DD140409A5 - Herbizide mittel - Google Patents
Herbizide mittel Download PDFInfo
- Publication number
- DD140409A5 DD140409A5 DD78208557A DD20855778A DD140409A5 DD 140409 A5 DD140409 A5 DD 140409A5 DD 78208557 A DD78208557 A DD 78208557A DD 20855778 A DD20855778 A DD 20855778A DD 140409 A5 DD140409 A5 DD 140409A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- methyl
- radical
- optionally substituted
- phenyl
- hydrogen
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title abstract description 20
- 239000004009 herbicide Substances 0.000 title description 7
- -1 acyl radical Chemical class 0.000 claims abstract description 206
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 31
- 239000001257 hydrogen Substances 0.000 claims abstract description 30
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 18
- 150000002367 halogens Chemical class 0.000 claims abstract description 17
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims abstract description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims abstract description 3
- 125000004670 alkyl amino thio carbonyl group Chemical group 0.000 claims abstract description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 3
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims abstract description 3
- 125000004671 dialkylaminothiocarbonyl group Chemical group 0.000 claims abstract description 3
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims abstract 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims abstract 2
- 239000000460 chlorine Chemical group 0.000 claims description 65
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 63
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 29
- 150000003839 salts Chemical group 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical group O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 22
- 125000003545 alkoxy group Chemical group 0.000 claims description 17
- 150000002431 hydrogen Chemical class 0.000 claims description 16
- 125000004414 alkyl thio group Chemical group 0.000 claims description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 10
- 229910052717 sulfur Chemical group 0.000 claims description 9
- 239000011593 sulfur Chemical group 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 229910052748 manganese Inorganic materials 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 150000001602 bicycloalkyls Chemical group 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 125000004471 alkyl aminosulfonyl group Chemical group 0.000 claims 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 15
- 239000007787 solid Substances 0.000 abstract description 10
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 abstract description 2
- 239000007788 liquid Substances 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 49
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 39
- 230000006378 damage Effects 0.000 description 28
- 238000012360 testing method Methods 0.000 description 23
- 239000003921 oil Substances 0.000 description 22
- 235000019198 oils Nutrition 0.000 description 22
- 239000004480 active ingredient Substances 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 13
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000013543 active substance Substances 0.000 description 11
- 239000006185 dispersion Substances 0.000 description 11
- 238000000034 method Methods 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 150000003217 pyrazoles Chemical class 0.000 description 10
- 244000105624 Arachis hypogaea Species 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 238000011282 treatment Methods 0.000 description 9
- 244000052363 Cynodon dactylon Species 0.000 description 8
- 240000004713 Pisum sativum Species 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 241000192043 Echinochloa Species 0.000 description 7
- 235000021506 Ipomoea Nutrition 0.000 description 7
- 241000207783 Ipomoea Species 0.000 description 7
- 244000042664 Matricaria chamomilla Species 0.000 description 7
- 235000010582 Pisum sativum Nutrition 0.000 description 7
- 244000062793 Sorghum vulgare Species 0.000 description 7
- 240000006694 Stellaria media Species 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 230000012010 growth Effects 0.000 description 7
- 235000010777 Arachis hypogaea Nutrition 0.000 description 6
- 235000003255 Carthamus tinctorius Nutrition 0.000 description 6
- 244000020518 Carthamus tinctorius Species 0.000 description 6
- 241000219146 Gossypium Species 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 6
- 241000205407 Polygonum Species 0.000 description 6
- 241000219782 Sesbania Species 0.000 description 6
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 210000001699 lower leg Anatomy 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical class NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 5
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 5
- 244000024671 Brassica kaber Species 0.000 description 5
- 241000219312 Chenopodium Species 0.000 description 5
- 244000000626 Daucus carota Species 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 244000020551 Helianthus annuus Species 0.000 description 5
- 235000017945 Matricaria Nutrition 0.000 description 5
- 235000005775 Setaria Nutrition 0.000 description 5
- 241000232088 Setaria <nematode> Species 0.000 description 5
- 241000207763 Solanum Species 0.000 description 5
- 235000002634 Solanum Nutrition 0.000 description 5
