für fahrzeugscheinwerfer und herstellungsverfahren | |
| DE1917495B2 (de) | Verfahren zur herstellung einer elektrischen gluehlampe | |
| AT331918B (de) | Quecksilberdampflampe | |
| AT143767B (de) | Elektrische Entladungsröhre oder Glühlampe. | |
| DE202007011210U1 (de) | Baueinheit für eine elektrische Lampe mit Außenkolben |