- 235000002595 Solanum tuberosum Nutrition 0.000 description 5
- 244000061456 Solanum tuberosum Species 0.000 description 5
- 240000008042 Zea mays Species 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 5
- 235000020232 peanut Nutrition 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 241000219318 Amaranthus Species 0.000 description 4
- 241000335053 Beta vulgaris Species 0.000 description 4
- 235000011293 Brassica napus Nutrition 0.000 description 4
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 4
- 235000002767 Daucus carota Nutrition 0.000 description 4
- 241000221079 Euphorbia <genus> Species 0.000 description 4
- 240000009088 Fragaria x ananassa Species 0.000 description 4
- 235000003222 Helianthus annuus Nutrition 0.000 description 4
- 241000221024 Mercurialis Species 0.000 description 4
- 240000000111 Saccharum officinarum Species 0.000 description 4
- 235000007201 Saccharum officinarum Nutrition 0.000 description 4
- 244000269722 Thea sinensis Species 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 239000004359 castor oil Substances 0.000 description 4
- 235000019438 castor oil Nutrition 0.000 description 4
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 4
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 241000894007 species Species 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 240000001592 Amaranthus caudatus Species 0.000 description 3
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 3
- 244000099147 Ananas comosus Species 0.000 description 3
- 235000007119 Ananas comosus Nutrition 0.000 description 3
- 235000017060 Arachis glabrata Nutrition 0.000 description 3
- 235000018262 Arachis monticola Nutrition 0.000 description 3
- 244000003416 Asparagus officinalis Species 0.000 description 3
- 235000005340 Asparagus officinalis Nutrition 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 3
- 235000007319 Avena orientalis Nutrition 0.000 description 3
- 235000021537 Beetroot Nutrition 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 235000021533 Beta vulgaris Nutrition 0.000 description 3
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 3
- 235000006463 Brassica alba Nutrition 0.000 description 3
- 235000008427 Brassica arvensis Nutrition 0.000 description 3
- 244000140786 Brassica hirta Species 0.000 description 3
- 240000002791 Brassica napus Species 0.000 description 3
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 3
- 235000005940 Centaurea cyanus Nutrition 0.000 description 3
- 240000004385 Centaurea cyanus Species 0.000 description 3
- 235000005979 Citrus limon Nutrition 0.000 description 3
- 244000131522 Citrus pyriformis Species 0.000 description 3
- 240000007154 Coffea arabica Species 0.000 description 3
- 240000008067 Cucumis sativus Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 235000001950 Elaeis guineensis Nutrition 0.000 description 3
- 235000014820 Galium aparine Nutrition 0.000 description 3
- 240000005702 Galium aparine Species 0.000 description 3
- 241000520028 Lamium Species 0.000 description 3
- 241000209082 Lolium Species 0.000 description 3
- 240000003183 Manihot esculenta Species 0.000 description 3
- 240000004658 Medicago sativa Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 235000010617 Phaseolus lunatus Nutrition 0.000 description 3
- 244000292697 Polygonum aviculare Species 0.000 description 3
- 244000234609 Portulaca oleracea Species 0.000 description 3
- 235000001855 Portulaca oleracea Nutrition 0.000 description 3
- 235000014443 Pyrus communis Nutrition 0.000 description 3
- 240000001987 Pyrus communis Species 0.000 description 3
- 244000286177 Raphanus raphanistrum Species 0.000 description 3
- 244000281247 Ribes rubrum Species 0.000 description 3
- 235000016911 Ribes sativum Nutrition 0.000 description 3
- 240000006410 Sida spinosa Species 0.000 description 3
- 241000220261 Sinapis Species 0.000 description 3
- 235000002594 Solanum nigrum Nutrition 0.000 description 3
- 235000006468 Thea sinensis Nutrition 0.000 description 3
- 235000015724 Trifolium pratense Nutrition 0.000 description 3
- 244000067505 Xanthium strumarium Species 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 244000038559 crop plants Species 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 235000013312 flour Nutrition 0.000 description 3
- 230000035784 germination Effects 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 238000003306 harvesting Methods 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- VYQNWZOUAUKGHI-UHFFFAOYSA-N monobenzone Chemical compound C1=CC(O)=CC=C1OCC1=CC=CC=C1 VYQNWZOUAUKGHI-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 3
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 3
- 235000013526 red clover Nutrition 0.000 description 3
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 3
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 2
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical class CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- FOGYNLXERPKEGN-UHFFFAOYSA-N 3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfopropyl)phenoxy]propane-1-sulfonic acid Chemical class COC1=CC=CC(CC(CS(O)(=O)=O)OC=2C(=CC(CCCS(O)(=O)=O)=CC=2)OC)=C1O FOGYNLXERPKEGN-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- KKIGUVBJOHCXSP-UHFFFAOYSA-N 4-phenylthiosemicarbazide Chemical compound NNC(=S)NC1=CC=CC=C1 KKIGUVBJOHCXSP-UHFFFAOYSA-N 0.000 description 2
- 241000219144 Abutilon Species 0.000 description 2
- 244000291564 Allium cepa Species 0.000 description 2
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 2
- 241000743985 Alopecurus Species 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 235000011371 Brassica hirta Nutrition 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- 241000132570 Centaurea Species 0.000 description 2
- 240000006122 Chenopodium album Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241001672694 Citrus reticulata Species 0.000 description 2
- 240000000560 Citrus x paradisi Species 0.000 description 2
- 241000207892 Convolvulus Species 0.000 description 2
- 241001354404 Cyanus Species 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- 241000208296 Datura Species 0.000 description 2
- 240000008853 Datura stramonium Species 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- 240000003133 Elaeis guineensis Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 241001101998 Galium Species 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 244000299507 Gossypium hirsutum Species 0.000 description 2
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 2
- 235000003230 Helianthus tuberosus Nutrition 0.000 description 2
- 240000008892 Helianthus tuberosus Species 0.000 description 2
- 244000043261 Hevea brasiliensis Species 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 244000017020 Ipomoea batatas Species 0.000 description 2
- 240000008415 Lactuca sativa Species 0.000 description 2
- 240000006503 Lamium purpureum Species 0.000 description 2
- 240000004322 Lens culinaris Species 0.000 description 2
- 240000006240 Linum usitatissimum Species 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 235000011430 Malus pumila Nutrition 0.000 description 2
- 235000015103 Malus silvestris Nutrition 0.000 description 2
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 2
- 235000010624 Medicago sativa Nutrition 0.000 description 2
- 241000221026 Mercurialis annua Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 244000061176 Nicotiana tabacum Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 240000007817 Olea europaea Species 0.000 description 2
- 244000115721 Pennisetum typhoides Species 0.000 description 2
- 235000007195 Pennisetum typhoides Nutrition 0.000 description 2
- 244000170788 Persicaria vulgaris Species 0.000 description 2
- 244000100170 Phaseolus lunatus Species 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241000218657 Picea Species 0.000 description 2
- 235000008124 Picea excelsa Nutrition 0.000 description 2
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 2
- 235000011613 Pinus brutia Nutrition 0.000 description 2
- 241000018646 Pinus brutia Species 0.000 description 2
- 235000006386 Polygonum aviculare Nutrition 0.000 description 2
- 244000007021 Prunus avium Species 0.000 description 2
- 235000010401 Prunus avium Nutrition 0.000 description 2
- 240000005809 Prunus persica Species 0.000 description 2
- 235000006040 Prunus persica var persica Nutrition 0.000 description 2
- 241001506137 Rapa Species 0.000 description 2
- 241000220259 Raphanus Species 0.000 description 2
- 244000171263 Ribes grossularia Species 0.000 description 2
- 235000002357 Ribes grossularia Nutrition 0.000 description 2
- 235000002355 Ribes spicatum Nutrition 0.000 description 2
- 235000016897 Ribes triste Nutrition 0.000 description 2
- 235000004443 Ricinus communis Nutrition 0.000 description 2
- 235000003434 Sesamum indicum Nutrition 0.000 description 2
- 241000533293 Sesbania emerus Species 0.000 description 2
- 244000061457 Solanum nigrum Species 0.000 description 2
- 235000021536 Sugar beet Nutrition 0.000 description 2
- 244000098338 Triticum aestivum Species 0.000 description 2
- 229920001807 Urea-formaldehyde Polymers 0.000 description 2
- 240000000851 Vaccinium corymbosum Species 0.000 description 2
- 244000042295 Vigna mungo Species 0.000 description 2
- 235000006085 Vigna mungo var mungo Nutrition 0.000 description 2
- 235000010721 Vigna radiata var radiata Nutrition 0.000 description 2
- 235000010726 Vigna sinensis Nutrition 0.000 description 2
- 241001506766 Xanthium Species 0.000 description 2
- 241000209149 Zea Species 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- SMLHHBQGIJMAIM-UHFFFAOYSA-N calcium;2-dodecylbenzenesulfonic acid Chemical compound [Ca].CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O SMLHHBQGIJMAIM-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940126214 compound 3 Drugs 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 244000013123 dwarf bean Species 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000003864 humus Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 125000000250 methylamino group Chemical class [H]N(*)C([H])([H])[H] 0.000 description 2
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- UAJUXJSXCLUTNU-UHFFFAOYSA-N pranlukast Chemical compound C=1C=C(OCCCCC=2C=CC=CC=2)C=CC=1C(=O)NC(C=1)=CC=C(C(C=2)=O)C=1OC=2C=1N=NNN=1 UAJUXJSXCLUTNU-UHFFFAOYSA-N 0.000 description 2
- 229960004583 pranlukast Drugs 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 235000021012 strawberries Nutrition 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- 229960000278 theophylline Drugs 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- VOLGAXAGEUPBDM-UHFFFAOYSA-N $l^{1}-oxidanylethane Chemical group CC[O] VOLGAXAGEUPBDM-UHFFFAOYSA-N 0.000 description 1
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical class CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- AIONMUKAPQSLHW-UHFFFAOYSA-N 1-amino-1,3-diphenylthiourea Chemical compound C=1C=CC=CC=1N(N)C(=S)NC1=CC=CC=C1 AIONMUKAPQSLHW-UHFFFAOYSA-N 0.000 description 1
- YZGLZXFPFUCNQE-UHFFFAOYSA-N 1-amino-1-methyl-3-phenylthiourea Chemical compound CN(N)C(=S)NC1=CC=CC=C1 YZGLZXFPFUCNQE-UHFFFAOYSA-N 0.000 description 1
- NXCOJHOEPLNGKL-UHFFFAOYSA-N 1-amino-3-(2-methylpropyl)thiourea Chemical compound CC(C)CNC(=S)NN NXCOJHOEPLNGKL-UHFFFAOYSA-N 0.000 description 1
- FKKAGFLIPSSCHT-UHFFFAOYSA-N 1-dodecoxydodecane;sulfuric acid Chemical compound OS(O)(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC FKKAGFLIPSSCHT-UHFFFAOYSA-N 0.000 description 1
- GQEZCXVZFLOKMC-UHFFFAOYSA-N 1-hexadecene Chemical class CCCCCCCCCCCCCCC=C GQEZCXVZFLOKMC-UHFFFAOYSA-N 0.000 description 1
- ZYVYEJXMYBUCMN-UHFFFAOYSA-N 1-methoxy-2-methylpropane Chemical group COCC(C)C ZYVYEJXMYBUCMN-UHFFFAOYSA-N 0.000 description 1
- XUJLWPFSUCHPQL-UHFFFAOYSA-N 11-methyldodecan-1-ol Chemical compound CC(C)CCCCCCCCCCO XUJLWPFSUCHPQL-UHFFFAOYSA-N 0.000 description 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 1
- ZOAMZFNAPHWBEN-UHFFFAOYSA-N 2-$l^{1}-oxidanylpropane Chemical compound CC(C)[O] ZOAMZFNAPHWBEN-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- TVOSZUQZKNFWJW-UHFFFAOYSA-N 2-(5-anilino-3-methyl-1-phenylpyrazol-4-yl)acetic acid Chemical compound OC(=O)CC=1C(C)=NN(C=2C=CC=CC=2)C=1NC1=CC=CC=C1 TVOSZUQZKNFWJW-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical class CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- GTLJSJNKRLFVSJ-UHFFFAOYSA-N 3,4,5,6-tetrahydro-2h-azepin-7-amine Chemical class N=C1CCCCCN1 GTLJSJNKRLFVSJ-UHFFFAOYSA-N 0.000 description 1
- 125000004462 3,4-difluorophenylmethyl group Chemical group FC=1C=C(C=CC1F)C* 0.000 description 1
- VLRGXXKFHVJQOL-UHFFFAOYSA-N 3-chloropentane-2,4-dione Chemical compound CC(=O)C(Cl)C(C)=O VLRGXXKFHVJQOL-UHFFFAOYSA-N 0.000 description 1
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 1
- 125000004917 3-methyl-2-butyl group Chemical group CC(C(C)*)C 0.000 description 1
- 125000006418 4-methylphenylsulfonyl group Chemical group 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 235000004507 Abies alba Nutrition 0.000 description 1
- 241000191291 Abies alba Species 0.000 description 1
- 240000000321 Abutilon grandifolium Species 0.000 description 1
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 244000144730 Amygdalus persica Species 0.000 description 1
- 235000011446 Amygdalus persica Nutrition 0.000 description 1
- 235000003276 Apios tuberosa Nutrition 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 235000010744 Arachis villosulicarpa Nutrition 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 244000060924 Brassica campestris Species 0.000 description 1
- 235000005637 Brassica campestris Nutrition 0.000 description 1
- 235000006008 Brassica napus var napus Nutrition 0.000 description 1
- 240000000385 Brassica napus var. napus Species 0.000 description 1
- 240000008100 Brassica rapa Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000045232 Canavalia ensiformis Species 0.000 description 1
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 1
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 1
- WLYGSPLCNKYESI-RSUQVHIMSA-N Carthamin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1[C@@]1(O)C(O)=C(C(=O)\C=C\C=2C=CC(O)=CC=2)C(=O)C(\C=C\2C([C@](O)([C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)C(O)=C(C(=O)\C=C\C=3C=CC(O)=CC=3)C/2=O)=O)=C1O WLYGSPLCNKYESI-RSUQVHIMSA-N 0.000 description 1
- 241000208809 Carthamus Species 0.000 description 1
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 235000011498 Chenopodium album var missouriense Nutrition 0.000 description 1
- 235000013328 Chenopodium album var. album Nutrition 0.000 description 1
- 235000014052 Chenopodium album var. microphyllum Nutrition 0.000 description 1
- 235000014050 Chenopodium album var. stevensii Nutrition 0.000 description 1
- 235000013012 Chenopodium album var. striatum Nutrition 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 235000001759 Citrus maxima Nutrition 0.000 description 1
- 244000276331 Citrus maxima Species 0.000 description 1
- 235000009088 Citrus pyriformis Nutrition 0.000 description 1
- 235000005976 Citrus sinensis Nutrition 0.000 description 1
- 240000002319 Citrus sinensis Species 0.000 description 1
- 241000543381 Cliftonia monophylla Species 0.000 description 1
- 235000007460 Coffea arabica Nutrition 0.000 description 1
- 241000228031 Coffea liberica Species 0.000 description 1
- 244000016593 Coffea robusta Species 0.000 description 1
- 235000002187 Coffea robusta Nutrition 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 244000241257 Cucumis melo Species 0.000 description 1
- 235000009842 Cucumis melo Nutrition 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 235000009849 Cucumis sativus Nutrition 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- 244000108484 Cyperus difformis Species 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- RDJTWDKSYLLHRW-UHFFFAOYSA-N Dinoseb acetate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(C)=O RDJTWDKSYLLHRW-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 244000127993 Elaeis melanococca Species 0.000 description 1
- 240000005002 Erythronium dens canis Species 0.000 description 1
- 244000081856 Euphorbia geniculata Species 0.000 description 1
- 241000221017 Euphorbiaceae Species 0.000 description 1
- 244000286663 Ficus elastica Species 0.000 description 1
- 235000016623 Fragaria vesca Nutrition 0.000 description 1
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 235000014751 Gossypium arboreum Nutrition 0.000 description 1
- 240000001814 Gossypium arboreum Species 0.000 description 1
- 240000000047 Gossypium barbadense Species 0.000 description 1
- 235000009429 Gossypium barbadense Nutrition 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 235000002678 Ipomoea batatas Nutrition 0.000 description 1
- 240000001549 Ipomoea eriocarpa Species 0.000 description 1
- 235000005146 Ipomoea eriocarpa Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 235000003228 Lactuca sativa Nutrition 0.000 description 1
- 235000009198 Lamium amplexicaule Nutrition 0.000 description 1
- 244000303225 Lamium amplexicaule Species 0.000 description 1
- 235000009193 Lamium purpureum Nutrition 0.000 description 1
- 235000012587 Lamium purpureum var. incisum Nutrition 0.000 description 1
- 235000010666 Lens esculenta Nutrition 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 235000003403 Limnocharis flava Nutrition 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 244000100545 Lolium multiflorum Species 0.000 description 1
- 241000227653 Lycopersicon Species 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 241001300479 Macroptilium Species 0.000 description 1
- 208000002720 Malnutrition Diseases 0.000 description 1
- 241000220225 Malus Species 0.000 description 1
- 244000081841 Malus domestica Species 0.000 description 1
- 244000070406 Malus silvestris Species 0.000 description 1
- 235000004456 Manihot esculenta Nutrition 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 241001479543 Mentha x piperita Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000234295 Musa Species 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 241000208134 Nicotiana rustica Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 235000017590 Nymphoides indica Nutrition 0.000 description 1
- 240000000905 Nymphoides indica Species 0.000 description 1
- 235000002725 Olea europaea Nutrition 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 244000037751 Persicaria maculosa Species 0.000 description 1
- 235000017845 Persicaria vulgaris Nutrition 0.000 description 1
- 240000009164 Petroselinum crispum Species 0.000 description 1
- 235000002770 Petroselinum crispum Nutrition 0.000 description 1
- 240000004133 Petroselinum crispum Radicosum Group Species 0.000 description 1
- 244000062780 Petroselinum sativum Species 0.000 description 1
- 241000218596 Picea rubens Species 0.000 description 1
- 241000219843 Pisum Species 0.000 description 1
- 235000016816 Pisum sativum subsp sativum Nutrition 0.000 description 1
- 235000010105 Polygonum aviculare subsp depressum Nutrition 0.000 description 1
- 235000004442 Polygonum persicaria Nutrition 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- 241001290151 Prunus avium subsp. avium Species 0.000 description 1
- 244000141353 Prunus domestica Species 0.000 description 1
- 235000011435 Prunus domestica Nutrition 0.000 description 1
- 235000000241 Raphanus raphanistrum Nutrition 0.000 description 1
- 235000000245 Raphanus raphanistrum subsp raphanistrum Nutrition 0.000 description 1
- 235000011380 Raphanus sativus Nutrition 0.000 description 1
- 240000000528 Ricinus communis Species 0.000 description 1
- 244000007853 Sarothamnus scoparius Species 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- 244000040738 Sesamum orientale Species 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- 235000002834 Sida rhombifolia Nutrition 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 240000002307 Solanum ptychanthum Species 0.000 description 1
- 235000007230 Sorghum bicolor Nutrition 0.000 description 1
- 235000015503 Sorghum bicolor subsp. drummondii Nutrition 0.000 description 1
- 240000002439 Sorghum halepense Species 0.000 description 1
- 244000138286 Sorghum saccharatum Species 0.000 description 1
- 241001271940 Sorghum x almum Species 0.000 description 1
- 244000300264 Spinacia oleracea Species 0.000 description 1
- 244000170625 Sudangrass Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 206010044278 Trace element deficiency Diseases 0.000 description 1
- 240000002913 Trifolium pratense Species 0.000 description 1
- 244000274883 Urtica dioica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- 235000003095 Vaccinium corymbosum Nutrition 0.000 description 1
- 240000001717 Vaccinium macrocarpon Species 0.000 description 1
- 235000012545 Vaccinium macrocarpon Nutrition 0.000 description 1
- 235000002118 Vaccinium oxycoccus Nutrition 0.000 description 1
- 235000017606 Vaccinium vitis idaea Nutrition 0.000 description 1
- 244000077923 Vaccinium vitis idaea Species 0.000 description 1
- 244000105016 Vicia faba var. minor Species 0.000 description 1
- 241000219977 Vigna Species 0.000 description 1
- 240000004922 Vigna radiata Species 0.000 description 1
- 235000011469 Vigna radiata var sublobata Nutrition 0.000 description 1
- 244000042327 Vigna sinensis Species 0.000 description 1
- 244000042314 Vigna unguiculata Species 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 241000482268 Zea mays subsp. mays Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- BOGSOFADOWIECK-UHFFFAOYSA-N [N].C=1C=NNC=1 Chemical compound [N].C=1C=NNC=1 BOGSOFADOWIECK-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 244000022203 blackseeded proso millet Species 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 235000009120 camo Nutrition 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 235000005607 chanvre indien Nutrition 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 235000004634 cranberry Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 150000004656 dimethylamines Chemical class 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- YPXGHKWOJXQLQU-UHFFFAOYSA-N ethyl 5-amino-1h-pyrazole-4-carboxylate Chemical compound CCOC(=O)C=1C=NNC=1N YPXGHKWOJXQLQU-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000004426 flaxseed Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 235000021331 green beans Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 239000011487 hemp Substances 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N heptadecan-1-ol Chemical class CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000006262 isopropyl amino sulfonyl group Chemical group 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 235000012245 magnesium oxide Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- LNDPZTYKWLDMAT-UHFFFAOYSA-L magnesium;dicarbamate Chemical compound [Mg+2].NC([O-])=O.NC([O-])=O LNDPZTYKWLDMAT-UHFFFAOYSA-L 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000001771 mentha piperita Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- QABLOFMHHSOFRJ-UHFFFAOYSA-N methyl 2-chloroacetate Chemical compound COC(=O)CCl QABLOFMHHSOFRJ-UHFFFAOYSA-N 0.000 description 1
- KNJRHXFQCJXGAK-UHFFFAOYSA-N methyl 5-methyl-3-(2-methylpropylamino)-1h-pyrazole-4-carboxylate Chemical compound COC(=O)C1=C(C)NN=C1NCC(C)C KNJRHXFQCJXGAK-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical compound COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000002540 palm oil Substances 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 235000011197 perejil Nutrition 0.000 description 1
- QZHDEAJFRJCDMF-UHFFFAOYSA-N perfluorohexanesulfonic acid Chemical compound OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F QZHDEAJFRJCDMF-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 239000001739 pinus spp. Substances 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- XHIHKTCUUHGKSF-UHFFFAOYSA-N piperidine-1-carbothiohydrazide Chemical compound NNC(=S)N1CCCCC1 XHIHKTCUUHGKSF-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 125000005624 silicic acid group Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000012916 structural analysis Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- NMGNJWORLGLLHQ-UHFFFAOYSA-M sulcofuron-sodium Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(Cl)=CC=C1OC1=CC=C(Cl)C=C1NC(=O)NC1=CC=C(Cl)C(Cl)=C1 NMGNJWORLGLLHQ-UHFFFAOYSA-M 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000011269 tar Substances 0.000 description 1
- 235000012976 tarts Nutrition 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 150000004886 thiomorpholines Chemical class 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/56—1,2-Diazoles; Hydrogenated 1,2-diazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
- A01N47/16—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof the nitrogen atom being part of a heterocyclic ring
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/38—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the group >N—CO—N< where at least one nitrogen atom is part of a heterocyclic ring; Thio analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
- C07D231/40—Acylated on said nitrogen atom
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Dentistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Plant Pathology (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772747531 DE2747531A1 (de) | 1977-10-22 | 1977-10-22 | Substituierte 3-aminopyrazole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD140409A5 true DD140409A5 (de) | 1980-03-05 |
Family
ID=6022057
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD78208557A DD140409A5 (de) | 1977-10-22 | 1978-10-19 | Herbizide mittel |
Country Status (19)
| Country | Link |
|---|---|
| US (4) | US4260775A (cs) |
| EP (1) | EP0002180B1 (cs) |
| JP (1) | JPS5470270A (cs) |
| AT (1) | AT362957B (cs) |
| AU (1) | AU522994B2 (cs) |
| BR (1) | BR7806938A (cs) |
| CA (1) | CA1109879A (cs) |
| CS (1) | CS203931B2 (cs) |
| DD (1) | DD140409A5 (cs) |
| DE (2) | DE2747531A1 (cs) |
| DK (1) | DK466578A (cs) |
| GR (1) | GR63684B (cs) |
| HU (1) | HU180670B (cs) |
| IL (1) | IL55747A (cs) |
| IT (1) | IT1109264B (cs) |
| PL (1) | PL109532B2 (cs) |
| PT (1) | PT68676A (cs) |
| SU (1) | SU967257A3 (cs) |
| ZA (1) | ZA785905B (cs) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6426333B1 (en) | 1996-09-19 | 2002-07-30 | Merial | Spot-on formulations for combating parasites |
| DE2920933A1 (de) * | 1979-05-23 | 1980-12-04 | Basf Ag | 3-aryl-5-methyl-pyrazol-4-carbonsaeureester enthaltende herbizide |
| US4496390A (en) * | 1980-02-26 | 1985-01-29 | May & Baker Limited | N-Phenylpyrazole derivatives |
| BG35741A1 (en) * | 1980-02-26 | 1984-06-15 | May & Baker Ltd | Herbicide composition and method for protection from weeds |
| JPS572276A (en) * | 1980-06-07 | 1982-01-07 | Otsuka Chem Co Ltd | 1-methyl-5- n-alkyl-n-chloroacetylamino pyrazole-4- carboxylic acid ester derivative, its preparation, and herbicide for paddy rice field |
| JPS5758670A (en) * | 1980-09-25 | 1982-04-08 | Otsuka Chem Co Ltd | 1-methyl-3-(n-substituted-n-chloroacetylamino)pyrazole-4-carboxylic acid ester derivative |
| EP0053699B1 (de) * | 1980-12-05 | 1983-09-21 | BASF Aktiengesellschaft | 2'-Phenylhydrazino-2-cyanacrylsäureester und diese enthaltende Herbizide |
| JPS57169465A (en) * | 1981-04-13 | 1982-10-19 | Showa Denko Kk | Pyrazole derivative, its preparation and herbicide |
| MA19540A1 (fr) * | 1981-07-17 | 1983-04-01 | May & Baker Ltd | Derives du n-phenylpyrazole |
| JPS5984871A (ja) * | 1982-11-08 | 1984-05-16 | Showa Denko Kk | ピラゾリルカルバミン酸エステル誘導体とその製造法及び除草剤 |
| MA19840A1 (fr) * | 1982-07-15 | 1984-04-01 | May & Baker Ltd | Alcoylamino n-phenyl pyrazole et n-phenyl pyrazole lactames herbicides . |
| JPS604171A (ja) * | 1983-06-23 | 1985-01-10 | Showa Denko Kk | Ｎ−アルキルアミノピラゾ−ル誘導体とその製造法および除草剤 |
| DE3331692A1 (de) * | 1983-09-02 | 1985-03-28 | Basf Ag, 6700 Ludwigshafen | 3-phenyl-4-methoxycarbonylpyrazole, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| US4620865A (en) * | 1983-11-07 | 1986-11-04 | Eli Lilly And Company | Herbicidal and algicidal 1,5-disubstituted-1H-pyrazole-4-carboxamides |
| DE3575130D1 (de) * | 1984-05-12 | 1990-02-08 | Fisons Plc | Antiinflammatorische 1,n-diarylpyrazol-3-amine, deren zusammensetzungen und verfahren zu deren herstellung. |
| US4666504A (en) * | 1984-09-25 | 1987-05-19 | Eli Lilly And Company | Pollen formation inhibiting 1-phenyl-4-carboxy-5-pyrazolecarboxamides |
| US5232940A (en) * | 1985-12-20 | 1993-08-03 | Hatton Leslie R | Derivatives of N-phenylpyrazoles |
| US5547974A (en) * | 1985-12-20 | 1996-08-20 | Rhone-Poulenc Agriculture Ltd. | Derivatives of N-phenylpyrazoles |
| US6372774B1 (en) | 1985-12-20 | 2002-04-16 | Rhone-Poulenc Agriculture Ltd. | Derivatives of N-phenylpyrazoles |
| DK93087A (da) * | 1986-02-27 | 1987-08-28 | Duphar Int Res | Hidtil ukendte aryl substituerede (n-piperidinyl)methyl- og (n-piperazinyl)methylazoler med antipsykotiske egenskaber |
| US4801326A (en) * | 1986-03-19 | 1989-01-31 | Eli Lilly And Company | 1-phenylpyrazole-4,5-dicarboxylic acid derivatives, composition containing them, and pollen formation inhibiting method of using them |
| CH675420A5 (cs) * | 1986-03-29 | 1990-09-28 | Agfa Gevaert Ag | |
| US4826866A (en) * | 1987-11-02 | 1989-05-02 | A. H. Robins Company, Incorporated | 3-amino-5-methyl-1H-pyrazole-4-carboxylic acids and esters thereof as anticonvulsants, muscle relaxants and anxiolytics |
| KR930004672B1 (ko) * | 1988-08-31 | 1993-06-03 | 니혼 노야꾸 가부시끼가이샤 | 3-치환 페닐피라졸 유도체 또는 이의 염 및 이의 제조방법, 이의 용도 및 이의 사용 방법 |
| GR900100380A (el) * | 1989-05-20 | 1991-10-10 | Fisons Plc | Μέ?οδος παρασκευής αντι-φλεγμονωδών παραγώγων αμινοφενόλης. |
| GB8929101D0 (en) * | 1989-12-22 | 1990-02-28 | May & Baker Ltd | New mixtures |
| US5281571A (en) * | 1990-10-18 | 1994-01-25 | Monsanto Company | Herbicidal benzoxazinone- and benzothiazinone-substituted pyrazoles |
| US5532416A (en) * | 1994-07-20 | 1996-07-02 | Monsanto Company | Benzoyl derivatives and synthesis thereof |
| WO1993015060A1 (en) * | 1992-01-22 | 1993-08-05 | Nissan Chemical Industries, Ltd. | Substituted pyrazole derivative and agrohorticultural bactericide |
| US5880290A (en) * | 1994-01-31 | 1999-03-09 | Monsanto Company | Preparation of substituted 3-aryl-5-haloalkyl-pyrazoles having herbicidal activity |
| US5869688A (en) * | 1994-07-20 | 1999-02-09 | Monsanto Company | Preparation of substituted 3-aryl-5-haloalkyl-pyrazoles having herbicidal activity |
| US5623072A (en) * | 1994-10-11 | 1997-04-22 | Monsanto Company | 3-phenylpyridazines, herbicidal compositions and uses thereof |
| US5698708A (en) * | 1996-06-20 | 1997-12-16 | Monsanto Company | Preparation of substituted 3-aryl-5-haloalkyl-pyrazoles having herbicidal activity |
| US6998131B2 (en) * | 1996-09-19 | 2006-02-14 | Merial Limited | Spot-on formulations for combating parasites |
| US20040092494A9 (en) * | 2000-08-30 | 2004-05-13 | Dudley Robert E. | Method of increasing testosterone and related steroid concentrations in women |
| US20040002482A1 (en) * | 2000-08-30 | 2004-01-01 | Dudley Robert E. | Androgen pharmaceutical composition and method for treating depression |
| US6503894B1 (en) | 2000-08-30 | 2003-01-07 | Unimed Pharmaceuticals, Inc. | Pharmaceutical composition and method for treating hypogonadism |
| US20070088012A1 (en) * | 2005-04-08 | 2007-04-19 | Woun Seo | Method of treating or preventing type-2 diabetes |
| CA2624788C (en) | 2005-10-12 | 2011-04-19 | Unimed Pharmaceuticals, Llc | Improved testosterone gel and method of use |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1088757B (de) * | 1957-12-27 | 1960-09-08 | Hoechst Ag | Mittel zur selektiven Unkrautbekaempfung |
| US2998419A (en) * | 1959-10-30 | 1961-08-29 | Du Pont | Certain amino, dicyano pyrazoles and process |
| US2998426A (en) * | 1959-11-02 | 1961-08-29 | Du Pont | Certain amine, cyano pyrazoles |
| US3708277A (en) * | 1966-08-30 | 1973-01-02 | Basf Ag | Herbicidal method |
| US3567735A (en) * | 1967-10-03 | 1971-03-02 | Ciba Geigy Corp | Beta - (substituted-hydrazino) - alpha - cyano acrylic acids and derivatives,and process for preparing n-substituted pyrazoles |
| US3558605A (en) * | 1969-05-14 | 1971-01-26 | Parke Davis & Co | Pyrazolo(3,4-e)(1,4)diazepin-7-(1h)-one compounds |
| BE758050A (fr) * | 1969-10-28 | 1971-04-27 | Geigy Ag J R | Derives 5-nitro-furyliques et medicaments contenant de tels composes |
| US3732225A (en) * | 1970-07-23 | 1973-05-08 | Squibb & Sons Inc | Pyrazolo(3,4-d)pyrimidine derivatives |
| DE2260485C2 (de) * | 1971-12-17 | 1983-12-29 | American Cyanamid Co., Wayne, N.J. | 1,2-Dialkyl-3,5-diphenylpyrazoliumsalze und diese enthaltende herbizide Mittel |
| DD101674A1 (cs) | 1972-05-25 | 1973-11-12 | ||
| US3882142A (en) * | 1972-07-13 | 1975-05-06 | American Cyanamid Co | 1,2-Dialkyl-3,5-diphenyl pyrazolium salts |
| US3922161A (en) * | 1972-11-17 | 1975-11-25 | American Cyanamid Co | Novel herbicidal compositions |
| JPS4995968A (cs) * | 1973-01-24 | 1974-09-11 | ||
| JPS49100080A (cs) * | 1973-02-01 | 1974-09-20 | ||
| DE2404795C2 (de) * | 1974-02-01 | 1983-03-24 | Basf Ag, 6700 Ludwigshafen | 1,2-Dimethyl-3,5-diphenyl-pyrazoliumsalze und deren Verwendung als Herbizid |
| DE2409753A1 (de) * | 1974-03-01 | 1975-09-11 | Basf Ag | Substituierte pyrazole |
| JPS5436648B2 (cs) * | 1974-03-28 | 1979-11-10 | ||
| DE2558117A1 (de) | 1975-12-23 | 1977-07-07 | Boehringer Mannheim Gmbh | 3-nitropyrazol-derivate |
| US4134987A (en) * | 1976-01-14 | 1979-01-16 | Huppatz John L | Compounds and compositions |
-
1977
- 1977-10-22 DE DE19772747531 patent/DE2747531A1/de active Pending
-
1978
- 1978-10-05 DE DE7878101074T patent/DE2860949D1/de not_active Expired
- 1978-10-05 EP EP78101074A patent/EP0002180B1/de not_active Expired
- 1978-10-07 GR GR57398A patent/GR63684B/el unknown
- 1978-10-13 CA CA313,448A patent/CA1109879A/en not_active Expired
- 1978-10-16 US US05/951,566 patent/US4260775A/en not_active Expired - Lifetime
- 1978-10-17 IL IL55747A patent/IL55747A/xx unknown
- 1978-10-18 AU AU40812/78A patent/AU522994B2/en not_active Expired
- 1978-10-18 SU SU782674200A patent/SU967257A3/ru active
- 1978-10-18 CS CS786775A patent/CS203931B2/cs unknown
- 1978-10-18 PT PT68676A patent/PT68676A/pt unknown
- 1978-10-19 DD DD78208557A patent/DD140409A5/de unknown
- 1978-10-19 IT IT51575/78A patent/IT1109264B/it active
- 1978-10-19 PL PL1978210379A patent/PL109532B2/xx unknown
- 1978-10-19 DK DK466578A patent/DK466578A/da not_active Application Discontinuation
- 1978-10-20 ZA ZA00785905A patent/ZA785905B/xx unknown
- 1978-10-20 JP JP12863678A patent/JPS5470270A/ja active Pending
- 1978-10-20 HU HU78BA3715A patent/HU180670B/hu unknown
- 1978-10-20 BR BR7806938A patent/BR7806938A/pt unknown
- 1978-10-20 AT AT0754478A patent/AT362957B/de not_active IP Right Cessation
-
1980
- 1980-08-25 US US06/180,949 patent/US4354031A/en not_active Expired - Lifetime
- 1980-08-25 US US06/180,950 patent/US4316039A/en not_active Expired - Lifetime
-
1981
- 1981-07-27 US US06/286,978 patent/US4424363A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| GR63684B (en) | 1979-11-28 |
| ZA785905B (en) | 1979-11-28 |
| PL109532B2 (en) | 1980-06-30 |
| AU4081278A (en) | 1980-04-24 |
| IL55747A0 (en) | 1978-12-17 |
| ATA754478A (de) | 1980-11-15 |
| AT362957B (de) | 1981-06-25 |
| CS203931B2 (en) | 1981-03-31 |
| US4424363A (en) | 1984-01-03 |
| US4260775A (en) | 1981-04-07 |
| IT7851575A0 (it) | 1978-10-19 |
| US4316039A (en) | 1982-02-16 |
| US4354031A (en) | 1982-10-12 |
| HU180670B (en) | 1983-04-29 |
| BR7806938A (pt) | 1979-05-08 |
| PL210379A1 (pl) | 1979-07-02 |
| EP0002180A1 (de) | 1979-06-13 |
| DK466578A (da) | 1979-04-23 |
| PT68676A (en) | 1978-11-01 |
| AU522994B2 (en) | 1982-07-08 |
| EP0002180B1 (de) | 1981-08-12 |
| DE2747531A1 (de) | 1979-04-26 |
| DE2860949D1 (en) | 1981-11-12 |
| JPS5470270A (en) | 1979-06-05 |
| SU967257A3 (ru) | 1982-10-15 |
| IL55747A (en) | 1982-02-28 |
| IT1109264B (it) | 1985-12-16 |
| CA1109879A (en) | 1981-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD140409A5 (de) | Herbizide mittel | |
| DD144708A5 (de) | Herbizide mittel | |
| CH629362A5 (de) | Herbizid. | |
| DE2914915A1 (de) | 4h-3,1-benzoxazinderivate | |
| DE3832237A1 (de) | Aromatische carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| US4472192A (en) | 5-Amino-1-phenyl-pyrazole-4-carboxylic acid derivatives and their use for controlling undesirable plant growth | |
| DD141606A5 (de) | Herbizide mittel | |
| EP0482349B1 (de) | Sulfonamide mit herbiziden Eigenschaften. | |
| DE3909146A1 (de) | Herbizide ((1,3,5-triazin-2-yl) aminosulfonyl)benzoesaeureester, verfahren zu ihrer herstellung und ihre verwendung | |
| DE3901074A1 (de) | Thiophen-2-carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DE2703838A1 (de) | Diurethane | |
| DE3601066A1 (de) | Cyclohexenonderivate, ein verfahren zu ihrer herstellung sowie ihre verwendung als herbizide und das pflanzenwachstum regulierende mittel | |
| DE3934204A1 (de) | Cyclohexenonverbindungen, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide oder das pflanzenwachstum regulierende mittel | |
| DE3607300A1 (de) | N-aryltetrahydrophthalimidderivate und deren vorprodukte | |
| DE3628356A1 (de) | Chinolin-8-carbonsaeurederivate | |
| DE3900472A1 (de) | Herbizide sulfonylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| CH633679A5 (de) | Herbizide, enthaltend substituierte 2,1,3-benzothiadiazinverbindungen als aktive komponenten. | |
| DE3830733A1 (de) | 5-(n-3,4,5,6-tetrahydrophthalimido)-zimtsaeurederivate, ihre herstellung und ihre verwendung in herbiziden mitteln | |
| EP0373472B1 (de) | Substituierte Sulfonylharnstoffe | |
| DE4024754A1 (de) | Herbizide sulfonylharnstoffe, verfahren und zwischenprodukte zu ihrer herstellung und ihre verwendung | |
| DE3210979A1 (de) | 3-chlor-8-cyano-chinoline, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DE3617997A1 (de) | Substituierte n-phenylpyridazonderivate i | |
| DE2821809A1 (de) | Pyridazone | |
| DE3223884A1 (de) | 3,7-dichlor-chinolinderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DE2916647A1 (de) | Parabansaeurederivate |